DE1053930B - Lichtempfindliches Material fuer die Herstellung von Druckplatten auf photomechanischem Wege - Google Patents
Lichtempfindliches Material fuer die Herstellung von Druckplatten auf photomechanischem WegeInfo
- Publication number
- DE1053930B DE1053930B DEK32598A DEK0032598A DE1053930B DE 1053930 B DE1053930 B DE 1053930B DE K32598 A DEK32598 A DE K32598A DE K0032598 A DEK0032598 A DE K0032598A DE 1053930 B DE1053930 B DE 1053930B
- Authority
- DE
- Germany
- Prior art keywords
- parts
- resin
- water
- weight
- ecm
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000463 material Substances 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 229920005989 resin Polymers 0.000 claims description 38
- 239000011347 resin Substances 0.000 claims description 38
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 29
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 28
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 claims description 25
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 18
- 239000001488 sodium phosphate Substances 0.000 claims description 15
- 239000007795 chemical reaction product Substances 0.000 claims description 13
- 229940106681 chloroacetic acid Drugs 0.000 claims description 13
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 claims description 11
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 10
- 239000011888 foil Substances 0.000 claims description 10
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 10
- 229910052782 aluminium Inorganic materials 0.000 claims description 9
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 9
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 9
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 claims description 9
- 229910000406 trisodium phosphate Inorganic materials 0.000 claims description 9
- 235000019801 trisodium phosphate Nutrition 0.000 claims description 9
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 claims description 8
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 8
- 235000011121 sodium hydroxide Nutrition 0.000 claims description 8
- 229920001577 copolymer Polymers 0.000 claims description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 claims description 6
- 229910000397 disodium phosphate Inorganic materials 0.000 claims description 6
- 235000019800 disodium phosphate Nutrition 0.000 claims description 6
- 238000006266 etherification reaction Methods 0.000 claims description 6
- 239000000047 product Substances 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 5
- -1 phenol aldehyde Chemical class 0.000 claims description 5
- 239000011541 reaction mixture Substances 0.000 claims description 5
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 238000007334 copolymerization reaction Methods 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 239000003973 paint Substances 0.000 claims description 4
- FDRCDNZGSXJAFP-UHFFFAOYSA-M sodium chloroacetate Chemical compound [Na+].[O-]C(=O)CCl FDRCDNZGSXJAFP-UHFFFAOYSA-M 0.000 claims description 4
- MDKVDJZIHRFUBO-UHFFFAOYSA-N 2-amino-3-benzoyl-4-(2-benzoylphenyl)iminocyclohexa-2,5-dien-1-one Chemical compound C1=CC=C(C=C1)C(=O)C2=CC=CC=C2N=C3C=CC(=O)C(=C3C(=O)C4=CC=CC=C4)N MDKVDJZIHRFUBO-UHFFFAOYSA-N 0.000 claims description 3
- 238000001035 drying Methods 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims 8
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims 4
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 claims 4
- 239000007787 solid Substances 0.000 claims 3
- 238000003756 stirring Methods 0.000 claims 3
- NKTOLZVEWDHZMU-UHFFFAOYSA-N 2,5-xylenol Chemical compound CC1=CC=C(C)C(O)=C1 NKTOLZVEWDHZMU-UHFFFAOYSA-N 0.000 claims 2
- 229920000084 Gum arabic Polymers 0.000 claims 2
- 241000978776 Senegalia senegal Species 0.000 claims 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims 2
- 239000000205 acacia gum Substances 0.000 claims 2
- 235000010489 acacia gum Nutrition 0.000 claims 2
- 239000000908 ammonium hydroxide Substances 0.000 claims 2
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 claims 2
- WUHMTAAQHHGPNT-UHFFFAOYSA-N 2,5-dimethylphenol;formaldehyde Chemical compound O=C.CC1=CC=C(C)C(O)=C1 WUHMTAAQHHGPNT-UHFFFAOYSA-N 0.000 claims 1
- NMFFUUFPJJOWHK-UHFFFAOYSA-N 2-phenoxyaniline Chemical compound NC1=CC=CC=C1OC1=CC=CC=C1 NMFFUUFPJJOWHK-UHFFFAOYSA-N 0.000 claims 1
- 229910019142 PO4 Inorganic materials 0.000 claims 1
- RSWGJHLUYNHPMX-ONCXSQPRSA-N abietic acid Chemical compound C([C@@H]12)CC(C(C)C)=CC1=CC[C@@H]1[C@]2(C)CCC[C@@]1(C)C(O)=O RSWGJHLUYNHPMX-ONCXSQPRSA-N 0.000 claims 1
- 230000002378 acidificating effect Effects 0.000 claims 1
- PLYXUQXNXRDVGX-UHFFFAOYSA-N furan-2-carbaldehyde;2-methylphenol Chemical compound O=CC1=CC=CO1.CC1=CC=CC=C1O PLYXUQXNXRDVGX-UHFFFAOYSA-N 0.000 claims 1
- 229920005546 furfural resin Polymers 0.000 claims 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims 1
- 239000010452 phosphate Substances 0.000 claims 1
- 239000002244 precipitate Substances 0.000 claims 1
- 238000010992 reflux Methods 0.000 claims 1
- 239000000243 solution Substances 0.000 description 20
- 229920003986 novolac Polymers 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 3
- 150000002790 naphthalenes Chemical class 0.000 description 3
- 239000012670 alkaline solution Substances 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- HGAZMNJKRQFZKS-UHFFFAOYSA-N chloroethene;ethenyl acetate Chemical compound ClC=C.CC(=O)OC=C HGAZMNJKRQFZKS-UHFFFAOYSA-N 0.000 description 2
- 239000012084 conversion product Substances 0.000 description 2
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229920001568 phenolic resin Polymers 0.000 description 2
- 239000005011 phenolic resin Substances 0.000 description 2
- ATACSYDDCNWCLV-UHFFFAOYSA-N 2-chloroacetic acid;sodium Chemical compound [Na].OC(=O)CCl ATACSYDDCNWCLV-UHFFFAOYSA-N 0.000 description 1
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000318 alkali metal phosphate Inorganic materials 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 150000004054 benzoquinones Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- CXHHBNMLPJOKQD-UHFFFAOYSA-N methyl hydrogen carbonate Chemical class COC(O)=O CXHHBNMLPJOKQD-UHFFFAOYSA-N 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03F—PHOTOMECHANICAL PRODUCTION OF TEXTURED OR PATTERNED SURFACES, e.g. FOR PRINTING, FOR PROCESSING OF SEMICONDUCTOR DEVICES; MATERIALS THEREFOR; ORIGINALS THEREFOR; APPARATUS SPECIALLY ADAPTED THEREFOR
- G03F7/00—Photomechanical, e.g. photolithographic, production of textured or patterned surfaces, e.g. printing surfaces; Materials therefor, e.g. comprising photoresists; Apparatus specially adapted therefor
- G03F7/004—Photosensitive materials
- G03F7/022—Quinonediazides
- G03F7/023—Macromolecular quinonediazides; Macromolecular additives, e.g. binders
- G03F7/0233—Macromolecular quinonediazides; Macromolecular additives, e.g. binders characterised by the polymeric binders or the macromolecular additives other than the macromolecular quinonediazides
Landscapes
- Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- General Physics & Mathematics (AREA)
- Printing Plates And Materials Therefor (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
- Phenolic Resins Or Amino Resins (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL103895D NL103895C (enExample) | 1957-08-01 | ||
| BE569763D BE569763A (enExample) | 1957-08-01 | ||
| NL230099D NL230099A (enExample) | 1957-08-01 | ||
| DEK32598A DE1053930B (de) | 1957-08-01 | 1957-08-01 | Lichtempfindliches Material fuer die Herstellung von Druckplatten auf photomechanischem Wege |
| CH6171958A CH370967A (de) | 1957-08-01 | 1958-07-14 | Lichtempfindliches Material |
| SE6910/58A SE310842B (enExample) | 1957-08-01 | 1958-07-22 | |
| US751112A US3050387A (en) | 1957-08-01 | 1958-07-28 | Light-sensitive material |
| GB24189/58A GB836341A (en) | 1957-08-01 | 1958-07-28 | Light-sensitive material for photo-meí¡í¡ |
| FR1210042D FR1210042A (fr) | 1957-08-01 | 1958-07-28 | Matériel photo-sensible |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK32598A DE1053930B (de) | 1957-08-01 | 1957-08-01 | Lichtempfindliches Material fuer die Herstellung von Druckplatten auf photomechanischem Wege |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1053930B true DE1053930B (de) | 1959-03-26 |
Family
ID=7219491
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEK32598A Pending DE1053930B (de) | 1957-08-01 | 1957-08-01 | Lichtempfindliches Material fuer die Herstellung von Druckplatten auf photomechanischem Wege |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3050387A (enExample) |
| BE (1) | BE569763A (enExample) |
| CH (1) | CH370967A (enExample) |
| DE (1) | DE1053930B (enExample) |
| FR (1) | FR1210042A (enExample) |
| GB (1) | GB836341A (enExample) |
| NL (2) | NL230099A (enExample) |
| SE (1) | SE310842B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1134887B (de) * | 1959-07-29 | 1962-08-16 | Kalle Ag | Kopierschichten zur Herstellung von Druckformen auf photomechanischem Wege |
| DE1195166B (de) * | 1959-09-04 | 1965-06-16 | Kalle Ag | Auf Metallunterlagen haftende, aetzfaehige Kopierschichten |
| DE1254466B (de) * | 1961-01-25 | 1967-11-16 | Kalle Ag | Kopiermaterial fuer die photomechanische Herstellung von Druckformen und Verfahren zur Herstellung von Druckformen |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3149972A (en) * | 1960-08-16 | 1964-09-22 | Gen Aniline & Film Corp | Diazo and resinous coupler printing plates for photomechanical reproduction |
| NL280959A (enExample) * | 1961-07-28 | |||
| DE3107109A1 (de) * | 1981-02-26 | 1982-09-09 | Hoechst Ag, 6000 Frankfurt | Lichtempfindliches gemisch und daraus hergestelltes kopiermaterial |
| US4564575A (en) * | 1984-01-30 | 1986-01-14 | International Business Machines Corporation | Tailoring of novolak and diazoquinone positive resists by acylation of novolak |
| DE58908411D1 (de) * | 1989-03-20 | 1994-10-27 | Siemens Ag | Hochauflösender Photoresist. |
| DE58908699D1 (de) * | 1989-03-20 | 1995-01-12 | Siemens Ag | Verfahren zum Erzeugen einer Photoresiststruktur. |
| US5212042A (en) * | 1989-08-22 | 1993-05-18 | Fuji Photo Film Co., Ltd. | Positive type light-sensitive composition |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1981102A (en) * | 1932-08-10 | 1934-11-20 | Agfa Ansco Corp | Photographic material and process of making the same |
| CH307356A (de) * | 1951-08-08 | 1955-05-31 | Kalle & Co Ag | Lichtempfindliches Material für die photomechanische Reproduktion. |
| US2754209A (en) * | 1952-06-10 | 1956-07-10 | Azoplate Corp | Light-sensitive para quinone diazides for making printing plates |
| NL94867C (enExample) * | 1955-02-25 | |||
| DE1003576B (de) * | 1955-02-25 | 1957-02-28 | Kalle & Co Ag | Aus Schichttraeger und lichtempfindlicher, wasserloeslicher oder wasserquellbarer Kolloidschicht bestehendes Material fuer die Herstellung von Gerbbildern |
-
0
- BE BE569763D patent/BE569763A/xx unknown
- NL NL103895D patent/NL103895C/xx active
- NL NL230099D patent/NL230099A/xx unknown
-
1957
- 1957-08-01 DE DEK32598A patent/DE1053930B/de active Pending
-
1958
- 1958-07-14 CH CH6171958A patent/CH370967A/de unknown
- 1958-07-22 SE SE6910/58A patent/SE310842B/xx unknown
- 1958-07-28 FR FR1210042D patent/FR1210042A/fr not_active Expired
- 1958-07-28 US US751112A patent/US3050387A/en not_active Expired - Lifetime
- 1958-07-28 GB GB24189/58A patent/GB836341A/en not_active Expired
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1134887B (de) * | 1959-07-29 | 1962-08-16 | Kalle Ag | Kopierschichten zur Herstellung von Druckformen auf photomechanischem Wege |
| DE1195166B (de) * | 1959-09-04 | 1965-06-16 | Kalle Ag | Auf Metallunterlagen haftende, aetzfaehige Kopierschichten |
| DE1254466B (de) * | 1961-01-25 | 1967-11-16 | Kalle Ag | Kopiermaterial fuer die photomechanische Herstellung von Druckformen und Verfahren zur Herstellung von Druckformen |
Also Published As
| Publication number | Publication date |
|---|---|
| SE310842B (enExample) | 1969-05-12 |
| GB836341A (en) | 1960-06-01 |
| NL103895C (enExample) | |
| BE569763A (enExample) | |
| CH370967A (de) | 1963-07-31 |
| FR1210042A (fr) | 1960-03-04 |
| NL230099A (enExample) | |
| US3050387A (en) | 1962-08-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE865860C (de) | Lichtempfindliche Schichten fuer die photomechanische Reproduktion | |
| DE2064079C2 (de) | Photopolymerisierbares Gemisch | |
| DE2150691C2 (de) | Lichtempfindliches Gemisch und Verwendung eines lichtempfindlichen Gemisches zur Herstellung einer Flachdruckplatte | |
| DE2147947C2 (de) | Lichtempfindliches Gemisch | |
| DE2024243B2 (de) | Verfahren zur Herstellung Diazoniumgruppen enthaltender, lichtempfindlicher Kondensationsprodukte und diese Kondensationsprodukte enthaltendes lichtempfindliches Kopiermaterial | |
| DE2352139A1 (de) | Lichtempfindliche masse | |
| DE3009873A1 (de) | Photoempfindliche masse | |
| EP0135026B1 (de) | Lichthärtbares Gemisch und daraus hergestelltes lichtempfindliches Aufzeichnungsmaterial | |
| DE1422474B2 (de) | Lichtempfindliches Gemisch | |
| DE1120273B (de) | Lichtempfindliche Schichten fuer die photomechanische Herstellung von Druckformen | |
| DE1807644A1 (de) | Verwendung von lichtempfindlichen,filmbildenden Polymerisaten aus Aminostyrolen zur Herstellung von lichtempfindlichen Schichten lichtempfindlicher Aufzeichnungsmaterialien | |
| DE1254466B (de) | Kopiermaterial fuer die photomechanische Herstellung von Druckformen und Verfahren zur Herstellung von Druckformen | |
| DE2616992C3 (de) | Lichtempfindliches Kopiermaterial zur Herstellung von Reliefs | |
| DE1114705C2 (de) | Lichtempfindliche Schichten fuer die photomechanische Herstellung von Druckformen | |
| DE2065732C2 (de) | Lichtempfindliches Aufzeichnungsmaterial | |
| DE1053930B (de) | Lichtempfindliches Material fuer die Herstellung von Druckplatten auf photomechanischem Wege | |
| DE2124047A1 (de) | Photosensitive Polymere, Verfahren zur Herstellung derselben und diese Polymeren enthaltende Zusammensetzungen | |
| DE918848C (de) | Unter Verwendung von Diazoverbindungen hergestelltes lichtempfindliches Material | |
| DE3123752A1 (de) | Lichtempfindliches gemisch auf basis von 1,2-naphthochinon-diaziden und daraus hergestelltes kopiermaterial | |
| DE69620556T2 (de) | Wässrig entwickelbare, negativ arbeitende, fotoempfindliche Zusammensetzung mit verbessertem Bildkontrast | |
| DE2065733C2 (de) | Lichtempfindliches Aufzeichnungsmaterial | |
| DE1224147B (de) | Verfahren zur Umkehrentwicklung von Diazo-verbindungen enthaltenden Kopierschichten | |
| DE2245433B2 (de) | Lichtempfindliches Gemisch | |
| AT205986B (de) | Lichtempfindliches Material | |
| DE3124936A1 (de) | Lichtempfindliches gemisch auf basis von o-naphthochinondiaziden und daraus hergestelltes lichtempfindliches kopiermaterial |