DE1265412B - Verfahren zur Herstellung von transparenten Copolyamiden - Google Patents
Verfahren zur Herstellung von transparenten CopolyamidenInfo
- Publication number
- DE1265412B DE1265412B DESCH34541A DESC034541A DE1265412B DE 1265412 B DE1265412 B DE 1265412B DE SCH34541 A DESCH34541 A DE SCH34541A DE SC034541 A DESC034541 A DE SC034541A DE 1265412 B DE1265412 B DE 1265412B
- Authority
- DE
- Germany
- Prior art keywords
- acid
- production
- aminomethyl
- copolyamides
- esters
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 239000002253 acid Substances 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 5
- 150000001991 dicarboxylic acids Chemical class 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- RNLHGQLZWXBQNY-UHFFFAOYSA-N 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine Chemical compound CC1(C)CC(N)CC(C)(CN)C1 RNLHGQLZWXBQNY-UHFFFAOYSA-N 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 4
- GUOSQNAUYHMCRU-UHFFFAOYSA-N 11-Aminoundecanoic acid Chemical compound NCCCCCCCCCCC(O)=O GUOSQNAUYHMCRU-UHFFFAOYSA-N 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 150000003951 lactams Chemical class 0.000 claims description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims description 2
- 229920000642 polymer Polymers 0.000 claims description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 14
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 239000004952 Polyamide Substances 0.000 description 7
- 239000001361 adipic acid Substances 0.000 description 7
- 235000011037 adipic acid Nutrition 0.000 description 7
- 229920002647 polyamide Polymers 0.000 description 7
- -1 adipic acid 3- (aminomethyl) -3,5,5-trimethyl-cyclohexylamine Chemical compound 0.000 description 5
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 4
- 229960002684 aminocaproic acid Drugs 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 238000006068 polycondensation reaction Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- 229920002292 Nylon 6 Polymers 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- OXIKYYJDTWKERT-UHFFFAOYSA-N [4-(aminomethyl)cyclohexyl]methanamine Chemical compound NCC1CCC(CN)CC1 OXIKYYJDTWKERT-UHFFFAOYSA-N 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- ITIONVBQFUNVJV-UHFFFAOYSA-N Etomidoline Chemical compound C12=CC=CC=C2C(=O)N(CC)C1NC(C=C1)=CC=C1OCCN1CCCCC1 ITIONVBQFUNVJV-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000005521 carbonamide group Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- LBVWYGNGGJURHQ-UHFFFAOYSA-N dicarbon Chemical compound [C-]#[C+] LBVWYGNGGJURHQ-UHFFFAOYSA-N 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000002649 leather substitute Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 229940006198 sodium phenylacetate Drugs 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/36—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from amino acids, polyamines and polycarboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyamides (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR3804A FR1423272A (fr) | 1964-01-29 | Procédé de fabrication de polycondensats et produits conformes à ceux obtenus parle présent procédé ou procédé similaire | |
| DESCH34541A DE1265412B (de) | 1964-01-29 | 1964-01-29 | Verfahren zur Herstellung von transparenten Copolyamiden |
| CH1628964A CH442747A (de) | 1964-01-29 | 1964-12-15 | Verfahren zur Herstellung von transparenten Polyamiden |
| ES0307278A ES307278A1 (es) | 1964-01-29 | 1964-12-18 | Procedimiento para la obtencion de policondensados transparentes. |
| AT1078364A AT251884B (de) | 1964-01-29 | 1964-12-21 | Verfahren zur Herstellung von transparenten Polykondensaten |
| LU47694A LU47694A1 (enExample) | 1964-01-29 | 1964-12-30 | |
| US428577A US3352942A (en) | 1964-01-29 | 1965-01-25 | Polyamides from 3-amino methyl-3, 5, 5-trimethyl-cyclohexylamine and an amino acid |
| NL656500985A NL145875B (nl) | 1964-01-29 | 1965-01-27 | Werkwijze ter bereiding van transparante polyamiden. |
| GB3637/65A GB1086832A (en) | 1964-01-29 | 1965-01-27 | Transparent polyamides |
| DK46565AA DK108757C (da) | 1964-01-29 | 1965-01-28 | Fremgangsmåde til fremstilling af transparente, linære polyamider. |
| BE659054A BE659054A (enExample) | 1964-01-29 | 1965-01-29 | |
| SE01200/65A SE334026B (enExample) | 1964-01-29 | 1965-01-29 | |
| DE19671745465 DE1745465A1 (de) | 1964-01-29 | 1967-12-01 | Verfahren zur Herstellung von Polykondensaten |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DESCH34541A DE1265412B (de) | 1964-01-29 | 1964-01-29 | Verfahren zur Herstellung von transparenten Copolyamiden |
| DESC041653 | 1967-12-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1265412B true DE1265412B (de) | 1968-04-04 |
Family
ID=7433172
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DESCH34541A Pending DE1265412B (de) | 1964-01-29 | 1964-01-29 | Verfahren zur Herstellung von transparenten Copolyamiden |
| DE19671745465 Pending DE1745465A1 (de) | 1964-01-29 | 1967-12-01 | Verfahren zur Herstellung von Polykondensaten |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671745465 Pending DE1745465A1 (de) | 1964-01-29 | 1967-12-01 | Verfahren zur Herstellung von Polykondensaten |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3352942A (enExample) |
| AT (1) | AT251884B (enExample) |
| BE (1) | BE659054A (enExample) |
| CH (1) | CH442747A (enExample) |
| DE (2) | DE1265412B (enExample) |
| DK (1) | DK108757C (enExample) |
| ES (1) | ES307278A1 (enExample) |
| FR (1) | FR1423272A (enExample) |
| GB (1) | GB1086832A (enExample) |
| LU (1) | LU47694A1 (enExample) |
| NL (1) | NL145875B (enExample) |
| SE (1) | SE334026B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1939758A1 (de) * | 1969-08-05 | 1971-02-18 | Veba Chemie Ag | Schmelzkleber auf Polyamid-Basis |
| DE2309420A1 (de) * | 1973-02-24 | 1974-11-07 | Bayer Ag | Verbundfolien |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE711736A (enExample) * | 1967-03-07 | 1968-07-15 | ||
| DE1770406A1 (de) * | 1968-05-14 | 1972-02-10 | Wolff Walsrode Ag | Schrumpffaehige filmbildende Copolyamide,ihre Herstellung und ihre Verwendung |
| US3839121A (en) * | 1969-08-05 | 1974-10-01 | Veba Chemie Ag | Method of bonding using melt adhesives based on polyamides |
| DE2060704A1 (de) * | 1970-12-10 | 1972-06-22 | Hoechst Ag | Glasklare Polyamide |
| BE792063A (fr) * | 1971-12-02 | 1973-05-29 | Bayer Ag | Copolyamides transparentes |
| DE2936759C2 (de) * | 1979-09-12 | 1987-03-26 | Hüls AG, 4370 Marl | Transparente Copolyamide |
| US4377683A (en) * | 1980-06-23 | 1983-03-22 | Ciba-Geigy Corporation | Transparent copolyamide from isophorone diamine and substituted undecane diamine |
| DE19536056A1 (de) * | 1995-09-28 | 1997-04-03 | Huels Chemische Werke Ag | Flüssige Lösungen von Dicarbonsäuren |
| CN106916294A (zh) * | 2015-12-25 | 2017-07-04 | 大连理工常熟研究院有限公司 | 一种半芳香族透明聚酰胺的制备方法及半芳香族透明聚酰胺 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2985627A (en) * | 1957-01-24 | 1961-05-23 | Eastman Kodak Co | High melting omega-amino carboxylic copolyamides |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2130948A (en) * | 1937-04-09 | 1938-09-20 | Du Pont | Synthetic fiber |
| US2252555A (en) * | 1939-04-04 | 1941-08-12 | Wilmington Trust Co | Polymeric material |
| US2274831A (en) * | 1939-07-20 | 1942-03-03 | Du Pont | Polyamides and process for their preparation |
-
0
- FR FR3804A patent/FR1423272A/fr not_active Expired
-
1964
- 1964-01-29 DE DESCH34541A patent/DE1265412B/de active Pending
- 1964-12-15 CH CH1628964A patent/CH442747A/de unknown
- 1964-12-18 ES ES0307278A patent/ES307278A1/es not_active Expired
- 1964-12-21 AT AT1078364A patent/AT251884B/de active
- 1964-12-30 LU LU47694A patent/LU47694A1/xx unknown
-
1965
- 1965-01-25 US US428577A patent/US3352942A/en not_active Expired - Lifetime
- 1965-01-27 GB GB3637/65A patent/GB1086832A/en not_active Expired
- 1965-01-27 NL NL656500985A patent/NL145875B/xx unknown
- 1965-01-28 DK DK46565AA patent/DK108757C/da active
- 1965-01-29 SE SE01200/65A patent/SE334026B/xx unknown
- 1965-01-29 BE BE659054A patent/BE659054A/xx unknown
-
1967
- 1967-12-01 DE DE19671745465 patent/DE1745465A1/de active Pending
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2985627A (en) * | 1957-01-24 | 1961-05-23 | Eastman Kodak Co | High melting omega-amino carboxylic copolyamides |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1939758A1 (de) * | 1969-08-05 | 1971-02-18 | Veba Chemie Ag | Schmelzkleber auf Polyamid-Basis |
| DE2309420A1 (de) * | 1973-02-24 | 1974-11-07 | Bayer Ag | Verbundfolien |
Also Published As
| Publication number | Publication date |
|---|---|
| SE334026B (enExample) | 1971-04-05 |
| BE659054A (enExample) | 1965-05-17 |
| LU47694A1 (enExample) | 1965-03-02 |
| NL145875B (nl) | 1975-05-15 |
| CH442747A (de) | 1967-08-31 |
| US3352942A (en) | 1967-11-14 |
| DE1745465A1 (de) | 1971-09-09 |
| NL6500985A (enExample) | 1965-07-30 |
| DK108757C (da) | 1968-02-05 |
| FR1423272A (fr) | 1966-03-18 |
| ES307278A1 (es) | 1965-04-01 |
| AT251884B (de) | 1967-01-25 |
| GB1086832A (en) | 1967-10-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0023956B1 (de) | Verfahren zur Herstellung von Polyether(ester)amiden | |
| DE1241984B (de) | Verfahren zum Herstellen von Polyesteramiden | |
| DE1301578B (de) | Verfahren zur Herstellung von Polybenzimidazolen | |
| DE1265412B (de) | Verfahren zur Herstellung von transparenten Copolyamiden | |
| EP2992035B1 (de) | Verfahren zur herstellung von hochviskosen polyamiden | |
| DE1269808B (de) | Verfahren zur Herstellung von synthetischen, linearen Polyamiden | |
| EP0027852A1 (de) | Transparente Copolyamide und deren Verwendung zur Herstellung transparenter schlagzäher Formkörper | |
| DE2802989A1 (de) | Hydrolysebestaendige copolyaetheresteramide | |
| EP0745631B1 (de) | Verfahren zur Wiederverwertung von wässrigen Extraktlösungen, die bei der Herstellung von PA 6 oder Copolyamiden anfallen | |
| DE2449713A1 (de) | Verfahren zur herstellung von copolyamiden | |
| DE1570774A1 (de) | Verfahren zur Polymerisation von Laurinlactam | |
| DE1520924A1 (de) | Verfahren zur Herstellung von Polyamiden | |
| DE1770379A1 (de) | Synthetische lineare faserbildende Polyamide und Verfahren zu deren Herstellung | |
| DE1943251A1 (de) | Faserbildende Polyamide mit erhoehtem Aminogruppengehalt | |
| DE846164C (de) | Verfahren zur Herstellung von Polyamiden | |
| DE1173248B (de) | Verfahren zur Herstellung von Polyamiden | |
| DE2215515A1 (de) | Verfahren zur Herstellung von kationisch färbbarem Polycaprolactam | |
| DE2732928A1 (de) | Transparente polyamide | |
| DD241607A5 (de) | Zusammensetzung fuer die herstellung von blockcopolymerlactamen | |
| DE2058414A1 (de) | Hochmolekulare lineare Copolyamide mit Oxamidgruppen | |
| DE917274C (de) | Verfahren zur Herstellung von vernetzten Polyamiden | |
| DE2045770A1 (de) | Neue Polyamide und Verfahren zur Herstellung derselben | |
| DE2264637C3 (de) | Verfahren zur Herstellung von Polyamiden durch Polymerisation von Lactamen | |
| DE1223100B (de) | Herstellen von Faeden oder Fasern aus Polyamiden | |
| DE1112293B (de) | Verfahren zur Herstellung von Polymilchsaeure |