DE1069755B - - Google Patents
Info
- Publication number
- DE1069755B DE1069755B DENDAT1069755D DE1069755DA DE1069755B DE 1069755 B DE1069755 B DE 1069755B DE NDAT1069755 D DENDAT1069755 D DE NDAT1069755D DE 1069755D A DE1069755D A DE 1069755DA DE 1069755 B DE1069755 B DE 1069755B
- Authority
- DE
- Germany
- Prior art keywords
- magnetic field
- resistance
- voltage divider
- dependent
- sections
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000001419 dependent effect Effects 0.000 claims description 12
- 230000008859 change Effects 0.000 claims description 4
- WPYVAWXEWQSOGY-UHFFFAOYSA-N indium antimonide Chemical compound [Sb]#[In] WPYVAWXEWQSOGY-UHFFFAOYSA-N 0.000 claims description 2
- 238000004321 preservation Methods 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- BGPVFRJUHWVFKM-UHFFFAOYSA-N N1=C2C=CC=CC2=[N+]([O-])C1(CC1)CCC21N=C1C=CC=CC1=[N+]2[O-] Chemical compound N1=C2C=CC=CC2=[N+]([O-])C1(CC1)CCC21N=C1C=CC=CC1=[N+]2[O-] BGPVFRJUHWVFKM-UHFFFAOYSA-N 0.000 description 3
- 229910052797 bismuth Inorganic materials 0.000 description 2
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000009471 action Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03H—IMPEDANCE NETWORKS, e.g. RESONANT CIRCUITS; RESONATORS
- H03H7/00—Multiple-port networks comprising only passive electrical elements as network components
- H03H7/24—Frequency- independent attenuators
- H03H7/25—Frequency- independent attenuators comprising an element controlled by an electric or magnetic variable
- H03H7/258—Frequency- independent attenuators comprising an element controlled by an electric or magnetic variable using a galvano-magnetic device
Landscapes
- Adjustable Resistors (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1069755B true DE1069755B (cg-RX-API-DMAC10.html) | 1959-11-26 |
Family
ID=594803
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1069755D Pending DE1069755B (cg-RX-API-DMAC10.html) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE1069755B (cg-RX-API-DMAC10.html) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1222986B (de) * | 1962-07-31 | 1966-08-18 | Siemens Ag | Einstellbare Entzerrerschaltung |
| US3281749A (en) * | 1963-12-14 | 1966-10-25 | Siemens Ag | Temperature-responsive current control device |
| DE1256707B (de) * | 1962-07-31 | 1967-12-21 | Siemens Ag | Einstellbare Entzerrerschaltung nach Art eines Bode-Entzerrers |
| DE1276132B (de) * | 1964-07-06 | 1968-08-29 | Siemens Ag | Elektrisches UEbertragungsglied nach Art eines Vierpols mit amplitudenabhaengigem UEbertragungsmass |
| DE1623843B1 (de) * | 1967-11-02 | 1970-08-27 | Siemens Ag | Messumformer |
| US3835377A (en) * | 1970-03-09 | 1974-09-10 | Kogyo Gijutsuin | Three terminal magnetoresistive magnetic field detector in which voltages of opposite polarity relative to ground are applied to opposite ends |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE590678C (de) * | 1931-09-15 | 1934-01-08 | Reinhold Bauder Dipl Ing | Zelle zum Messen der Feldstaerke bzw. Induktion magnetischer Felder |
| GB659653A (en) * | 1949-06-01 | 1951-10-24 | British Thomson Houston Co Ltd | Improvements relating to the measurement of magnetic field strength by the use of a material exhibiting the "hall" effect |
| DE839220C (de) * | 1949-04-06 | 1952-05-19 | Walter Von Dipl-Ing Sauer | Widerstandsfeinregler |
| US2599550A (en) * | 1949-04-27 | 1952-06-10 | Fraser Robert | Fluxmeter and probe therefor |
-
0
- DE DENDAT1069755D patent/DE1069755B/de active Pending
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE590678C (de) * | 1931-09-15 | 1934-01-08 | Reinhold Bauder Dipl Ing | Zelle zum Messen der Feldstaerke bzw. Induktion magnetischer Felder |
| DE839220C (de) * | 1949-04-06 | 1952-05-19 | Walter Von Dipl-Ing Sauer | Widerstandsfeinregler |
| US2599550A (en) * | 1949-04-27 | 1952-06-10 | Fraser Robert | Fluxmeter and probe therefor |
| GB659653A (en) * | 1949-06-01 | 1951-10-24 | British Thomson Houston Co Ltd | Improvements relating to the measurement of magnetic field strength by the use of a material exhibiting the "hall" effect |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1222986B (de) * | 1962-07-31 | 1966-08-18 | Siemens Ag | Einstellbare Entzerrerschaltung |
| DE1256707B (de) * | 1962-07-31 | 1967-12-21 | Siemens Ag | Einstellbare Entzerrerschaltung nach Art eines Bode-Entzerrers |
| US3281749A (en) * | 1963-12-14 | 1966-10-25 | Siemens Ag | Temperature-responsive current control device |
| DE1276132B (de) * | 1964-07-06 | 1968-08-29 | Siemens Ag | Elektrisches UEbertragungsglied nach Art eines Vierpols mit amplitudenabhaengigem UEbertragungsmass |
| DE1623843B1 (de) * | 1967-11-02 | 1970-08-27 | Siemens Ag | Messumformer |
| US3835377A (en) * | 1970-03-09 | 1974-09-10 | Kogyo Gijutsuin | Three terminal magnetoresistive magnetic field detector in which voltages of opposite polarity relative to ground are applied to opposite ends |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1202830B (de) | Elektronisches Schaltgeraet, bestehend aus zwei Transistoren, deren Emitter-Kollektor-Strecken gegensinnig in Reihe geschaltet sind | |
| DE1299729B (de) | Schaltungsanordnung zum Einstellen des Verstaerkungsgrades einer Verstaerkeranordnung mit einem Differentialverstaerker | |
| DE1043479B (de) | Elektrisches Relaisschutzsystem | |
| DE2325752B2 (de) | Einrichtung zur Umformung eines Wegs in eine elektrische Größe | |
| DE1069755B (cg-RX-API-DMAC10.html) | ||
| DE1184798B (de) | Selbsthaltender Schaltkreis | |
| DE1257201B (de) | Elektronischer Schalter | |
| DE1040079B (de) | Anordnung zur Rueckkopplung von eine magnetflusserzeugende Einrichtung enthaltenden elektrischen Stromkreisen | |
| AT165941B (de) | Kompensator zur Messung elektrischer Spannungen | |
| DE728196C (de) | Vorrichtung zum Gleichhalten von mechanischen Schwingungsausschlaegen, insbesondere bei Materialpruefmaschinen | |
| AT167088B (de) | Kompensator zur Messung elektrischer Spannungen | |
| DE1180846B (de) | Wechselstromgespeistes elektro-magnetisches Relais | |
| DE743450C (de) | Roehren-Kipprelais-Anordnung in einer Gleichstrom-Rueckkopplungsschaltung fuer Kurzzeitmessungen | |
| DE1763031B2 (de) | Schaltungsanordnung zur Speisung eines Verbrauchers mit konstantem Strom | |
| DE1182288B (de) | Schaltungsanordnung zur Einstellung der Ampitude einer von einem Pulsgenerator erzeugten Pulsspannung | |
| DE3016354C2 (cg-RX-API-DMAC10.html) | ||
| DE818535C (de) | Mechanischer Wechselrichter | |
| DE2337691C3 (de) | Widerstandsanordnung mit einer als ohmschen Widerstand dienenden Feldplatte | |
| DE1129529B (de) | Schaltungsanordnung zur Erzeugung von Impulsen wechselnder Polaritaet | |
| DE1208396B (de) | Elektrische Schaltung zur Steuerung des einem Verbraucher zugefuehrten Stromes | |
| DE1790236A1 (de) | Schleifkontaktloser veraenderbarer Spannungsteiler | |
| DE1178113B (de) | Bistabile Schaltung | |
| DE3151082A1 (de) | Schaltungsanordnung zur erweiterung des linearitaetsbereiches eines steuerbaren widerstandes | |
| DE1177471B (de) | Elektromagnetischer Blendenverschluss | |
| DE1512353B2 (de) | Dreieckspannungsgenerator |