CZ47493A3 - Pyridyloxy derivatives, process of their preparation and pharmaceutical preparations containing thereof - Google Patents
Pyridyloxy derivatives, process of their preparation and pharmaceutical preparations containing thereof Download PDFInfo
- Publication number
- CZ47493A3 CZ47493A3 CZ93474A CZ47493A CZ47493A3 CZ 47493 A3 CZ47493 A3 CZ 47493A3 CZ 93474 A CZ93474 A CZ 93474A CZ 47493 A CZ47493 A CZ 47493A CZ 47493 A3 CZ47493 A3 CZ 47493A3
- Authority
- CZ
- Czechia
- Prior art keywords
- group
- methyl
- substituents
- pip
- substituted
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 97
- 238000002360 preparation method Methods 0.000 title claims description 39
- 125000005554 pyridyloxy group Chemical group 0.000 title claims description 17
- 239000000825 pharmaceutical preparation Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 249
- 150000003839 salts Chemical class 0.000 claims abstract description 41
- 125000003118 aryl group Chemical group 0.000 claims abstract description 40
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 39
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims abstract description 21
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 16
- 125000004663 dialkyl amino group Chemical group 0.000 claims abstract description 14
- 125000003277 amino group Chemical group 0.000 claims abstract description 12
- 125000001118 alkylidene group Chemical group 0.000 claims abstract description 11
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 9
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 8
- 125000004122 cyclic group Chemical group 0.000 claims abstract description 8
- 230000000767 anti-ulcer Effects 0.000 claims abstract description 6
- 125000000547 substituted alkyl group Chemical group 0.000 claims abstract description 5
- -1 pireridine Chemical group 0.000 claims description 1408
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 824
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 429
- 125000001424 substituent group Chemical group 0.000 claims description 202
- 239000000203 mixture Substances 0.000 claims description 96
- 125000004432 carbon atom Chemical group C* 0.000 claims description 87
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 53
- 229910052799 carbon Inorganic materials 0.000 claims description 47
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 45
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 39
- 229910052757 nitrogen Inorganic materials 0.000 claims description 35
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 32
- 150000001721 carbon Chemical group 0.000 claims description 26
- 125000006413 ring segment Chemical group 0.000 claims description 25
- 229910052760 oxygen Inorganic materials 0.000 claims description 24
- 239000001301 oxygen Substances 0.000 claims description 24
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 21
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 21
- 229910052717 sulfur Inorganic materials 0.000 claims description 21
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 20
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 19
- 125000004429 atom Chemical group 0.000 claims description 19
- 125000005842 heteroatom Chemical group 0.000 claims description 17
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 16
- 239000011593 sulfur Substances 0.000 claims description 16
- 239000002585 base Substances 0.000 claims description 15
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 15
- 125000001544 thienyl group Chemical group 0.000 claims description 15
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 14
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 13
- 125000000335 thiazolyl group Chemical group 0.000 claims description 13
- 208000025865 Ulcer Diseases 0.000 claims description 12
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 12
- 125000002883 imidazolyl group Chemical group 0.000 claims description 12
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 12
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 claims description 11
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 11
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 claims description 10
- GYBTXQZBDYKYPG-DJWKRKHSSA-N 2-(2-hydroxyethylsulfanyl)-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]acetamide Chemical compound C1=NC(OC\C=C/CNC(=O)CSCCO)=CC(CN2CCCCC2)=C1 GYBTXQZBDYKYPG-DJWKRKHSSA-N 0.000 claims description 10
- 125000002541 furyl group Chemical group 0.000 claims description 10
- 125000002971 oxazolyl group Chemical group 0.000 claims description 10
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 9
- 125000005201 cycloalkylcarbonyloxy group Chemical group 0.000 claims description 9
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 9
- 231100000397 ulcer Toxicity 0.000 claims description 9
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 8
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 8
- 125000006239 protecting group Chemical group 0.000 claims description 8
- 125000004076 pyridyl group Chemical group 0.000 claims description 8
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 claims description 8
- 150000003568 thioethers Chemical class 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- 238000011282 treatment Methods 0.000 claims description 7
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 6
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 6
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 6
- 239000008194 pharmaceutical composition Substances 0.000 claims description 6
- 125000003386 piperidinyl group Chemical group 0.000 claims description 6
- 125000004434 sulfur atom Chemical group 0.000 claims description 6
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 6
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 6
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims description 6
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 claims description 5
- LOLKAJARZKDJTD-UHFFFAOYSA-N 4-Ethoxy-4-oxobutanoic acid Chemical compound CCOC(=O)CCC(O)=O LOLKAJARZKDJTD-UHFFFAOYSA-N 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000004423 acyloxy group Chemical group 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 5
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 claims description 4
- RVKNJSSYDLXEPA-DAXSKMNVSA-N 2-[2-oxo-2-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]ethyl]sulfanylethyl propanoate Chemical compound C1=NC(OC\C=C/CNC(=O)CSCCOC(=O)CC)=CC(CN2CCCCC2)=C1 RVKNJSSYDLXEPA-DAXSKMNVSA-N 0.000 claims description 4
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 125000005199 aryl carbonyloxy group Chemical group 0.000 claims description 4
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 claims description 4
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 claims description 4
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 125000001153 fluoro group Chemical group F* 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000001786 isothiazolyl group Chemical group 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- DOQNXPUJDNVKGS-UTCJRWHESA-N 2-[2-oxo-2-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]ethyl]sulfanylethyl acetate Chemical compound C1=NC(OC\C=C/CNC(=O)CSCCOC(=O)C)=CC(CN2CCCCC2)=C1 DOQNXPUJDNVKGS-UTCJRWHESA-N 0.000 claims description 3
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 3
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 3
- 125000004658 aryl carbonyl amino group Chemical group 0.000 claims description 3
- LNQUWGZAZIOHMM-UHFFFAOYSA-N ethoxy-hydroxy-methoxy-lambda3-chlorane Chemical compound CCOCl(O)OC LNQUWGZAZIOHMM-UHFFFAOYSA-N 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000001715 oxadiazolyl group Chemical group 0.000 claims description 3
- 238000011321 prophylaxis Methods 0.000 claims description 3
- DVVNHLJPEOIKOA-YVMONPNESA-N 2-[2-oxo-2-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]ethyl]sulfanylethyl 2,2-dimethylpropanoate Chemical compound C1=NC(OC\C=C/CNC(=O)CSCCOC(=O)C(C)(C)C)=CC(CN2CCCCC2)=C1 DVVNHLJPEOIKOA-YVMONPNESA-N 0.000 claims description 2
- VBLBAQMHDGZSAN-YVMONPNESA-N 2-[2-oxo-2-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]ethyl]sulfanylethyl 3,3-dimethylbutanoate Chemical compound C1=NC(OC\C=C/CNC(=O)CSCCOC(=O)CC(C)(C)C)=CC(CN2CCCCC2)=C1 VBLBAQMHDGZSAN-YVMONPNESA-N 0.000 claims description 2
- KJQJTGNYBOZTPM-YVMONPNESA-N 2-[2-oxo-2-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]ethyl]sulfanylethyl benzoate Chemical compound C=1C(CN2CCCCC2)=CC=NC=1OC\C=C/CNC(=O)CSCCOC(=O)C1=CC=CC=C1 KJQJTGNYBOZTPM-YVMONPNESA-N 0.000 claims description 2
- LARMFXGRXNYEAE-DAXSKMNVSA-N 2-[2-oxo-2-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]ethyl]sulfanylethyl butanoate Chemical compound C1=NC(OC\C=C/CNC(=O)CSCCOC(=O)CCC)=CC(CN2CCCCC2)=C1 LARMFXGRXNYEAE-DAXSKMNVSA-N 0.000 claims description 2
- OYNSFGMENZBISK-YVMONPNESA-N 2-[2-oxo-2-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]ethyl]sulfanylethyl cyclohexanecarboxylate Chemical compound C=1C(CN2CCCCC2)=CC=NC=1OC\C=C/CNC(=O)CSCCOC(=O)C1CCCCC1 OYNSFGMENZBISK-YVMONPNESA-N 0.000 claims description 2
- 150000001340 alkali metals Chemical group 0.000 claims description 2
- 125000001589 carboacyl group Chemical group 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- ZOXWMKHSGHJITK-DJWKRKHSSA-N n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]-1h-pyrazole-4-carboxamide Chemical compound C1=NNC=C1C(=O)NC\C=C/COC(N=CC=1)=CC=1CN1CCCCC1 ZOXWMKHSGHJITK-DJWKRKHSSA-N 0.000 claims description 2
- YQLBJYAGYYYNLE-DJWKRKHSSA-N n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]-4-pyrimidin-2-ylsulfanylbutanamide Chemical compound C=1C(CN2CCCCC2)=CC=NC=1OC\C=C/CNC(=O)CCCSC1=NC=CC=N1 YQLBJYAGYYYNLE-DJWKRKHSSA-N 0.000 claims description 2
- DJPHISIRZWTUGL-DJWKRKHSSA-N 5-amino-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]-1h-pyrazole-4-carboxamide Chemical compound NC1=NNC=C1C(=O)NC\C=C/COC1=CC(CN2CCCCC2)=CC=N1 DJPHISIRZWTUGL-DJWKRKHSSA-N 0.000 claims 1
- RJSYPKWVIJGNLO-UHFFFAOYSA-N CCOClOC Chemical compound CCOClOC RJSYPKWVIJGNLO-UHFFFAOYSA-N 0.000 claims 1
- 125000003282 alkyl amino group Chemical group 0.000 claims 1
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical compound COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 claims 1
- 239000008024 pharmaceutical diluent Substances 0.000 claims 1
- 230000000694 effects Effects 0.000 abstract description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 246
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 198
- 238000006243 chemical reaction Methods 0.000 description 166
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Substances OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 131
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 110
- 239000002904 solvent Substances 0.000 description 100
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 97
- 239000000243 solution Substances 0.000 description 85
- 239000007858 starting material Substances 0.000 description 82
- 238000000862 absorption spectrum Methods 0.000 description 67
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 66
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N EtOH Substances CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 56
- 239000003921 oil Substances 0.000 description 55
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 53
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 51
- 239000011541 reaction mixture Substances 0.000 description 50
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 46
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 40
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 39
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 36
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 36
- 239000003153 chemical reaction reagent Substances 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 36
- GEKLDGQKEZAPFZ-UHFFFAOYSA-N 2-(ethylamino)-1-(3-methylphenyl)propan-1-one Chemical compound CCNC(C)C(=O)C1=CC=CC(C)=C1 GEKLDGQKEZAPFZ-UHFFFAOYSA-N 0.000 description 30
- 238000010898 silica gel chromatography Methods 0.000 description 28
- LSWHRGCYVNXXLD-DJWKRKHSSA-N (z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-en-1-amine Chemical compound C1=NC(OC\C=C/CN)=CC(CN2CCCCC2)=C1 LSWHRGCYVNXXLD-DJWKRKHSSA-N 0.000 description 27
- 239000003480 eluent Substances 0.000 description 27
- 238000001704 evaporation Methods 0.000 description 27
- 230000008020 evaporation Effects 0.000 description 27
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 26
- 239000002253 acid Substances 0.000 description 25
- 239000000843 powder Substances 0.000 description 24
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 23
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 22
- 238000001228 spectrum Methods 0.000 description 22
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 21
- UIIMBOGNXHQVGW-UHFFFAOYSA-M sodium bicarbonate Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 20
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 19
- 238000004821 distillation Methods 0.000 description 18
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 17
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 17
- 150000002170 ethers Chemical class 0.000 description 16
- 150000008282 halocarbons Chemical class 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- 229920006395 saturated elastomer Polymers 0.000 description 15
- 125000004521 1,3,4-thiadiazol-2-yl group Chemical group S1C(=NN=C1)* 0.000 description 14
- 239000012141 concentrate Substances 0.000 description 14
- 235000008504 concentrate Nutrition 0.000 description 14
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 13
- 238000001816 cooling Methods 0.000 description 13
- 239000012442 inert solvent Substances 0.000 description 13
- 231100000989 no adverse effect Toxicity 0.000 description 13
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 12
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 12
- 239000000460 chlorine Substances 0.000 description 12
- 150000002148 esters Chemical class 0.000 description 12
- XYCMVFLHLLJKOI-DJWKRKHSSA-N 4-chloro-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]butanamide Chemical compound C1=NC(OC\C=C/CNC(=O)CCCCl)=CC(CN2CCCCC2)=C1 XYCMVFLHLLJKOI-DJWKRKHSSA-N 0.000 description 11
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 11
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 11
- 150000001412 amines Chemical class 0.000 description 11
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 11
- 239000008096 xylene Substances 0.000 description 11
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 10
- 150000007513 acids Chemical class 0.000 description 10
- 150000001298 alcohols Chemical class 0.000 description 10
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 10
- 235000017557 sodium bicarbonate Nutrition 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 9
- 210000004051 gastric juice Anatomy 0.000 description 9
- 230000005764 inhibitory process Effects 0.000 description 9
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 9
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 8
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 8
- 238000005481 NMR spectroscopy Methods 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- 150000001408 amides Chemical class 0.000 description 8
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- 125000001305 1,2,4-triazol-3-yl group Chemical group [H]N1N=C([*])N=C1[H] 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 7
- 150000002825 nitriles Chemical class 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- 230000028327 secretion Effects 0.000 description 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 6
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 6
- 125000004512 1,2,3-thiadiazol-4-yl group Chemical group S1N=NC(=C1)* 0.000 description 6
- 125000001414 1,2,4-triazol-5-yl group Chemical group [H]N1N=C([H])N=C1[*] 0.000 description 6
- 125000004509 1,3,4-oxadiazol-2-yl group Chemical group O1C(=NN=C1)* 0.000 description 6
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 6
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 6
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 6
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 6
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 6
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- 150000008065 acid anhydrides Chemical class 0.000 description 6
- 150000008064 anhydrides Chemical class 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- 210000002784 stomach Anatomy 0.000 description 6
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 6
- 125000004515 1,2,4-thiadiazol-3-yl group Chemical group S1N=C(N=C1)* 0.000 description 5
- 125000004518 1,2,5-thiadiazol-3-yl group Chemical group S1N=C(C=N1)* 0.000 description 5
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 5
- RTYWRWNJRVRDPQ-DJWKRKHSSA-N 2-chloro-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]acetamide Chemical compound C1=NC(OC\C=C/CNC(=O)CCl)=CC(CN2CCCCC2)=C1 RTYWRWNJRVRDPQ-DJWKRKHSSA-N 0.000 description 5
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 5
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 5
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 5
- 238000010521 absorption reaction Methods 0.000 description 5
- 239000004202 carbamide Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 230000006378 damage Effects 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 230000002496 gastric effect Effects 0.000 description 5
- 235000011167 hydrochloric acid Nutrition 0.000 description 5
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 5
- 238000001226 reprecipitation Methods 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- 125000004516 1,2,4-thiadiazol-5-yl group Chemical group S1N=CN=C1* 0.000 description 4
- NTQWRATXYSFYJX-UHFFFAOYSA-N 1,4-oxathian-2-one Chemical compound O=C1CSCCO1 NTQWRATXYSFYJX-UHFFFAOYSA-N 0.000 description 4
- MDBMOJJCRGYOPH-UHFFFAOYSA-N 2-(2-hydroxyethylsulfanyl)-n-[3-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropyl]acetamide Chemical compound C1=NC(OCCCNC(=O)CSCCO)=CC(CN2CCCCC2)=C1 MDBMOJJCRGYOPH-UHFFFAOYSA-N 0.000 description 4
- AAEOEVRPMYKMKS-UHFFFAOYSA-N 3-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropan-1-amine Chemical compound C1=NC(OCCCN)=CC(CN2CCCCC2)=C1 AAEOEVRPMYKMKS-UHFFFAOYSA-N 0.000 description 4
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 4
- IMBBXSASDSZJSX-UHFFFAOYSA-N 4-Carboxypyrazole Chemical compound OC(=O)C=1C=NNC=1 IMBBXSASDSZJSX-UHFFFAOYSA-N 0.000 description 4
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 208000007107 Stomach Ulcer Diseases 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- 238000007796 conventional method Methods 0.000 description 4
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 4
- ZWWWLCMDTZFSOO-UHFFFAOYSA-N diethoxyphosphorylformonitrile Chemical compound CCOP(=O)(C#N)OCC ZWWWLCMDTZFSOO-UHFFFAOYSA-N 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 4
- 229960001340 histamine Drugs 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 239000002480 mineral oil Substances 0.000 description 4
- 235000010446 mineral oil Nutrition 0.000 description 4
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 4
- 210000004877 mucosa Anatomy 0.000 description 4
- YKYONYBAUNKHLG-UHFFFAOYSA-N n-Propyl acetate Natural products CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 230000003389 potentiating effect Effects 0.000 description 4
- 230000002265 prevention Effects 0.000 description 4
- 229940090181 propyl acetate Drugs 0.000 description 4
- 230000001681 protective effect Effects 0.000 description 4
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 4
- WRHZVMBBRYBTKZ-UHFFFAOYSA-N pyrrole-2-carboxylic acid Chemical compound OC(=O)C1=CC=CN1 WRHZVMBBRYBTKZ-UHFFFAOYSA-N 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- 125000004299 tetrazol-5-yl group Chemical group [H]N1N=NC(*)=N1 0.000 description 4
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 4
- 125000001359 1,2,3-triazol-4-yl group Chemical group [H]N1N=NC([*])=C1[H] 0.000 description 3
- 125000001766 1,2,4-oxadiazol-3-yl group Chemical group [H]C1=NC(*)=NO1 0.000 description 3
- ZPFVYBLYHOACKO-UHFFFAOYSA-N 2-(2-hydroxyethylsulfanyl)-n-[4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybutyl]acetamide Chemical compound C1=NC(OCCCCNC(=O)CSCCO)=CC(CN2CCCCC2)=C1 ZPFVYBLYHOACKO-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- XZBXAYCCBFTQHH-UHFFFAOYSA-N 3-chloropropylbenzene Chemical compound ClCCCC1=CC=CC=C1 XZBXAYCCBFTQHH-UHFFFAOYSA-N 0.000 description 3
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 208000027418 Wounds and injury Diseases 0.000 description 3
- 239000002250 absorbent Substances 0.000 description 3
- 230000002745 absorbent Effects 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 3
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 150000004292 cyclic ethers Chemical group 0.000 description 3
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 208000000718 duodenal ulcer Diseases 0.000 description 3
- 210000004211 gastric acid Anatomy 0.000 description 3
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 208000014674 injury Diseases 0.000 description 3
- 229960004592 isopropanol Drugs 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 3
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 3
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 3
- 150000003254 radicals Chemical group 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 150000003462 sulfoxides Chemical class 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 238000000870 ultraviolet spectroscopy Methods 0.000 description 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 2
- 125000001724 1,2,3-oxadiazol-4-yl group Chemical group [H]C1=C(*)N=NO1 0.000 description 2
- 125000004505 1,2,4-oxadiazol-5-yl group Chemical group O1N=CN=C1* 0.000 description 2
- 125000004507 1,2,5-oxadiazol-3-yl group Chemical group O1N=C(C=N1)* 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- 125000004317 1,3,5-triazin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=N1 0.000 description 2
- XOHZHMUQBFJTNH-UHFFFAOYSA-N 1-methyl-2h-tetrazole-5-thione Chemical compound CN1N=NN=C1S XOHZHMUQBFJTNH-UHFFFAOYSA-N 0.000 description 2
- FETFXNFGOYOOSP-UHFFFAOYSA-N 1-sulfanylpropan-2-ol Chemical compound CC(O)CS FETFXNFGOYOOSP-UHFFFAOYSA-N 0.000 description 2
- AFBBKYQYNPNMAT-UHFFFAOYSA-N 1h-1,2,4-triazol-1-ium-3-thiolate Chemical compound SC=1N=CNN=1 AFBBKYQYNPNMAT-UHFFFAOYSA-N 0.000 description 2
- ZVXKYWHJBYIYNI-UHFFFAOYSA-N 1h-pyrazole-4-carboxamide Chemical compound NC(=O)C=1C=NNC=1 ZVXKYWHJBYIYNI-UHFFFAOYSA-N 0.000 description 2
- KOPFEFZSAMLEHK-UHFFFAOYSA-N 1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1C=CNN=1 KOPFEFZSAMLEHK-UHFFFAOYSA-N 0.000 description 2
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 2
- CIHZCANEMUJTCI-UHFFFAOYSA-N 2-(2-hydroxyethylsulfanyl)-n-[5-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypentyl]acetamide Chemical compound C1=NC(OCCCCCNC(=O)CSCCO)=CC(CN2CCCCC2)=C1 CIHZCANEMUJTCI-UHFFFAOYSA-N 0.000 description 2
- JKZVUPQWLXNIPR-DJWKRKHSSA-N 2-(3-hydroxypropylsulfanyl)-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]acetamide Chemical compound C1=NC(OC\C=C/CNC(=O)CSCCCO)=CC(CN2CCCCC2)=C1 JKZVUPQWLXNIPR-DJWKRKHSSA-N 0.000 description 2
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 2
- ZRSDCWGAFBYVLB-UHFFFAOYSA-N 2-[2-oxo-2-[4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybutylamino]ethyl]sulfanylethyl acetate Chemical compound C1=NC(OCCCCNC(=O)CSCCOC(=O)C)=CC(CN2CCCCC2)=C1 ZRSDCWGAFBYVLB-UHFFFAOYSA-N 0.000 description 2
- SEZAMAPIDDGNLV-UHFFFAOYSA-N 2-[2-oxo-2-[5-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypentylamino]ethyl]sulfanylethyl acetate Chemical compound C1=NC(OCCCCCNC(=O)CSCCOC(=O)C)=CC(CN2CCCCC2)=C1 SEZAMAPIDDGNLV-UHFFFAOYSA-N 0.000 description 2
- XWPDHVIFLSSJIZ-DAXSKMNVSA-N 2-[5-oxo-5-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]pentyl]sulfanylethyl acetate Chemical compound C1=NC(OC\C=C/CNC(=O)CCCCSCCOC(=O)C)=CC(CN2CCCCC2)=C1 XWPDHVIFLSSJIZ-DAXSKMNVSA-N 0.000 description 2
- DDOQVMNQXVFAGA-UHFFFAOYSA-N 2-chloro-n-[3-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropyl]acetamide Chemical compound C1=NC(OCCCNC(=O)CCl)=CC(CN2CCCCC2)=C1 DDOQVMNQXVFAGA-UHFFFAOYSA-N 0.000 description 2
- QRAFJHXNLQTXQW-UHFFFAOYSA-N 2-methylpropyl hydrogen carbonate Chemical compound CC(C)COC(O)=O QRAFJHXNLQTXQW-UHFFFAOYSA-N 0.000 description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 2
- DLQGOEJQJWXQRJ-DJWKRKHSSA-N 4-(2-hydroxyethylsulfanyl)-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]butanamide Chemical compound C1=NC(OC\C=C/CNC(=O)CCCSCCO)=CC(CN2CCCCC2)=C1 DLQGOEJQJWXQRJ-DJWKRKHSSA-N 0.000 description 2
- SFHAXPBOIIQYEP-UHFFFAOYSA-N 4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybutan-1-amine Chemical compound C1=NC(OCCCCN)=CC(CN2CCCCC2)=C1 SFHAXPBOIIQYEP-UHFFFAOYSA-N 0.000 description 2
- QVIIQZFCPCJYBT-UHFFFAOYSA-N 5-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypentan-1-amine Chemical compound C1=NC(OCCCCCN)=CC(CN2CCCCC2)=C1 QVIIQZFCPCJYBT-UHFFFAOYSA-N 0.000 description 2
- CXZGPJGOFYCCKJ-YVMONPNESA-N 6-bromo-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]hexanamide Chemical compound C1=NC(OC\C=C/CNC(=O)CCCCCBr)=CC(CN2CCCCC2)=C1 CXZGPJGOFYCCKJ-YVMONPNESA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- 229940126062 Compound A Drugs 0.000 description 2
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- 229940121948 Muscarinic receptor antagonist Drugs 0.000 description 2
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 2
- 208000008469 Peptic Ulcer Diseases 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 125000005910 alkyl carbonate group Chemical group 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000000812 cholinergic antagonist Substances 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- MVLFZSOUJWRVJN-UHFFFAOYSA-N ethyl 4-hydroxy-1,2-oxazole-3-carboxylate Chemical compound CCOC(=O)C1=NOC=C1O MVLFZSOUJWRVJN-UHFFFAOYSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 2
- WPOPBEXJJONVMH-DAXSKMNVSA-N methyl 2-[5-oxo-5-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]pentyl]sulfanylacetate Chemical compound C1=NC(OC\C=C/CNC(=O)CCCCSCC(=O)OC)=CC(CN2CCCCC2)=C1 WPOPBEXJJONVMH-DAXSKMNVSA-N 0.000 description 2
- CXHHBNMLPJOKQD-UHFFFAOYSA-N methyl hydrogen carbonate Chemical compound COC(O)=O CXHHBNMLPJOKQD-UHFFFAOYSA-N 0.000 description 2
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 2
- YNDHRLSIIIUSNG-DJWKRKHSSA-N n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]-4-pyrimidin-4-ylsulfanylbutanamide Chemical compound C=1C(CN2CCCCC2)=CC=NC=1OC\C=C/CNC(=O)CCCSC1=CC=NC=N1 YNDHRLSIIIUSNG-DJWKRKHSSA-N 0.000 description 2
- PGGNPLYRJGQWKB-ARJAWSKDSA-N n-[(z)-4-[4-[(dimethylamino)methyl]pyridin-2-yl]oxybut-2-enyl]-2-(2-hydroxyethylsulfanyl)acetamide Chemical compound CN(C)CC1=CC=NC(OC\C=C/CNC(=O)CSCCO)=C1 PGGNPLYRJGQWKB-ARJAWSKDSA-N 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 235000012149 noodles Nutrition 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 2
- QIIPQYDSKRYMFG-UHFFFAOYSA-N phenyl hydrogen carbonate Chemical compound OC(=O)OC1=CC=CC=C1 QIIPQYDSKRYMFG-UHFFFAOYSA-N 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 2
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 2
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 2
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 2
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 2
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 description 2
- HBCQSNAFLVXVAY-UHFFFAOYSA-N pyrimidine-2-thiol Chemical compound SC1=NC=CC=N1 HBCQSNAFLVXVAY-UHFFFAOYSA-N 0.000 description 2
- DOYOPBSXEIZLRE-UHFFFAOYSA-N pyrrole-3-carboxylic acid Chemical compound OC(=O)C=1C=CNC=1 DOYOPBSXEIZLRE-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 229940044551 receptor antagonist Drugs 0.000 description 2
- 239000002464 receptor antagonist Substances 0.000 description 2
- NVDKUGRZKXOIBR-UTCJRWHESA-N s-[4-oxo-4-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]butyl] ethanethioate Chemical compound C1=NC(OC\C=C/CNC(=O)CCCSC(=O)C)=CC(CN2CCCCC2)=C1 NVDKUGRZKXOIBR-UTCJRWHESA-N 0.000 description 2
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 description 2
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 2
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- DENPQNAWGQXKCU-UHFFFAOYSA-N thiophene-2-carboxamide Chemical compound NC(=O)C1=CC=CS1 DENPQNAWGQXKCU-UHFFFAOYSA-N 0.000 description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- ONDSBJMLAHVLMI-UHFFFAOYSA-N trimethylsilyldiazomethane Chemical compound C[Si](C)(C)[CH-][N+]#N ONDSBJMLAHVLMI-UHFFFAOYSA-N 0.000 description 2
- 230000036269 ulceration Effects 0.000 description 2
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- PFJVIOBMBDFBCJ-UHFFFAOYSA-N (1z)-1-diazobutane Chemical compound CCCC=[N+]=[N-] PFJVIOBMBDFBCJ-UHFFFAOYSA-N 0.000 description 1
- HFVMEOPYDLEHBR-UHFFFAOYSA-N (2-fluorophenyl)-phenylmethanol Chemical compound C=1C=CC=C(F)C=1C(O)C1=CC=CC=C1 HFVMEOPYDLEHBR-UHFFFAOYSA-N 0.000 description 1
- HQZQYLGYCXEDHR-UHFFFAOYSA-N (2-methylphenyl) hydrogen carbonate Chemical compound CC1=CC=CC=C1OC(O)=O HQZQYLGYCXEDHR-UHFFFAOYSA-N 0.000 description 1
- NRQHBNNTBIDSRK-YRNVUSSQSA-N (4e)-4-[(4-methoxyphenyl)methylidene]-2-methyl-1,3-oxazol-5-one Chemical compound C1=CC(OC)=CC=C1\C=C\1C(=O)OC(C)=N/1 NRQHBNNTBIDSRK-YRNVUSSQSA-N 0.000 description 1
- PJBPUBIFRFCYHE-UHFFFAOYSA-N 1,2,3-Thiadiazole, 5-methyl- Chemical compound CC1=CN=NS1 PJBPUBIFRFCYHE-UHFFFAOYSA-N 0.000 description 1
- 125000004503 1,2,3-oxadiazol-5-yl group Chemical group O1N=NC=C1* 0.000 description 1
- 125000005918 1,2-dimethylbutyl group Chemical group 0.000 description 1
- LKYNGTHMKCTTQC-UHFFFAOYSA-N 1,2-oxazole-3-carboxamide Chemical compound NC(=O)C=1C=CON=1 LKYNGTHMKCTTQC-UHFFFAOYSA-N 0.000 description 1
- 125000003363 1,3,5-triazinyl group Chemical group N1=C(N=CN=C1)* 0.000 description 1
- NOIOGQJFLIPRBI-UHFFFAOYSA-N 1,3,5-trimethylpyrazole-4-carboxylic acid Chemical compound CC1=NN(C)C(C)=C1C(O)=O NOIOGQJFLIPRBI-UHFFFAOYSA-N 0.000 description 1
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- XSCGOEDJEMBHIL-FLIBITNWSA-N 1-(1,2-diphenylethyl)-3-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]urea Chemical compound C=1C=CC=CC=1CC(C=1C=CC=CC=1)NC(=O)NC\C=C/COC(N=CC=1)=CC=1CN1CCCCC1 XSCGOEDJEMBHIL-FLIBITNWSA-N 0.000 description 1
- JJKXYNAIQHKISA-TWGQIWQCSA-N 1-(1-phenylethyl)-3-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]urea Chemical compound C=1C=CC=CC=1C(C)NC(=O)NC\C=C/COC(N=CC=1)=CC=1CN1CCCCC1 JJKXYNAIQHKISA-TWGQIWQCSA-N 0.000 description 1
- LAIBRJVMZSXDFJ-YVMONPNESA-N 1-(3-methylbutan-2-yl)-3-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]urea Chemical compound C1=NC(OC\C=C/CNC(=O)NC(C)C(C)C)=CC(CN2CCCCC2)=C1 LAIBRJVMZSXDFJ-YVMONPNESA-N 0.000 description 1
- KVJDEADEYQGNMR-DAXSKMNVSA-N 1-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]-3-propan-2-ylurea Chemical compound C1=NC(OC\C=C/CNC(=O)NC(C)C)=CC(CN2CCCCC2)=C1 KVJDEADEYQGNMR-DAXSKMNVSA-N 0.000 description 1
- YPMVIOUQGGYGMV-UHFFFAOYSA-N 1-[3-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropyl]-3-propan-2-ylurea Chemical compound C1=NC(OCCCNC(=O)NC(C)C)=CC(CN2CCCCC2)=C1 YPMVIOUQGGYGMV-UHFFFAOYSA-N 0.000 description 1
- CGTARCOMKRZQFA-TWGQIWQCSA-N 1-cycloheptyl-3-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]urea Chemical compound C1CCCCCC1NC(=O)NC\C=C/COC(N=CC=1)=CC=1CN1CCCCC1 CGTARCOMKRZQFA-TWGQIWQCSA-N 0.000 description 1
- HRGDWXDMSYHCAL-YVMONPNESA-N 1-cyclohexyl-3-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]urea Chemical compound C1CCCCC1NC(=O)NC\C=C/COC(N=CC=1)=CC=1CN1CCCCC1 HRGDWXDMSYHCAL-YVMONPNESA-N 0.000 description 1
- CUFPRCMUOJMHDY-YFHOEESVSA-N 1-cyclooctyl-3-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]urea Chemical compound C1CCCCCCC1NC(=O)NC\C=C/COC(N=CC=1)=CC=1CN1CCCCC1 CUFPRCMUOJMHDY-YFHOEESVSA-N 0.000 description 1
- TZQACTPUPRTTTA-DAXSKMNVSA-N 1-cyclopentyl-3-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]urea Chemical compound C1CCCC1NC(=O)NC\C=C/COC(N=CC=1)=CC=1CN1CCCCC1 TZQACTPUPRTTTA-DAXSKMNVSA-N 0.000 description 1
- BZWJDKJBAVXCMH-UHFFFAOYSA-N 1-diazopropane Chemical compound CCC=[N+]=[N-] BZWJDKJBAVXCMH-UHFFFAOYSA-N 0.000 description 1
- SZLHXBVVOFDXDQ-YFHOEESVSA-N 1-heptan-2-yl-3-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]urea Chemical compound C1=NC(OC\C=C/CNC(=O)NC(C)CCCCC)=CC(CN2CCCCC2)=C1 SZLHXBVVOFDXDQ-YFHOEESVSA-N 0.000 description 1
- FZGBZDIQPYGGDV-UTCJRWHESA-N 1-methyl-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]pyrrole-2-carboxamide Chemical compound CN1C=CC=C1C(=O)NC\C=C/COC1=CC(CN2CCCCC2)=CC=N1 FZGBZDIQPYGGDV-UTCJRWHESA-N 0.000 description 1
- ILAOVOOZLVGAJF-UHFFFAOYSA-N 1-methylpyrrole-2-carboxylic acid Chemical compound CN1C=CC=C1C(O)=O ILAOVOOZLVGAJF-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 1
- BNYCHCAYYYRJSH-UHFFFAOYSA-N 1h-pyrazole-5-carboxamide Chemical compound NC(=O)C1=CC=NN1 BNYCHCAYYYRJSH-UHFFFAOYSA-N 0.000 description 1
- FHTDDANQIMVWKZ-UHFFFAOYSA-N 1h-pyridine-4-thione Chemical compound SC1=CC=NC=C1 FHTDDANQIMVWKZ-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- VEUMBMHMMCOFAG-UHFFFAOYSA-N 2,3-dihydrooxadiazole Chemical compound N1NC=CO1 VEUMBMHMMCOFAG-UHFFFAOYSA-N 0.000 description 1
- JPSKCQCQZUGWNM-UHFFFAOYSA-N 2,7-Oxepanedione Chemical compound O=C1CCCCC(=O)O1 JPSKCQCQZUGWNM-UHFFFAOYSA-N 0.000 description 1
- RPNNHKZOKONSQV-UTCJRWHESA-N 2-(1-methyltetrazol-5-yl)sulfanyl-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]acetamide Chemical compound CN1N=NN=C1SCC(=O)NC\C=C/COC1=CC(CN2CCCCC2)=CC=N1 RPNNHKZOKONSQV-UTCJRWHESA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- HRQGVQMYKIVLSK-UHFFFAOYSA-N 2-[2-oxo-2-[3-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropylamino]ethyl]sulfanylethyl acetate Chemical compound C1=NC(OCCCNC(=O)CSCCOC(=O)C)=CC(CN2CCCCC2)=C1 HRQGVQMYKIVLSK-UHFFFAOYSA-N 0.000 description 1
- WMCYMKSOVNRSNJ-DAXSKMNVSA-N 2-[2-oxo-2-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]ethyl]sulfanylethyl 2-methylpropanoate Chemical compound C1=NC(OC\C=C/CNC(=O)CSCCOC(=O)C(C)C)=CC(CN2CCCCC2)=C1 WMCYMKSOVNRSNJ-DAXSKMNVSA-N 0.000 description 1
- CQMIVJXJCQNKJQ-UTCJRWHESA-N 2-[2-oxo-2-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]ethyl]sulfonylethyl acetate Chemical compound C1=NC(OC\C=C/CNC(=O)CS(=O)(=O)CCOC(=O)C)=CC(CN2CCCCC2)=C1 CQMIVJXJCQNKJQ-UTCJRWHESA-N 0.000 description 1
- YWJUGFMKSMSXGW-UTCJRWHESA-N 2-[3-oxo-3-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]propyl]sulfanylethyl acetate Chemical compound C1=NC(OC\C=C/CNC(=O)CCSCCOC(=O)C)=CC(CN2CCCCC2)=C1 YWJUGFMKSMSXGW-UTCJRWHESA-N 0.000 description 1
- QJXIQJWXEHCYSG-UTCJRWHESA-N 2-[4-oxo-4-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]butyl]sulfanylethyl acetate Chemical compound C1=NC(OC\C=C/CNC(=O)CCCSCCOC(=O)C)=CC(CN2CCCCC2)=C1 QJXIQJWXEHCYSG-UTCJRWHESA-N 0.000 description 1
- IICDKBTZGQOHMX-YVMONPNESA-N 2-[6-oxo-6-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]hexyl]sulfanylethyl acetate Chemical compound C1=NC(OC\C=C/CNC(=O)CCCCCSCCOC(=O)C)=CC(CN2CCCCC2)=C1 IICDKBTZGQOHMX-YVMONPNESA-N 0.000 description 1
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical class OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 description 1
- JHDUWUWSAAOXBK-UHFFFAOYSA-N 2-chloro-n-[4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybutyl]acetamide Chemical compound C1=NC(OCCCCNC(=O)CCl)=CC(CN2CCCCC2)=C1 JHDUWUWSAAOXBK-UHFFFAOYSA-N 0.000 description 1
- VJIOSCMTZVXQQU-UHFFFAOYSA-N 2-chlorobutanamide Chemical compound CCC(Cl)C(N)=O VJIOSCMTZVXQQU-UHFFFAOYSA-N 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- SMNDYUVBFMFKNZ-UHFFFAOYSA-N 2-furoic acid Chemical compound OC(=O)C1=CC=CO1 SMNDYUVBFMFKNZ-UHFFFAOYSA-N 0.000 description 1
- VTFXQRCKJVZYKC-UTCJRWHESA-N 2-methyl-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]furan-3-carboxamide Chemical compound O1C=CC(C(=O)NC\C=C/COC=2N=CC=C(CN3CCCCC3)C=2)=C1C VTFXQRCKJVZYKC-UTCJRWHESA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- CFGQZVOVFIZRMN-UHFFFAOYSA-N 2-methylfuran-3-carboxylic acid Chemical compound CC=1OC=CC=1C(O)=O CFGQZVOVFIZRMN-UHFFFAOYSA-N 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- XQGVQRPSTODODM-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrrole-2-carboxylic acid Chemical compound CC1=CC(C)=C(C(O)=O)N1 XQGVQRPSTODODM-UHFFFAOYSA-N 0.000 description 1
- GSCDOLIEJOWBQN-DAXSKMNVSA-N 3,5-dimethyl-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]-1h-pyrrole-2-carboxamide Chemical compound N1C(C)=CC(C)=C1C(=O)NC\C=C/COC1=CC(CN2CCCCC2)=CC=N1 GSCDOLIEJOWBQN-DAXSKMNVSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- SFHDYBBCVYDZGB-UTCJRWHESA-N 3-[2-oxo-2-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]ethyl]sulfanylpropyl acetate Chemical compound C1=NC(OC\C=C/CNC(=O)CSCCCOC(=O)C)=CC(CN2CCCCC2)=C1 SFHDYBBCVYDZGB-UTCJRWHESA-N 0.000 description 1
- AYQXANXXZYKTDL-UHFFFAOYSA-N 3-acetylsulfanylpropanoic acid Chemical compound CC(=O)SCCC(O)=O AYQXANXXZYKTDL-UHFFFAOYSA-N 0.000 description 1
- ONADMTIHWBLAPI-DJWKRKHSSA-N 3-amino-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]thiophene-2-carboxamide Chemical compound C1=CSC(C(=O)NC\C=C/COC=2N=CC=C(CN3CCCCC3)C=2)=C1N ONADMTIHWBLAPI-DJWKRKHSSA-N 0.000 description 1
- CQSJDKGNONPQOQ-UHFFFAOYSA-N 3-aminothiophene-2-carboxylic acid Chemical compound NC=1C=CSC=1C(O)=O CQSJDKGNONPQOQ-UHFFFAOYSA-N 0.000 description 1
- LAMUXTNQCICZQX-UHFFFAOYSA-N 3-chloropropan-1-ol Chemical compound OCCCCl LAMUXTNQCICZQX-UHFFFAOYSA-N 0.000 description 1
- RQAQLPFCVVKMSH-UHFFFAOYSA-N 3-methyl-1,2,4-triazine Chemical compound CC1=NC=CN=N1 RQAQLPFCVVKMSH-UHFFFAOYSA-N 0.000 description 1
- JOZZAIIGWFLONA-UHFFFAOYSA-N 3-methylbutan-2-amine Chemical compound CC(C)C(C)N JOZZAIIGWFLONA-UHFFFAOYSA-N 0.000 description 1
- ISULZYQDGYXDFW-UHFFFAOYSA-N 3-methylbutanoyl chloride Chemical compound CC(C)CC(Cl)=O ISULZYQDGYXDFW-UHFFFAOYSA-N 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- MFEILWXBDBCWKF-UHFFFAOYSA-N 3-phenylpropanoyl chloride Chemical compound ClC(=O)CCC1=CC=CC=C1 MFEILWXBDBCWKF-UHFFFAOYSA-N 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QCAWOHUJKPKOMD-UHFFFAOYSA-N 4,6-diamino-1h-pyrimidine-2-thione Chemical compound NC1=CC(N)=NC(S)=N1 QCAWOHUJKPKOMD-UHFFFAOYSA-N 0.000 description 1
- NSXUOMOGJGTPSN-UTCJRWHESA-N 4-(1-methylimidazol-2-yl)sulfanyl-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]butanamide Chemical compound CN1C=CN=C1SCCCC(=O)NC\C=C/COC1=CC(CN2CCCCC2)=CC=N1 NSXUOMOGJGTPSN-UTCJRWHESA-N 0.000 description 1
- IWAZQRUHMSJIDK-UTCJRWHESA-N 4-(1-methyltetrazol-5-yl)sulfanyl-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]butanamide Chemical compound CN1N=NN=C1SCCCC(=O)NC\C=C/COC1=CC(CN2CCCCC2)=CC=N1 IWAZQRUHMSJIDK-UTCJRWHESA-N 0.000 description 1
- IWROIFSIKFRRNR-UTCJRWHESA-N 4-(2-hydroxypropylsulfanyl)-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]butanamide Chemical compound C1=NC(OC\C=C/CNC(=O)CCCSCC(O)C)=CC(CN2CCCCC2)=C1 IWROIFSIKFRRNR-UTCJRWHESA-N 0.000 description 1
- HZDYGPMWNNJWIR-DJWKRKHSSA-N 4-(4,6-diaminopyrimidin-2-yl)sulfanyl-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]butanamide Chemical compound NC1=CC(N)=NC(SCCCC(=O)NC\C=C/COC=2N=CC=C(CN3CCCCC3)C=2)=N1 HZDYGPMWNNJWIR-DJWKRKHSSA-N 0.000 description 1
- UVWDYXXSFSKYCB-UTCJRWHESA-N 4-(4-methylpyrimidin-2-yl)sulfanyl-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]butanamide Chemical compound CC1=CC=NC(SCCCC(=O)NC\C=C/COC=2N=CC=C(CN3CCCCC3)C=2)=N1 UVWDYXXSFSKYCB-UTCJRWHESA-N 0.000 description 1
- YOENXDXPGOCYKP-UTCJRWHESA-N 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]butanamide Chemical compound O1C(C)=NN=C1SCCCC(=O)NC\C=C/COC1=CC(CN2CCCCC2)=CC=N1 YOENXDXPGOCYKP-UTCJRWHESA-N 0.000 description 1
- AZRXNVXVDOZHJF-UTCJRWHESA-N 4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]butanamide Chemical compound S1C(C)=NN=C1SCCCC(=O)NC\C=C/COC1=CC(CN2CCCCC2)=CC=N1 AZRXNVXVDOZHJF-UTCJRWHESA-N 0.000 description 1
- FQWUJOODRYOPSQ-DJWKRKHSSA-N 4-[1-(2-hydroxyethyl)tetrazol-5-yl]sulfanyl-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]butanamide Chemical compound OCCN1N=NN=C1SCCCC(=O)NC\C=C/COC1=CC(CN2CCCCC2)=CC=N1 FQWUJOODRYOPSQ-DJWKRKHSSA-N 0.000 description 1
- CDIIZULDSLKBKV-UHFFFAOYSA-N 4-chlorobutanoyl chloride Chemical compound ClCCCC(Cl)=O CDIIZULDSLKBKV-UHFFFAOYSA-N 0.000 description 1
- DBPKMSBWOKAKLA-UHFFFAOYSA-N 4-chloropyrimidine Chemical compound ClC1=CC=NC=N1 DBPKMSBWOKAKLA-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- JVNMXQGJNRGLTC-DJWKRKHSSA-N 4-hydroxy-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]-1,2-oxazole-3-carboxamide Chemical compound OC1=CON=C1C(=O)NC\C=C/COC1=CC(CN2CCCCC2)=CC=N1 JVNMXQGJNRGLTC-DJWKRKHSSA-N 0.000 description 1
- QWNXPRSJULWBKU-UHFFFAOYSA-N 4-hydroxybutanethioamide Chemical compound NC(=S)CCCO QWNXPRSJULWBKU-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- YOCRBYYCENPWRL-UTCJRWHESA-N 5-(2-hydroxyethylsulfanyl)-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]pentanamide Chemical compound C1=NC(OC\C=C/CNC(=O)CCCCSCCO)=CC(CN2CCCCC2)=C1 YOCRBYYCENPWRL-UTCJRWHESA-N 0.000 description 1
- KMRVTZLKQPFHFS-UHFFFAOYSA-N 5-amino-1h-pyrazole-4-carboxylic acid Chemical compound NC=1NN=CC=1C(O)=O KMRVTZLKQPFHFS-UHFFFAOYSA-N 0.000 description 1
- IQBAYVXKLKLRMN-DAXSKMNVSA-N 5-chloro-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]pentanamide Chemical compound C1=NC(OC\C=C/CNC(=O)CCCCCl)=CC(CN2CCCCC2)=C1 IQBAYVXKLKLRMN-DAXSKMNVSA-N 0.000 description 1
- SVNNWKWHLOJLOK-UHFFFAOYSA-N 5-chloropentanoyl chloride Chemical compound ClCCCCC(Cl)=O SVNNWKWHLOJLOK-UHFFFAOYSA-N 0.000 description 1
- IFLKEBSJTZGCJG-UHFFFAOYSA-N 5-methyl-2-thiophenecarboxylic acid Natural products CC=1C=CSC=1C(O)=O IFLKEBSJTZGCJG-UHFFFAOYSA-N 0.000 description 1
- FPVUWZFFEGYCGB-UHFFFAOYSA-N 5-methyl-3h-1,3,4-thiadiazole-2-thione Chemical compound CC1=NN=C(S)S1 FPVUWZFFEGYCGB-UHFFFAOYSA-N 0.000 description 1
- WSMQKESQZFQMFW-UHFFFAOYSA-N 5-methyl-pyrazole-3-carboxylic acid Chemical compound CC1=CC(C(O)=O)=NN1 WSMQKESQZFQMFW-UHFFFAOYSA-N 0.000 description 1
- VCNGNQLPFHVODE-UHFFFAOYSA-N 5-methylthiophene-2-carboxylic acid Chemical compound CC1=CC=C(C(O)=O)S1 VCNGNQLPFHVODE-UHFFFAOYSA-N 0.000 description 1
- XIBVQYMGYZQFLR-DAXSKMNVSA-N 6-(2-hydroxyethylsulfanyl)-n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]hexanamide Chemical compound C1=NC(OC\C=C/CNC(=O)CCCCCSCCO)=CC(CN2CCCCC2)=C1 XIBVQYMGYZQFLR-DAXSKMNVSA-N 0.000 description 1
- NOPKNBDBHMWPEF-UHFFFAOYSA-N 6-bromohexanoyl bromide Chemical compound BrCCCCCC(Br)=O NOPKNBDBHMWPEF-UHFFFAOYSA-N 0.000 description 1
- BVPHXTUEZOQIBS-UHFFFAOYSA-N 6-methyl-1h-pyrimidine-2-thione Chemical compound CC1=CC=NC(S)=N1 BVPHXTUEZOQIBS-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- 125000000041 C6-C10 aryl group Chemical group 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 101100289061 Drosophila melanogaster lili gene Proteins 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- 208000012895 Gastric disease Diseases 0.000 description 1
- 208000007882 Gastritis Diseases 0.000 description 1
- 208000018522 Gastrointestinal disease Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 102000003834 Histamine H1 Receptors Human genes 0.000 description 1
- 108090000110 Histamine H1 Receptors Proteins 0.000 description 1
- 241000692870 Inachis io Species 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 241001435619 Lile Species 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- ABQVQBVPCGVIFN-UHFFFAOYSA-N N1(CCCCC1)CC1=CC(=NC=C1)OCCC=C/N Chemical compound N1(CCCCC1)CC1=CC(=NC=C1)OCCC=C/N ABQVQBVPCGVIFN-UHFFFAOYSA-N 0.000 description 1
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 201000008629 Zollinger-Ellison syndrome Diseases 0.000 description 1
- SORGEQQSQGNZFI-UHFFFAOYSA-N [azido(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(N=[N+]=[N-])OC1=CC=CC=C1 SORGEQQSQGNZFI-UHFFFAOYSA-N 0.000 description 1
- 210000000683 abdominal cavity Anatomy 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 238000010976 amide bond formation reaction Methods 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- LDDQLRUQCUTJBB-UHFFFAOYSA-N ammonium fluoride Chemical class [NH4+].[F-] LDDQLRUQCUTJBB-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 230000002238 attenuated effect Effects 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- BFAKENXZKHGIGE-UHFFFAOYSA-N bis(2,3,5,6-tetrafluoro-4-iodophenyl)diazene Chemical compound FC1=C(C(=C(C(=C1F)I)F)F)N=NC1=C(C(=C(C(=C1F)F)I)F)F BFAKENXZKHGIGE-UHFFFAOYSA-N 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229940105329 carboxymethylcellulose Drugs 0.000 description 1
- 229940084030 carboxymethylcellulose calcium Drugs 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 235000005607 chanvre indien Nutrition 0.000 description 1
- 244000261228 chanvre indien Species 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- AQIXAKUUQRKLND-UHFFFAOYSA-N cimetidine Chemical compound N#C/N=C(/NC)NCCSCC=1N=CNC=1C AQIXAKUUQRKLND-UHFFFAOYSA-N 0.000 description 1
- 229960001380 cimetidine Drugs 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical compound C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 150000003972 cyclic carboxylic anhydrides Chemical class 0.000 description 1
- KZZKOVLJUKWSKX-UHFFFAOYSA-N cyclobutanamine Chemical compound NC1CCC1 KZZKOVLJUKWSKX-UHFFFAOYSA-N 0.000 description 1
- JFWMYCVMQSLLOO-UHFFFAOYSA-N cyclobutanecarbonyl chloride Chemical compound ClC(=O)C1CCC1 JFWMYCVMQSLLOO-UHFFFAOYSA-N 0.000 description 1
- VXVVUHQULXCUPF-UHFFFAOYSA-N cycloheptanamine Chemical compound NC1CCCCCC1 VXVVUHQULXCUPF-UHFFFAOYSA-N 0.000 description 1
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 description 1
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 1
- 150000005378 cyclohexanecarboxylic acids Chemical class 0.000 description 1
- HSOHBWMXECKEKV-UHFFFAOYSA-N cyclooctanamine Chemical compound NC1CCCCCCC1 HSOHBWMXECKEKV-UHFFFAOYSA-N 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- WEPUZBYKXNKSDH-UHFFFAOYSA-N cyclopentanecarbonyl chloride Chemical compound ClC(=O)C1CCCC1 WEPUZBYKXNKSDH-UHFFFAOYSA-N 0.000 description 1
- JBDSSBMEKXHSJF-UHFFFAOYSA-N cyclopentanecarboxylic acid Chemical compound OC(=O)C1CCCC1 JBDSSBMEKXHSJF-UHFFFAOYSA-N 0.000 description 1
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000005105 dialkylarylsilyl group Chemical group 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- WLXALCKAKGDNAT-UHFFFAOYSA-N diazoethane Chemical compound CC=[N+]=[N-] WLXALCKAKGDNAT-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- 230000001079 digestive effect Effects 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000002019 doping agent Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001647 drug administration Methods 0.000 description 1
- 210000001198 duodenum Anatomy 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- VEOZBFFLKPBVIY-UHFFFAOYSA-N ethyl 6-chloro-6-oxohexanoate Chemical compound CCOC(=O)CCCCC(Cl)=O VEOZBFFLKPBVIY-UHFFFAOYSA-N 0.000 description 1
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethyl mercaptane Natural products CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- VGGRCVDNFAQIKO-UHFFFAOYSA-N formic anhydride Chemical compound O=COC=O VGGRCVDNFAQIKO-UHFFFAOYSA-N 0.000 description 1
- 201000000052 gastrinoma Diseases 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- VANNPISTIUFMLH-UHFFFAOYSA-N glutaric anhydride Chemical compound O=C1CCCC(=O)O1 VANNPISTIUFMLH-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 210000002837 heart atrium Anatomy 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 125000006316 iso-butyl amino group Chemical group [H]N(*)C([H])([H])C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- USSBDBZGEDUBHE-UHFFFAOYSA-L magnesium;2-oxidooxycarbonylbenzoate Chemical compound [Mg+2].[O-]OC(=O)C1=CC=CC=C1C([O-])=O USSBDBZGEDUBHE-UHFFFAOYSA-L 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- PMRYVIKBURPHAH-UHFFFAOYSA-N methimazole Chemical compound CN1C=CNC1=S PMRYVIKBURPHAH-UHFFFAOYSA-N 0.000 description 1
- MKIJJIMOAABWGF-UHFFFAOYSA-N methyl 2-sulfanylacetate Chemical compound COC(=O)CS MKIJJIMOAABWGF-UHFFFAOYSA-N 0.000 description 1
- UTBCRHAMJFMIIR-UHFFFAOYSA-N methyl 3-chloro-3-oxopropanoate Chemical compound COC(=O)CC(Cl)=O UTBCRHAMJFMIIR-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 1
- ZQRBSCXRHDJZBS-UHFFFAOYSA-N n,n-dibutylbutan-1-amine;hydrofluoride Chemical compound F.CCCCN(CCCC)CCCC ZQRBSCXRHDJZBS-UHFFFAOYSA-N 0.000 description 1
- PKTORQJDSOUZOI-DJWKRKHSSA-N n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]-1,3-thiazole-4-carboxamide Chemical compound C=1SC=NC=1C(=O)NC\C=C/COC(N=CC=1)=CC=1CN1CCCCC1 PKTORQJDSOUZOI-DJWKRKHSSA-N 0.000 description 1
- VLPWBYLYOLNJAV-DJWKRKHSSA-N n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]-1h-pyrrole-2-carboxamide Chemical compound C=1C=CNC=1C(=O)NC\C=C/COC(N=CC=1)=CC=1CN1CCCCC1 VLPWBYLYOLNJAV-DJWKRKHSSA-N 0.000 description 1
- OJRSPDIMICNALS-DJWKRKHSSA-N n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]-1h-pyrrole-3-carboxamide Chemical compound C1=CNC=C1C(=O)NC\C=C/COC(N=CC=1)=CC=1CN1CCCCC1 OJRSPDIMICNALS-DJWKRKHSSA-N 0.000 description 1
- LYLOPBTYEROXAE-DJWKRKHSSA-N n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]-3-sulfanylpropanamide Chemical compound C1=NC(OC\C=C/CNC(=O)CCS)=CC(CN2CCCCC2)=C1 LYLOPBTYEROXAE-DJWKRKHSSA-N 0.000 description 1
- PIGTWIJCXYQOIC-DJWKRKHSSA-N n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]-4-(1,3,4-thiadiazol-2-ylsulfanyl)butanamide Chemical compound C=1C(CN2CCCCC2)=CC=NC=1OC\C=C/CNC(=O)CCCSC1=NN=CS1 PIGTWIJCXYQOIC-DJWKRKHSSA-N 0.000 description 1
- OENTWKKAWPMXAS-DJWKRKHSSA-N n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]-4-(1h-1,2,4-triazol-5-ylsulfanyl)butanamide Chemical compound C=1C(CN2CCCCC2)=CC=NC=1OC\C=C/CNC(=O)CCCSC=1N=CNN=1 OENTWKKAWPMXAS-DJWKRKHSSA-N 0.000 description 1
- JCLHDFLZJKDPLF-DAXSKMNVSA-N n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]-4-pyridin-2-ylsulfanylbutanamide Chemical compound C=1C(CN2CCCCC2)=CC=NC=1OC\C=C/CNC(=O)CCCSC1=CC=CC=N1 JCLHDFLZJKDPLF-DAXSKMNVSA-N 0.000 description 1
- OXHHQTPTFJMEHE-DJWKRKHSSA-N n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]-4-pyridin-4-ylsulfanylbutanamide Chemical compound C=1C(CN2CCCCC2)=CC=NC=1OC\C=C/CNC(=O)CCCSC1=CC=NC=C1 OXHHQTPTFJMEHE-DJWKRKHSSA-N 0.000 description 1
- FOPCXAVZDQBMSK-DJWKRKHSSA-N n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]furan-2-carboxamide Chemical compound C=1C=COC=1C(=O)NC\C=C/COC(N=CC=1)=CC=1CN1CCCCC1 FOPCXAVZDQBMSK-DJWKRKHSSA-N 0.000 description 1
- KNWWEYSZOPBEFA-DJWKRKHSSA-N n-[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]thiadiazole-4-carboxamide Chemical compound C=1SN=NC=1C(=O)NC\C=C/COC(N=CC=1)=CC=1CN1CCCCC1 KNWWEYSZOPBEFA-DJWKRKHSSA-N 0.000 description 1
- OBBBMQRBAMRKGZ-ARJAWSKDSA-N n-[(z)-4-[4-[(dimethylamino)methyl]pyridin-2-yl]oxybut-2-enyl]pyrazole-1-carboxamide Chemical compound CN(C)CC1=CC=NC(OC\C=C/CNC(=O)N2N=CC=C2)=C1 OBBBMQRBAMRKGZ-ARJAWSKDSA-N 0.000 description 1
- ITDZUGKAFHHJHR-UHFFFAOYSA-N n-[3-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropyl]-1h-pyrazole-4-carboxamide Chemical compound C1=NNC=C1C(=O)NCCCOC(N=CC=1)=CC=1CN1CCCCC1 ITDZUGKAFHHJHR-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- ABMYLEFQOWVIGW-UHFFFAOYSA-N n-[5-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypentyl]-1h-pyrazole-4-carboxamide Chemical compound C1=NNC=C1C(=O)NCCCCCOC(N=CC=1)=CC=1CN1CCCCC1 ABMYLEFQOWVIGW-UHFFFAOYSA-N 0.000 description 1
- DYFFAVRFJWYYQO-UHFFFAOYSA-N n-methyl-n-phenylaniline Chemical compound C=1C=CC=CC=1N(C)C1=CC=CC=C1 DYFFAVRFJWYYQO-UHFFFAOYSA-N 0.000 description 1
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- IGEIPFLJVCPEKU-UHFFFAOYSA-N pentan-2-amine Chemical compound CCCC(C)N IGEIPFLJVCPEKU-UHFFFAOYSA-N 0.000 description 1
- PQPFFKCJENSZKL-UHFFFAOYSA-N pentan-3-amine Chemical compound CCC(N)CC PQPFFKCJENSZKL-UHFFFAOYSA-N 0.000 description 1
- FDOHPUYPQQKECS-UHFFFAOYSA-N pentanoyl bromide Chemical compound CCCCC(Br)=O FDOHPUYPQQKECS-UHFFFAOYSA-N 0.000 description 1
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 1
- 208000011906 peptic ulcer disease Diseases 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- CZPZWMPYEINMCF-UHFFFAOYSA-N propaneperoxoic acid Chemical compound CCC(=O)OO CZPZWMPYEINMCF-UHFFFAOYSA-N 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- MWWATHDPGQKSAR-UHFFFAOYSA-N propyne Chemical compound CC#C MWWATHDPGQKSAR-UHFFFAOYSA-N 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 210000001747 pupil Anatomy 0.000 description 1
- 210000001187 pylorus Anatomy 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical compound SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 210000005245 right atrium Anatomy 0.000 description 1
- KQJWTIOZZLQART-UHFFFAOYSA-N s-(2-amino-2-oxoethyl) ethanethioate Chemical compound CC(=O)SCC(N)=O KQJWTIOZZLQART-UHFFFAOYSA-N 0.000 description 1
- JICXKVYQCPTTGP-UTCJRWHESA-N s-[2-oxo-2-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]ethyl] ethanethioate Chemical compound C1=NC(OC\C=C/CNC(=O)CSC(=O)C)=CC(CN2CCCCC2)=C1 JICXKVYQCPTTGP-UTCJRWHESA-N 0.000 description 1
- LWTLWBHEUMROPI-UTCJRWHESA-N s-[3-oxo-3-[[(z)-4-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxybut-2-enyl]amino]propyl] ethanethioate Chemical compound C1=NC(OC\C=C/CNC(=O)CCSC(=O)C)=CC(CN2CCCCC2)=C1 LWTLWBHEUMROPI-UTCJRWHESA-N 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 230000035900 sweating Effects 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- HJZYBDPHAHGHAZ-UHFFFAOYSA-N thiadiazole-4-carboxylic acid Chemical compound OC(=O)C1=CSN=N1 HJZYBDPHAHGHAZ-UHFFFAOYSA-N 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 description 1
- 230000035922 thirst Effects 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- VSRBKQFNFZQRBM-UHFFFAOYSA-N tuaminoheptane Chemical compound CCCCCC(C)N VSRBKQFNFZQRBM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/10—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Cleaning And De-Greasing Of Metallic Materials By Chemical Methods (AREA)
- Magnetic Resonance Imaging Apparatus (AREA)
- Diaphragms For Electromechanical Transducers (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP6532492 | 1992-03-23 | ||
| JP10139292 | 1992-04-21 | ||
| JP17570792 | 1992-07-02 | ||
| JP34903592 | 1992-12-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CZ47493A3 true CZ47493A3 (en) | 1993-12-15 |
Family
ID=27464571
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CZ93474A CZ47493A3 (en) | 1992-03-23 | 1993-03-23 | Pyridyloxy derivatives, process of their preparation and pharmaceutical preparations containing thereof |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US5616579A (enExample) |
| EP (1) | EP0562833B1 (enExample) |
| JP (1) | JPH06247933A (enExample) |
| CN (1) | CN1081437A (enExample) |
| AT (1) | ATE137748T1 (enExample) |
| AU (1) | AU659922B2 (enExample) |
| CA (1) | CA2092111A1 (enExample) |
| CZ (1) | CZ47493A3 (enExample) |
| DE (1) | DE69302515T2 (enExample) |
| DK (1) | DK0562833T3 (enExample) |
| ES (1) | ES2090859T3 (enExample) |
| FI (1) | FI931292A7 (enExample) |
| GR (1) | GR3020069T3 (enExample) |
| HK (1) | HK159796A (enExample) |
| HU (1) | HUT64053A (enExample) |
| IL (1) | IL105140A (enExample) |
| NO (1) | NO931041L (enExample) |
| NZ (1) | NZ247229A (enExample) |
| TW (1) | TW240222B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1251474B (it) * | 1991-09-13 | 1995-05-15 | Mini Ricerca Scient Tecnolog | Derivati ossimici ad attivita' fungicida |
| JP4058129B2 (ja) * | 1996-03-18 | 2008-03-05 | 株式会社資生堂 | ピリジン誘導体及び抗潰瘍剤、抗菌剤 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS568352A (en) * | 1979-07-03 | 1981-01-28 | Shionogi & Co Ltd | Aminoalkylvenzene derivative |
| US4300549A (en) * | 1980-01-07 | 1981-11-17 | Surgikos | Operating room face mask |
| JPS6185365A (ja) | 1984-10-02 | 1986-04-30 | Ikeda Mohandou:Kk | アミノアルキルピリジルオキシ誘導体 |
| US4837316A (en) * | 1985-08-29 | 1989-06-06 | Fujirebio Kabushiki Kaisha | Alkylamide derivatives with H2 -receptor antagonistic and cytoprotective action |
| JPS63225371A (ja) | 1987-03-13 | 1988-09-20 | Fujirebio Inc | ピリジルオキシ誘導体 |
| US4912101A (en) * | 1987-03-13 | 1990-03-27 | Fujirebio Kabushiki Kaisha | 4-aminomethyl-pyridyl-2-oxy derivatives having anti-ulcer activity |
| JPH0639466B2 (ja) * | 1987-08-03 | 1994-05-25 | 杏林製薬株式会社 | ウレア誘導体 |
| JPH0193247A (ja) * | 1987-10-05 | 1989-04-12 | Toshiba Corp | マルチノードシステム |
| JPH0637472B2 (ja) | 1988-01-29 | 1994-05-18 | 富士レビオ株式会社 | ピリジルオキシ誘導体 |
| US5192774A (en) * | 1988-07-05 | 1993-03-09 | Zeria Pharmaceutical Co., Ltd. | Substituted acetamide derivatives, process for their preparation and antiulcer drug containing same |
| ATE116343T1 (de) * | 1990-03-06 | 1995-01-15 | Akzo Nobel Nv | Wässrige hybridpolymerdispersion und beschichtungszusammensetzung. |
| JPH04257581A (ja) * | 1991-02-08 | 1992-09-11 | Kyorin Pharmaceut Co Ltd | ピペリジノメチルピリジン誘導体 |
-
1993
- 1993-03-22 TW TW082102119A patent/TW240222B/zh active
- 1993-03-22 CA CA002092111A patent/CA2092111A1/en not_active Abandoned
- 1993-03-22 JP JP5061815A patent/JPH06247933A/ja active Pending
- 1993-03-22 US US08/035,081 patent/US5616579A/en not_active Expired - Fee Related
- 1993-03-23 CN CN93105481A patent/CN1081437A/zh active Pending
- 1993-03-23 EP EP93302221A patent/EP0562833B1/en not_active Expired - Lifetime
- 1993-03-23 DE DE69302515T patent/DE69302515T2/de not_active Expired - Fee Related
- 1993-03-23 DK DK93302221.2T patent/DK0562833T3/da active
- 1993-03-23 ES ES93302221T patent/ES2090859T3/es not_active Expired - Lifetime
- 1993-03-23 NO NO93931041A patent/NO931041L/no unknown
- 1993-03-23 CZ CZ93474A patent/CZ47493A3/cs unknown
- 1993-03-23 FI FI931292A patent/FI931292A7/fi not_active Application Discontinuation
- 1993-03-23 NZ NZ247229A patent/NZ247229A/en unknown
- 1993-03-23 IL IL10514093A patent/IL105140A/xx not_active IP Right Cessation
- 1993-03-23 AT AT93302221T patent/ATE137748T1/de not_active IP Right Cessation
- 1993-03-23 AU AU35379/93A patent/AU659922B2/en not_active Ceased
- 1993-03-23 HU HU9300827A patent/HUT64053A/hu unknown
-
1996
- 1996-05-27 GR GR960401433T patent/GR3020069T3/el unknown
- 1996-08-22 HK HK159796A patent/HK159796A/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPH06247933A (ja) | 1994-09-06 |
| AU659922B2 (en) | 1995-06-01 |
| NZ247229A (en) | 1994-10-26 |
| CN1081437A (zh) | 1994-02-02 |
| NO931041D0 (no) | 1993-03-23 |
| CA2092111A1 (en) | 1993-09-24 |
| DE69302515D1 (de) | 1996-06-13 |
| GR3020069T3 (en) | 1996-08-31 |
| US5616579A (en) | 1997-04-01 |
| DE69302515T2 (de) | 1997-01-09 |
| FI931292A0 (fi) | 1993-03-23 |
| EP0562833B1 (en) | 1996-05-08 |
| HU9300827D0 (en) | 1993-06-28 |
| TW240222B (enExample) | 1995-02-11 |
| IL105140A (en) | 1997-01-10 |
| NO931041L (no) | 1993-09-24 |
| ATE137748T1 (de) | 1996-05-15 |
| ES2090859T3 (es) | 1996-10-16 |
| HK159796A (en) | 1996-08-30 |
| AU3537993A (en) | 1993-09-30 |
| DK0562833T3 (da) | 1996-09-09 |
| EP0562833A1 (en) | 1993-09-29 |
| IL105140A0 (en) | 1993-07-08 |
| FI931292L (fi) | 1993-09-24 |
| HUT64053A (en) | 1993-11-29 |
| FI931292A7 (fi) | 1993-09-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US6448247B1 (en) | Method for treating an inflammatory disease | |
| US6013663A (en) | Dithiolan derivatives, their preparation and their therapeutic effect | |
| US6090753A (en) | Pyridazin-3-one derivatives, their use, and intermediates for their production | |
| US7294625B2 (en) | Pyrazole compounds | |
| US20170096402A1 (en) | 5-(hetero)arylpyridazinones and their use as herbicides | |
| US20070031514A1 (en) | Use of isoindolinone derivatives as insecticides | |
| JP2000169371A (ja) | ジチオラン誘導体を含有する医薬 | |
| JPH11269170A (ja) | ジチオラン誘導体 | |
| US20050032858A1 (en) | Novel heterocyclic compound and anti-inflamatory agent | |
| US20070275968A1 (en) | Substituted Biphenyl Derivative | |
| JP3192631B2 (ja) | 飽和複素環化合物からなる医薬 | |
| TW200409757A (en) | 1-aralkyl-N-(3-quinolyl)-1-cyclohexancarboxamide derivatives | |
| US5616579A (en) | Anti-ulcer pyridyloxy derivatives, their preparation and uses | |
| JP2000178188A (ja) | 回腸型胆汁酸トランスポ−タ−阻害剤 | |
| EP3145918B1 (de) | 2-(hetero)aryl-pyridazinone und ihre verwendung als herbizide | |
| JPH11286443A (ja) | 飽和複素環化合物からなる医薬 | |
| JPH1160548A (ja) | ベンジルアミン類 | |
| AU6669100A (en) | Dithiolan derivatives, their preparation and their therapeutic effect | |
| JP2002128762A (ja) | 新規フェナントリジノン誘導体 | |
| HK1002279A (en) | Heterocyclic compounds having tachykinin receptor antagonist activity, their preparation and their use | |
| HK1019061A (en) | Dithiolan derivatices, their preparation and their therapeutic effect |