DE1234199B - Verfahren zur Herstellung von Mono- oder Diaethern von Glykolen durch Hydrogenolyse von cylischen Ketalen - Google Patents
Verfahren zur Herstellung von Mono- oder Diaethern von Glykolen durch Hydrogenolyse von cylischen KetalenInfo
- Publication number
- DE1234199B DE1234199B DES93397A DES0093397A DE1234199B DE 1234199 B DE1234199 B DE 1234199B DE S93397 A DES93397 A DE S93397A DE S0093397 A DES0093397 A DE S0093397A DE 1234199 B DE1234199 B DE 1234199B
- Authority
- DE
- Germany
- Prior art keywords
- hydrogenolysis
- carbon atoms
- hydrogenation catalyst
- group
- ether
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000007327 hydrogenolysis reaction Methods 0.000 title claims description 19
- 238000000034 method Methods 0.000 title claims description 16
- 125000004122 cyclic group Chemical group 0.000 title claims description 13
- 150000002334 glycols Chemical class 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title description 3
- 239000000126 substance Substances 0.000 claims description 19
- 239000003054 catalyst Substances 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- 239000000203 mixture Substances 0.000 claims description 11
- 230000002378 acidificating effect Effects 0.000 claims description 10
- 238000005984 hydrogenation reaction Methods 0.000 claims description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 239000011541 reaction mixture Substances 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 6
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 229910052703 rhodium Inorganic materials 0.000 claims description 5
- 239000010948 rhodium Substances 0.000 claims description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 239000007791 liquid phase Substances 0.000 claims description 3
- 230000000737 periodic effect Effects 0.000 claims description 3
- 229910052723 transition metal Inorganic materials 0.000 claims description 3
- 150000003624 transition metals Chemical class 0.000 claims description 3
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 2
- 229910052759 nickel Inorganic materials 0.000 claims description 2
- 229910052763 palladium Inorganic materials 0.000 claims description 2
- 229910052697 platinum Inorganic materials 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 229910052707 ruthenium Inorganic materials 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 11
- HCGFUIQPSOCUHI-UHFFFAOYSA-N 2-propan-2-yloxyethanol Chemical compound CC(C)OCCO HCGFUIQPSOCUHI-UHFFFAOYSA-N 0.000 description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- MGZCLRWCEUBEGO-UHFFFAOYSA-N 2-(2-propan-2-yloxyethoxy)propane Chemical compound CC(C)OCCOC(C)C MGZCLRWCEUBEGO-UHFFFAOYSA-N 0.000 description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- 150000001298 alcohols Chemical class 0.000 description 5
- -1 cyclic acetals Chemical class 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- SIJBDWPVNAYVGY-UHFFFAOYSA-N 2,2-dimethyl-1,3-dioxolane Chemical compound CC1(C)OCCO1 SIJBDWPVNAYVGY-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 4
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 4
- 238000001030 gas--liquid chromatography Methods 0.000 description 4
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000001951 (4R)-2,2,4-trimethyl-1,3-dioxolane Substances 0.000 description 3
- ALTFLAPROMVXNX-UHFFFAOYSA-N 2,2,4-Trimethyl-1,3-dioxolane Chemical compound CC1COC(C)(C)O1 ALTFLAPROMVXNX-UHFFFAOYSA-N 0.000 description 3
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- ZWVMLYRJXORSEP-UHFFFAOYSA-N 1,2,6-Hexanetriol Chemical compound OCCCCC(O)CO ZWVMLYRJXORSEP-UHFFFAOYSA-N 0.000 description 2
- RPLSBADGISFNSI-UHFFFAOYSA-N 2,2-dimethyl-1,3-dioxane Chemical compound CC1(C)OCCCO1 RPLSBADGISFNSI-UHFFFAOYSA-N 0.000 description 2
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 2
- YIWUKEYIRIRTPP-UHFFFAOYSA-N 2-ethylhexan-1-ol Chemical compound CCCCC(CC)CO YIWUKEYIRIRTPP-UHFFFAOYSA-N 0.000 description 2
- 229910015900 BF3 Inorganic materials 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- IUGPRERXXKWPFI-UHFFFAOYSA-N 1,2-di(propan-2-yloxy)propane Chemical compound CC(C)OCC(C)OC(C)C IUGPRERXXKWPFI-UHFFFAOYSA-N 0.000 description 1
- VVJPTCRJUZMAOU-UHFFFAOYSA-N 1,3-di(propan-2-yloxy)propane Chemical compound CC(C)OCCCOC(C)C VVJPTCRJUZMAOU-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- AFHJYKBGDDJSRR-UHFFFAOYSA-N 1-propan-2-yloxypropan-2-ol Chemical compound CC(C)OCC(C)O AFHJYKBGDDJSRR-UHFFFAOYSA-N 0.000 description 1
- ZGISFWLFKHFBHQ-UHFFFAOYSA-N 2,2,4-triethyl-1,3-dioxane Chemical compound CCC1CCOC(CC)(CC)O1 ZGISFWLFKHFBHQ-UHFFFAOYSA-N 0.000 description 1
- NOTMGPGPGBYOKK-UHFFFAOYSA-N 2,2-diethyl-4,5-dimethyl-1,3-dioxolane Chemical compound CCC1(CC)OC(C)C(C)O1 NOTMGPGPGBYOKK-UHFFFAOYSA-N 0.000 description 1
- HEWZVZIVELJPQZ-UHFFFAOYSA-N 2,2-dimethoxypropane Chemical compound COC(C)(C)OC HEWZVZIVELJPQZ-UHFFFAOYSA-N 0.000 description 1
- CGNOMSJAJQUXAT-UHFFFAOYSA-N 2,2-dimethyl-1,3-dioxan-5-ol Chemical compound CC1(C)OCC(O)CO1 CGNOMSJAJQUXAT-UHFFFAOYSA-N 0.000 description 1
- BCVTUPLNURAZHB-UHFFFAOYSA-N 2,2-dimethyl-4,5-diphenyl-1,3-dioxolane Chemical compound O1C(C)(C)OC(C=2C=CC=CC=2)C1C1=CC=CC=C1 BCVTUPLNURAZHB-UHFFFAOYSA-N 0.000 description 1
- ZNNNXHPKOZRCJS-UHFFFAOYSA-N 2,3-dipropoxypropan-1-ol Chemical compound CCCOCC(CO)OCCC ZNNNXHPKOZRCJS-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- JLBBOOGYMDVXMA-UHFFFAOYSA-N 2-ethyl-2-methyl-1,3-dioxan-5-ol Chemical compound CCC1(C)OCC(O)CO1 JLBBOOGYMDVXMA-UHFFFAOYSA-N 0.000 description 1
- UPZFLZYXYGBAPL-UHFFFAOYSA-N 2-ethyl-2-methyl-1,3-dioxolane Chemical compound CCC1(C)OCCO1 UPZFLZYXYGBAPL-UHFFFAOYSA-N 0.000 description 1
- RMGHERXMTMUMMV-UHFFFAOYSA-N 2-methoxypropane Chemical compound COC(C)C RMGHERXMTMUMMV-UHFFFAOYSA-N 0.000 description 1
- BVRDPBHMGKJNEJ-UHFFFAOYSA-N 2-methyl-2-(2-methylpropyl)-1,3-dioxolane Chemical compound CC(C)CC1(C)OCCO1 BVRDPBHMGKJNEJ-UHFFFAOYSA-N 0.000 description 1
- GAOQAPRPYXWTFK-UHFFFAOYSA-N 2-methyl-2-phenyl-1,3-dioxolane Chemical compound C=1C=CC=CC=1C1(C)OCCO1 GAOQAPRPYXWTFK-UHFFFAOYSA-N 0.000 description 1
- ZFEKANLLFQEKED-UHFFFAOYSA-N 2-propan-2-yloxypropan-1-ol Chemical compound CC(C)OC(C)CO ZFEKANLLFQEKED-UHFFFAOYSA-N 0.000 description 1
- PSJBSUHYCGQTHZ-UHFFFAOYSA-N 3-Methoxy-1,2-propanediol Chemical compound COCC(O)CO PSJBSUHYCGQTHZ-UHFFFAOYSA-N 0.000 description 1
- GBSGXZBOFKJGMG-UHFFFAOYSA-N 3-propan-2-yloxypropan-1-ol Chemical compound CC(C)OCCCO GBSGXZBOFKJGMG-UHFFFAOYSA-N 0.000 description 1
- FJOWHXOYIIREHB-UHFFFAOYSA-N 4-(2-ethyl-2-methyl-1,3-dioxolan-4-yl)butan-1-ol Chemical compound CCC1(C)OCC(CCCCO)O1 FJOWHXOYIIREHB-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 229910000599 Cr alloy Inorganic materials 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical class CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 229910000990 Ni alloy Inorganic materials 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000005112 continuous flow technique Methods 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- XXJWXESWEXIICW-UHFFFAOYSA-N diethylene glycol monoethyl ether Chemical compound CCOCCOCCO XXJWXESWEXIICW-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 1
- SZNYYWIUQFZLLT-UHFFFAOYSA-N isopropylmethyl ether Natural products CC(C)COCC(C)C SZNYYWIUQFZLLT-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- OPUAWDUYWRUIIL-UHFFFAOYSA-N methanedisulfonic acid Chemical compound OS(=O)(=O)CS(O)(=O)=O OPUAWDUYWRUIIL-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- RNVYQYLELCKWAN-UHFFFAOYSA-N solketal Chemical compound CC1(C)OCC(CO)O1 RNVYQYLELCKWAN-UHFFFAOYSA-N 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 238000005690 transetherification reaction Methods 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/01—Preparation of ethers
- C07C41/18—Preparation of ethers by reactions not forming ether-oxygen bonds
- C07C41/28—Preparation of ethers by reactions not forming ether-oxygen bonds from acetals, e.g. by dealcoholysis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/03—Ethers having all ether-oxygen atoms bound to acyclic carbon atoms
- C07C43/04—Saturated ethers
- C07C43/13—Saturated ethers containing hydroxy or O-metal groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US31235663A | 1963-09-30 | 1963-09-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1234199B true DE1234199B (de) | 1967-02-16 |
Family
ID=23211089
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DES93397A Pending DE1234199B (de) | 1963-09-30 | 1964-09-28 | Verfahren zur Herstellung von Mono- oder Diaethern von Glykolen durch Hydrogenolyse von cylischen Ketalen |
Country Status (6)
| Country | Link |
|---|---|
| JP (1) | JPS426721B1 (enExample) |
| BE (1) | BE653656A (enExample) |
| DE (1) | DE1234199B (enExample) |
| FR (1) | FR1409152A (enExample) |
| GB (1) | GB1020500A (enExample) |
| NL (1) | NL6411361A (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3224033A1 (de) * | 1981-06-29 | 1983-01-05 | Mitsubishi Petrochemical Co., Ltd., Tokyo | Verfahren zur herstellung von aetherverbindungen durch katalytische hydrogenolyse |
| WO1993002033A1 (de) * | 1991-07-20 | 1993-02-04 | Henkel Kommanditgesellschaft Auf Aktien | Verfahren zur herstellung von polyolethern |
| EP0616994A3 (en) * | 1993-03-15 | 1994-11-09 | Kao Corp | Process for the preparation of ether alcohols by hydrogenolysis of cyclic ketals. |
| EP0810194A1 (de) * | 1996-05-30 | 1997-12-03 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von 3-Oxyalkylpropan-1-olen |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2525211A1 (fr) * | 1982-04-20 | 1983-10-21 | Ugine Kuhlmann | Procede de fabrication de mono-ether de monoethyleneglycol par hydrogenolyse d'acetals cycliques |
| US4482753A (en) * | 1983-03-28 | 1984-11-13 | Olin Corporation | Catalyst for use in the hydrogenolysis of methyl glycol formals |
| US9388105B2 (en) * | 2011-06-24 | 2016-07-12 | Eastman Chemical Company | Production of hydroxy ether hydrocarbons by liquid phase hydrogenolysis of cyclic acetals or cyclic ketals |
| US8785697B2 (en) | 2011-06-24 | 2014-07-22 | Eastman Chemical Company | Nickel modified catalyst for the production of hydroxy ether hydrocarbons by vapor phase hydrogenolysis of cyclic acetals and ketals |
| US9000229B2 (en) | 2011-06-24 | 2015-04-07 | Eastman Chemical Company | Production of hydroxy ether hydrocarbons by vapor phase hydrogenolysis of cyclic acetals and ketals |
| US8829207B2 (en) | 2011-06-24 | 2014-09-09 | Eastman Chemical Company | Production of cyclic acetals by reactive distillation |
| US9056313B2 (en) | 2011-06-24 | 2015-06-16 | Eastman Chemical Company | Catalysts for the production of hydroxy ether hydrocarbons by vapor phase hydrogenolysis of cyclic acetals and ketals |
| US8969598B2 (en) | 2011-06-24 | 2015-03-03 | Eastman Chemical Company | Production of cyclic acetals or ketals using liquid-phase acid catalysts |
| US8829206B2 (en) | 2011-06-24 | 2014-09-09 | Eastman Chemical Company | Production of cyclic acetals or ketals using solid acid catalysts |
| JPWO2025095105A1 (enExample) * | 2023-11-02 | 2025-05-08 |
-
1964
- 1964-09-28 BE BE653656D patent/BE653656A/xx unknown
- 1964-09-28 JP JP5539564A patent/JPS426721B1/ja active Pending
- 1964-09-28 FR FR989560A patent/FR1409152A/fr not_active Expired
- 1964-09-28 GB GB39395/64A patent/GB1020500A/en not_active Expired
- 1964-09-28 DE DES93397A patent/DE1234199B/de active Pending
- 1964-09-30 NL NL6411361A patent/NL6411361A/xx unknown
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3224033A1 (de) * | 1981-06-29 | 1983-01-05 | Mitsubishi Petrochemical Co., Ltd., Tokyo | Verfahren zur herstellung von aetherverbindungen durch katalytische hydrogenolyse |
| DE3224033C2 (enExample) * | 1981-06-29 | 1990-04-26 | Mitsubishi Petrochemical Co., Ltd., Tokio/Tokyo, Jp | |
| WO1993002033A1 (de) * | 1991-07-20 | 1993-02-04 | Henkel Kommanditgesellschaft Auf Aktien | Verfahren zur herstellung von polyolethern |
| US5446210A (en) * | 1991-07-20 | 1995-08-29 | Henkel Kommanditgesellschaft Auf Aktien | Process for the production of polyol ethers |
| EP0616994A3 (en) * | 1993-03-15 | 1994-11-09 | Kao Corp | Process for the preparation of ether alcohols by hydrogenolysis of cyclic ketals. |
| US5446208A (en) * | 1993-03-15 | 1995-08-29 | Kao Corporation | Process for producing ether alcohols by hydrogenolysis of cyclic ketal |
| EP0810194A1 (de) * | 1996-05-30 | 1997-12-03 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von 3-Oxyalkylpropan-1-olen |
| US5780687A (en) * | 1996-05-30 | 1998-07-14 | Hoechst Aktiengesellschaft | Process for preparing 3-oxyalkylpropan-1-ols |
Also Published As
| Publication number | Publication date |
|---|---|
| BE653656A (enExample) | 1965-03-29 |
| FR1409152A (fr) | 1965-08-20 |
| JPS426721B1 (enExample) | 1967-03-18 |
| NL6411361A (enExample) | 1965-03-31 |
| GB1020500A (en) | 1966-02-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1957591C3 (de) | Verfahren zur Herstellung von 2,2- Dimethylpropandiol-(1,3) | |
| DE2507461C3 (de) | Verfahren zur Herstellung von 2,2- Dimethylolalkanalen | |
| DE102008033163B4 (de) | Verfahren zur Gewinnung von Neopentylglykol durch Spaltung von im Herstellverfahren anfallenden Hochsiedern | |
| DE3224033A1 (de) | Verfahren zur herstellung von aetherverbindungen durch katalytische hydrogenolyse | |
| DE102012021280A1 (de) | Verfahren zur Herstellung von Neopentylglykol | |
| DE69415572T2 (de) | Verfahren zur Herstellung von Etheralkoholen durch Hydrogenolyse von zyklischem Ketal | |
| DE2054601C3 (de) | Verfahren zur Herstellung von zweiwertigen Alkoholen | |
| EP1620377B1 (de) | Verfahren zur hydrierung von methylolalkanalen | |
| DE69214026T2 (de) | Herstellung von Neopentylglykol (III) | |
| DE2825586A1 (de) | Verfahren zur herstellung von 1,4-butandiol | |
| DE69636943T2 (de) | Verfahren zur Herstellung von Etherverbindungen | |
| DE3331929C2 (enExample) | ||
| EP0233337B1 (de) | Verfahren zur Herstellung von Carbonylverbindungen | |
| DE3888417T2 (de) | Herstellung cyclischer Carbonate. | |
| DE2029557A1 (enExample) | ||
| EP0227057B1 (de) | Verfahren zur Herstellung von in 1-Stellung durch aromatische oder heterocyclische Reste substituierten Alkanolen | |
| EP1090899B1 (de) | Verfahren zur Herstellung von 1,3-Diolen | |
| WO1998009932A1 (de) | Verfahren zur herstellung von alkindiolen oder gemischen von alkindiolen mit alkinmonoolen | |
| DE102011118956A1 (de) | Verfahren zur Gewinnung von Di-Trimethylolpropan und mit Trimethylolpropan angereicherten Produktströmen aus den Nebenströmen der Trimethylolpropanherstellung | |
| DE1196174B (de) | Verfahren zum Herstellen partieller Alkylaether mehrwertiger Alkohole | |
| DE1793182A1 (de) | Verfahren zur Herstellung von 2-Methylalkanolen | |
| DE3627776A1 (de) | Verfahren zur herstellung von 1,1,2-trialkoxyethan | |
| DE2940256A1 (de) | N,n-dimethyl-n'-(beta)-hydroxyethyl-propylendiamin und verfahren zu seiner herstellung | |
| DE1958463C3 (de) | Verfahren zur Herstellung von 2,2-Dimethyl-1,3-propandiol-hy droxypivalinsäuremonoester | |
| DE871443C (de) | Verfahren zur Herstellung von Nitrobenzylaethern |