DE1247282B - Verfahren zur Herstellung von Perdisulfaten - Google Patents
Verfahren zur Herstellung von PerdisulfatenInfo
- Publication number
- DE1247282B DE1247282B DEL42810A DEL0042810A DE1247282B DE 1247282 B DE1247282 B DE 1247282B DE L42810 A DEL42810 A DE L42810A DE L0042810 A DEL0042810 A DE L0042810A DE 1247282 B DE1247282 B DE 1247282B
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen peroxide
- permonosulfate
- bisulfate
- reaction zone
- production
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 30
- 238000004519 manufacturing process Methods 0.000 title claims description 12
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 70
- 238000006243 chemical reaction Methods 0.000 claims description 35
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 claims description 17
- 239000000203 mixture Substances 0.000 claims description 11
- 229910052700 potassium Inorganic materials 0.000 claims description 9
- 239000011591 potassium Substances 0.000 claims description 9
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 239000011734 sodium Substances 0.000 claims description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 6
- 229910052708 sodium Inorganic materials 0.000 claims description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 4
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052792 caesium Inorganic materials 0.000 claims description 3
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 claims description 3
- 239000002245 particle Substances 0.000 claims description 3
- 229910052701 rubidium Inorganic materials 0.000 claims description 3
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 claims description 3
- 239000010802 sludge Substances 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- 229910001870 ammonium persulfate Inorganic materials 0.000 claims description 2
- 229910052788 barium Inorganic materials 0.000 claims description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052790 beryllium Inorganic materials 0.000 claims description 2
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- 229910052712 strontium Inorganic materials 0.000 claims description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 2
- 239000007864 aqueous solution Substances 0.000 claims 2
- 239000007789 gas Substances 0.000 description 9
- 239000000047 product Substances 0.000 description 6
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- JTNCEQNHURODLX-UHFFFAOYSA-N 2-phenylethanimidamide Chemical compound NC(=N)CC1=CC=CC=C1 JTNCEQNHURODLX-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000012808 vapor phase Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 238000003809 water extraction Methods 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- BIGPRXCJEDHCLP-UHFFFAOYSA-N ammonium bisulfate Chemical compound [NH4+].OS([O-])(=O)=O BIGPRXCJEDHCLP-UHFFFAOYSA-N 0.000 description 1
- VAZSKTXWXKYQJF-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)OOS([O-])=O VAZSKTXWXKYQJF-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- OYLGLPVAKCEIKU-UHFFFAOYSA-N diazanium;sulfonato sulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OS([O-])(=O)=O OYLGLPVAKCEIKU-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/055—Peroxyhydrates; Peroxyacids or salts thereof
- C01B15/06—Peroxyhydrates; Peroxyacids or salts thereof containing sulfur
- C01B15/08—Peroxysulfates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB31398/61A GB1026873A (en) | 1961-08-31 | 1961-08-31 | Perdisulphates from permonosulphates |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1247282B true DE1247282B (de) | 1967-08-17 |
Family
ID=10322496
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEL42810A Pending DE1247282B (de) | 1961-08-31 | 1962-08-27 | Verfahren zur Herstellung von Perdisulfaten |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3351426A (esLanguage) |
| BE (1) | BE621960A (esLanguage) |
| DE (1) | DE1247282B (esLanguage) |
| ES (1) | ES280443A1 (esLanguage) |
| GB (1) | GB1026873A (esLanguage) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4778669A (en) * | 1986-01-22 | 1988-10-18 | Basf Aktiengesellschaft | Preparation of aqueous solutions of free hydroxylamine |
| WO1999007637A1 (de) | 1997-08-04 | 1999-02-18 | Basf Aktiengesellschaft | Verfahren zur herstellung einer wässrigen lösung von freiem hydroxylamin |
| WO2017204936A1 (en) | 2016-05-26 | 2017-11-30 | Exxonmobil Chemical Patents Inc. | Production of cyclic imides suitable for oxidation catalysis |
| WO2017204935A1 (en) | 2016-05-26 | 2017-11-30 | Exxonmobil Chemical Patents Inc. | Production of cyclic imides suitable for oxidation catalysis |
| WO2018075176A1 (en) | 2016-10-18 | 2018-04-26 | Exxonmobil Chemical Patents Inc. | Cyclic imide slurry compositions |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3954952A (en) * | 1975-03-24 | 1976-05-04 | Fmc Corporation | Continuous chemical process for the manufacture of sodium and potassium peroxydisulfate |
| US4965825A (en) | 1981-11-03 | 1990-10-23 | The Personalized Mass Media Corporation | Signal processing apparatus and methods |
| DE19725851A1 (de) * | 1997-06-18 | 1998-12-24 | Basf Ag | Verfahren zur Herstellung hochreiner, wässriger Hydroxylaminlösungen |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2886534A (en) * | 1954-12-23 | 1959-05-12 | Du Pont | Production of alkali metal monopersulfates |
| US3002813A (en) * | 1959-07-15 | 1961-10-03 | Fmc Corp | Method of preparing monopersulfates |
| GB992742A (en) * | 1961-03-27 | 1965-05-19 | Laporte Chemical | Preparation of permonosulphates |
-
0
- BE BE621960D patent/BE621960A/xx unknown
-
1961
- 1961-08-31 GB GB31398/61A patent/GB1026873A/en not_active Expired
-
1962
- 1962-08-27 DE DEL42810A patent/DE1247282B/de active Pending
- 1962-08-31 ES ES0280443A patent/ES280443A1/es not_active Expired
-
1966
- 1966-07-07 US US563615A patent/US3351426A/en not_active Expired - Lifetime
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4778669A (en) * | 1986-01-22 | 1988-10-18 | Basf Aktiengesellschaft | Preparation of aqueous solutions of free hydroxylamine |
| WO1999007637A1 (de) | 1997-08-04 | 1999-02-18 | Basf Aktiengesellschaft | Verfahren zur herstellung einer wässrigen lösung von freiem hydroxylamin |
| WO2017204936A1 (en) | 2016-05-26 | 2017-11-30 | Exxonmobil Chemical Patents Inc. | Production of cyclic imides suitable for oxidation catalysis |
| WO2017204935A1 (en) | 2016-05-26 | 2017-11-30 | Exxonmobil Chemical Patents Inc. | Production of cyclic imides suitable for oxidation catalysis |
| US11014883B2 (en) | 2016-05-26 | 2021-05-25 | Exxonmobil Chemical Patents Inc. | Production of cyclic imides suitable for oxidation catalysis |
| US11161812B2 (en) | 2016-05-26 | 2021-11-02 | Exxonmobil Chemical Patents Inc. | Production of cyclic imides suitable for oxidation catalysis |
| WO2018075176A1 (en) | 2016-10-18 | 2018-04-26 | Exxonmobil Chemical Patents Inc. | Cyclic imide slurry compositions |
Also Published As
| Publication number | Publication date |
|---|---|
| BE621960A (esLanguage) | |
| GB1026873A (en) | 1966-04-20 |
| US3351426A (en) | 1967-11-07 |
| ES280443A1 (es) | 1962-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE976951C (de) | Verfahren zur Herstellung von Phenolen durch unvollständige Oxydation von Benzolderivaten | |
| DE1695753C3 (de) | Verfahren zur Herstellung von 6,6disubstituierten 2,2-Dimethyl-4-oxopiperidinen | |
| CH639936A5 (de) | Verfahren zur mononitrierung von benzol. | |
| DE3011391C2 (esLanguage) | ||
| DD232252A5 (de) | Verfahren zur herstellung von kaliumsulfat aus schwefliger saeure und kaliumchlorid | |
| DE1247282B (de) | Verfahren zur Herstellung von Perdisulfaten | |
| DE2548470A1 (de) | Verfahren zur herstellung einer komplexverbindung aus di-(4-hydroxyphenyl)-2,2-propan und phenol | |
| DE3319651A1 (de) | Verfahren zur destillativen gewinnung von ameisensaeure | |
| DE2638170C3 (de) | Kontinuierliches Verfahren von Nicotinsäureamid durch Hydrolyse von Nicotinsäurenitril | |
| DE2444425A1 (de) | Verfahren zum behandeln eisen(iii)nitrat enthaltender waessriger salpetersaeureloesungen | |
| DE1543448B1 (de) | Verfahren zur Gewinnung von Acrylsaeureamid | |
| DE1925038C3 (de) | Verfahren zur Gewinnung von Terephthalsäure | |
| DE2645703A1 (de) | Verfahren zur herstellung von hexamethyldisilazan | |
| DE2018616B2 (de) | Verfahren zur gewinnung von reinem dimethylformamid | |
| EP1313688A1 (de) | Tmp/dampfdruckfiltration | |
| DE1593339C3 (de) | Verfahren zur Herstellung von Milchsäure | |
| DE1618694A1 (de) | Verfahren zur Herstellung von Isoapfelsaeure | |
| DE2052167C3 (de) | Verfahren zur Herstellung des gereinigten Ammoniumsalzes der 11-Cyanundecansäure bzw. der reinen freien 11-Cyanundecansäure | |
| DE1950391A1 (de) | Verfahren zur Herstellung von 7-Aminocephalosporansaeure | |
| DE2036710A1 (de) | Aktive Detergentien | |
| DE2949514C2 (de) | Verfahren zur Herstellung von wasserlöslichen Kaliumsalzen | |
| DE1592195B2 (de) | Verfahren zur herstellung von wasserfreiem aluminiumfluorid | |
| DE3825524A1 (de) | Verfahren zum reinigen von caprolactam | |
| DE1124507B (de) | Verfahren zur Herstellung von reinem adipinsaurem Hexamethylendiamin | |
| DE1803167C (de) | Verfahren zur Herstellung von 5 Chlor 3,6 dialkyl uracilen |