DE1035398B - Mittel zur Beeinflussung des Pflanzenwachstums - Google Patents
Mittel zur Beeinflussung des PflanzenwachstumsInfo
- Publication number
- DE1035398B DE1035398B DEG21138A DEG0021138A DE1035398B DE 1035398 B DE1035398 B DE 1035398B DE G21138 A DEG21138 A DE G21138A DE G0021138 A DEG0021138 A DE G0021138A DE 1035398 B DE1035398 B DE 1035398B
- Authority
- DE
- Germany
- Prior art keywords
- chloro
- pyrimidine
- bis
- groups
- ethylamino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000008635 plant growth Effects 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title description 4
- -1 alkyl radicals Chemical class 0.000 claims description 10
- 239000000969 carrier Substances 0.000 claims description 4
- 230000002401 inhibitory effect Effects 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- WCZVZNOTHYJIEI-UHFFFAOYSA-N cinnoline Chemical class N1=NC=CC2=CC=CC=C21 WCZVZNOTHYJIEI-UHFFFAOYSA-N 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 150000004891 diazines Chemical class 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 2
- 125000006323 alkenyl amino group Chemical group 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 description 10
- 241000196324 Embryophyta Species 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 8
- 240000002024 Gossypium herbaceum Species 0.000 description 6
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 239000000839 emulsion Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000007921 spray Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- DPVIABCMTHHTGB-UHFFFAOYSA-N 2,4,6-trichloropyrimidine Chemical compound ClC1=CC(Cl)=NC(Cl)=N1 DPVIABCMTHHTGB-UHFFFAOYSA-N 0.000 description 4
- 235000007319 Avena orientalis Nutrition 0.000 description 4
- 241000219198 Brassica Species 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000013543 active substance Substances 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- 239000000080 wetting agent Substances 0.000 description 4
- AQUPHFTUIGINQN-UHFFFAOYSA-N 3-chloro-n-ethylquinoxalin-2-amine Chemical compound C1=CC=C2N=C(Cl)C(NCC)=NC2=C1 AQUPHFTUIGINQN-UHFFFAOYSA-N 0.000 description 3
- DBPKMSBWOKAKLA-UHFFFAOYSA-N 4-chloropyrimidine Chemical compound ClC1=CC=NC=N1 DBPKMSBWOKAKLA-UHFFFAOYSA-N 0.000 description 3
- 244000075850 Avena orientalis Species 0.000 description 3
- 235000007558 Avena sp Nutrition 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 235000003351 Brassica cretica Nutrition 0.000 description 3
- 235000003343 Brassica rupestris Nutrition 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 3
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000000428 dust Substances 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 230000002147 killing effect Effects 0.000 description 3
- 235000010460 mustard Nutrition 0.000 description 3
- GBDJCFNRYXQSGW-UHFFFAOYSA-N n,n-diethylquinazolin-4-amine Chemical compound C1=CC=C2C(N(CC)CC)=NC=NC2=C1 GBDJCFNRYXQSGW-UHFFFAOYSA-N 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- LYULECFELHWXDR-UHFFFAOYSA-N 2,4-diethoxy-6-methylpyrimidine Chemical compound CCOC1=CC(C)=NC(OCC)=N1 LYULECFELHWXDR-UHFFFAOYSA-N 0.000 description 2
- CMHRCTUAQQYJFU-UHFFFAOYSA-N 6-chloro-2-n,2-n,4-n,4-n-tetraethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=CC(Cl)=NC(N(CC)CC)=N1 CMHRCTUAQQYJFU-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 2
- 235000011130 ammonium sulphate Nutrition 0.000 description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 230000035613 defoliation Effects 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- MCYBHXLJGJKIIU-UHFFFAOYSA-N n-ethylquinazolin-4-amine Chemical compound C1=CC=C2C(NCC)=NC=NC2=C1 MCYBHXLJGJKIIU-UHFFFAOYSA-N 0.000 description 2
- NMGFYKOSVIFRBE-UHFFFAOYSA-N n-ethylquinoxalin-2-amine Chemical compound C1=CC=CC2=NC(NCC)=CN=C21 NMGFYKOSVIFRBE-UHFFFAOYSA-N 0.000 description 2
- 230000002028 premature Effects 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 238000009331 sowing Methods 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- ODCNAEMHGMYADO-UHFFFAOYSA-N 1,4-dichlorophthalazine Chemical compound C1=CC=C2C(Cl)=NN=C(Cl)C2=C1 ODCNAEMHGMYADO-UHFFFAOYSA-N 0.000 description 1
- XHZOHQFFKAOCSU-UHFFFAOYSA-N 1,4-dimethoxyphthalazine Chemical compound C1=CC=C2C(OC)=NN=C(OC)C2=C1 XHZOHQFFKAOCSU-UHFFFAOYSA-N 0.000 description 1
- GWYZIDACSVOFQB-UHFFFAOYSA-N 1-chloro-4-methoxyphthalazine Chemical compound C1=CC=C2C(OC)=NN=C(Cl)C2=C1 GWYZIDACSVOFQB-UHFFFAOYSA-N 0.000 description 1
- TUYGKDDXRSSYPJ-UHFFFAOYSA-N 1-ethylsulfanylphthalazine Chemical compound C1=CC=C2C(SCC)=NN=CC2=C1 TUYGKDDXRSSYPJ-UHFFFAOYSA-N 0.000 description 1
- CRAYFGFTLBTRRS-UHFFFAOYSA-N 2,3-dimethoxyquinoxaline Chemical compound C1=CC=C2N=C(OC)C(OC)=NC2=C1 CRAYFGFTLBTRRS-UHFFFAOYSA-N 0.000 description 1
- VTSWSQGDJQFXHB-UHFFFAOYSA-N 2,4,6-trichloro-5-methylpyrimidine Chemical compound CC1=C(Cl)N=C(Cl)N=C1Cl VTSWSQGDJQFXHB-UHFFFAOYSA-N 0.000 description 1
- RJVAFLZWVUIBOU-UHFFFAOYSA-N 2,4,6-trimethoxypyrimidine Chemical compound COC1=CC(OC)=NC(OC)=N1 RJVAFLZWVUIBOU-UHFFFAOYSA-N 0.000 description 1
- ZTISACKWPCLLCJ-UHFFFAOYSA-N 2,4-bis(methylsulfanyl)quinazoline Chemical compound C1=CC=CC2=NC(SC)=NC(SC)=C21 ZTISACKWPCLLCJ-UHFFFAOYSA-N 0.000 description 1
- BTLKROSJMNFSQZ-UHFFFAOYSA-N 2,4-dichloro-6-methylpyrimidine Chemical compound CC1=CC(Cl)=NC(Cl)=N1 BTLKROSJMNFSQZ-UHFFFAOYSA-N 0.000 description 1
- PMCOWOCKUQWYRL-UHFFFAOYSA-N 2,4-dimethylpyrimidine Chemical compound CC1=CC=NC(C)=N1 PMCOWOCKUQWYRL-UHFFFAOYSA-N 0.000 description 1
- LSEAAPGIZCDEEH-UHFFFAOYSA-N 2,6-dichloropyrazine Chemical compound ClC1=CN=CC(Cl)=N1 LSEAAPGIZCDEEH-UHFFFAOYSA-N 0.000 description 1
- BJJDXAFKCKSLTE-UHFFFAOYSA-N 2,6-dimethylpyrimidin-4-amine Chemical compound CC1=CC(N)=NC(C)=N1 BJJDXAFKCKSLTE-UHFFFAOYSA-N 0.000 description 1
- SXCYPUDQWGUNHG-UHFFFAOYSA-N 2-chloro-3-ethoxyquinoxaline Chemical compound C1=CC=C2N=C(Cl)C(OCC)=NC2=C1 SXCYPUDQWGUNHG-UHFFFAOYSA-N 0.000 description 1
- BHAKRVSCGILCEW-UHFFFAOYSA-N 2-chloro-4-methylpyrimidine Chemical compound CC1=CC=NC(Cl)=N1 BHAKRVSCGILCEW-UHFFFAOYSA-N 0.000 description 1
- PFEIMKNQOIFKSW-UHFFFAOYSA-N 2-chloro-4-methylquinoline Chemical compound C1=CC=C2C(C)=CC(Cl)=NC2=C1 PFEIMKNQOIFKSW-UHFFFAOYSA-N 0.000 description 1
- ICFXJGYFOYFDBO-UHFFFAOYSA-N 2-chloro-n,n-diethyl-6-methylpyrimidin-4-amine Chemical compound CCN(CC)C1=CC(C)=NC(Cl)=N1 ICFXJGYFOYFDBO-UHFFFAOYSA-N 0.000 description 1
- YFIGAAOCPBNSER-UHFFFAOYSA-N 2-chloro-n-ethylquinazolin-4-amine Chemical compound C1=CC=C2C(NCC)=NC(Cl)=NC2=C1 YFIGAAOCPBNSER-UHFFFAOYSA-N 0.000 description 1
- GELVZYOEQVJIRR-UHFFFAOYSA-N 2-chloropyrazine Chemical compound ClC1=CN=CC=N1 GELVZYOEQVJIRR-UHFFFAOYSA-N 0.000 description 1
- BYHVGQHIAFURIL-UHFFFAOYSA-N 2-chloroquinoxaline Chemical compound C1=CC=CC2=NC(Cl)=CN=C21 BYHVGQHIAFURIL-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical group CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- HUCCVCXEWPCKLR-UHFFFAOYSA-N 2-ethoxyquinoxaline Chemical compound C1=CC=CC2=NC(OCC)=CN=C21 HUCCVCXEWPCKLR-UHFFFAOYSA-N 0.000 description 1
- UYTGGRJPWFSBEV-UHFFFAOYSA-N 2-n,3-n-diethylquinoxaline-2,3-diamine Chemical compound C1=CC=C2N=C(NCC)C(NCC)=NC2=C1 UYTGGRJPWFSBEV-UHFFFAOYSA-N 0.000 description 1
- CQCLFLRRIMEBFA-UHFFFAOYSA-N 2-n,4-n-diethylquinazoline-2,4-diamine Chemical compound C1=CC=CC2=NC(NCC)=NC(NCC)=C21 CQCLFLRRIMEBFA-UHFFFAOYSA-N 0.000 description 1
- LJDQXQOPXOLCHL-UHFFFAOYSA-N 3,4,6-trichloropyridazine Chemical compound ClC1=CC(Cl)=C(Cl)N=N1 LJDQXQOPXOLCHL-UHFFFAOYSA-N 0.000 description 1
- GUSWJGOYDXFJSI-UHFFFAOYSA-N 3,6-dichloropyridazine Chemical compound ClC1=CC=C(Cl)N=N1 GUSWJGOYDXFJSI-UHFFFAOYSA-N 0.000 description 1
- HKQOBAGKDBSVEQ-UHFFFAOYSA-N 3,6-dimethoxypyridazine Chemical compound COC1=CC=C(OC)N=N1 HKQOBAGKDBSVEQ-UHFFFAOYSA-N 0.000 description 1
- PTCKNLGMBFKIFP-UHFFFAOYSA-N 4-bromo-2,6-dimethylpyrimidine Chemical compound CC1=CC(Br)=NC(C)=N1 PTCKNLGMBFKIFP-UHFFFAOYSA-N 0.000 description 1
- LUERGSJQVGGPMC-UHFFFAOYSA-N 4-chloro-2,6-diethoxypyrimidine Chemical compound CCOC1=CC(Cl)=NC(OCC)=N1 LUERGSJQVGGPMC-UHFFFAOYSA-N 0.000 description 1
- JDYDIHVYOFAERC-UHFFFAOYSA-N 4-chloro-n,n,6-trimethylpyrimidin-2-amine Chemical compound CN(C)C1=NC(C)=CC(Cl)=N1 JDYDIHVYOFAERC-UHFFFAOYSA-N 0.000 description 1
- QNMMHMUBEBANON-UHFFFAOYSA-N 4-chloro-n,n-diethyl-6-methylpyrimidin-2-amine Chemical compound CCN(CC)C1=NC(C)=CC(Cl)=N1 QNMMHMUBEBANON-UHFFFAOYSA-N 0.000 description 1
- IJSFFUOWXQRDMS-UHFFFAOYSA-N 4-chlorocinnoline Chemical compound C1=CC=C2C(Cl)=CN=NC2=C1 IJSFFUOWXQRDMS-UHFFFAOYSA-N 0.000 description 1
- XVPKWOIIQKBTFD-UHFFFAOYSA-N 4-methoxycinnoline Chemical compound C1=CC=C2C(OC)=CN=NC2=C1 XVPKWOIIQKBTFD-UHFFFAOYSA-N 0.000 description 1
- ZLNPDTOTEVIMMY-UHFFFAOYSA-N 5-chloropyrimidine Chemical compound ClC1=CN=CN=C1 ZLNPDTOTEVIMMY-UHFFFAOYSA-N 0.000 description 1
- IQXZFCPJXDXYOD-UHFFFAOYSA-N 6-chloro-2-n,4-n-diethylpyrimidine-2,4-diamine Chemical compound CCNC1=CC(Cl)=NC(NCC)=N1 IQXZFCPJXDXYOD-UHFFFAOYSA-N 0.000 description 1
- CLUVHLIUOIFYEE-UHFFFAOYSA-N 6-chloro-n,n-diethylpyridazin-3-amine Chemical compound CCN(CC)C1=CC=C(Cl)N=N1 CLUVHLIUOIFYEE-UHFFFAOYSA-N 0.000 description 1
- STAKPHFAQGICDI-UHFFFAOYSA-N 6-chloro-n-ethylpyridazin-3-amine Chemical compound CCNC1=CC=C(Cl)N=N1 STAKPHFAQGICDI-UHFFFAOYSA-N 0.000 description 1
- 241000209761 Avena Species 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- HHZJPKDVXUMDNL-UHFFFAOYSA-N C1=CN(NC(=C1)Cl)NN Chemical compound C1=CN(NC(=C1)Cl)NN HHZJPKDVXUMDNL-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 244000300264 Spinacia oleracea Species 0.000 description 1
- 235000009337 Spinacia oleracea Nutrition 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- VJHCJDRQFCCTHL-UHFFFAOYSA-N acetic acid 2,3,4,5,6-pentahydroxyhexanal Chemical compound CC(O)=O.OCC(O)C(O)C(O)C(O)C=O VJHCJDRQFCCTHL-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000011280 coal tar Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 230000005094 fruit set Effects 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000009036 growth inhibition Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- WTPLIDBXKIZTGI-UHFFFAOYSA-N n-ethylcinnolin-4-amine Chemical compound C1=CC=C2C(NCC)=CN=NC2=C1 WTPLIDBXKIZTGI-UHFFFAOYSA-N 0.000 description 1
- CRUONNUVJWGWCK-UHFFFAOYSA-N n-ethylphthalazin-1-amine Chemical compound C1=CC=C2C(NCC)=NN=CC2=C1 CRUONNUVJWGWCK-UHFFFAOYSA-N 0.000 description 1
- CBLIKXAFMIOTGR-UHFFFAOYSA-N n-ethylpyrazin-2-amine Chemical compound CCNC1=CN=CC=N1 CBLIKXAFMIOTGR-UHFFFAOYSA-N 0.000 description 1
- BXOUERBETVRQKV-UHFFFAOYSA-N n-propan-2-ylpyridazin-3-amine Chemical compound CC(C)NC1=CC=CN=N1 BXOUERBETVRQKV-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 239000012875 nonionic emulsifier Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 235000017807 phytochemicals Nutrition 0.000 description 1
- 229930000223 plant secondary metabolite Natural products 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- CZAAKPFIWJXPQT-UHFFFAOYSA-N quinazolin-2-amine Chemical compound C1=CC=CC2=NC(N)=NC=C21 CZAAKPFIWJXPQT-UHFFFAOYSA-N 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 230000005070 ripening Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 239000005418 vegetable material Substances 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 230000017260 vegetative to reproductive phase transition of meristem Effects 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH2940844X | 1955-12-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1035398B true DE1035398B (de) | 1958-07-31 |
Family
ID=4572907
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG21138A Pending DE1035398B (de) | 1955-12-21 | 1956-12-20 | Mittel zur Beeinflussung des Pflanzenwachstums |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2940844A (Direct) |
| BE (1) | BE553585A (Direct) |
| CH (1) | CH347670A (Direct) |
| DE (1) | DE1035398B (Direct) |
| FR (1) | FR1170743A (Direct) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1099544B (de) * | 1958-10-10 | 1961-02-16 | Lentia Gmbh | Verfahren zur Herstellung von neuen Pyridazinderivaten |
| DE1107998B (de) | 1960-03-19 | 1961-05-31 | Basf Ag | Mittel zur Beeinflussung des Pflanzenwachstums, insbesondere zur Unkrautbekaempfung |
| DE1135238B (de) * | 1958-11-05 | 1962-08-23 | Geigy Ag J R | Mittel zur Hemmung des Pflanzenwachstums, insbesondere Unkrautvertilgungsmittel |
| DE1240698B (Direct) | 1959-08-14 | 1973-01-04 |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3127408A (en) * | 1960-06-08 | 1964-03-31 | Spencer Chem Co | 4-thiocyanato-2-butynyl carbamates |
| US3244503A (en) * | 1962-04-02 | 1966-04-05 | Du Pont | Methods for the control of plants |
| BE636199A (Direct) * | 1962-08-16 | |||
| US3256290A (en) * | 1963-06-21 | 1966-06-14 | Dow Chemical Co | 4-methoxypolychloropyridines |
| US4025515A (en) * | 1969-02-14 | 1977-05-24 | Sandoz Ltd. | 6-Chloro-2,4-diaminopyrimidines |
| HU181184B (en) * | 1980-09-12 | 1983-06-28 | Eszakmagyar Vegyimuevek | Composition for replacing kinetine,the effect and membraneactivity of which is similar to citokinine,which composition improves plant productivity,quantity of protein-nitrogen and anion-absorptivity |
| US4699651A (en) * | 1984-08-13 | 1987-10-13 | E. I. Du Pont De Nemours And Company | Use of certain cinnoline-4-carboxylic acids and congeners thereof for controlling the growth of unwanted plants |
| JP2018525345A (ja) * | 2015-07-01 | 2018-09-06 | ノースウェスタン ユニバーシティ | 置換キナゾリン化合物及びグルコセレブロシダーゼ活性の調節のためのその使用 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2620266A (en) * | 1951-01-25 | 1952-12-02 | Monsanto Chemicals | Herbicides |
| US2661277A (en) * | 1952-09-12 | 1953-12-01 | Monsanto Chemicals | Herbicides |
| US2661276A (en) * | 1951-01-25 | 1953-12-01 | Monsanto Chemicals | Herbicides |
| US2679453A (en) * | 1952-10-10 | 1954-05-25 | Charles H Brett | Method and composition for the control of undesired vegetation |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2537871A (en) * | 1946-07-03 | 1951-01-09 | Merck & Co Inc | 2-aminoquinoxaline and process of preparing same |
| US2594381A (en) * | 1949-09-29 | 1952-04-29 | Goodrich Co B F | 4-quinazoline sulfenamides |
| US2811523A (en) * | 1956-03-02 | 1957-10-29 | Dow Chemical Co | 3, 4-dihydro-2h-1, 3-benzoxazines |
-
0
- BE BE553585D patent/BE553585A/xx unknown
-
1956
- 1956-12-12 CH CH347670D patent/CH347670A/de unknown
- 1956-12-18 US US628957A patent/US2940844A/en not_active Expired - Lifetime
- 1956-12-20 DE DEG21138A patent/DE1035398B/de active Pending
- 1956-12-20 FR FR1170743D patent/FR1170743A/fr not_active Expired
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2620266A (en) * | 1951-01-25 | 1952-12-02 | Monsanto Chemicals | Herbicides |
| US2661276A (en) * | 1951-01-25 | 1953-12-01 | Monsanto Chemicals | Herbicides |
| US2661277A (en) * | 1952-09-12 | 1953-12-01 | Monsanto Chemicals | Herbicides |
| US2679453A (en) * | 1952-10-10 | 1954-05-25 | Charles H Brett | Method and composition for the control of undesired vegetation |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1099544B (de) * | 1958-10-10 | 1961-02-16 | Lentia Gmbh | Verfahren zur Herstellung von neuen Pyridazinderivaten |
| DE1135238B (de) * | 1958-11-05 | 1962-08-23 | Geigy Ag J R | Mittel zur Hemmung des Pflanzenwachstums, insbesondere Unkrautvertilgungsmittel |
| DE1240698B (Direct) | 1959-08-14 | 1973-01-04 | ||
| DE1240698C2 (de) * | 1959-08-14 | 1973-01-04 | Unkrautbekaempfungsmittel | |
| DE1107998B (de) | 1960-03-19 | 1961-05-31 | Basf Ag | Mittel zur Beeinflussung des Pflanzenwachstums, insbesondere zur Unkrautbekaempfung |
Also Published As
| Publication number | Publication date |
|---|---|
| BE553585A (Direct) | |
| FR1170743A (fr) | 1959-01-16 |
| US2940844A (en) | 1960-06-14 |
| CH347670A (de) | 1960-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69625587T2 (de) | Synergistiche herbizide zusammensetzungen mit metolachlor | |
| DE1011904B (de) | Mittel zur Beeinflussung des Pflanzenwachstums | |
| US2909421A (en) | Compositions and methods for influencing the growth of plants | |
| DE972405C (de) | Mittel zur Regelung des Pflanzenwachstums | |
| US2936227A (en) | Method for inhibiting the growth of plants | |
| EP0012717A1 (de) | Verfahren und Mittel zur selektiven preemergenten Bekämpfung von Unkräutern in Getreidekulturen | |
| DE1006203B (de) | Selektiv wirkendes Unkrautbekaempfungsmittel | |
| US2940844A (en) | Compositions and method for inhibiting the growth of plants | |
| DE1271452B (de) | Selektives Herbizid | |
| US3169848A (en) | Composition and method for inhibiting the growth of plants | |
| EP1290946A2 (de) | Herbizides Mittel | |
| DE69507965T2 (de) | Neue herbizide zusammensetzungen | |
| EP0658308A1 (de) | Herbizide verbindung und verfahren zur bekämpfung unerwünschter vegetation | |
| DE1135238B (de) | Mittel zur Hemmung des Pflanzenwachstums, insbesondere Unkrautvertilgungsmittel | |
| DE1088757B (de) | Mittel zur selektiven Unkrautbekaempfung | |
| DE69906611T2 (de) | Herbizide Mischungen | |
| DE1107998B (de) | Mittel zur Beeinflussung des Pflanzenwachstums, insbesondere zur Unkrautbekaempfung | |
| DE1251074B (de) | Selektives Herbizid | |
| DE1301819B (de) | Substituierte 2, 4-Diamino-6-chlor-s-triazine | |
| DE2431560A1 (de) | Verfahren und zusammensetzung zur regulierung des wachstums von pflanzen | |
| DE1542812A1 (de) | Verfahren und Mittel zur Bekaempfung von Unkraeutern in Getreidekulturen | |
| DE3106407A1 (de) | Herbizides mittel und verfahren zur wachstumshemmung unerwuenschter pflanzen | |
| DE1140396B (de) | Unkrautvertilgungsmittel | |
| DE2028552A1 (Direct) | ||
| DE69601282T2 (de) | Herbizide Zusammensetzungen und Verfahren auf der Basis von Aminotriazol |