DE1278994B - Polymere Vinylbenzylverbindung als Flockungsmittel fuer waessrige Medien - Google Patents
Polymere Vinylbenzylverbindung als Flockungsmittel fuer waessrige MedienInfo
- Publication number
- DE1278994B DE1278994B DED34379A DED0034379A DE1278994B DE 1278994 B DE1278994 B DE 1278994B DE D34379 A DED34379 A DE D34379A DE D0034379 A DED0034379 A DE D0034379A DE 1278994 B DE1278994 B DE 1278994B
- Authority
- DE
- Germany
- Prior art keywords
- radical
- aqueous media
- chloride
- vinylbenzyl
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 vinylbenzyl compound Chemical class 0.000 title claims description 28
- 239000012736 aqueous medium Substances 0.000 title claims description 7
- RYZCGQUXJPHSSF-UHFFFAOYSA-N ethenylsulfanylmethylbenzene Chemical class C=CSCC1=CC=CC=C1 RYZCGQUXJPHSSF-UHFFFAOYSA-N 0.000 claims description 7
- 229910052717 sulfur Inorganic materials 0.000 claims description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 239000008394 flocculating agent Substances 0.000 claims description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001450 anions Chemical group 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 125000003368 amide group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000004185 ester group Chemical group 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims description 2
- 125000004043 oxo group Chemical group O=* 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims 1
- 239000000178 monomer Substances 0.000 description 13
- 239000000243 solution Substances 0.000 description 13
- 229920000642 polymer Polymers 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 150000003254 radicals Chemical class 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- RIHJQMCQZHTQOT-UHFFFAOYSA-M dimethyl(1-phenylprop-2-enyl)sulfanium;chloride Chemical compound [Cl-].C[S+](C)C(C=C)C1=CC=CC=C1 RIHJQMCQZHTQOT-UHFFFAOYSA-M 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- SLBOQBILGNEPEB-UHFFFAOYSA-N 1-chloroprop-2-enylbenzene Chemical compound C=CC(Cl)C1=CC=CC=C1 SLBOQBILGNEPEB-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- YPWFISCTZQNZAU-UHFFFAOYSA-N Thiane Chemical compound C1CCSCC1 YPWFISCTZQNZAU-UHFFFAOYSA-N 0.000 description 2
- JHXKRIRFYBPWGE-UHFFFAOYSA-K bismuth chloride Chemical compound Cl[Bi](Cl)Cl JHXKRIRFYBPWGE-UHFFFAOYSA-K 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 2
- 150000003572 thiolanes Chemical class 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- JBYHSSAVUBIJMK-UHFFFAOYSA-N 1,4-oxathiane Chemical compound C1CSCCO1 JBYHSSAVUBIJMK-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000003957 anion exchange resin Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000012431 aqueous reaction media Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- PQKKUWUVAJSDHD-UHFFFAOYSA-N benzyl(ethenyl)sulfanium chloride Chemical compound [Cl-].C(=C)[SH+]CC1=CC=CC=C1 PQKKUWUVAJSDHD-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 238000012662 bulk polymerization Methods 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical group 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- YLMGFJXSLBMXHK-UHFFFAOYSA-M potassium perchlorate Chemical class [K+].[O-]Cl(=O)(=O)=O YLMGFJXSLBMXHK-UHFFFAOYSA-M 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000003797 solvolysis reaction Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- QJGDIYBRQHIAPB-UHFFFAOYSA-N sulfanium;perchlorate Chemical compound [SH3+].[O-]Cl(=O)(=O)=O QJGDIYBRQHIAPB-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/46—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings substituted on the ring sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C381/00—Compounds containing carbon and sulfur and having functional groups not covered by groups C07C301/00 - C07C337/00
- C07C381/12—Sulfonium compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D327/00—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms
- C07D327/02—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms one oxygen atom and one sulfur atom
- C07D327/06—Six-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Separation Of Suspended Particles By Flocculating Agents (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US843945A US3078259A (en) | 1959-10-02 | 1959-10-02 | Vinylbenzylsulfonium monomers and polymers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1278994B true DE1278994B (de) | 1968-10-03 |
Family
ID=25291387
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DED34379A Pending DE1278994B (de) | 1959-10-02 | 1960-09-29 | Polymere Vinylbenzylverbindung als Flockungsmittel fuer waessrige Medien |
| DE19601720485 Pending DE1720485A1 (de) | 1959-10-02 | 1960-09-29 | Verfahren zur Herstellung von polymerisierten Vinylbenzylsulfoniumverbindungen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19601720485 Pending DE1720485A1 (de) | 1959-10-02 | 1960-09-29 | Verfahren zur Herstellung von polymerisierten Vinylbenzylsulfoniumverbindungen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3078259A (https=) |
| BE (1) | BE595607A (https=) |
| DE (2) | DE1278994B (https=) |
| GB (1) | GB931786A (https=) |
| LU (1) | LU39199A1 (https=) |
| NL (2) | NL256230A (https=) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3216979A (en) * | 1961-03-09 | 1965-11-09 | American Cyanamid Co | Polymer composed of sulfonium salts |
| US3236820A (en) * | 1961-04-03 | 1966-02-22 | Dow Chemical Co | Process for water-soluble sulfonium polymers |
| US3544499A (en) * | 1961-05-25 | 1970-12-01 | Dow Chemical Co | Sulfonium modified water soluble surface coatings |
| US3207656A (en) * | 1962-12-26 | 1965-09-21 | Union Carbide Corp | Paper products containing sulfine polymers |
| US3287348A (en) * | 1963-04-30 | 1966-11-22 | American Aniline Prod | S-alkyl-2-haloethylsulfonium dyestuffs |
| US3502710A (en) * | 1963-11-07 | 1970-03-24 | Dow Chemical Co | Water-soluble sulfonium derivatives of diphenyl ether |
| US3389108A (en) * | 1967-07-19 | 1968-06-18 | Scott Paper Co | Printing fluid comprising an aqueous solution of a water-soluble dye and a thermosetting vinylsulfonium polymer |
| US3873488A (en) * | 1971-04-30 | 1975-03-25 | Dow Chemical Co | Latexes for cathodic electrocoating |
| US4366073A (en) * | 1976-08-13 | 1982-12-28 | Halliburton Company | Oil well treating method and composition |
| US4528384A (en) * | 1980-06-30 | 1985-07-09 | The Dow Chemical Company | Addition polymerizable aromatic sulfonium salts and polymers thereof |
| US4797456A (en) * | 1982-12-09 | 1989-01-10 | The Dow Chemical Company | Aqueous-dispersible cyclic sulfonium compounds that cure to form water-insoluble polymers |
| US4885355A (en) * | 1982-12-09 | 1989-12-05 | The Dow Chemical Company | Water-insoluble polymers from cyclic sulfonium compounds |
| US4704324A (en) * | 1985-04-03 | 1987-11-03 | The Dow Chemical Company | Semi-permeable membranes prepared via reaction of cationic groups with nucleophilic groups |
| US4839203A (en) * | 1985-04-03 | 1989-06-13 | The Dow Chemical Company | Semi-permeable membranes prepared via reaction of cationic groups with nucleophilic groups |
| DE3903279A1 (de) * | 1988-02-03 | 1989-08-10 | Mitsubishi Gas Chemical Co | Schwefel enthaltende aromatische vinylverbindung |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1029534B (de) * | 1956-10-31 | 1958-05-08 | Walter Kinttof Dipl Chem Dr | Verfahren zum Verfestigen von Aceton oder von acetonischen Loesungen |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2193963A (en) * | 1937-04-17 | 1940-03-19 | Benjamin R Harris | Sulphonium compounds |
| US2178353A (en) * | 1937-07-21 | 1939-10-31 | Du Pont | High molecular weight tetravalent sulphur compounds and process for their production |
| US2794026A (en) * | 1955-04-11 | 1957-05-28 | Dow Chemical Co | Thiapyrylium and thiophenium compounds |
| US2895925A (en) * | 1956-02-02 | 1959-07-21 | Rohm & Haas | Anion-exchange resin containing sulfonium groups |
-
0
- LU LU39199D patent/LU39199A1/xx unknown
- NL NL121408D patent/NL121408C/xx active
- NL NL256230D patent/NL256230A/xx unknown
-
1959
- 1959-10-02 US US843945A patent/US3078259A/en not_active Expired - Lifetime
-
1960
- 1960-09-05 GB GB30577/60A patent/GB931786A/en not_active Expired
- 1960-09-29 DE DED34379A patent/DE1278994B/de active Pending
- 1960-09-29 DE DE19601720485 patent/DE1720485A1/de active Pending
- 1960-09-30 BE BE595607A patent/BE595607A/fr unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1029534B (de) * | 1956-10-31 | 1958-05-08 | Walter Kinttof Dipl Chem Dr | Verfahren zum Verfestigen von Aceton oder von acetonischen Loesungen |
Also Published As
| Publication number | Publication date |
|---|---|
| LU39199A1 (https=) | |
| US3078259A (en) | 1963-02-19 |
| BE595607A (fr) | 1961-03-30 |
| NL121408C (https=) | |
| GB931786A (en) | 1963-07-17 |
| NL256230A (https=) | |
| DE1720485A1 (de) | 1971-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1278994B (de) | Polymere Vinylbenzylverbindung als Flockungsmittel fuer waessrige Medien | |
| DE874908C (de) | Verfahren zur Herstellung von acyloxymethylsubstituierten Siloxanen | |
| DE1418995A1 (de) | Diisocyanate und Verfahren zu ihrer Herstellung | |
| DE2256783C2 (de) | Verfahren zur Herstellung von neuen Diphenylmethan-, Diphenyloxid- und Diphenylsulfid-phosphonigsäuren, deren Salzen mit anorganischen Kationen, deren Ester und Thioester | |
| DE102004018193A1 (de) | Herstellung von Thioschwefelsäurederivaten | |
| DE814294C (de) | Verfahren zur Herstellung von insekticiden Phosphorverbindungen | |
| DE102008002073A1 (de) | Verfahren zur Herstellung des Trinatriumsalzes des 2,4,6-Trimercapto-s-triazins | |
| DE4411752C1 (de) | Verfahren zur Herstellung von Dimethylaminboran | |
| DE2417615A1 (de) | Cyclische ketone und verfahren zu ihrer herstellung | |
| DE1249274B (de) | Verfahren zur Herstellung von alkoholi sehe Hydroxylgruppen und Phosphor enthaltenden Polyathern, Zus z Änm C | |
| DE1445912C3 (de) | Verfahren zur Herstellung von 2-Py rrolidino-1,4-benzodiazepin-4oxyden | |
| DE2214261C3 (de) | Amino- oder Ammoniumgruppen enthaltende Amide der Acryl- bzw. Methacrylsäure, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Polymerisaten | |
| DE2339463A1 (de) | Verfahren zur herstellung eines methallylsulfonats | |
| DE3229589A1 (de) | Verfahren zur herstellung von phenmedipham | |
| DE2460288A1 (de) | Verfahren zur herstellung von tricyclohexylzinnderivaten | |
| DE2060875A1 (de) | Verfahren zur Herstellung von Pyrimidinderivaten | |
| DE519449C (de) | Verfahren zur Herstellung von N: N-Thioderivaten von Aminen | |
| DE1568838C3 (de) | Verfahren zur Herstellung von Hydroxyalkylacrylaten oder Hydroxyalkylmethacrylaten | |
| DE1229074B (de) | Verfahren zur Herstellung von Dodecaboranat-und/bzw. Dodecaboran-thioaetheraten | |
| AT231423B (de) | Verfahren zur Herstellung von Methacrylsäure und deren Estern | |
| DE1075609B (de) | Verfahren zur Herstellung neuer O - Aryl O - methylthiophosphorsaureamidester | |
| DE2304589A1 (de) | 3-alkyloxazolinone-(2) | |
| DE2212766A1 (de) | Verfahren zur Herstellung von fluessigen Thiocarbaminsaeureestern | |
| DE2133198C3 (de) | Verfahren zur Herstellung von O-(2,2-Dichlorvinyl)-thionophosphorsäureesterdichlorid | |
| DE1129961B (de) | Verfahren zur Herstellung von ringfoermigen Thiophosphorsaeureestern |