DD240543A5 - Verfahren zur herstellung von 3-amino-2-benzoyl-acrylsaeurederivaten - Google Patents
Verfahren zur herstellung von 3-amino-2-benzoyl-acrylsaeurederivaten Download PDFInfo
- Publication number
- DD240543A5 DD240543A5 DD85281131A DD28113185A DD240543A5 DD 240543 A5 DD240543 A5 DD 240543A5 DD 85281131 A DD85281131 A DD 85281131A DD 28113185 A DD28113185 A DD 28113185A DD 240543 A5 DD240543 A5 DD 240543A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- benzoyl
- dichloro
- fluoro
- acrylic acid
- amino
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000000034 method Methods 0.000 claims abstract description 16
- 238000002360 preparation method Methods 0.000 claims abstract description 8
- -1 benzoyl halides Chemical class 0.000 abstract description 19
- 150000001875 compounds Chemical class 0.000 abstract description 7
- DIRFIAXLTZSXFX-UHFFFAOYSA-N 3-amino-2-benzoylprop-2-enoic acid Chemical class NC=C(C(O)=O)C(=O)C1=CC=CC=C1 DIRFIAXLTZSXFX-UHFFFAOYSA-N 0.000 abstract description 5
- 150000002081 enamines Chemical class 0.000 abstract description 3
- 239000000543 intermediate Substances 0.000 abstract description 3
- 238000005917 acylation reaction Methods 0.000 abstract description 2
- 229940124350 antibacterial drug Drugs 0.000 abstract description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 57
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 24
- RPZXUSJCSDQNTE-UHFFFAOYSA-N 2,4-dichloro-5-fluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(Cl)C=C1Cl RPZXUSJCSDQNTE-UHFFFAOYSA-N 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 239000000243 solution Substances 0.000 description 12
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 229910052736 halogen Inorganic materials 0.000 description 8
- 150000002367 halogens Chemical class 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- YTLYLLTVENPWFT-UPHRSURJSA-N (Z)-3-aminoacrylic acid Chemical class N\C=C/C(O)=O YTLYLLTVENPWFT-UPHRSURJSA-N 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- ZKKBIZXAEDFPNL-HWKANZROSA-N (e)-3-(dimethylamino)prop-2-enenitrile Chemical compound CN(C)\C=C\C#N ZKKBIZXAEDFPNL-HWKANZROSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 241000251730 Chondrichthyes Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- MVPDNJQLPITPIX-UHFFFAOYSA-N methyl 3-(dimethylamino)prop-2-enoate Chemical compound COC(=O)C=CN(C)C MVPDNJQLPITPIX-UHFFFAOYSA-N 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 235000015096 spirit Nutrition 0.000 description 3
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- XWCKIXLTBNGIHV-UHFFFAOYSA-N 2,3,4,5-tetrafluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(F)C(F)=C1F XWCKIXLTBNGIHV-UHFFFAOYSA-N 0.000 description 2
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 230000006181 N-acylation Effects 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 125000005521 carbonamide group Chemical group 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- MYSWGUAQZAJSOK-UHFFFAOYSA-N ciprofloxacin Chemical compound C12=CC(N3CCNCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 MYSWGUAQZAJSOK-UHFFFAOYSA-N 0.000 description 2
- OFULWOHHSSJLTJ-UHFFFAOYSA-N ethyl 2-(2,4-dichloro-5-fluorobenzoyl)-3-(diethylamino)prop-2-enoate Chemical compound CCOC(=O)C(=CN(CC)CC)C(=O)C1=CC(F)=C(Cl)C=C1Cl OFULWOHHSSJLTJ-UHFFFAOYSA-N 0.000 description 2
- UYJWKMILOGUYTL-UHFFFAOYSA-N ethyl 3-(cyclopropylamino)-2-(2,4-dichloro-5-fluorobenzoyl)prop-2-enoate Chemical compound C=1C(F)=C(Cl)C=C(Cl)C=1C(=O)C(C(=O)OCC)=CNC1CC1 UYJWKMILOGUYTL-UHFFFAOYSA-N 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- PZDBUCAGCYWAOF-UHFFFAOYSA-N methyl 2-(2,4-dichloro-5-fluorobenzoyl)-3-(dimethylamino)prop-2-enoate Chemical compound COC(=O)C(=CN(C)C)C(=O)C1=CC(F)=C(Cl)C=C1Cl PZDBUCAGCYWAOF-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- IROWIXYGGPOJFJ-UHFFFAOYSA-N 2,3,4,5-tetrachlorobenzoyl chloride Chemical compound ClC(=O)C1=CC(Cl)=C(Cl)C(Cl)=C1Cl IROWIXYGGPOJFJ-UHFFFAOYSA-N 0.000 description 1
- BONFTDXNVIOQBZ-UHFFFAOYSA-N 2,4,5-trichlorobenzoyl chloride Chemical compound ClC(=O)C1=CC(Cl)=C(Cl)C=C1Cl BONFTDXNVIOQBZ-UHFFFAOYSA-N 0.000 description 1
- STBGCAUUOPNJBH-UHFFFAOYSA-N 2,4,5-trifluorobenzoyl chloride Chemical compound FC1=CC(F)=C(C(Cl)=O)C=C1F STBGCAUUOPNJBH-UHFFFAOYSA-N 0.000 description 1
- AAXLNXKBUDBMAZ-UHFFFAOYSA-N 2-(2,4-dichloro-5-fluorobenzoyl)-3-(dimethylamino)prop-2-enoic acid Chemical compound CN(C)C=C(C(O)=O)C(=O)C1=CC(F)=C(Cl)C=C1Cl AAXLNXKBUDBMAZ-UHFFFAOYSA-N 0.000 description 1
- GCSHFLICMVGYIB-UHFFFAOYSA-N 2-(3-aminobenzoyl)prop-2-enoic acid Chemical class NC1=CC=CC(C(=O)C(=C)C(O)=O)=C1 GCSHFLICMVGYIB-UHFFFAOYSA-N 0.000 description 1
- DUVWEYQMWDHDBY-UHFFFAOYSA-N 2-(dimethylamino)prop-2-enamide Chemical compound CN(C)C(=C)C(N)=O DUVWEYQMWDHDBY-UHFFFAOYSA-N 0.000 description 1
- RMBZGFRPRFOSCD-UHFFFAOYSA-N 3-(cyclopropylamino)prop-2-enoic acid Chemical compound OC(=O)C=CNC1CC1 RMBZGFRPRFOSCD-UHFFFAOYSA-N 0.000 description 1
- ODTUTOFQZYUGPW-UHFFFAOYSA-N 3-(dimethylamino)-n-methylprop-2-enamide Chemical compound CNC(=O)C=CN(C)C ODTUTOFQZYUGPW-UHFFFAOYSA-N 0.000 description 1
- NKNBYFBSHOGEKE-UHFFFAOYSA-N 3-(dimethylamino)prop-2-enoic acid Chemical compound CN(C)C=CC(O)=O NKNBYFBSHOGEKE-UHFFFAOYSA-N 0.000 description 1
- IEDMMCZBIKXEJP-UHFFFAOYSA-N 3-chloro-2,4,5-trifluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(F)C(Cl)=C1F IEDMMCZBIKXEJP-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- HXELGNKCCDGMMN-UHFFFAOYSA-N [F].[Cl] Chemical compound [F].[Cl] HXELGNKCCDGMMN-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229960003405 ciprofloxacin Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- MVUMJYQUKKUOHO-AATRIKPKSA-N ethyl (e)-3-(dimethylamino)prop-2-enoate Chemical compound CCOC(=O)\C=C\N(C)C MVUMJYQUKKUOHO-AATRIKPKSA-N 0.000 description 1
- DJRMXRPIBLNZHF-UHFFFAOYSA-N ethyl 2-(2,4-dichloro-5-fluorobenzoyl)-3-(dimethylamino)prop-2-enoate Chemical compound CCOC(=O)C(=CN(C)C)C(=O)C1=CC(F)=C(Cl)C=C1Cl DJRMXRPIBLNZHF-UHFFFAOYSA-N 0.000 description 1
- MVUMJYQUKKUOHO-UHFFFAOYSA-N ethyl 3-(dimethylamino)prop-2-enoate Chemical compound CCOC(=O)C=CN(C)C MVUMJYQUKKUOHO-UHFFFAOYSA-N 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- CTWDRRITAMBEPI-UHFFFAOYSA-N methyl 2-(2,4-dichloro-5-fluorobenzoyl)-3-pyrrolidin-1-ylprop-2-enoate Chemical compound C=1C(F)=C(Cl)C=C(Cl)C=1C(=O)C(C(=O)OC)=CN1CCCC1 CTWDRRITAMBEPI-UHFFFAOYSA-N 0.000 description 1
- YCDBNUJZSAFBIY-UHFFFAOYSA-N methyl 3-(cyclopropylamino)-2-(2,4-dichloro-5-fluorobenzoyl)prop-2-enoate Chemical compound C=1C(F)=C(Cl)C=C(Cl)C=1C(=O)C(C(=O)OC)=CNC1CC1 YCDBNUJZSAFBIY-UHFFFAOYSA-N 0.000 description 1
- NUKQGQGCRCXGMN-UHFFFAOYSA-N methyl 3-pyrrolidin-1-ylprop-2-enoate Chemical compound COC(=O)C=CN1CCCC1 NUKQGQGCRCXGMN-UHFFFAOYSA-N 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3435930 | 1984-09-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD240543A5 true DD240543A5 (de) | 1986-11-05 |
Family
ID=6246777
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD85281131A DD240543A5 (de) | 1984-09-29 | 1985-09-27 | Verfahren zur herstellung von 3-amino-2-benzoyl-acrylsaeurederivaten |
Country Status (4)
| Country | Link |
|---|---|
| JP (1) | JPS61112051A (enExample) |
| DD (1) | DD240543A5 (enExample) |
| SU (1) | SU1395139A3 (enExample) |
| UA (1) | UA7018A1 (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3724466A1 (de) * | 1987-07-24 | 1989-02-02 | Bayer Ag | Verfahren zur herstellung von chinoloncarbonsaeuren |
| CA2129773C (en) * | 1993-09-02 | 2007-05-01 | Michael Klaus | Aromatic carboxylic acid derivatives |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4243406A (en) * | 1978-12-26 | 1981-01-06 | Monsanto Company | 5-Aryl-4-isoxazolecarboxylate-safening agents |
| JPS61100568A (ja) * | 1984-10-19 | 1986-05-19 | Otsuka Pharmaceut Co Ltd | ベンゾヘテロ環化合物 |
-
1985
- 1985-09-09 SU SU853950797A patent/SU1395139A3/ru active
- 1985-09-09 UA UA3950797A patent/UA7018A1/uk unknown
- 1985-09-25 JP JP60210345A patent/JPS61112051A/ja active Granted
- 1985-09-27 DD DD85281131A patent/DD240543A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| UA7018A1 (uk) | 1995-03-31 |
| SU1395139A3 (ru) | 1988-05-07 |
| JPS61112051A (ja) | 1986-05-30 |
| JPH0457662B2 (enExample) | 1992-09-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0176846B1 (de) | 3-Amino-2-benzoyl-acrylsäurederivate und ein Verfahren zu ihrer Herstellung | |
| EP0812845B1 (en) | Process for preparing sildenafil | |
| DE2658610C2 (de) | Phenylessigsäureesterderivate | |
| DE2808070A1 (de) | Verfahren zur herstellung von 4-pyridon-3-carbonsaeuren und/oder deren derivaten | |
| CH625788A5 (enExample) | ||
| EP0168737A2 (de) | Verfahren zur Herstellung von halogenierten Chinoloncarbonsäuren | |
| DE60202261T2 (de) | Verfahren zur herstellung von mesylaten von piperazinderivaten | |
| DE2809720C2 (enExample) | ||
| DD240543A5 (de) | Verfahren zur herstellung von 3-amino-2-benzoyl-acrylsaeurederivaten | |
| EP0380712A1 (de) | Verfahren zur Herstellung von 2,6-Dichlordiphenylaminessigsäurederivaten | |
| EP0607826A1 (de) | Fluor-trifluormethylbenzoesäure-Derivate | |
| EP0003105B1 (de) | Verfahren zur Anilidierung von Carbonsäureestern | |
| EP0414020A2 (de) | Verfahren zur Herstellung von Clausenamid und Neoclausenamid und deren Derivate | |
| EP0362350A1 (de) | Verfahren zur herstellung von 5-gliedrigen, stickstoffhaltigen heteroaromaten | |
| EP0014390A1 (de) | 2-Amino-8-cyclopropyl-5-oxo-5,8-dihydro-pyrido (2,3-d) pyrimidin-6-carbonsäuren, sie enthaltende Arzneimittel sowie Verfahren zu ihrer Herstellung | |
| EP0694534A1 (de) | 3-Substituierte Chinolin-5-carbonsäurederivate und Verfahren zu ihrer Herstellung | |
| EP1252159B1 (de) | Verfahren zur herstellung von heterocyclischen verbindungen | |
| EP1023272B1 (de) | Verfahren zur herstellung von alkoxytriazolinonen | |
| DE2634854C2 (enExample) | ||
| DE4408083C1 (de) | Verfahren zur Herstellung von 4-Fluoralkoxyzimtsäurenitrilen | |
| DE2943809A1 (de) | 1-mercaptoacylpiperazin-2-carbonsaeure-verbindungen und ihre salze, verfahren zu ihrer herstellung und ihre verwendung bei der bekaempfung von hypertonie | |
| EP0002477B1 (de) | Verfahren zur Herstellung von 1,1-Dihalogen-4-methyl-1,3-pentadienen | |
| CH634555A5 (de) | Verfahren zur herstellung von mit nocardicin verwandten azetidinonen. | |
| DD201587A5 (de) | Verfahren zur herstellung von 3,6-disubstituierten 4-amino-1,2,4-triazin-5-onen | |
| EP1392698B1 (de) | Verfahren zur herstellung von 6-aryl-4h-s-triazolo[3,4-c]-thieno[2,3-e]-1,4-diazepinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ENJ | Ceased due to non-payment of renewal fee |