DE1119287B - Verfahren zur Herstellung blutdruckwirksamer sekundaerer Amine - Google Patents
Verfahren zur Herstellung blutdruckwirksamer sekundaerer AmineInfo
- Publication number
- DE1119287B DE1119287B DEF28066A DEF0028066A DE1119287B DE 1119287 B DE1119287 B DE 1119287B DE F28066 A DEF28066 A DE F28066A DE F0028066 A DEF0028066 A DE F0028066A DE 1119287 B DE1119287 B DE 1119287B
- Authority
- DE
- Germany
- Prior art keywords
- formula
- carbon atoms
- preparation
- blood pressure
- tert
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 5
- 238000002360 preparation method Methods 0.000 title claims description 4
- 150000003335 secondary amines Chemical class 0.000 title claims description 4
- 230000036772 blood pressure Effects 0.000 title claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- -1 aryl sulfonic acid esters Chemical class 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 150000001298 alcohols Chemical class 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 150000003141 primary amines Chemical class 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 239000002262 Schiff base Substances 0.000 claims 1
- 150000004753 Schiff bases Chemical class 0.000 claims 1
- 239000002585 base Substances 0.000 claims 1
- 125000004417 unsaturated alkyl group Chemical group 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 2
- AQIXEPGDORPWBJ-UHFFFAOYSA-N pentan-3-ol Chemical compound CCC(O)CC AQIXEPGDORPWBJ-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- LGAJYTCRJPCZRJ-UHFFFAOYSA-N 2-bromopentane Chemical compound CCCC(C)Br LGAJYTCRJPCZRJ-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- SGRBRAQXECVTBV-UHFFFAOYSA-N 2-methyl-n-propan-2-ylbutan-2-amine Chemical compound CCC(C)(C)NC(C)C SGRBRAQXECVTBV-UHFFFAOYSA-N 0.000 description 1
- ZWXQPERWRDHCMZ-UHFFFAOYSA-N 2-methyl-n-propan-2-ylpropan-2-amine Chemical compound CC(C)NC(C)(C)C ZWXQPERWRDHCMZ-UHFFFAOYSA-N 0.000 description 1
- GELMWIVBBPAMIO-UHFFFAOYSA-N 2-methylbutan-2-amine Chemical compound CCC(C)(C)N GELMWIVBBPAMIO-UHFFFAOYSA-N 0.000 description 1
- WVYWICLMDOOCFB-UHFFFAOYSA-N 4-methyl-2-pentanol Chemical compound CC(C)CC(C)O WVYWICLMDOOCFB-UHFFFAOYSA-N 0.000 description 1
- 208000003098 Ganglion Cysts Diseases 0.000 description 1
- 208000005400 Synovial Cyst Diseases 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- AYHWQTQILBGWRN-UHFFFAOYSA-N butan-2-yl 4-methylbenzenesulfonate Chemical compound CCC(C)OS(=O)(=O)C1=CC=C(C)C=C1 AYHWQTQILBGWRN-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- RRYYENPEMDHYLQ-UHFFFAOYSA-N n-tert-butylbutan-2-amine Chemical compound CCC(C)NC(C)(C)C RRYYENPEMDHYLQ-UHFFFAOYSA-N 0.000 description 1
- SZAGYXMYNOXHSN-UHFFFAOYSA-N n-tert-butylpentan-3-amine Chemical compound CCC(CC)NC(C)(C)C SZAGYXMYNOXHSN-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- SLMCDJBSBDYBAX-UHFFFAOYSA-N pentan-3-yl 4-methylbenzenesulfonate Chemical compound CCC(CC)OS(=O)(=O)C1=CC=C(C)C=C1 SLMCDJBSBDYBAX-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/02—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton by reactions involving the formation of amino groups from compounds containing hydroxy groups or etherified or esterified hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/08—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to an acyclic carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF28066A DE1119287B (de) | 1959-03-28 | 1959-03-28 | Verfahren zur Herstellung blutdruckwirksamer sekundaerer Amine |
| BE589125A BE589125A (fr) | 1959-03-28 | 1960-03-28 | Fabrication d'amines secondaires agissant sur la tension sanguine. |
| FR837167A FR456M (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | 1959-03-28 | 1960-08-30 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF28066A DE1119287B (de) | 1959-03-28 | 1959-03-28 | Verfahren zur Herstellung blutdruckwirksamer sekundaerer Amine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1119287B true DE1119287B (de) | 1961-12-14 |
Family
ID=7092731
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF28066A Pending DE1119287B (de) | 1959-03-28 | 1959-03-28 | Verfahren zur Herstellung blutdruckwirksamer sekundaerer Amine |
Country Status (3)
-
1959
- 1959-03-28 DE DEF28066A patent/DE1119287B/de active Pending
-
1960
- 1960-03-28 BE BE589125A patent/BE589125A/fr unknown
- 1960-08-30 FR FR837167A patent/FR456M/fr active Active
Also Published As
| Publication number | Publication date |
|---|---|
| FR456M (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | 1961-04-24 |
| BE589125A (fr) | 1960-07-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1770595A1 (de) | Substituierte Tetrahydrochinoline | |
| DE2429562A1 (de) | Benzoxazolinon-derivate | |
| DE1119287B (de) | Verfahren zur Herstellung blutdruckwirksamer sekundaerer Amine | |
| DE2310140A1 (de) | Neue 1-phenyl-2-amino-aethanolderivate und ein verfahren zu ihrer herstellung | |
| DE1793693B2 (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | ||
| DE2166997C3 (de) | Verfahren zur Herstellung von 4,4-Diphenyl-piperidinen | |
| DE826133C (de) | Verfahren zur Herstellung von Dihydroresorcin-carbaminsaeureestern | |
| DE960813C (de) | Verfahren zur Herstellung von ungesaettigten ª†- und ª€-Laktonen | |
| EP0251058A2 (de) | Verfahren zur Racemisierung optisch aktiver- Phenoxy- propionsäureester und deren Derivate | |
| AT243268B (de) | Verfahren zur Herstellung von neuen Benzochinolizin-Derivaten | |
| DE955947C (de) | Verfahren zur Herstellung von Diglycidestern | |
| DE1618310C3 (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | ||
| DE895452C (de) | Verfahren zur Herstellung von Mono-vinyl-und Di-vinyl-acetalen | |
| DE954599C (de) | Verfahren zur Herstellung von Derivaten des 5-Amino-8-methyl-thiochromanons und -thiochromons | |
| DE819992C (de) | Verfahren zur Herstellung von Amiden und Thioamiden | |
| DE1000381C2 (de) | Verfahren zur Herstellung von 2-Thio-3, 3-dialkyl- bzw. 2-Thio-3, 3-dialkenyl-4-oxo-1, 2, 3, 4-tetrahydro-pyridinen | |
| DE935365C (de) | Verfahren zur Herstellung von Ketoverbindungen | |
| DE946707C (de) | Verfahren zur Herstellung neuer Thioncarbaminsaeureester | |
| AT238187B (de) | Verfahren zur Herstellung neuer Pyrrolidinverbindungen | |
| DE1242241B (de) | Verfahren zur Herstellung von substituierten Phenyl-alpha-aminoketonen und deren Saeureadditionssalzen bzw. deren optischen Antipoden | |
| DE1119263B (de) | Verfahren zur Herstellung neuer Sulfonylurethane | |
| DE1158499B (de) | Verfahren zur Herstellung von Isonitrilen | |
| DE2167282C2 (de) | Verfahren zur Herstellung der 7-[2-(1H-Tetrazol-1-yl)-acetamido]-3-(2-methyl-1,3,4-thiadiazol-5-yl)-thiomethyl-3-cephem-4-carbonsäure | |
| DE672435C (de) | Verfahren zur Isomerisierung des í¸5,6-Dehydroandrosterons und sich davon ableitender Verbindungen | |
| AT360019B (de) | Verfahren zur herstellung von neuen piperidin- derivaten und deren salzen |