DE1105375B - Optische Aufheller - Google Patents
Optische AufhellerInfo
- Publication number
- DE1105375B DE1105375B DEB51851A DEB0051851A DE1105375B DE 1105375 B DE1105375 B DE 1105375B DE B51851 A DEB51851 A DE B51851A DE B0051851 A DEB0051851 A DE B0051851A DE 1105375 B DE1105375 B DE 1105375B
- Authority
- DE
- Germany
- Prior art keywords
- formula
- aminostilbene
- parts
- treated
- fabric
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000003287 optical effect Effects 0.000 title claims description 8
- BIEFDNUEROKZRA-UHFFFAOYSA-N 2-(2-phenylethenyl)aniline Chemical compound NC1=CC=CC=C1C=CC1=CC=CC=C1 BIEFDNUEROKZRA-UHFFFAOYSA-N 0.000 claims description 29
- 125000003363 1,3,5-triazinyl group Chemical group N1=C(N=CN=C1)* 0.000 claims description 3
- 239000004744 fabric Substances 0.000 description 20
- 239000011734 sodium Substances 0.000 description 16
- 150000001875 compounds Chemical class 0.000 description 15
- 239000000203 mixture Substances 0.000 description 13
- 230000000694 effects Effects 0.000 description 10
- 239000000243 solution Substances 0.000 description 9
- -1 1-aza-4-thiacyclohexane-4,4-dioxide radical Chemical class 0.000 description 8
- 229920000742 Cotton Polymers 0.000 description 8
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 230000002087 whitening effect Effects 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 229920002292 Nylon 6 Polymers 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000003599 detergent Substances 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000004952 Polyamide Substances 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000005282 brightening Methods 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 150000003335 secondary amines Chemical class 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- NDOVLWQBFFJETK-UHFFFAOYSA-N 1,4-thiazinane 1,1-dioxide Chemical compound O=S1(=O)CCNCC1 NDOVLWQBFFJETK-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 240000002129 Malva sylvestris Species 0.000 description 2
- 235000006770 Malva sylvestris Nutrition 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- 235000013351 cheese Nutrition 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000013068 control sample Substances 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000001033 ether group Chemical group 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical class C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- FBAQFBBASACECK-UHFFFAOYSA-N 2-amino-6-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid Chemical compound NC1=CC=CC(C=CC=2C(=CC=CC=2)S(O)(=O)=O)=C1S(O)(=O)=O FBAQFBBASACECK-UHFFFAOYSA-N 0.000 description 1
- YTZWQUYIRHGHMJ-UHFFFAOYSA-N 3-(1,2-diamino-2-phenylethenyl)benzene-1,2-disulfonic acid Chemical compound NC(=C(C1=C(C(=CC=C1)S(=O)(=O)O)S(=O)(=O)O)N)C1=CC=CC=C1 YTZWQUYIRHGHMJ-UHFFFAOYSA-N 0.000 description 1
- BKKCHPZQDBOJLI-UHFFFAOYSA-N 3-amino-6-[2-(4-aminophenyl)ethenyl]cyclohexa-2,4-diene-1,1-disulfonic acid Chemical compound NC1=CC(C(C=C1)C=CC1=CC=C(C=C1)N)(S(=O)(=O)O)S(=O)(=O)O BKKCHPZQDBOJLI-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Natural products C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 241001085205 Prenanthella exigua Species 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 1
- OUUQCZGPVNCOIJ-UHFFFAOYSA-M Superoxide Chemical compound [O-][O] OUUQCZGPVNCOIJ-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000005013 aryl ether group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000005362 aryl sulfone group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 150000001805 chlorine compounds Chemical group 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004966 cyanoalkyl group Chemical group 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 235000021286 stilbenes Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/54—Three nitrogen atoms
- C07D251/68—Triazinylamino stilbenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Detergent Compositions (AREA)
- Paper (AREA)
- Coloring (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL127242D NL127242C (enExample) | 1959-01-24 | ||
| NL247686D NL247686A (enExample) | 1959-01-24 | ||
| DEB51851A DE1105375B (de) | 1959-01-24 | 1959-01-24 | Optische Aufheller |
| CH31560A CH366023A (de) | 1959-01-24 | 1960-01-13 | Verfahren zum optischen Aufhellen von rohen oder verarbeiteten Textilfasern |
| US3265A US3051704A (en) | 1959-01-24 | 1960-01-19 | Optical brightening agents of the 4, 4'-bis-(triazinylamino)-stilbene disulfonic acid series |
| BE586775A BE586775A (fr) | 1959-01-24 | 1960-01-20 | Agents d'azurage optique. |
| GB2193/60A GB908229A (en) | 1959-01-24 | 1960-01-21 | Bis-(triazinylamino)-stilbene disulphonic acid brightening agents |
| FR816257A FR1245962A (fr) | 1959-01-24 | 1960-01-21 | Agents d'azurage optique |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB51851A DE1105375B (de) | 1959-01-24 | 1959-01-24 | Optische Aufheller |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1105375B true DE1105375B (de) | 1961-04-27 |
Family
ID=6969686
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEB51851A Pending DE1105375B (de) | 1959-01-24 | 1959-01-24 | Optische Aufheller |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3051704A (enExample) |
| BE (1) | BE586775A (enExample) |
| CH (1) | CH366023A (enExample) |
| DE (1) | DE1105375B (enExample) |
| FR (1) | FR1245962A (enExample) |
| GB (1) | GB908229A (enExample) |
| NL (2) | NL127242C (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH386436A (de) * | 1960-07-28 | 1965-01-15 | Geigy Ag J R | Verfahren zur Herstellung von Bis-triazinylaminostilbenverbindungen |
| DE1200531B (de) * | 1963-12-06 | 1965-09-09 | Basf Ag | Verfahren zum Herstellen hochelastischer Formkoerper aus isocyanatmodifizierten Polyhydroxylverbindungen |
| NL126746C (enExample) * | 1964-11-20 | |||
| US3508858A (en) * | 1966-01-11 | 1970-04-28 | Bemberg Spa | Process and product for improving the textile characteristics of natural and synthetic fibers and fibers obtained thereby |
| CH597204A5 (enExample) * | 1973-02-16 | 1978-03-31 | Sandoz Ag | |
| RU2413719C2 (ru) * | 2008-11-28 | 2011-03-10 | Альбина Ивановна Леонтьева | Способ получения белофора кд-2 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2666052A (en) * | 1954-01-12 | Triazine fluorescent agents | ||
| BE490716A (enExample) * | 1948-08-24 | |||
| US2658065A (en) * | 1950-08-10 | 1953-11-03 | Gen Aniline & Film Corp | Triazine fluorescent agents |
-
0
- NL NL247686D patent/NL247686A/xx unknown
- NL NL127242D patent/NL127242C/xx active
-
1959
- 1959-01-24 DE DEB51851A patent/DE1105375B/de active Pending
-
1960
- 1960-01-13 CH CH31560A patent/CH366023A/de unknown
- 1960-01-19 US US3265A patent/US3051704A/en not_active Expired - Lifetime
- 1960-01-20 BE BE586775A patent/BE586775A/fr unknown
- 1960-01-21 GB GB2193/60A patent/GB908229A/en not_active Expired
- 1960-01-21 FR FR816257A patent/FR1245962A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL127242C (enExample) | |
| US3051704A (en) | 1962-08-28 |
| NL247686A (enExample) | |
| GB908229A (en) | 1962-10-17 |
| FR1245962A (fr) | 1960-11-10 |
| BE586775A (fr) | 1960-05-16 |
| CH366023A (de) | 1962-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1795047C3 (de) | Bis-s- triazinylamino-stilben-2,2'disulfonsäuren | |
| DE2726432A1 (de) | Verfahren zur verbesserung der farbausbeute und der echtheiten von mit anionischen farbstoffen auf cellulosefasermaterial erzeugten faerbungen, fluorhaltige verbindungen und ihre herstellung | |
| DE1963065A1 (de) | Neue Bis-(triazinylamino)-stilbene | |
| DE1105375B (de) | Optische Aufheller | |
| DE1594822B1 (de) | Optische Aufhellmittel | |
| CH668774A5 (de) | Selbstschmierende antifriktionskomposition. | |
| DE1545920A1 (de) | Verfahren zur Herstellung optischer Aufheller der Stilbenreihe | |
| DE2459393C3 (de) | Mittel zum Flammfestmachen von synthetischem Fasermaterial aus Polyester oder Polyamid | |
| AT215944B (de) | Optisch aufhellende Stoffe | |
| DE2921641C2 (enExample) | ||
| EP0011824A1 (de) | Benzofuranyl-benzimidazole, Verfahren zu ihrer Herstellung sowie ihre Verwendung zum optischen Aufhellen von organischen Materialien | |
| DE1114162B (de) | Aufheller | |
| DE1469218B1 (de) | 4,4'-Bis-triazinylamino-stilbenverbindungen und ihre Verwendung als reaktive optischeAufhellungsmittel | |
| CH366050A (de) | Verfahren zur Herstellung neuer organischer Verbindungen | |
| EP0344776B1 (de) | Benzofuranylbiphenyle | |
| DE1802642A1 (de) | Fluoreszierende 1-(Pyrazolinylphenylsulfonyl)-piperazine | |
| DE1469218C (de) | 4,4 Bis triazinylamino stilbenver bmdungen und ihre Verwendung als reaktive optische Aufhetlungsmittel | |
| DE2325582A1 (de) | Neue bis-(triazinylamino)-stilbendisulfosaeure-derivate | |
| DE1444023C3 (de) | Substituierte 4,4'-Bis-(4,6diamino- s-triazin-2-y lamino)- sti lben-2,2'-disulfonsäuren, Verfahren zu ihrer Herstellung und ihre Verwendung als Aufheller | |
| DE1237525B (de) | Optischer Aufheller | |
| DE2727776A1 (de) | Verfahren zum flammfestmachen von polyesterfasermaterialien mit substituierten sulfurylamiden | |
| DE1719005C3 (de) | 2-(4'-Carboxystyryl)-benzoxazolderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als optische Aufheller | |
| DE2166632C3 (de) | Verwendung quatemierter Benzofuranylbenzimldazole als optische Aufhellungsmittel | |
| DE2261062A1 (de) | Phenylstilbentriazolverbindungen | |
| DE1108655B (de) | Optische Aufhellmittel |