DD207198A5 - Verfahren zur herstellung von n-(tert.aminoalkyl)acrylamiden - Google Patents
Verfahren zur herstellung von n-(tert.aminoalkyl)acrylamiden Download PDFInfo
- Publication number
- DD207198A5 DD207198A5 DD83248917A DD24891783A DD207198A5 DD 207198 A5 DD207198 A5 DD 207198A5 DD 83248917 A DD83248917 A DD 83248917A DD 24891783 A DD24891783 A DD 24891783A DD 207198 A5 DD207198 A5 DD 207198A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- acrylamides
- aminoalkyl
- acrylic acid
- tert
- reaction
- Prior art date
Links
- 150000003926 acrylamides Chemical class 0.000 title claims abstract description 12
- 238000004519 manufacturing process Methods 0.000 title abstract description 4
- 238000000034 method Methods 0.000 claims abstract description 16
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims abstract description 14
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims abstract description 14
- 238000006243 chemical reaction Methods 0.000 claims abstract description 8
- 230000002378 acidificating effect Effects 0.000 claims abstract description 4
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 5
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 4
- 238000006116 polymerization reaction Methods 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- 101000588924 Anthopleura elegantissima Delta-actitoxin-Ael1a Proteins 0.000 claims description 3
- 230000003197 catalytic effect Effects 0.000 claims description 3
- 239000003112 inhibitor Substances 0.000 claims description 3
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 claims description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- 239000002841 Lewis acid Substances 0.000 claims description 2
- 239000002879 Lewis base Substances 0.000 claims description 2
- 150000001879 copper Chemical class 0.000 claims description 2
- 238000004821 distillation Methods 0.000 claims description 2
- 150000002500 ions Chemical class 0.000 claims description 2
- 150000007517 lewis acids Chemical class 0.000 claims description 2
- 150000007527 lewis bases Chemical class 0.000 claims description 2
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 claims description 2
- 229950000688 phenothiazine Drugs 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- UXKQNCDDHDBAPD-UHFFFAOYSA-N 4-n,4-n-diphenylbenzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 UXKQNCDDHDBAPD-UHFFFAOYSA-N 0.000 claims 1
- 239000002585 base Substances 0.000 claims 1
- 150000007522 mineralic acids Chemical class 0.000 claims 1
- 150000007524 organic acids Chemical class 0.000 claims 1
- 239000003054 catalyst Substances 0.000 abstract description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 10
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- -1 iron ions Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- ZZSGYARVLIMPBM-UHFFFAOYSA-N n-[3-(dimethylamino)-2,2-dimethylpropyl]prop-2-enamide Chemical compound CN(C)CC(C)(C)CNC(=O)C=C ZZSGYARVLIMPBM-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KEQFTVQCIQJIQW-UHFFFAOYSA-N N-Phenyl-2-naphthylamine Chemical compound C=1C=C2C=CC=CC2=CC=1NC1=CC=CC=C1 KEQFTVQCIQJIQW-UHFFFAOYSA-N 0.000 description 2
- 238000007334 copolymerization reaction Methods 0.000 description 2
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 2
- VOPPDUQFENQNOL-UHFFFAOYSA-N n',n'-diethyl-2,2-dimethylpropane-1,3-diamine Chemical compound CCN(CC)CC(C)(C)CN VOPPDUQFENQNOL-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 150000003839 salts Chemical group 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- IIXQGSCPSKVKFC-UHFFFAOYSA-N 2,2-diethyl-n',n'-dimethylpropane-1,3-diamine Chemical compound CCC(CC)(CN)CN(C)C IIXQGSCPSKVKFC-UHFFFAOYSA-N 0.000 description 1
- ADMTUGZFHLWYAU-UHFFFAOYSA-N 2,2-dimethylpropylhydrazine Chemical compound CC(C)(C)CNN ADMTUGZFHLWYAU-UHFFFAOYSA-N 0.000 description 1
- VOMOXLXEWQBTFF-UHFFFAOYSA-N 2-butyl-2-ethyl-n',n'-dimethylpropane-1,3-diamine Chemical compound CCCCC(CC)(CN)CN(C)C VOMOXLXEWQBTFF-UHFFFAOYSA-N 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- UTGQNNCQYDRXCH-UHFFFAOYSA-N N,N'-diphenyl-1,4-phenylenediamine Chemical compound C=1C=C(NC=2C=CC=CC=2)C=CC=1NC1=CC=CC=C1 UTGQNNCQYDRXCH-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000005396 acrylic acid ester group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 238000007068 beta-elimination reaction Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical class CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- ULDIVZQLPBUHAG-UHFFFAOYSA-N n',n',2,2-tetramethylpropane-1,3-diamine Chemical compound CN(C)CC(C)(C)CN ULDIVZQLPBUHAG-UHFFFAOYSA-N 0.000 description 1
- YOVUEGLUYRMSPG-UHFFFAOYSA-N n-[2-[(dimethylamino)methyl]-2-ethylhexyl]prop-2-enamide Chemical compound CCCCC(CC)(CN(C)C)CNC(=O)C=C YOVUEGLUYRMSPG-UHFFFAOYSA-N 0.000 description 1
- IBOFFDNDRXEPFG-UHFFFAOYSA-N n-[3-(diethylamino)-2,2-dimethylpropyl]prop-2-enamide Chemical compound CCN(CC)CC(C)(C)CNC(=O)C=C IBOFFDNDRXEPFG-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C231/00—Preparation of carboxylic acid amides
- C07C231/02—Preparation of carboxylic acid amides from carboxylic acids or from esters, anhydrides, or halides thereof by reaction with ammonia or amines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3209800A DE3209800C2 (de) | 1982-03-18 | 1982-03-18 | Verfahren zur Herstellung von N-(tert. Aminoalkyl)acrylamiden |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD207198A5 true DD207198A5 (de) | 1984-02-22 |
Family
ID=6158551
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD83248917A DD207198A5 (de) | 1982-03-18 | 1983-03-17 | Verfahren zur herstellung von n-(tert.aminoalkyl)acrylamiden |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4582933A (enExample) |
| EP (1) | EP0089557B1 (enExample) |
| JP (1) | JPS58170741A (enExample) |
| AT (1) | ATE14217T1 (enExample) |
| CA (1) | CA1189873A (enExample) |
| DD (1) | DD207198A5 (enExample) |
| DE (2) | DE3209800C2 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0150011A3 (en) * | 1984-01-20 | 1986-07-30 | Dietrich Dr. Schuster | Catalytic process for the preparation of amides |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS62187710A (ja) * | 1986-02-14 | 1987-08-17 | Kohjin Co Ltd | アクリルモノマ−用重合禁止剤 |
| JP3027275B2 (ja) * | 1991-12-23 | 2000-03-27 | ゼネラル・エレクトリック・カンパニイ | モニタスクリーン上でカーソルを位置させる装置 |
| IT1256162B (it) * | 1992-10-27 | 1995-11-29 | Zambon Spa | Processo per la preparazione di un intermedio della sintesi organica |
| FR2789999B1 (fr) * | 1999-02-18 | 2004-05-28 | Arc Chimie | Procede de traitement des melanges d'hydrocarbures contenant des asphaltenes |
| DE102006047617B4 (de) * | 2006-10-09 | 2008-11-27 | Clariant International Limited | Verfahren zur Herstellung basischer (Meth)acrylamide |
| DE102006047620B4 (de) | 2006-10-09 | 2008-11-27 | Clariant International Limited | Verfahren zur Herstellung tertiärer Amide von Alkylphenylcarbonsäuren |
| DE102006047619B4 (de) * | 2006-10-09 | 2008-11-13 | Clariant International Limited | Verfahren zur Herstellung basischer Fettsäureamide |
| DE102006047618B3 (de) | 2006-10-09 | 2007-11-15 | Clariant International Limited | Verfahren zur Herstellung von Bisbenzoxazolen |
| BRPI0719896A2 (pt) | 2006-10-09 | 2014-10-07 | Clariant Finance Bvi Ltd | Processo para a preparação de alcanolamidas de ácidos graxos |
| DE102008017213B4 (de) * | 2008-04-04 | 2012-08-09 | Clariant International Limited | Kontinuierliches Verfahren zur Herstellung von Amiden aliphatischer Hydroxycarbonsäuren |
| DE102008017219A1 (de) * | 2008-04-04 | 2009-10-08 | Clariant International Ltd. | Verfahren zur Herstellung von Amiden in Gegenwart von überhitztem Wasser |
| DE102008017214B4 (de) * | 2008-04-04 | 2012-02-16 | Clariant International Limited | Kontinuierliches Verfahren zur Herstellung von Fettsäurealkanolamiden |
| DE102008017215B4 (de) * | 2008-04-04 | 2012-08-09 | Clariant International Ltd. | Kontinuierliches Verfahren zur Herstellung von Amiden ethylenisch ungesättigter Carbonsäuren |
| DE102008017218B4 (de) * | 2008-04-04 | 2011-09-22 | Clariant International Ltd. | Kontinuierliches Verfahren zur Herstellung von Amiden niederer aliphatischer Carbonsäuren |
| DE102008017217A1 (de) * | 2008-04-04 | 2009-10-08 | Clariant International Ltd. | Kontinuierliches Verfahren zur Herstellung von Amiden aromatischer Carbonsäuren |
| DE102008017216B4 (de) | 2008-04-04 | 2013-08-14 | Clariant International Ltd. | Kontinuierliches Verfahren zur Herstellung von Fettsäureamiden |
| DE102009031059A1 (de) | 2009-06-30 | 2011-01-05 | Clariant International Ltd. | Vorrichtung zur kontinuierlichen Durchführung chemischer Reaktionen bei hohen Temperaturen |
| DE102009042522A1 (de) | 2009-09-22 | 2011-04-07 | Clariant International Ltd. | Kontinuierliches Umesterungsverfahren |
| DE102009042523B4 (de) | 2009-09-22 | 2012-02-16 | Clariant International Ltd. | Vorrichtung und Verfahren zur kontinuierlichen Durchführung heterogen katalysierter chemischer Reaktionen bei hohen Temperaturen |
| DE102010056565A1 (de) | 2010-12-30 | 2012-07-05 | Clariant International Ltd. | Verfahren zur Modifizierung Hydroxylgruppen tragender Polymere |
| DE102010056564A1 (de) | 2010-12-30 | 2012-07-05 | Clariant International Limited | Hydroxylgruppen und Estergruppen tragende Polymere und Verfahren zu ihrer Herstellung |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2595907A (en) * | 1950-12-30 | 1952-05-06 | American Cyanamid Co | Polymerizable and polymerized acrylonitrile-dialkylaminopropylacrylamide compositions |
| US2719177A (en) * | 1953-03-18 | 1955-09-27 | Eastman Kodak Co | N-substituted acrylamides by vapor phase method using acrylic acids |
| US3200150A (en) * | 1962-05-02 | 1965-08-10 | Fmc Corp | Process for the preparation of amides |
| US3652671A (en) * | 1970-06-01 | 1972-03-28 | Dow Chemical Co | Process for making a cationic methacrylamide |
| US3878247A (en) * | 1974-01-25 | 1975-04-15 | Jefferson Chem Co Inc | Preparation of n-(tertiaryaminoalkyl) acrylamides |
| US4031138A (en) * | 1976-03-18 | 1977-06-21 | Texaco Development Corporation | Stable substituted acrylamides or methacrylamides |
| DE2809102C2 (de) * | 1978-03-03 | 1986-12-04 | Röhm GmbH, 6100 Darmstadt | Verfahren zur Herstellung von α,β-ungesättigen Carbonsäureamiden |
| DE2816516C2 (de) * | 1978-04-17 | 1985-05-15 | Röhm GmbH, 6100 Darmstadt | Verfahren zur Herstellung N-substituierter Acryl- und Methacrylamide |
| IN151693B (enExample) * | 1978-05-05 | 1983-07-02 | Stockhausen & Cie Chem Fab | |
| DE2856383C2 (de) * | 1978-12-27 | 1982-11-25 | Chemische Fabrik Stockhausen GmbH, 4150 Krefeld | Verfahren zur Herstellung von alpha, beta -ungesättigten N-substituierten Säureamiden und ihre Verwendung zur Herstellung von Polymerisaten sowie das N-(2,2-Dimethyl-3-dimethylaminopropyl)-crotonsäureamid |
| ATE15377T1 (de) * | 1978-12-27 | 1985-09-15 | Stockhausen Chem Fab Gmbh | Polymerisate von alpha,beta-ungesaettigten nsubstituierten carbonsaeureamiden und ihre verwendung als sedimentations-, flockungs-, entwaesserungs- und retentionshilfsmittel. |
| JPS5742661A (en) * | 1980-08-29 | 1982-03-10 | Mitsubishi Chem Ind Ltd | Preparation of n- dialkylaminoalkyl acrylamide |
| DE3130508A1 (de) * | 1981-08-01 | 1983-02-17 | Röhm GmbH, 6100 Darmstadt | "verfahren zur herstellung von methacryl- und acrylamiden" |
-
1982
- 1982-03-18 DE DE3209800A patent/DE3209800C2/de not_active Expired - Lifetime
-
1983
- 1983-03-10 AT AT83102335T patent/ATE14217T1/de not_active IP Right Cessation
- 1983-03-10 EP EP83102335A patent/EP0089557B1/de not_active Expired
- 1983-03-10 DE DE8383102335T patent/DE3360371D1/de not_active Expired
- 1983-03-11 CA CA000423405A patent/CA1189873A/en not_active Expired
- 1983-03-17 DD DD83248917A patent/DD207198A5/de unknown
- 1983-03-17 JP JP58045829A patent/JPS58170741A/ja active Granted
- 1983-03-17 US US06/476,095 patent/US4582933A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0150011A3 (en) * | 1984-01-20 | 1986-07-30 | Dietrich Dr. Schuster | Catalytic process for the preparation of amides |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3209800A1 (de) | 1983-09-29 |
| US4582933A (en) | 1986-04-15 |
| ATE14217T1 (de) | 1985-07-15 |
| JPS58170741A (ja) | 1983-10-07 |
| DE3209800C2 (de) | 1990-03-08 |
| JPH0237913B2 (enExample) | 1990-08-28 |
| DE3360371D1 (en) | 1985-08-14 |
| EP0089557A1 (de) | 1983-09-28 |
| EP0089557B1 (de) | 1985-07-10 |
| CA1189873A (en) | 1985-07-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD207198A5 (de) | Verfahren zur herstellung von n-(tert.aminoalkyl)acrylamiden | |
| DE2816516C2 (de) | Verfahren zur Herstellung N-substituierter Acryl- und Methacrylamide | |
| CH640512A5 (de) | Verfahren zur herstellung von alpha, beta-ungesaettigten, n-substituierten carbonsaeureamiden. | |
| DE3028792C2 (enExample) | ||
| DE3039572C2 (enExample) | ||
| EP0070424B1 (de) | Verfahren zur Herstellung von N,N'-disubstituierten 3-Aminopropanamiden | |
| DE2738388C2 (enExample) | ||
| EP0151967B1 (de) | Verfahren zur Herstellung von N-substituierten, alpha, beta-ungesättigten Carbonsäureamiden | |
| EP0010165B1 (de) | Verfahren zur Herstellung von 6-Hydroxypyrid-2-onen | |
| DE2836520C2 (de) | Verfahren zur Herstellung von alpha , beta -ungesättigten, N-substituierten Carbonsäureamiden | |
| EP0171046B1 (de) | Verfahren zur Herstellung von Pantolacton | |
| DE2658300A1 (de) | 3,5-bis-(acylamino)-benzamide | |
| DE1272914B (de) | Verfahren zur Herstellung von Cyanessigsaeureestern | |
| DE2217494C2 (de) | Verfahren zur Herstellung von Alkoxypropionitrilen | |
| DE808835C (de) | Verfahren zur Herstellung von Nitrilen | |
| DE2549957C3 (de) | Verfahren zur Herstellung von Naphthylaminen | |
| EP0064702B1 (de) | 4-tert.-Butoxybenzylamine | |
| DE948157C (de) | Verfahren zur Herstellung von mono- und di-ª‡-cyanaethylierten Ketiminen | |
| DE2544504C2 (de) | Verfahren zur Herstellung von Diarylaminen | |
| DE933028C (de) | Verfahren zur Herstellung von am zentralen Kohlenstoffatom substituierten Diarylacetonitrilen | |
| DE1140583B (de) | Verfahren zur Herstellung von o-[Bis-(2-chloraethyl)-amino]-phenyl-alanin | |
| AT162933B (de) | Verfahren zur Herstellung von neuen Amiden α, β-ungesättigter Carbonsäuren | |
| DE1151516B (de) | Verfahren zur Herstellung von ª†-Aminoalkoholen mit quartaerem ª‰-C-Atom | |
| AT233594B (de) | Verfahren zur Herstellung von 0,0-Dimethylthionothiolphosphorylessigsäuremonomethylamid | |
| DE940528C (de) | Verfahren zur Herstellung von Acrylsaeureamid und ª‡-substituierten Acrylsaeureamiden |