DE1229587B - Anordnung zur thermoplastischen und loeschbaren Registrierung - Google Patents
Anordnung zur thermoplastischen und loeschbaren RegistrierungInfo
- Publication number
- DE1229587B DE1229587B DEJ21196A DEJ0021196A DE1229587B DE 1229587 B DE1229587 B DE 1229587B DE J21196 A DEJ21196 A DE J21196A DE J0021196 A DEJ0021196 A DE J0021196A DE 1229587 B DE1229587 B DE 1229587B
- Authority
- DE
- Germany
- Prior art keywords
- layer
- thermoplastic
- arrangement according
- charge
- photoconductive
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920001169 thermoplastic Polymers 0.000 title claims description 42
- 239000004416 thermosoftening plastic Substances 0.000 title claims description 42
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 12
- 238000002844 melting Methods 0.000 claims description 11
- 238000010438 heat treatment Methods 0.000 claims description 9
- 230000008018 melting Effects 0.000 claims description 9
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- 238000001816 cooling Methods 0.000 claims description 5
- 239000003989 dielectric material Substances 0.000 claims description 4
- 229920006267 polyester film Polymers 0.000 claims description 4
- 230000008569 process Effects 0.000 claims description 4
- 230000032798 delamination Effects 0.000 claims 1
- 230000007717 exclusion Effects 0.000 claims 1
- 238000000926 separation method Methods 0.000 claims 1
- 239000000463 material Substances 0.000 description 13
- 239000012815 thermoplastic material Substances 0.000 description 8
- 238000007373 indentation Methods 0.000 description 5
- 238000010586 diagram Methods 0.000 description 4
- 230000003287 optical effect Effects 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- 229920003023 plastic Polymers 0.000 description 4
- 230000003068 static effect Effects 0.000 description 3
- 239000004793 Polystyrene Substances 0.000 description 2
- 238000012217 deletion Methods 0.000 description 2
- 230000037430 deletion Effects 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 1
- 241000158147 Sator Species 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000002800 charge carrier Substances 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- 230000005686 electrostatic field Effects 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 238000009499 grossing Methods 0.000 description 1
- -1 polyethylene Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000003303 reheating Methods 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 230000003319 supportive effect Effects 0.000 description 1
- 230000009897 systematic effect Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 239000012780 transparent material Substances 0.000 description 1
- 230000032258 transport Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N5/00—Details of television systems
- H04N5/76—Television signal recording
- H04N5/80—Television signal recording using electrostatic recording
- H04N5/82—Television signal recording using electrostatic recording using deformable thermoplastic recording medium
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G15/00—Apparatus for electrographic processes using a charge pattern
- G03G15/14—Apparatus for electrographic processes using a charge pattern for transferring a pattern to a second base
- G03G15/18—Apparatus for electrographic processes using a charge pattern for transferring a pattern to a second base of a charge pattern
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G16/00—Electrographic processes using deformation of thermoplastic layers; Apparatus therefor
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/022—Layers for surface-deformation imaging, e.g. frost imaging
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C13/00—Digital stores characterised by the use of storage elements not covered by groups G11C11/00, G11C23/00, or G11C25/00
- G11C13/04—Digital stores characterised by the use of storage elements not covered by groups G11C11/00, G11C23/00, or G11C25/00 using optical elements ; using other beam accessed elements, e.g. electron or ion beam
- G11C13/048—Digital stores characterised by the use of storage elements not covered by groups G11C11/00, G11C23/00, or G11C25/00 using optical elements ; using other beam accessed elements, e.g. electron or ion beam using other optical storage elements
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Signal Processing (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US84570A US3055006A (en) | 1961-01-24 | 1961-01-24 | High density, erasable optical image recorder |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1229587B true DE1229587B (de) | 1966-12-01 |
Family
ID=22185806
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEJ21196A Pending DE1229587B (de) | 1961-01-24 | 1962-01-24 | Anordnung zur thermoplastischen und loeschbaren Registrierung |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3055006A (enExample) |
| CA (1) | CA921102A (enExample) |
| DE (1) | DE1229587B (enExample) |
| GB (1) | GB1000431A (enExample) |
| NL (1) | NL273832A (enExample) |
Families Citing this family (53)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE592152A (enExample) * | 1959-06-22 | |||
| NL262411A (enExample) * | 1960-03-18 | |||
| US3214272A (en) * | 1960-05-10 | 1965-10-26 | Method of recording still optical images by means of a photocondugtive layer using thermoplastic imagewise deformation of the image layer | |
| BE603891A (enExample) * | 1960-05-17 | 1900-01-01 | ||
| BE612087A (enExample) * | 1960-12-29 | |||
| US3170008A (en) * | 1961-03-14 | 1965-02-16 | Litton Systems Inc | Embossing process |
| US3281856A (en) * | 1961-04-10 | 1966-10-25 | Litton Systems Inc | Microwave recording upon a deformable medium |
| GB1006318A (en) * | 1961-05-01 | 1965-09-29 | Rca Corp | Electrophotographic recording |
| US3169061A (en) * | 1961-05-01 | 1965-02-09 | Rca Corp | Electrostatic printing |
| US3274565A (en) * | 1961-05-01 | 1966-09-20 | Rca Corp | Optical-photoconductive reproducer utilizing insulative liquids |
| NL292131A (enExample) * | 1962-04-30 | |||
| US3238041A (en) * | 1962-05-08 | 1966-03-01 | Xerox Co | Relief imaging of photoresponsive member and product |
| US3196008A (en) * | 1962-05-08 | 1965-07-20 | Xerox Corp | Electrophotographic process for formation of frost-like deformation images in mechanically deformable photoconductive layers |
| NL292401A (enExample) * | 1962-05-08 | |||
| US3196010A (en) * | 1962-05-08 | 1965-07-20 | Xerox Corp | Electrophotographic process for formation of deformation images in deformable interference films |
| US3258336A (en) * | 1962-05-08 | 1966-06-28 | Xerox Corp | Strippable layer frost printing |
| US3196009A (en) * | 1962-05-08 | 1965-07-20 | Xerox Co | Electrostatic image liquid deformation development |
| US3196013A (en) * | 1962-06-07 | 1965-07-20 | Xerox Corp | Xerographic induction recording with mechanically deformable image formation in a deformable layer |
| US3196012A (en) * | 1962-06-07 | 1965-07-20 | Xerox Corp | Half-tone xerography with thermoplastic deformation of the image |
| DE1252061B (enExample) * | 1962-07-02 | |||
| US3322538A (en) * | 1962-11-30 | 1967-05-30 | Gen Electric | Electrophotographic process |
| US3322539A (en) * | 1962-11-30 | 1967-05-30 | Gen Electric | Electrophotographic process |
| US3276031A (en) * | 1963-01-14 | 1966-09-27 | Gen Electric | Thermoplastic information recording utilizing electrets |
| US3263557A (en) * | 1963-02-26 | 1966-08-02 | Gen Electric | Document recording systems |
| US3321308A (en) * | 1963-05-17 | 1967-05-23 | Xerox Corp | Xerographic induction recording |
| US3525613A (en) * | 1963-08-12 | 1970-08-25 | Rca Corp | Thermoplastic deformation imaging process |
| US3365543A (en) * | 1963-09-04 | 1968-01-23 | Hitachi Ltd | Thermoplastic recording apparatus for television signals |
| US3320060A (en) * | 1963-11-29 | 1967-05-16 | Xerox Corp | Deformation image reproduction process utilizing a voltage threshold reducing surfactant |
| US3322537A (en) * | 1963-11-29 | 1967-05-30 | Rca Corp | Electrophotographic reproduction process including removal of electroscopic particles from developed electrostatic image |
| US3351920A (en) * | 1964-01-02 | 1967-11-07 | Xerox Corp | Thermoplastic computer memory storage system |
| US3333958A (en) * | 1964-03-27 | 1967-08-01 | Rca Corp | Electrophotographic developing |
| US3308444A (en) * | 1964-04-27 | 1967-03-07 | Ibm | Thermoplastic recording system |
| US3404001A (en) * | 1964-09-17 | 1968-10-01 | Xerox Corp | Thermoplastic deformation imaging with color reagents |
| US3443937A (en) * | 1965-04-20 | 1969-05-13 | Xerox Corp | Image resolution |
| US3395264A (en) * | 1965-05-03 | 1968-07-30 | Sperry Rand Corp | Marking apparatus |
| US3329500A (en) * | 1965-06-07 | 1967-07-04 | Xerox Corp | Electrostatic frosting |
| US3322034A (en) * | 1965-09-02 | 1967-05-30 | Xerox Corp | Frost color display |
| US3795009A (en) * | 1970-06-17 | 1974-02-26 | Bell & Howell Co | Information recording methods, apparatus and media using deformable magnetized materials |
| US3692404A (en) * | 1970-10-29 | 1972-09-19 | Corrsin Lester | Strippable layer relief printing |
| FR2210302A5 (enExample) * | 1972-12-08 | 1974-07-05 | Cellophane Sa | |
| US3906462A (en) * | 1973-05-04 | 1975-09-16 | Itek Corp | Optical storage device using piezoelectric read-out |
| US4015248A (en) * | 1973-11-07 | 1977-03-29 | Siemens Aktiengesellschaft | Process for recording low-frequency wide-band signals on a thermoplastic storage medium |
| JPS50115830A (enExample) * | 1974-02-22 | 1975-09-10 | ||
| DE2412771C3 (de) * | 1974-03-16 | 1979-03-15 | Hoechst Ag, 6000 Frankfurt | Verfahren zum Aufzeichnen oder Löschen von Deformationsbildern und Vorrichtung zur Durchführung des Verfahrens |
| US4539591A (en) * | 1979-03-22 | 1985-09-03 | University Of Texas System | Method of impressing and reading out a surface charge on a multi-layered detector structure |
| US4521808A (en) * | 1979-03-22 | 1985-06-04 | University Of Texas System | Electrostatic imaging apparatus |
| US4320489A (en) * | 1980-03-03 | 1982-03-16 | Rca Corporation | Reversible optical storage medium and a method for recording information therein |
| US4757472A (en) * | 1986-12-31 | 1988-07-12 | Tecon Memory, Inc. | Electrophotographic optical memory system |
| US5508727A (en) * | 1991-05-08 | 1996-04-16 | Imagine, Ltd. | Apparatus and method for pattern generation on a dielectric substrate |
| US5777576A (en) * | 1991-05-08 | 1998-07-07 | Imagine Ltd. | Apparatus and methods for non impact imaging and digital printing |
| US5157423A (en) * | 1991-05-08 | 1992-10-20 | Cubital Ltd. | Apparatus for pattern generation on a dielectric substrate |
| KR930702658A (ko) | 1991-05-08 | 1993-09-09 | 이차크 포메란츠 | 비접촉 인쇄, 판독 및 영상용 장치 |
| EP0706891A3 (en) | 1994-10-13 | 1998-05-06 | Imagine Ltd. | Apparatus and methods for non impact imaging and digital printing |
-
0
- NL NL273832D patent/NL273832A/xx unknown
-
1961
- 1961-01-24 US US84570A patent/US3055006A/en not_active Expired - Lifetime
- 1961-12-27 CA CA838819A patent/CA921102A/en not_active Expired
- 1961-12-29 GB GB46674/61A patent/GB1000431A/en not_active Expired
-
1962
- 1962-01-24 DE DEJ21196A patent/DE1229587B/de active Pending
Non-Patent Citations (1)
| Title |
|---|
| None * |
Also Published As
| Publication number | Publication date |
|---|---|
| NL273832A (enExample) | |
| GB1000431A (en) | 1965-08-04 |
| US3055006A (en) | 1962-09-18 |
| CA921102A (en) | 1973-02-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1229587B (de) | Anordnung zur thermoplastischen und loeschbaren Registrierung | |
| DE1267550B (de) | Elektrofotografisches Verfahren zur Herstellung eines Deformationsbildes | |
| DE2053135C3 (de) | Einrichtung zur photoelektrophoretischen Herstellung von Farbbildern | |
| DE1437260C3 (de) | Vorrichtung zur Aufzeichnung von Informationen | |
| DE1804982B2 (de) | Elektrophotographisches Aufzeichnungs- und Bildempfangsmaterial | |
| DE1810757A1 (de) | Verfahren zur UEbertragung von elektrostatischen Ladungsbildern | |
| DE1804974C3 (de) | Elektrophoretophotographisches Verfahren und Vorrichtung zum Durchführen dieses Verfahrens | |
| DE1497060C3 (de) | Elektrofotografisches Verfahren und Bildempfangsmaterial zur Herstel lung gerasterter Halbtonbilder | |
| DE1273565B (de) | Verfahren und Einrichtung zur Beeinflussung der Oberflaechengestalt eines durch Erwaermung deformierbaren, der Speicherung breitbandiger Signale, insbesondere Fernsehsignale, dienenden Aufzeichenmediums, vorzugsweise eines thermoplastischen Aufzeichenmediums | |
| DE2111494C3 (de) | Elektrophotographische Entwicklungseinrichtung | |
| DE2648298A1 (de) | Aufzeichnungsorgan fuer die elektrostatische reproduktion | |
| DE1253581B (de) | Verfahren zur Herstellung eines Deformationsbildes | |
| DE1414991A1 (de) | Vorrichtung zur Induktion von Ladungen | |
| DE68914364T2 (de) | Verfahren und Vorrichtung zur Übertragung eines elektrostatischen latenten Bildes. | |
| DE1812856A1 (de) | Elektrographisches Wiedergabemittel | |
| DE2609230B2 (de) | Elektrophotographisches Aufzeichnungsmaterial und Verfahren zur Herstellung eines elektrophotographischen Aufzeichnungsmaterial^ | |
| DE2301233C3 (de) | Verfahren zum Betrieb eines optischen Relais, insbesondere für die Projektion von Fernsehbildern | |
| DE1522518A1 (de) | Verfahren zur Herstellung von Mutterdruckplatten | |
| DE1772763C3 (de) | Verfahren zur Umkehrentwicklung eines Ladungsbildes | |
| DE1807469C3 (de) | Elektrophotographisches Verfahren | |
| DE2347270A1 (de) | Elektrostatisches kopierverfahren und vorrichtung zum kopieren auf elektrophotographischem oder elektrostatischem wege | |
| DE1908847A1 (de) | Verfahren zur fluessigen Entwicklung von elektrostatischen latenten Bildern | |
| DE2200136A1 (de) | Einrichtung zur Bilderzeugung durch Schichtuebertragung | |
| DE3040222C2 (de) | Treiberschaltung für ein elektrostatisches Aufzeichnungsgerät mit Multi-Pin-Elektrode | |
| DE2011963C3 (de) | Elektrographlsche Abbildungsanlage mit einem Aufzeichnungsträger mit einer leitenden und einer dielektrischen Schicht |