DE1188440B - Entwickler fuer elektrostatische latente Bilder - Google Patents
Entwickler fuer elektrostatische latente BilderInfo
- Publication number
- DE1188440B DE1188440B DEK41304A DEK0041304A DE1188440B DE 1188440 B DE1188440 B DE 1188440B DE K41304 A DEK41304 A DE K41304A DE K0041304 A DEK0041304 A DE K0041304A DE 1188440 B DE1188440 B DE 1188440B
- Authority
- DE
- Germany
- Prior art keywords
- toner
- parts
- weight
- charge
- image
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000975 dye Substances 0.000 claims description 8
- 238000002844 melting Methods 0.000 claims description 8
- 239000001993 wax Substances 0.000 claims description 8
- 239000000049 pigment Substances 0.000 claims description 6
- 150000002894 organic compounds Chemical class 0.000 claims description 4
- 239000000203 mixture Substances 0.000 description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 10
- 229910052782 aluminium Inorganic materials 0.000 description 10
- 239000000463 material Substances 0.000 description 8
- 229920005989 resin Polymers 0.000 description 8
- 239000011347 resin Substances 0.000 description 8
- 238000001816 cooling Methods 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- 229920003023 plastic Polymers 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000004793 Polystyrene Substances 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000006229 carbon black Substances 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 229920002223 polystyrene Polymers 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 229910021538 borax Inorganic materials 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 239000001023 inorganic pigment Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000012860 organic pigment Substances 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000004328 sodium tetraborate Substances 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- DSEKYWAQQVUQTP-XEWMWGOFSA-N (2r,4r,4as,6as,6as,6br,8ar,12ar,14as,14bs)-2-hydroxy-4,4a,6a,6b,8a,11,11,14a-octamethyl-2,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-tetradecahydro-1h-picen-3-one Chemical compound C([C@H]1[C@]2(C)CC[C@@]34C)C(C)(C)CC[C@]1(C)CC[C@]2(C)[C@H]4CC[C@@]1(C)[C@H]3C[C@@H](O)C(=O)[C@@H]1C DSEKYWAQQVUQTP-XEWMWGOFSA-N 0.000 description 1
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- SWJPEBQEEAHIGZ-UHFFFAOYSA-N 1,4-dibromobenzene Chemical compound BrC1=CC=C(Br)C=C1 SWJPEBQEEAHIGZ-UHFFFAOYSA-N 0.000 description 1
- VOZKAJLKRJDJLL-UHFFFAOYSA-N 2,4-diaminotoluene Chemical compound CC1=CC=C(N)C=C1N VOZKAJLKRJDJLL-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- MLKXDPUZXIRXEP-UHFFFAOYSA-N 2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]-1-indenyl]acetic acid Chemical class CC1=C(CC(O)=O)C2=CC(F)=CC=C2C1=CC1=CC=C(S(C)=O)C=C1 MLKXDPUZXIRXEP-UHFFFAOYSA-N 0.000 description 1
- PYSRRFNXTXNWCD-UHFFFAOYSA-N 3-(2-phenylethenyl)furan-2,5-dione Chemical compound O=C1OC(=O)C(C=CC=2C=CC=CC=2)=C1 PYSRRFNXTXNWCD-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- 240000000972 Agathis dammara Species 0.000 description 1
- 241000016649 Copaifera officinalis Species 0.000 description 1
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 1
- 239000005751 Copper oxide Substances 0.000 description 1
- 229920002871 Dammar gum Polymers 0.000 description 1
- 235000009161 Espostoa lanata Nutrition 0.000 description 1
- 240000001624 Espostoa lanata Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 1
- CWRYPZZKDGJXCA-UHFFFAOYSA-N acenaphthene Chemical compound C1=CC(CC2)=C3C2=CC=CC3=C1 CWRYPZZKDGJXCA-UHFFFAOYSA-N 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 229940103272 aluminum potassium sulfate Drugs 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 239000010426 asphalt Substances 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- QXJJQWWVWRCVQT-UHFFFAOYSA-K calcium;sodium;phosphate Chemical compound [Na+].[Ca+2].[O-]P([O-])([O-])=O QXJJQWWVWRCVQT-UHFFFAOYSA-K 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- VVOLVFOSOPJKED-UHFFFAOYSA-N copper phthalocyanine Chemical compound [Cu].N=1C2=NC(C3=CC=CC=C33)=NC3=NC(C3=CC=CC=C33)=NC3=NC(C3=CC=CC=C33)=NC3=NC=1C1=CC=CC=C12 VVOLVFOSOPJKED-UHFFFAOYSA-N 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- SNWKSPIFHCTHRU-UHFFFAOYSA-L disodium;3-[[4-hydroxy-9,10-dioxo-2-(4-sulfonatoanilino)anthracen-1-yl]amino]benzenesulfonate Chemical compound [Na+].[Na+].C=1C=CC(S([O-])(=O)=O)=CC=1NC=1C=2C(=O)C3=CC=CC=C3C(=O)C=2C(O)=CC=1NC1=CC=C(S([O-])(=O)=O)C=C1 SNWKSPIFHCTHRU-UHFFFAOYSA-L 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000012182 japan wax Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 239000012170 montan wax Substances 0.000 description 1
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- GRLPQNLYRHEGIJ-UHFFFAOYSA-J potassium aluminium sulfate Chemical compound [Al+3].[K+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRLPQNLYRHEGIJ-UHFFFAOYSA-J 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- 230000001846 repelling effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000005204 segregation Methods 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000002639 sodium chloride Nutrition 0.000 description 1
- NVIFVTYDZMXWGX-UHFFFAOYSA-N sodium metaborate Chemical compound [Na+].[O-]B=O NVIFVTYDZMXWGX-UHFFFAOYSA-N 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- WUUHFRRPHJEEKV-UHFFFAOYSA-N tripotassium borate Chemical compound [K+].[K+].[K+].[O-]B([O-])[O-] WUUHFRRPHJEEKV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G13/00—Electrographic processes using a charge pattern
- G03G13/26—Electrographic processes using a charge pattern for the production of printing plates for non-xerographic printing processes
- G03G13/28—Planographic printing plates
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Developing Agents For Electrophotography (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL267570D NL267570A (enExample) | 1960-07-27 | ||
| BE606518D BE606518A (enExample) | 1960-07-27 | ||
| DEK41304A DE1188440B (de) | 1960-07-27 | 1960-07-27 | Entwickler fuer elektrostatische latente Bilder |
| FR867594A FR1294633A (fr) | 1960-07-27 | 1961-07-11 | Révélateur pour images électrostatiques latentes |
| SE7271/61A SE308252B (enExample) | 1960-07-27 | 1961-07-13 | |
| GB25620/61A GB944396A (en) | 1960-07-27 | 1961-07-14 | Developer for electrostatic latent images |
| LU40401D LU40401A1 (enExample) | 1960-07-27 | 1961-07-14 | |
| DK306661AA DK134576B (da) | 1960-07-27 | 1961-07-26 | Fremkalder for elektrostatiske latente billeder. |
| CH878661A CH425470A (de) | 1960-07-27 | 1961-07-26 | Entwickler für elektrostatische latente Bilder |
| NL61267570A NL141665B (nl) | 1960-07-27 | 1961-07-26 | Werkwijze voor het bereiden van een poeder voor het ontwikkelen van elektrostatische latente beelden. |
| US37472A US3650797A (en) | 1960-07-27 | 1970-05-18 | Developing electrostatic latent images with a mixture of positive and negative toners |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK41304A DE1188440B (de) | 1960-07-27 | 1960-07-27 | Entwickler fuer elektrostatische latente Bilder |
| US3747270A | 1970-05-18 | 1970-05-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1188440B true DE1188440B (de) | 1965-03-04 |
Family
ID=25983296
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEK41304A Pending DE1188440B (de) | 1960-07-27 | 1960-07-27 | Entwickler fuer elektrostatische latente Bilder |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3650797A (enExample) |
| BE (1) | BE606518A (enExample) |
| CH (1) | CH425470A (enExample) |
| DE (1) | DE1188440B (enExample) |
| DK (1) | DK134576B (enExample) |
| GB (1) | GB944396A (enExample) |
| LU (1) | LU40401A1 (enExample) |
| NL (2) | NL141665B (enExample) |
| SE (1) | SE308252B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2461643A1 (de) * | 1973-12-29 | 1975-07-10 | Kao Corp | Toener-zusammensetzung fuer die verwendung bei der elektrofotografie |
| DE2723668A1 (de) * | 1976-05-28 | 1977-12-01 | Ricoh Kk | Trockenentwicklerpulver |
| DE3120542A1 (de) * | 1980-05-22 | 1982-03-25 | Hitachi Chemical Co., Ltd., Tokyo | Positiv aufladbarer toner |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3901695A (en) * | 1964-04-06 | 1975-08-26 | Addressograph Multigraph | Electrophotographic process using polyamide containing developer |
| NL7207688A (enExample) * | 1972-06-07 | 1973-12-11 | Oce Van Der Grinten Nv | |
| US4038076A (en) * | 1972-07-24 | 1977-07-26 | Xerox Corporation | Process for producing electrostatographic prints |
| JPS49113838A (enExample) * | 1973-03-05 | 1974-10-30 | ||
| US4016814A (en) * | 1973-04-13 | 1977-04-12 | Xerox Corporation | Planographic printing master |
| JPS5725267B2 (enExample) * | 1973-05-02 | 1982-05-28 | ||
| US3951063A (en) * | 1973-11-30 | 1976-04-20 | Xerox Corporation | Process for preparing reversible cure waterless lithographic masters |
| US3900588A (en) * | 1974-02-25 | 1975-08-19 | Xerox Corp | Non-filming dual additive developer |
| US4126454A (en) * | 1974-05-30 | 1978-11-21 | Xerox Corporation | Imaging process utilizing classified high surface area carrier materials |
| US3942979A (en) * | 1974-05-30 | 1976-03-09 | Xerox Corporation | Imaging system |
| DE2556386C2 (de) * | 1975-12-15 | 1985-02-28 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Herstellung von Druckformen und/oder metallisierten Bildern |
| JPS5814319B2 (ja) * | 1976-04-26 | 1983-03-18 | 京セラミタ株式会社 | 平版又はオフセツト印刷用版及びその製法 |
| US4331757A (en) * | 1976-12-29 | 1982-05-25 | Minolta Camera Kabushiki Kaisha | Dry process developing method and device employed therefore |
| US4142981A (en) * | 1977-07-05 | 1979-03-06 | Xerox Corporation | Toner combination for carrierless development |
| US4525447A (en) * | 1982-11-08 | 1985-06-25 | Minolta Camera Kabushiki Kaisha | Image forming method using three component developer |
| US4705696A (en) * | 1984-09-27 | 1987-11-10 | Olin Hunt Specialty Products Inc. | Method of making a lithographic printing plate, printing plates made by the method, and the use of such printing plates to make lithographic prints |
| DE19602328A1 (de) * | 1996-01-24 | 1997-07-31 | Roland Man Druckmasch | Verfahren zum Bebildern einer löschbaren Druckform |
| JP4103868B2 (ja) * | 2004-08-05 | 2008-06-18 | コニカミノルタビジネステクノロジーズ株式会社 | 画像形成装置および現像装置 |
| JP2018180150A (ja) * | 2017-04-07 | 2018-11-15 | 京セラドキュメントソリューションズ株式会社 | 静電潜像現像用トナー及びその製造方法 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2221776A (en) * | 1938-09-08 | 1940-11-19 | Chester F Carlson | Electron photography |
| US2297691A (en) * | 1939-04-04 | 1942-10-06 | Chester F Carlson | Electrophotography |
| US2416480A (en) * | 1943-08-19 | 1947-02-25 | Henrite Products Corp | Electrical brush |
| IT453731A (enExample) * | 1948-05-01 | |||
| US2940934A (en) * | 1953-06-22 | 1960-06-14 | Haloid Xerox Inc | Electrostatic developer composition and method therefor |
| US2758939A (en) * | 1953-12-30 | 1956-08-14 | Rca Corp | Electrostatic printing |
| US2986521A (en) * | 1958-03-28 | 1961-05-30 | Rca Corp | Reversal type electroscopic developer powder |
| US2952536A (en) * | 1958-04-21 | 1960-09-13 | Haloid Xerox Inc | Method of preparing a lithographic printing plate |
| US3013890A (en) * | 1958-07-08 | 1961-12-19 | Xerox Corp | Process of developing electrostatic images and composition therefor |
-
0
- BE BE606518D patent/BE606518A/xx unknown
- NL NL267570D patent/NL267570A/xx unknown
-
1960
- 1960-07-27 DE DEK41304A patent/DE1188440B/de active Pending
-
1961
- 1961-07-13 SE SE7271/61A patent/SE308252B/xx unknown
- 1961-07-14 LU LU40401D patent/LU40401A1/xx unknown
- 1961-07-14 GB GB25620/61A patent/GB944396A/en not_active Expired
- 1961-07-26 CH CH878661A patent/CH425470A/de unknown
- 1961-07-26 NL NL61267570A patent/NL141665B/xx unknown
- 1961-07-26 DK DK306661AA patent/DK134576B/da unknown
-
1970
- 1970-05-18 US US37472A patent/US3650797A/en not_active Expired - Lifetime
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2461643A1 (de) * | 1973-12-29 | 1975-07-10 | Kao Corp | Toener-zusammensetzung fuer die verwendung bei der elektrofotografie |
| DE2723668A1 (de) * | 1976-05-28 | 1977-12-01 | Ricoh Kk | Trockenentwicklerpulver |
| DE3120542A1 (de) * | 1980-05-22 | 1982-03-25 | Hitachi Chemical Co., Ltd., Tokyo | Positiv aufladbarer toner |
Also Published As
| Publication number | Publication date |
|---|---|
| DK134576C (enExample) | 1977-05-02 |
| LU40401A1 (enExample) | 1961-09-14 |
| DK134576B (da) | 1976-11-29 |
| NL267570A (enExample) | |
| NL141665B (nl) | 1974-03-15 |
| CH425470A (de) | 1966-11-30 |
| SE308252B (enExample) | 1969-02-03 |
| GB944396A (en) | 1963-12-11 |
| BE606518A (enExample) | |
| US3650797A (en) | 1972-03-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1188440B (de) | Entwickler fuer elektrostatische latente Bilder | |
| DE69009610T2 (de) | Verfahren zur Erzeugung gesicherter Bilder. | |
| US3345294A (en) | Developer mix for electrostatic printing | |
| US2899335A (en) | Process for developing electrostatic | |
| US2877133A (en) | Electrostatic photography | |
| DE3834631C2 (de) | Elektrophotographische Vorrichtung mit einem photoleitfähigen Aufzeichnungsmaterial mit aufgerauhter Oberfläche | |
| DE1797462C3 (de) | Verfahren zur Pulverentwicklung von latenten elektrostatischen Bildern | |
| DE2249384A1 (de) | Elektrostatographisches entwicklermaterial | |
| US2659670A (en) | Method of developing electrostatic images | |
| DE1115580B (de) | Entwickler fuer elektrophotographische Zwecke | |
| DE2815093A1 (de) | Entwickler fuer elektrostatische bilder | |
| DE1215524B (de) | Verfahren zur Herstellung eines fluessigen Entwicklers fuer Ladungsbilder | |
| DE2256329A1 (de) | Feinteilige bilderzeugungszusammensetzung | |
| US2753308A (en) | Xerography developer composition | |
| DE1197754B (de) | Entwickler fuer elektrophotographische Zwecke | |
| DE3029837A1 (de) | Bildtraegerelement | |
| US3576624A (en) | Electrostatic printing method employing a pigmented light filter | |
| DE2555811A1 (de) | Entwicklungspulver zur verwendung in einem trockenen elektrophotographischen verfahren | |
| US3090755A (en) | Xerographic process toner and method of producing same | |
| NO140966B (no) | Separat fikseringsenhet for intravenoese kanyler og kateter | |
| US4058470A (en) | Liquid developer composition for lithographic masters | |
| DE2041616A1 (de) | Bildplatte fuer die Bilderzeugung durch Teilchenwanderung | |
| DE2828890C2 (enExample) | ||
| DE1497061A1 (de) | Xerographisches Kopierverfahren | |
| DE3227475A1 (de) | In waessrigen mitteln loesliche oder dispergierbare, photoleitende masse |