CS241072B2 - Method of 3-/(amino or subst,amino/)-4-/(subst.amino/)-1,2,5-thiadizoles production - Google Patents
Method of 3-/(amino or subst,amino/)-4-/(subst.amino/)-1,2,5-thiadizoles production Download PDFInfo
- Publication number
- CS241072B2 CS241072B2 CS841859A CS185984A CS241072B2 CS 241072 B2 CS241072 B2 CS 241072B2 CS 841859 A CS841859 A CS 841859A CS 185984 A CS185984 A CS 185984A CS 241072 B2 CS241072 B2 CS 241072B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- formula
- amino
- pharmaceutically acceptable
- toxic
- thiadiazole
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 65
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 title claims description 15
- 238000004519 manufacturing process Methods 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 105
- 239000012453 solvate Substances 0.000 claims abstract description 36
- 150000003839 salts Chemical class 0.000 claims abstract description 34
- 231100000252 nontoxic Toxicity 0.000 claims abstract description 30
- 230000003000 nontoxic effect Effects 0.000 claims abstract description 30
- 150000004677 hydrates Chemical class 0.000 claims abstract description 18
- RDJGIQPSSNMJPF-UHFFFAOYSA-N ethanediimidamide Chemical class NC(=N)C(N)=N RDJGIQPSSNMJPF-UHFFFAOYSA-N 0.000 claims abstract description 7
- -1 methylenedioxy Chemical group 0.000 claims description 63
- 229910052757 nitrogen Inorganic materials 0.000 claims description 61
- 229910052739 hydrogen Inorganic materials 0.000 claims description 58
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 39
- 239000001257 hydrogen Substances 0.000 claims description 38
- 125000000217 alkyl group Chemical group 0.000 claims description 35
- 238000006243 chemical reaction Methods 0.000 claims description 35
- 125000006308 propyl amino group Chemical group 0.000 claims description 32
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 30
- 230000008569 process Effects 0.000 claims description 30
- 229910052717 sulfur Inorganic materials 0.000 claims description 29
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 27
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 26
- QYIWBOWEQBEAGP-UHFFFAOYSA-N 2-(1,3-dioxoisoindol-2-yl)sulfanylisoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1SN1C(=O)C2=CC=CC=C2C1=O QYIWBOWEQBEAGP-UHFFFAOYSA-N 0.000 claims description 20
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 20
- 238000002360 preparation method Methods 0.000 claims description 20
- 150000002431 hydrogen Chemical class 0.000 claims description 19
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 claims description 19
- 239000003960 organic solvent Substances 0.000 claims description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 17
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 17
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 16
- 125000003545 alkoxy group Chemical group 0.000 claims description 15
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 13
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 11
- 239000000460 chlorine Substances 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- 239000011541 reaction mixture Substances 0.000 claims description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- JRHOBGUKGKDYFU-UHFFFAOYSA-N 3-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 JRHOBGUKGKDYFU-UHFFFAOYSA-N 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 150000007530 organic bases Chemical class 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 4
- 125000003386 piperidinyl group Chemical group 0.000 claims description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 4
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 3
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 3
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 3
- DRGIXHISBNDJEL-UHFFFAOYSA-N 3-n-[3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCOC1=CC=CC(CN2CCCC2)=C1 DRGIXHISBNDJEL-UHFFFAOYSA-N 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 239000012458 free base Substances 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 claims description 3
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- 239000002585 base Substances 0.000 claims description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims 1
- VRALOCFIFDRXTC-UHFFFAOYSA-N 2-n'-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]ethanediimidamide Chemical compound NC(=N)C(=N)NCCCOC1=CC=CC(CN2CCCCC2)=C1 VRALOCFIFDRXTC-UHFFFAOYSA-N 0.000 claims 1
- IRQUPRKBBWVPAU-UHFFFAOYSA-N 2-n'-[3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propyl]ethanediimidamide Chemical compound NC(=N)C(=N)NCCCOC1=CC=CC(CN2CCCC2)=C1 IRQUPRKBBWVPAU-UHFFFAOYSA-N 0.000 claims 1
- LBNPMRUENVBXOR-UHFFFAOYSA-N 2-n'-[3-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropyl]ethanediimidamide Chemical compound C1=NC(OCCCNC(=N)C(=N)N)=CC(CN2CCCCC2)=C1 LBNPMRUENVBXOR-UHFFFAOYSA-N 0.000 claims 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 claims 1
- 125000003884 phenylalkyl group Chemical group 0.000 claims 1
- 239000002904 solvent Substances 0.000 claims 1
- 229940122957 Histamine H2 receptor antagonist Drugs 0.000 abstract description 2
- 239000003485 histamine H2 receptor antagonist Substances 0.000 abstract description 2
- 239000003699 antiulcer agent Substances 0.000 abstract 1
- 238000006798 ring closing metathesis reaction Methods 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 60
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 35
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 26
- 229910052799 carbon Inorganic materials 0.000 description 24
- 239000000047 product Substances 0.000 description 24
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 21
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 20
- 238000004458 analytical method Methods 0.000 description 18
- 239000000203 mixture Substances 0.000 description 17
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 238000012360 testing method Methods 0.000 description 14
- 229960001340 histamine Drugs 0.000 description 13
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 13
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- FNGLQNMQHOAIJQ-UHFFFAOYSA-N Cl[S](Cl)Cl Chemical compound Cl[S](Cl)Cl FNGLQNMQHOAIJQ-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000523 sample Substances 0.000 description 9
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 8
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 8
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 8
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 8
- 230000028327 secretion Effects 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- 241000700159 Rattus Species 0.000 description 7
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- RIOYHEJVKJDCEJ-UHFFFAOYSA-N 3-n-[3-[3-[(2-methylpyrrolidin-1-yl)methyl]phenoxy]propyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine Chemical compound CC1CCCN1CC1=CC=CC(OCCCNC=2C(=NS(=O)N=2)N)=C1 RIOYHEJVKJDCEJ-UHFFFAOYSA-N 0.000 description 6
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- CCGSUNCLSOWKJO-UHFFFAOYSA-N cimetidine Chemical compound N#CNC(=N/C)\NCCSCC1=NC=N[C]1C CCGSUNCLSOWKJO-UHFFFAOYSA-N 0.000 description 6
- 229960001380 cimetidine Drugs 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 241000700199 Cavia porcellus Species 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- KXOFUUASPAGCPE-UHFFFAOYSA-N ethanediimidamide trihydrochloride Chemical compound Cl.Cl.Cl.C(C(N)=N)(N)=N KXOFUUASPAGCPE-UHFFFAOYSA-N 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 230000002496 gastric effect Effects 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 210000005245 right atrium Anatomy 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- XSZQYVCYBUOSGN-UHFFFAOYSA-N 1-oxo-4-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-3-n-(pyridin-3-ylmethyl)-1,2,5-thiadiazole-3,4-diamine Chemical compound C=1C=CN=CC=1CNC1=NS(=O)N=C1NCCCOC(C=1)=CC=CC=1CN1CCCCC1 XSZQYVCYBUOSGN-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 230000001746 atrial effect Effects 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000003818 flash chromatography Methods 0.000 description 4
- 230000004044 response Effects 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- OOYDKECBDSSEAP-UHFFFAOYSA-N 1-oxo-3-n-[3-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxypropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NS(=O)N=C1NCCCOC1=CSC(CN2CCCCC2)=C1 OOYDKECBDSSEAP-UHFFFAOYSA-N 0.000 description 3
- MIUWQWMRZOEFEX-UHFFFAOYSA-N 3-n-benzyl-4-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound C=1C=CC(CN2CCCCC2)=CC=1OCCCNC1=NSN=C1NCC1=CC=CC=C1 MIUWQWMRZOEFEX-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- 239000005557 antagonist Substances 0.000 description 3
- 239000000739 antihistaminic agent Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000008602 contraction Effects 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 239000001530 fumaric acid Substances 0.000 description 3
- 210000002837 heart atrium Anatomy 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- 108020003175 receptors Proteins 0.000 description 3
- 102000005962 receptors Human genes 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 210000002784 stomach Anatomy 0.000 description 3
- PWWIWFJRQSXNDA-UHFFFAOYSA-N 1-imidazol-1-ylsulfanylimidazole Chemical compound C1=CN=CN1SN1C=CN=C1 PWWIWFJRQSXNDA-UHFFFAOYSA-N 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- DUPAVAVETJQPOR-UHFFFAOYSA-N 1-oxo-3-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NS(=O)N=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 DUPAVAVETJQPOR-UHFFFAOYSA-N 0.000 description 2
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 2
- CBIRHQBQOSDSFG-UHFFFAOYSA-N 3-(1,3-benzothiazol-2-yl)-6-nitrochromen-2-one Chemical compound C1=CC=C2SC(C=3C(=O)OC4=CC=C(C=C4C=3)[N+](=O)[O-])=NC2=C1 CBIRHQBQOSDSFG-UHFFFAOYSA-N 0.000 description 2
- ZQHHHMVXDKTKQW-UHFFFAOYSA-N 3-n-[2-[[4-[(dimethylamino)methyl]pyridin-2-yl]methylsulfanyl]ethyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine Chemical compound CN(C)CC1=CC=NC(CSCCNC=2C(=NS(=O)N=2)N)=C1 ZQHHHMVXDKTKQW-UHFFFAOYSA-N 0.000 description 2
- FZKWXDQZIXBDGQ-UHFFFAOYSA-N 3-n-[2-[[5-[(dimethylamino)methyl]thiophen-3-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound S1C(CN(C)C)=CC(CSCCNC=2C(=NSN=2)N)=C1 FZKWXDQZIXBDGQ-UHFFFAOYSA-N 0.000 description 2
- YIROYDNZEPTFOL-UHFFFAOYSA-N 5,5-Dimethylhydantoin Chemical compound CC1(C)NC(=O)NC1=O YIROYDNZEPTFOL-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 241000700198 Cavia Species 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-ZSJDYOACSA-N Heavy water Chemical compound [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 230000001262 anti-secretory effect Effects 0.000 description 2
- 238000010009 beating Methods 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 2
- 231100000673 dose–response relationship Toxicity 0.000 description 2
- 230000027119 gastric acid secretion Effects 0.000 description 2
- 238000003304 gavage Methods 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000003780 insertion Methods 0.000 description 2
- 230000037431 insertion Effects 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 150000003464 sulfur compounds Chemical class 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- 229930192474 thiophene Natural products 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- XIWSFHMGJRJKJR-UHFFFAOYSA-N 1,2,5-thiadiazol-3-amine Chemical compound NC=1C=NSN=1 XIWSFHMGJRJKJR-UHFFFAOYSA-N 0.000 description 1
- UDGKZGLPXCRRAM-UHFFFAOYSA-N 1,2,5-thiadiazole Chemical compound C=1C=NSN=1 UDGKZGLPXCRRAM-UHFFFAOYSA-N 0.000 description 1
- SOQFZXMZMHODLD-UHFFFAOYSA-N 1,2,5-thiadiazolidine Chemical compound C1CNSN1 SOQFZXMZMHODLD-UHFFFAOYSA-N 0.000 description 1
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 description 1
- VCJCXAUVIYTYIF-UHFFFAOYSA-N 1-oxo-3-n-[2-[[6-(piperidin-1-ylmethyl)pyridin-2-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NS(=O)N=C1NCCSCC1=CC=CC(CN2CCCCC2)=N1 VCJCXAUVIYTYIF-UHFFFAOYSA-N 0.000 description 1
- VOEMYPMXKXCFCF-UHFFFAOYSA-N 1-oxo-3-n-[3-[6-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NS(=O)N=C1NCCCOC1=CC=CC(CN2CCCCC2)=N1 VOEMYPMXKXCFCF-UHFFFAOYSA-N 0.000 description 1
- NMNIHVKUIGROBN-UHFFFAOYSA-N 1-oxo-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-4-prop-2-ynyl-1,2,5-thiadiazol-3-amine Chemical compound O=S1N=C(CC#C)C(NCCCOC=2C=C(CN3CCCCC3)C=CC=2)=N1 NMNIHVKUIGROBN-UHFFFAOYSA-N 0.000 description 1
- SLCZNGZFOVAAED-UHFFFAOYSA-N 2-aminoethanimidamide;dihydrobromide Chemical compound Br.Br.NCC(N)=N SLCZNGZFOVAAED-UHFFFAOYSA-N 0.000 description 1
- LSZMVESSGLHDJE-UHFFFAOYSA-N 2-bromo-4-methylpyridine Chemical compound CC1=CC=NC(Br)=C1 LSZMVESSGLHDJE-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- FAIBGOCQOUIHDC-UHFFFAOYSA-N 3-N-[3-[3-(piperidin-1-ylmethyl)phenyl]sulfanylpropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCSC1=CC(=CC=C1)CN1CCCCC1 FAIBGOCQOUIHDC-UHFFFAOYSA-N 0.000 description 1
- AVFWSRPBBZUMQK-UHFFFAOYSA-N 3-N-[3-[3-(pyrrolidin-1-ylmethyl)phenyl]sulfanylpropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCSC1=CC(=CC=C1)CN1CCCC1 AVFWSRPBBZUMQK-UHFFFAOYSA-N 0.000 description 1
- SXAKEWROCCBLGU-UHFFFAOYSA-N 3-N-[3-[3-[(dimethylamino)methyl]phenyl]sulfanylpropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCSC1=CC(=CC=C1)CN(C)C SXAKEWROCCBLGU-UHFFFAOYSA-N 0.000 description 1
- WEKYWIBCHONDBC-UHFFFAOYSA-N 3-[6-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropan-1-amine Chemical compound NCCCOC1=CC=CC(CN2CCCCC2)=N1 WEKYWIBCHONDBC-UHFFFAOYSA-N 0.000 description 1
- QCHHKUYJOJEKBO-UHFFFAOYSA-N 3-[6-[(dimethylamino)methyl]pyridin-2-yl]oxypropan-1-amine Chemical compound CN(C)CC1=CC=CC(OCCCN)=N1 QCHHKUYJOJEKBO-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- WLSZUAXZAVDHLM-UHFFFAOYSA-N 3-methoxy-1,2,5-thiadiazole 1-oxide Chemical compound COC=1C=NS(=O)N=1 WLSZUAXZAVDHLM-UHFFFAOYSA-N 0.000 description 1
- JAZTUSIZPLFSSZ-UHFFFAOYSA-N 3-n-[2-[[4-[(dimethylamino)methyl]pyridin-2-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CN(C)CC1=CC=NC(CSCCNC=2C(=NSN=2)N)=C1 JAZTUSIZPLFSSZ-UHFFFAOYSA-N 0.000 description 1
- HCBVAPDYYRYBBB-UHFFFAOYSA-N 3-n-[2-[[5-(piperidin-1-ylmethyl)thiophen-3-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCSCC1=CSC(CN2CCCCC2)=C1 HCBVAPDYYRYBBB-UHFFFAOYSA-N 0.000 description 1
- GSKUHCYANQAPDQ-UHFFFAOYSA-N 3-n-[2-[[5-[(dimethylamino)methyl]-4-methylthiophen-2-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CC1=C(CN(C)C)SC(CSCCNC=2C(=NSN=2)N)=C1 GSKUHCYANQAPDQ-UHFFFAOYSA-N 0.000 description 1
- RHPQYKPBHCAVNL-UHFFFAOYSA-N 3-n-[2-[[6-(piperidin-1-ylmethyl)pyridin-2-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCSCC1=CC=CC(CN2CCCCC2)=N1 RHPQYKPBHCAVNL-UHFFFAOYSA-N 0.000 description 1
- NMZTUUMPAVUKHW-UHFFFAOYSA-N 3-n-[2-[[6-[(dimethylamino)methyl]pyridin-2-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CN(C)CC1=CC=CC(CSCCNC=2C(=NSN=2)N)=N1 NMZTUUMPAVUKHW-UHFFFAOYSA-N 0.000 description 1
- UMTHCSXKPPAXDW-UHFFFAOYSA-N 3-n-[2-[[6-[(dimethylamino)methyl]pyridin-2-yl]methylsulfanyl]ethyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine Chemical compound CN(C)CC1=CC=CC(CSCCNC=2C(=NS(=O)N=2)N)=N1 UMTHCSXKPPAXDW-UHFFFAOYSA-N 0.000 description 1
- BIHKIFICPIILPI-UHFFFAOYSA-N 3-n-[3-[3-(diethylaminomethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CCN(CC)CC1=CC=CC(OCCCNC=2C(=NSN=2)N)=C1 BIHKIFICPIILPI-UHFFFAOYSA-N 0.000 description 1
- BEPUFQXSKMYDLW-UHFFFAOYSA-N 3-n-[3-[3-(morpholin-4-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCOC1=CC=CC(CN2CCOCC2)=C1 BEPUFQXSKMYDLW-UHFFFAOYSA-N 0.000 description 1
- SSTYCGCTOJCTIB-UHFFFAOYSA-N 3-n-[3-[3-[(2-methylpyrrolidin-1-yl)methyl]phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CC1CCCN1CC1=CC=CC(OCCCNC=2C(=NSN=2)N)=C1 SSTYCGCTOJCTIB-UHFFFAOYSA-N 0.000 description 1
- RPQYDOLJIJTBMC-UHFFFAOYSA-N 3-n-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine Chemical compound CN(C)CC1=CC=CC(OCCCNC=2C(=NS(=O)N=2)N)=C1 RPQYDOLJIJTBMC-UHFFFAOYSA-N 0.000 description 1
- FTQNYNLEKXCHPJ-UHFFFAOYSA-N 3-n-[3-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCOC1=CC(CN2CCCCC2)=CC=N1 FTQNYNLEKXCHPJ-UHFFFAOYSA-N 0.000 description 1
- HHMDIOWYYPBROF-UHFFFAOYSA-N 3-n-[3-[4-[(dimethylamino)methyl]pyridin-2-yl]oxypropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CN(C)CC1=CC=NC(OCCCNC=2C(=NSN=2)N)=C1 HHMDIOWYYPBROF-UHFFFAOYSA-N 0.000 description 1
- WNOQDNRCZMOINJ-UHFFFAOYSA-N 3-n-[3-[4-[(dimethylamino)methyl]pyridin-2-yl]oxypropyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine Chemical compound CN(C)CC1=CC=NC(OCCCNC=2C(=NS(=O)N=2)N)=C1 WNOQDNRCZMOINJ-UHFFFAOYSA-N 0.000 description 1
- FIGKQXOGRKFRGS-UHFFFAOYSA-N 3-n-[3-[6-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCOC1=CC=CC(CN2CCCCC2)=N1 FIGKQXOGRKFRGS-UHFFFAOYSA-N 0.000 description 1
- VBJIUTXAZRATMG-UHFFFAOYSA-N 3-n-benzyl-1-oxo-4-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound C=1C=CC=CC=1CNC1=NS(=O)N=C1NCCCOC(C=1)=CC=CC=1CN1CCCCC1 VBJIUTXAZRATMG-UHFFFAOYSA-N 0.000 description 1
- OHLUAARMJNNWIK-UHFFFAOYSA-N 4-methoxy-1-oxo-1,2,5-thiadiazol-3-amine Chemical compound COC1=NS(=O)N=C1N OHLUAARMJNNWIK-UHFFFAOYSA-N 0.000 description 1
- YQDWLHLUZWGZBN-UHFFFAOYSA-N 4-n-ethyl-1-oxo-3-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CCNC1=NS(=O)N=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 YQDWLHLUZWGZBN-UHFFFAOYSA-N 0.000 description 1
- BRYKZFSZHNTNOI-UHFFFAOYSA-N 4-n-ethyl-3-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CCNC1=NSN=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 BRYKZFSZHNTNOI-UHFFFAOYSA-N 0.000 description 1
- XGRRSCZJFCJRGY-UHFFFAOYSA-N 4-n-methyl-3-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CNC1=NSN=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 XGRRSCZJFCJRGY-UHFFFAOYSA-N 0.000 description 1
- JOOXCMJARBKPKM-UHFFFAOYSA-N 4-oxopentanoic acid Chemical compound CC(=O)CCC(O)=O JOOXCMJARBKPKM-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- HQULYFAKUZDRPB-UHFFFAOYSA-N 6-bromo-2-[4-(trifluoromethoxy)phenoxy]-1,3-benzothiazole Chemical compound BrC1=CC2=C(N=C(S2)OC2=CC=C(C=C2)OC(F)(F)F)C=C1 HQULYFAKUZDRPB-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- YLMQLRBJNUXGQC-UHFFFAOYSA-N Cl.Cl.Cl.C(C)(N)N Chemical compound Cl.Cl.Cl.C(C)(N)N YLMQLRBJNUXGQC-UHFFFAOYSA-N 0.000 description 1
- APNDGESUTRXNEO-UHFFFAOYSA-N Cl.Cl.Cl.C(C)NC(C(N)=N)=N Chemical compound Cl.Cl.Cl.C(C)NC(C(N)=N)=N APNDGESUTRXNEO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 206010065713 Gastric Fistula Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229940122236 Histamine receptor antagonist Drugs 0.000 description 1
- 101150056637 Hrh2 gene Proteins 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- SWEUMHMNAMOFMV-UHFFFAOYSA-N N1(CCCCC1)CC1=CC(=CS1)CSCCNC1=NSN=C1 Chemical compound N1(CCCCC1)CC1=CC(=CS1)CSCCNC1=NSN=C1 SWEUMHMNAMOFMV-UHFFFAOYSA-N 0.000 description 1
- BCAKQOWRRNAMTL-UHFFFAOYSA-N NC1=NS(N=C1NCCCSC1=CC(=CC=C1)CN1CCCCC1)=O Chemical compound NC1=NS(N=C1NCCCSC1=CC(=CC=C1)CN1CCCCC1)=O BCAKQOWRRNAMTL-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001260 acyclic compounds Chemical class 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- RIMGDBZXWSGBQN-UHFFFAOYSA-N burimamide Chemical compound CNC(=S)NCCCCC1=CN=C[N]1 RIMGDBZXWSGBQN-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000002057 chronotropic effect Effects 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- RSMPILKUYOCFMR-UHFFFAOYSA-N ethane propane-1,3-diamine Chemical group CC.NCCCN RSMPILKUYOCFMR-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 229960004931 histamine dihydrochloride Drugs 0.000 description 1
- PPZMYIBUHIPZOS-UHFFFAOYSA-N histamine dihydrochloride Chemical compound Cl.Cl.NCCC1=CN=CN1 PPZMYIBUHIPZOS-UHFFFAOYSA-N 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- HPQIDJKQMFOBKA-UHFFFAOYSA-N n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-4-prop-2-ynyl-1,2,5-thiadiazol-3-amine Chemical compound C#CCC1=NSN=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 HPQIDJKQMFOBKA-UHFFFAOYSA-N 0.000 description 1
- AHKHXHNFVGUCBC-UHFFFAOYSA-N n-propyl-1,2,5-thiadiazol-3-amine Chemical compound CCCNC=1C=NSN=1 AHKHXHNFVGUCBC-UHFFFAOYSA-N 0.000 description 1
- 101150009274 nhr-1 gene Proteins 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000000611 regression analysis Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- RKBCYCFRFCNLTO-UHFFFAOYSA-N triisopropylamine Chemical compound CC(C)N(C(C)C)C(C)C RKBCYCFRFCNLTO-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D407/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00
- C07D407/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings
- C07D407/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/10—1,2,5-Thiadiazoles; Hydrogenated 1,2,5-thiadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/096—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/475,985 US4440933A (en) | 1983-03-16 | 1983-03-16 | Process for preparing 1,2,5-thiadiazoles |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CS185984A2 CS185984A2 (en) | 1985-06-13 |
| CS241072B2 true CS241072B2 (en) | 1986-03-13 |
Family
ID=23890020
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS841859A CS241072B2 (en) | 1983-03-16 | 1984-03-15 | Method of 3-/(amino or subst,amino/)-4-/(subst.amino/)-1,2,5-thiadizoles production |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4440933A (sh) |
| KR (1) | KR860002036B1 (sh) |
| CA (1) | CA1207763A (sh) |
| CS (1) | CS241072B2 (sh) |
| DD (1) | DD218364A5 (sh) |
| DK (1) | DK155984A (sh) |
| ES (1) | ES530590A0 (sh) |
| FI (1) | FI79848C (sh) |
| GR (1) | GR81826B (sh) |
| HU (1) | HU198925B (sh) |
| IE (1) | IE57306B1 (sh) |
| LU (1) | LU85254A1 (sh) |
| NO (1) | NO158136C (sh) |
| YU (1) | YU45597B (sh) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4588826A (en) * | 1982-03-29 | 1986-05-13 | Bristol-Myers Company | Ethanediimidamide intermediates |
| US4578471A (en) * | 1982-03-29 | 1986-03-25 | Bristol-Myers Company | Substituted amino alkyl pyridyl ethanediimidamides |
| US4600779A (en) * | 1982-03-29 | 1986-07-15 | Bristol-Myers Company | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity |
| US4595758A (en) * | 1982-03-29 | 1986-06-17 | Bristol-Myers Company | Ethanediimidamide intermediates |
| AU2222083A (en) * | 1982-12-14 | 1984-06-21 | Smith Kline & French Laboratories Limited | Pyridine derivatives |
| US4692531A (en) * | 1984-06-22 | 1987-09-08 | Bristol-Myers Company | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity |
| US4644006A (en) * | 1984-06-22 | 1987-02-17 | Bristol-Myers Company | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity |
| CA1275097A (en) * | 1984-10-02 | 1990-10-09 | Fujio Nohara | Pyridyloxy derivatives |
| DE3513184A1 (de) * | 1985-04-12 | 1986-10-16 | Ludwig Heumann & Co GmbH, 8500 Nürnberg | 1,3,4-thiadiazolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| US5248673A (en) * | 1992-12-23 | 1993-09-28 | Bristol-Myers Squibb Co. | Bisamidine derivatives as thrombin inhibitors |
| US5618816A (en) * | 1995-03-02 | 1997-04-08 | Bristol-Myers Squibb Company | Antimigraine 1,2,5-thiadiazole derivatives of indolylalkyl-pyridnyl and pyrimidinylpiperazines |
| TW200517114A (en) | 2003-10-15 | 2005-06-01 | Combinatorx Inc | Methods and reagents for the treatment of immunoinflammatory disorders |
| WO2007056457A2 (en) | 2005-11-09 | 2007-05-18 | Combinatorx, Incorporated | Methods, compositions, and kits for the treatment of medical conditions |
| US20100092479A1 (en) * | 2008-08-18 | 2010-04-15 | Combinatorx (Singapore) Pte. Ltd. | Compositions and methods for treatment of viral diseases |
| US20110130711A1 (en) * | 2009-11-19 | 2011-06-02 | Follica, Inc. | Hair growth treatment |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK160611C (da) * | 1979-09-04 | 1991-09-16 | Bristol Myers Squibb Co | Analogifremgangsmaade til fremstilling af 3,4-disubstituerede 1,2,5-thiadiazol-1-oxider og -1,1-dioxider |
| EP0040696B1 (en) * | 1980-04-30 | 1986-08-27 | Merck & Co. Inc. | Aminothiadiazoles as gastric secretion inhibitors |
| US4394508A (en) * | 1980-06-07 | 1983-07-19 | Bristol-Myers Company | Chemical compounds |
| US4380638A (en) * | 1981-03-03 | 1983-04-19 | Bristol-Myers Company | Chemical compounds |
| US4380639A (en) * | 1981-03-03 | 1983-04-19 | Bristol-Myers Company | Substituted 1,2,5-thiadiazole derivatives |
-
1983
- 1983-03-16 US US06/475,985 patent/US4440933A/en not_active Expired - Fee Related
-
1984
- 1984-03-12 NO NO840929A patent/NO158136C/no unknown
- 1984-03-13 FI FI841009A patent/FI79848C/fi not_active IP Right Cessation
- 1984-03-14 DK DK155984A patent/DK155984A/da not_active Application Discontinuation
- 1984-03-14 ES ES530590A patent/ES530590A0/es active Granted
- 1984-03-15 LU LU85254A patent/LU85254A1/de unknown
- 1984-03-15 GR GR74113A patent/GR81826B/el unknown
- 1984-03-15 IE IE651/84A patent/IE57306B1/en not_active IP Right Cessation
- 1984-03-15 CS CS841859A patent/CS241072B2/cs unknown
- 1984-03-15 HU HU841026A patent/HU198925B/hu not_active IP Right Cessation
- 1984-03-15 CA CA000449644A patent/CA1207763A/en not_active Expired
- 1984-03-16 YU YU46984A patent/YU45597B/sh unknown
- 1984-03-16 KR KR1019840001362A patent/KR860002036B1/ko not_active IP Right Cessation
- 1984-03-16 DD DD84260980A patent/DD218364A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| KR860002036B1 (ko) | 1986-11-17 |
| DK155984A (da) | 1984-09-17 |
| YU46984A (en) | 1986-10-31 |
| LU85254A1 (de) | 1984-11-14 |
| HU198925B (en) | 1989-12-28 |
| NO158136B (no) | 1988-04-11 |
| DK155984D0 (da) | 1984-03-14 |
| CA1207763A (en) | 1986-07-15 |
| CS185984A2 (en) | 1985-06-13 |
| ES8602721A1 (es) | 1985-12-01 |
| NO840929L (no) | 1984-09-17 |
| GR81826B (sh) | 1984-12-12 |
| YU45597B (sh) | 1992-07-20 |
| FI79848B (fi) | 1989-11-30 |
| FI841009A (fi) | 1984-09-17 |
| IE840651L (en) | 1984-09-16 |
| FI79848C (fi) | 1990-03-12 |
| ES530590A0 (es) | 1985-12-01 |
| KR840008005A (ko) | 1984-12-12 |
| FI841009A0 (fi) | 1984-03-13 |
| DD218364A5 (de) | 1985-02-06 |
| NO158136C (no) | 1988-07-20 |
| US4440933A (en) | 1984-04-03 |
| IE57306B1 (en) | 1992-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4390701A (en) | 1-Amino-2-[3-(3-piperidinomethylphenoxy)propylamino]cyclobutene-3,4-dione | |
| CS241072B2 (en) | Method of 3-/(amino or subst,amino/)-4-/(subst.amino/)-1,2,5-thiadizoles production | |
| US4522943A (en) | Chemical compounds | |
| US4528375A (en) | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity | |
| US4526973A (en) | Chemical compounds | |
| KR870000912B1 (ko) | 디하이드로피리딘 유도체의 제조방법 | |
| US4692531A (en) | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity | |
| KR880002209B1 (ko) | 치환된 3,4-디아미노-1,2,5-티아디아졸류 및 그의 제조방법 | |
| US4395553A (en) | Chemical compounds | |
| US4528378A (en) | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity | |
| US4600779A (en) | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity | |
| US4503051A (en) | Substituted 3-cyclobutene-1,2-diones, pharmaceutical compositions thereof and methods of use | |
| US4528377A (en) | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity | |
| US4588826A (en) | Ethanediimidamide intermediates | |
| US4539316A (en) | Pyridine derivatives of 1,2-diaminocyclobutene-3,4-diones | |
| US4578471A (en) | Substituted amino alkyl pyridyl ethanediimidamides | |
| Breslin et al. | A novel series of N-(1-aminoalkylidene) carboximidamides as potential hypoglycemia agents | |
| US4517366A (en) | Intermediates for preparing 3,4-diamino-1,2,5-thiadiazoles | |
| US4595758A (en) | Ethanediimidamide intermediates | |
| US4546188A (en) | Substituted 1,2-diaminocyclobutene-3,4-diones | |
| KR880002530B1 (ko) | 치환된 에탄디이미드 아미드 및 그의 제조방법 | |
| US4788184A (en) | Substituted 3-cyclobutene-1,2-diones as anti-ulcer agents | |
| US4644006A (en) | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity | |
| HU196064B (en) | Process for production of 1,3,4-tiadiasole-derivatives and medical preparatives containing such compositions | |
| JPS61115074A (ja) | ３，４‐ジアゾール誘導体、その製法、およびその化合物を含有する医薬品 |