DE1002198B - Verfahren zur Herstellung von farbenphotographischen Bildern - Google Patents
Verfahren zur Herstellung von farbenphotographischen BildernInfo
- Publication number
- DE1002198B DE1002198B DEE11960A DEE0011960A DE1002198B DE 1002198 B DE1002198 B DE 1002198B DE E11960 A DEE11960 A DE E11960A DE E0011960 A DEE0011960 A DE E0011960A DE 1002198 B DE1002198 B DE 1002198B
- Authority
- DE
- Germany
- Prior art keywords
- coupler
- color
- image
- auxiliary
- emulsion
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 55
- 230000008569 process Effects 0.000 title claims description 34
- 239000000839 emulsion Substances 0.000 claims description 81
- 229910052709 silver Inorganic materials 0.000 claims description 46
- 239000004332 silver Substances 0.000 claims description 46
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 44
- 229910052736 halogen Inorganic materials 0.000 claims description 22
- 150000002367 halogens Chemical class 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 21
- 239000000126 substance Substances 0.000 claims description 13
- 238000003384 imaging method Methods 0.000 claims description 9
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- -1 silver halide Chemical class 0.000 claims description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000003368 amide group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 1
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 1
- 239000010410 layer Substances 0.000 description 54
- 239000000975 dye Substances 0.000 description 46
- 150000001875 compounds Chemical class 0.000 description 33
- 239000000463 material Substances 0.000 description 17
- 230000009467 reduction Effects 0.000 description 10
- 238000009792 diffusion process Methods 0.000 description 9
- 230000000694 effects Effects 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- 230000035945 sensitivity Effects 0.000 description 7
- 238000005406 washing Methods 0.000 description 6
- 230000003287 optical effect Effects 0.000 description 5
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 3
- ZSASBMJOYAJYFO-UHFFFAOYSA-N N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-2-pentyl-2-phenoxyheptanamide Chemical compound C(CCCC)C(C(=O)NC1=C(C(=C(C(=C1)Cl)C)Cl)O)(OC1=CC=CC=C1)CCCCC ZSASBMJOYAJYFO-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000004043 dyeing Methods 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 230000005012 migration Effects 0.000 description 2
- 238000013508 migration Methods 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 230000004043 responsiveness Effects 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 239000002356 single layer Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 1
- WBMKUJLUHZENGU-UHFFFAOYSA-N 2,6-di(dodecanoyloxy)pyridine-4-carboxylic acid Chemical compound C(CCCCCCCCCCC)(=O)OC=1C=C(C(=O)O)C=C(N1)OC(CCCCCCCCCCC)=O WBMKUJLUHZENGU-UHFFFAOYSA-N 0.000 description 1
- KIEFFPFIBREPIX-UHFFFAOYSA-N 2-(2,4-dihydroxybenzoyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=C(O)C=C1O KIEFFPFIBREPIX-UHFFFAOYSA-N 0.000 description 1
- DVZPQHRWOUXUPU-UHFFFAOYSA-N 4-ethoxy-2-hydroxybenzoic acid Chemical compound CCOC1=CC=C(C(O)=O)C(O)=C1 DVZPQHRWOUXUPU-UHFFFAOYSA-N 0.000 description 1
- LHHAIWKNFVQUEG-UHFFFAOYSA-N 6-hydroxy-4-propyl-1H-pyridin-2-one Chemical compound OC1=NC(=CC(=C1)CCC)O LHHAIWKNFVQUEG-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 206010012289 Dementia Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- OIDPCXKPHYRNKH-UHFFFAOYSA-J chrome alum Chemical compound [K]OS(=O)(=O)O[Cr]1OS(=O)(=O)O1 OIDPCXKPHYRNKH-UHFFFAOYSA-J 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000000763 evoking effect Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- YAGKRVSRTSUGEY-UHFFFAOYSA-N ferricyanide Chemical compound [Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] YAGKRVSRTSUGEY-UHFFFAOYSA-N 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- CBEQRNSPHCCXSH-UHFFFAOYSA-N iodine monobromide Chemical compound IBr CBEQRNSPHCCXSH-UHFFFAOYSA-N 0.000 description 1
- 125000000400 lauroyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000004382 potting Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
- 230000003313 weakening effect Effects 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
- G03C7/30—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials
- G03C7/32—Colour coupling substances
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US488957A US2742832A (en) | 1955-02-17 | 1955-02-17 | Controlling grain and contrast in color photography |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1002198B true DE1002198B (de) | 1957-02-07 |
Family
ID=23941816
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEE11960A Pending DE1002198B (de) | 1955-02-17 | 1956-02-16 | Verfahren zur Herstellung von farbenphotographischen Bildern |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2742832A (enExample) |
| BE (1) | BE545183A (enExample) |
| DE (1) | DE1002198B (enExample) |
| FR (1) | FR1149695A (enExample) |
| GB (1) | GB784479A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1958709A1 (de) * | 1969-11-22 | 1971-06-09 | Agfa Gevaert Ag | Farbfotografisches Mehrschichtenmaterial |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE560907A (enExample) * | 1956-09-18 | |||
| BE619300A (enExample) * | 1959-04-06 | |||
| US3132946A (en) * | 1960-01-11 | 1964-05-12 | Eastman Kodak Co | Contact screens for photogravure |
| US3402046A (en) * | 1963-09-23 | 1968-09-17 | Eastman Kodak Co | Multilayer color photographic elements |
| US4002477A (en) * | 1973-11-28 | 1977-01-11 | Eastman Kodak Company | Diffusion transfer processes and elements using or containing inert transitional metal complex oxidizing agents |
| JPS53293B2 (enExample) * | 1973-12-24 | 1978-01-07 | ||
| JPS5250230A (en) * | 1975-10-20 | 1977-04-22 | Fuji Photo Film Co Ltd | Method for forming color photographic image |
-
0
- BE BE545183D patent/BE545183A/xx unknown
-
1955
- 1955-02-17 US US488957A patent/US2742832A/en not_active Expired - Lifetime
-
1956
- 1956-01-05 GB GB384/56A patent/GB784479A/en not_active Expired
- 1956-02-15 FR FR1149695D patent/FR1149695A/fr not_active Expired
- 1956-02-16 DE DEE11960A patent/DE1002198B/de active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1958709A1 (de) * | 1969-11-22 | 1971-06-09 | Agfa Gevaert Ag | Farbfotografisches Mehrschichtenmaterial |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1149695A (fr) | 1957-12-30 |
| GB784479A (en) | 1957-10-09 |
| US2742832A (en) | 1956-04-24 |
| BE545183A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2250050C2 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE964655C (de) | Verfahren zur Herstellung eines Maskenbildes in einem photographischen Mehrschichtenmaterial mit Halogensilberemulsionsschichten | |
| DE964203C (de) | Photographisches Kontaktverfahren zur Erzeugung mehrfarbiger Bilder | |
| DE2424946A1 (de) | Kuppler fuer die photographie | |
| DE1522374C2 (de) | Verfahren zur Herstellung eines direktpositiven photographischen Bildes | |
| DE2034064B2 (de) | Farbfotografisches Aufzeichenmaterial | |
| DE1002198B (de) | Verfahren zur Herstellung von farbenphotographischen Bildern | |
| DE2515771A1 (de) | Verfahren zur erzeugung eines farbphotographischen bildes | |
| DE3133164A1 (de) | Verfahren zur herstellung von optischen mehrfarbenfiltern | |
| DE876506C (de) | Photographischer Entwickler | |
| DE1547673C3 (de) | Verfahren zur Herstellung von blaugrünen maskierten Bildern auf photographischem Wege | |
| DE962666C (de) | Verfahren zur Herstellung von farbenphotographischen Bildern nach dem Farbentwicklungsverfahren | |
| DE1202638B (de) | Photographisches Entwicklungsverfahren zur Herstellung von Farbbildern nach dem Farbentwicklungsverfahren | |
| DE1772123C2 (de) | Verfahren zur Entwicklung silberhalogenidhaltiger Aufzeichnungsmaterialien | |
| DE976586C (de) | Mehrschichtiges, kopierfaehiges, transparentes, subtraktiv gefaerbtes Farbnegativ und Verfahren zu dessen Herstellung | |
| EP0044813A2 (de) | Verfahren zur Herstellung negativer Farbbilder nach dem Silberfarbbleichverfahren und das in diesem Verfahren verwendete Silberfarbbleichmaterial | |
| EP0023888B1 (de) | Verfahren zur Herstellung maskierter positiver Farbbilder nach dem Silberfarbbleichverfahren sowie das photographische Silberfarbbleichmaterial hierfür | |
| DE2421068C2 (de) | Farbphotographisches mehrschichtiges Aufzeichnungsmaterial | |
| DE3878368T2 (de) | Photographisches eintragungsmaterial mit einer ein purpurrotes farbbild bildenden kupplerverbindung. | |
| DE2453641A1 (de) | Mehrschichtiges farbphotographisches aufzeichnungsmaterial sowie verfahren zur herstellung positiver farbphotographischer bilder | |
| DE2035382A1 (de) | Verhinderung der Farbmischung bei farbphotographischen, lichtempfindlichen Umkehrmaterialien mit mehreren Schichten | |
| DE69103896T2 (de) | Umkehrfarbphotographisches material mit einer feinkornunterschicht. | |
| DE2550552C2 (de) | Farbphotographisches Mehrschichtenmaterial mit verbesserter Farbdichte | |
| DE2328014A1 (de) | Lichtempfindliches farbphotographisches material | |
| DE1952253B2 (de) | Verfahren zum Entwickeln farbphotographischer Aufzeichnungsmaterialien |