DE1124929B - Verfahren zur Herstellung von Peroxymonosulfaten - Google Patents
Verfahren zur Herstellung von PeroxymonosulfatenInfo
- Publication number
- DE1124929B DE1124929B DEF31644A DEF0031644A DE1124929B DE 1124929 B DE1124929 B DE 1124929B DE F31644 A DEF31644 A DE F31644A DE F0031644 A DEF0031644 A DE F0031644A DE 1124929 B DE1124929 B DE 1124929B
- Authority
- DE
- Germany
- Prior art keywords
- hso
- hydrogen peroxide
- reaction
- peroxide
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 19
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 47
- 238000006243 chemical reaction Methods 0.000 claims description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 24
- 239000011541 reaction mixture Substances 0.000 claims description 20
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 15
- 229910052760 oxygen Inorganic materials 0.000 claims description 15
- 239000001301 oxygen Substances 0.000 claims description 15
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 12
- 150000002978 peroxides Chemical class 0.000 claims description 12
- 239000007795 chemical reaction product Substances 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 4
- 230000003197 catalytic effect Effects 0.000 claims description 4
- 238000011065 in-situ storage Methods 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 125000004334 oxygen containing inorganic group Chemical group 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims 1
- 238000003756 stirring Methods 0.000 claims 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 13
- 239000000047 product Substances 0.000 description 10
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 5
- 230000002349 favourable effect Effects 0.000 description 5
- FHHJDRFHHWUPDG-UHFFFAOYSA-L peroxysulfate(2-) Chemical compound [O-]OS([O-])(=O)=O FHHJDRFHHWUPDG-UHFFFAOYSA-L 0.000 description 5
- FHHJDRFHHWUPDG-UHFFFAOYSA-N peroxysulfuric acid Chemical compound OOS(O)(=O)=O FHHJDRFHHWUPDG-UHFFFAOYSA-N 0.000 description 5
- 150000001342 alkaline earth metals Chemical class 0.000 description 3
- -1 chlorine ions Chemical class 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- BIGPRXCJEDHCLP-UHFFFAOYSA-N ammonium bisulfate Chemical compound [NH4+].OS([O-])(=O)=O BIGPRXCJEDHCLP-UHFFFAOYSA-N 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- 150000004976 peroxydisulfates Chemical class 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- QHGNHLZPVBIIPX-UHFFFAOYSA-N tin(ii) oxide Chemical class [Sn]=O QHGNHLZPVBIIPX-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/055—Peroxyhydrates; Peroxyacids or salts thereof
- C01B15/06—Peroxyhydrates; Peroxyacids or salts thereof containing sulfur
- C01B15/08—Peroxysulfates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US827144A US3002813A (en) | 1959-07-15 | 1959-07-15 | Method of preparing monopersulfates |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1124929B true DE1124929B (de) | 1962-03-08 |
Family
ID=25248425
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF31644A Pending DE1124929B (de) | 1959-07-15 | 1960-07-12 | Verfahren zur Herstellung von Peroxymonosulfaten |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3002813A (enExample) |
| CH (1) | CH403727A (enExample) |
| DE (1) | DE1124929B (enExample) |
| FR (1) | FR1262422A (enExample) |
| GB (1) | GB919862A (enExample) |
| LU (1) | LU38924A1 (enExample) |
| NL (1) | NL130829C (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB988356A (en) * | 1960-08-23 | 1965-04-07 | Laporte Chemical | Improvements in or relating to permonosulphates and the preparation thereof |
| GB992742A (en) * | 1961-03-27 | 1965-05-19 | Laporte Chemical | Preparation of permonosulphates |
| BE621960A (enExample) * | 1961-08-31 | |||
| US4049786A (en) * | 1976-09-13 | 1977-09-20 | Fmc Corporation | Process of preparing peroxymonosulfate |
| DE3427119A1 (de) * | 1984-07-23 | 1986-01-23 | Peroxid-Chemie GmbH, 8023 Höllriegelskreuth | Verfahren zur herstellung von kaliumpermonosulfat-tripelsalz |
| FR2904435B1 (fr) * | 2006-07-27 | 2008-12-05 | Tokendo Soc Par Actions Simpli | Sonde endoscopique integrant un objectif ayant un encombrement reduit |
| US9539286B2 (en) | 2013-10-18 | 2017-01-10 | Globus Medical, Inc. | Bone grafts including osteogenic stem cells, and methods relating to the same |
-
1959
- 1959-07-15 US US827144A patent/US3002813A/en not_active Expired - Lifetime
-
1960
- 1960-07-07 LU LU38924D patent/LU38924A1/xx unknown
- 1960-07-11 GB GB24050/60A patent/GB919862A/en not_active Expired
- 1960-07-12 DE DEF31644A patent/DE1124929B/de active Pending
- 1960-07-13 FR FR832973A patent/FR1262422A/fr not_active Expired
- 1960-07-14 CH CH805760A patent/CH403727A/de unknown
- 1960-07-15 NL NL253872A patent/NL130829C/xx active
Also Published As
| Publication number | Publication date |
|---|---|
| GB919862A (en) | 1963-02-27 |
| CH403727A (de) | 1965-12-15 |
| US3002813A (en) | 1961-10-03 |
| NL253872A (enExample) | 1964-03-25 |
| LU38924A1 (enExample) | 1960-09-07 |
| FR1262422A (fr) | 1961-05-26 |
| NL130829C (enExample) | 1971-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2625248C2 (de) | Verfahren zum Aufarbeiten von Soleschlamm | |
| DE1124929B (de) | Verfahren zur Herstellung von Peroxymonosulfaten | |
| DE19503900C1 (de) | Verfahren zur Herstellung des Kaliumperoxomonosulfat-Tripelsalzes 2 KHSO¶5¶ . KHSO¶4¶ . K¶2¶SO¶4¶ | |
| DE1054076B (de) | Verfahren zur Herstellung von Chlordioxyd | |
| DE1103309B (de) | Verfahren zur Herstellung von Peroxymonosulfaten | |
| CA1061081A (en) | Production of alkali metal phosphate slutions of low vanadium content | |
| DE2548592C3 (de) | Verfahren zur Herstellung von Azodicarbonamid | |
| EP0279438B1 (de) | Verfahren zur Herstellung von reinem Bortrifluorid | |
| DE2522220C3 (de) | Verfahren zur Beseitigung der organischen Verunreinigungen in wässrigen Phosphorsäurelösungen | |
| DE3427119A1 (de) | Verfahren zur herstellung von kaliumpermonosulfat-tripelsalz | |
| EP0127783B1 (de) | Verfahren zum Phlegmatisieren von wasserunlöslichen Peroxycarbonsäuren | |
| AT220589B (de) | Verfahren zur Herstellung von Ammonium-, Alkali- oder Erdalkaliperoxomonosulfaten | |
| DE2933502C2 (de) | Verfahren zur Reinigung von fluorwasserstoff- und fluorhaltigen Abgasen | |
| SU850583A1 (ru) | Способ получени сульфата аммони | |
| DE2240723A1 (de) | Verfahren zur herstellung von zitronensaeure oder deren salze oder ester | |
| DE835439C (de) | Verfahren zur Herstellung von Chlordioxyd | |
| US3660030A (en) | Method of preparing nitrosyl chloride | |
| AT215957B (de) | Verfahren zur Herstellung von Peroxomonosulfaten | |
| DE868597C (de) | Verfahren zur Herstellung von Chlordioxyd | |
| US3297684A (en) | Photochemical process for the preparation of lactams | |
| DE1912898C (de) | Verfahren zur Herstellung eines aus Ammoniumnatriumnitrat bestehenden Dungemit tels | |
| DE1284953B (de) | Verfahren zur Herstellung eines an Kaliummonopersulfat reichen Salzgemisches | |
| DE834091C (de) | Verfahren zur Herstellung von Chlordioxyd | |
| DE1912898B (de) | Verfahren zur Herstellung eines aus Ammoniumnatriumnitrat bestehenden Dungemit fels | |
| EP0000935A1 (de) | Verfahren zur Reinigung von Schwefelsäure |