CS232000B2 - Manufacturing process of new ergoline derovatives - Google Patents
Manufacturing process of new ergoline derovatives Download PDFInfo
- Publication number
- CS232000B2 CS232000B2 CS827752A CS775282A CS232000B2 CS 232000 B2 CS232000 B2 CS 232000B2 CS 827752 A CS827752 A CS 827752A CS 775282 A CS775282 A CS 775282A CS 232000 B2 CS232000 B2 CS 232000B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- group
- methyl
- ergoline
- carbon atoms
- yield
- Prior art date
Links
- AWFDCTXCTHGORH-HGHGUNKESA-N 6-[4-[(6ar,9r,10ar)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carbonyl]piperazin-1-yl]-1-methylpyridin-2-one Chemical compound O=C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(Br)=C(C=34)C2)C1)C)N(CC1)CCN1C1=CC=CC(=O)N1C AWFDCTXCTHGORH-HGHGUNKESA-N 0.000 title claims abstract description 68
- 238000004519 manufacturing process Methods 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 42
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 7
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 7
- 150000003839 salts Chemical class 0.000 claims abstract description 6
- 125000005843 halogen group Chemical group 0.000 claims abstract description 5
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 3
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 3
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims abstract description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract 2
- 238000000034 method Methods 0.000 claims description 44
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 239000012948 isocyanate Substances 0.000 claims description 4
- 150000002513 isocyanates Chemical class 0.000 claims description 4
- 150000002540 isothiocyanates Chemical class 0.000 claims description 4
- 125000006431 methyl cyclopropyl group Chemical group 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical group CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims 2
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 230000003276 anti-hypertensive effect Effects 0.000 abstract description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 abstract 2
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000004104 aryloxy group Chemical group 0.000 abstract 1
- 125000000623 heterocyclic group Chemical group 0.000 abstract 1
- -1 3-benzoyl-thioureidomethyl Chemical group 0.000 description 28
- CPEKAXYCDKETEN-UHFFFAOYSA-N benzoyl isothiocyanate Chemical compound S=C=NC(=O)C1=CC=CC=C1 CPEKAXYCDKETEN-UHFFFAOYSA-N 0.000 description 14
- 241000700159 Rattus Species 0.000 description 13
- RPTUSVTUFVMDQK-UHFFFAOYSA-N Hidralazin Chemical compound C1=CC=C2C(NN)=NN=CC2=C1 RPTUSVTUFVMDQK-UHFFFAOYSA-N 0.000 description 10
- 230000000694 effects Effects 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- VITFJKNVGRZRKB-UHFFFAOYSA-N acetyl isothiocyanate Chemical compound CC(=O)N=C=S VITFJKNVGRZRKB-UHFFFAOYSA-N 0.000 description 5
- CJCSPKMFHVPWAR-JTQLQIEISA-N alpha-methyl-L-dopa Chemical compound OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 CJCSPKMFHVPWAR-JTQLQIEISA-N 0.000 description 5
- 229960002474 hydralazine Drugs 0.000 description 5
- 230000001262 anti-secretory effect Effects 0.000 description 4
- 230000035488 systolic blood pressure Effects 0.000 description 4
- 238000005303 weighing Methods 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- OCKPROYBCPQWJO-UHFFFAOYSA-N acetyl isocyanate Chemical compound CC(=O)N=C=O OCKPROYBCPQWJO-UHFFFAOYSA-N 0.000 description 3
- 230000001078 anti-cholinergic effect Effects 0.000 description 3
- 230000000026 anti-ulcerogenic effect Effects 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 230000002496 gastric effect Effects 0.000 description 3
- 238000002203 pretreatment Methods 0.000 description 3
- 101100231508 Caenorhabditis elegans ceh-5 gene Proteins 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- LURYMYITPCOQAU-UHFFFAOYSA-N benzoyl isocyanate Chemical compound O=C=NC(=O)C1=CC=CC=C1 LURYMYITPCOQAU-UHFFFAOYSA-N 0.000 description 2
- MDKCFLQDBWCQCV-UHFFFAOYSA-N benzyl isothiocyanate Chemical compound S=C=NCC1=CC=CC=C1 MDKCFLQDBWCQCV-UHFFFAOYSA-N 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- BNTOYYSKEDTQHC-QFIXIFRTSA-N n-[[(6ar,9r,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]methylcarbamoyl]benzamide Chemical compound C([C@@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC=C(C=34)C2)C1)C)NC(=O)NC(=O)C1=CC=CC=C1 BNTOYYSKEDTQHC-QFIXIFRTSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- SJVGFKBLUYAEOK-SFHVURJKSA-N 6-[4-[(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazole-2-carbonyl]piperidin-1-yl]pyrimidine-4-carbonitrile Chemical compound FC=1C=C(C=C(C=1)F)[C@@H]1CC=NN1C(=O)C1CCN(CC1)C1=CC(=NC=N1)C#N SJVGFKBLUYAEOK-SFHVURJKSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- 229930003347 Atropine Natural products 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241001340534 Eido Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- IPCRBOOJBPETMF-UHFFFAOYSA-N N-acetylthiourea Chemical compound CC(=O)NC(N)=S IPCRBOOJBPETMF-UHFFFAOYSA-N 0.000 description 1
- QAADZYUXQLUXFX-UHFFFAOYSA-N N-phenylmethylthioformamide Natural products S=CNCC1=CC=CC=C1 QAADZYUXQLUXFX-UHFFFAOYSA-N 0.000 description 1
- 206010030201 Oesophageal ulcer Diseases 0.000 description 1
- RSDOPYMFZBJHRL-UHFFFAOYSA-N Oxotremorine Chemical compound O=C1CCCN1CC#CCN1CCCC1 RSDOPYMFZBJHRL-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 208000007107 Stomach Ulcer Diseases 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- IXCCQSTVBSTCLP-PSOPSSQASA-N [(6ar,9s,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]methanamine Chemical compound C1=CC([C@H]2C[C@@H](CN)CN([C@@H]2C2)C)=C3C2=CNC3=C1 IXCCQSTVBSTCLP-PSOPSSQASA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 230000000767 anti-ulcer Effects 0.000 description 1
- 239000003699 antiulcer agent Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 1
- 229960000396 atropine Drugs 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 208000006218 bradycardia Diseases 0.000 description 1
- 230000036471 bradycardia Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000002183 duodenal effect Effects 0.000 description 1
- 208000000718 duodenal ulcer Diseases 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- PUSKHXMZPOMNTQ-UHFFFAOYSA-N ethyl 2,1,3-benzoselenadiazole-5-carboxylate Chemical compound CCOC(=O)C1=CC=C2N=[Se]=NC2=C1 PUSKHXMZPOMNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 230000027119 gastric acid secretion Effects 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 210000001156 gastric mucosa Anatomy 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- BNZBMEIFAOYZEA-UHFFFAOYSA-N n-cyanoacetamide Chemical compound CC(=O)NC#N BNZBMEIFAOYZEA-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000001301 oxygen Chemical group 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 230000001175 peptic effect Effects 0.000 description 1
- 235000020004 porter Nutrition 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- LYULLJDMUFOQHU-UHFFFAOYSA-N propanoyl isothiocyanate Chemical compound CCC(=O)N=C=S LYULLJDMUFOQHU-UHFFFAOYSA-N 0.000 description 1
- 230000035485 pulse pressure Effects 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 102000012498 secondary active transmembrane transporter activity proteins Human genes 0.000 description 1
- 108040003878 secondary active transmembrane transporter activity proteins Proteins 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000012453 sprague-dawley rat model Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 231100000397 ulcer Toxicity 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/10—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hetero atoms directly attached in position 8
- C07D457/12—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Heart & Thoracic Surgery (AREA)
- Cardiology (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8133631 | 1981-11-06 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CS775282A2 CS775282A2 (en) | 1984-01-16 |
| CS232000B2 true CS232000B2 (en) | 1985-01-16 |
Family
ID=10525712
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS827752A CS232000B2 (en) | 1981-11-06 | 1982-11-01 | Manufacturing process of new ergoline derovatives |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4500712A (show.php) |
| JP (1) | JPS5885886A (show.php) |
| AT (1) | AT381091B (show.php) |
| AU (1) | AU553903B2 (show.php) |
| BE (1) | BE894927A (show.php) |
| CA (1) | CA1191841A (show.php) |
| CH (1) | CH650506A5 (show.php) |
| CS (1) | CS232000B2 (show.php) |
| DE (1) | DE3240727A1 (show.php) |
| DK (1) | DK494882A (show.php) |
| FI (1) | FI73214C (show.php) |
| FR (1) | FR2516083A1 (show.php) |
| GB (1) | GB2112382B (show.php) |
| GR (1) | GR77055B (show.php) |
| IE (1) | IE54327B1 (show.php) |
| IL (1) | IL67155A (show.php) |
| IT (1) | IT1205272B (show.php) |
| NL (1) | NL8204225A (show.php) |
| SE (1) | SE452884B (show.php) |
| SU (1) | SU1189347A3 (show.php) |
| ZA (1) | ZA828095B (show.php) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3151912A1 (de) * | 1981-12-23 | 1983-06-30 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue ergolin-aminoderivate, verfahren zu ihrer herstellung und deren verwendung als arzneimittel |
| PH21123A (en) * | 1983-04-28 | 1987-07-27 | Erba Farmitalia | Ergoline derivatives |
| DE3587860D1 (de) * | 1984-04-09 | 1994-07-28 | Schering Ag | 2-substituierte Ergolin-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel. |
| DE3413657A1 (de) * | 1984-04-09 | 1985-10-17 | Schering AG, 1000 Berlin und 4709 Bergkamen | Neue ergoline |
| GB2173189B (en) * | 1985-02-21 | 1988-04-27 | Maruko Pharmaceutical Co | Ergoline derivatives and salts thereof and pharmaceutical compositions thereof |
| GB8515528D0 (en) * | 1985-06-19 | 1985-07-24 | Erba Farmitalia | Ergoline derivatives |
| DE3528584A1 (de) * | 1985-08-06 | 1987-02-19 | Schering Ag | Neue 1-alkyl-ergolin-thioharnstoffderivate |
| DE3533672A1 (de) * | 1985-09-19 | 1987-03-26 | Schering Ag | Neue 12- und 13-substituierte ergolinderivate |
| DE3535930A1 (de) * | 1985-10-04 | 1987-04-09 | Schering Ag | Neue 2-substituierte ergolinderivate |
| ES2162856T3 (es) * | 1992-12-24 | 2002-01-16 | Pharmacia & Upjohn Spa | Derivados de ergolina serotoninergicos. |
| DE19832191A1 (de) * | 1998-07-17 | 2000-01-27 | Knoell Hans Forschung Ev | Neuartige Ergolinamin-Derivate und ihre Verwendung |
| PT1401863E (pt) | 2001-06-08 | 2009-07-23 | Ipsen Pharma | Análogos quiméricos da somatostatina-dopamina |
| WO2006104141A1 (ja) * | 2005-03-29 | 2006-10-05 | Shionogi & Co., Ltd. | 3-プロペニルセフェム誘導体 |
| US9777039B2 (en) | 2012-11-01 | 2017-10-03 | Ipsen Pharma S.A.S. | Somatostatin analogs and dimers thereof |
| TWI523863B (zh) | 2012-11-01 | 2016-03-01 | 艾普森藥品公司 | 體抑素-多巴胺嵌合體類似物 |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3238211A (en) * | 1966-03-01 | Derhvatives of g-methyl and i,g-dimethyl ergolhne | ||
| AT258479B (de) * | 1961-05-29 | 1967-11-27 | Farmaceutici Italia | Verfahren zur Herstellung von neuen Verbindungen aus der Klasse des D-6-Methyl- (und -1,6-Dimethyl)-8-amino-methyl-ergolins I |
| GB1005880A (en) * | 1961-11-10 | 1965-09-29 | Sandoz Ag | Ergolene and ergoline derivatives |
| GB1138419A (en) * | 1966-07-29 | 1969-01-01 | Farmaceutici Italia | Ergoline derivatives |
| CH507248A (de) * | 1967-03-16 | 1971-05-15 | Spofa Vereinigte Pharma Werke | Verfahren zur Herstellung von D-6-Methylergolin(I)ylessigsäure |
| BR6915443D0 (pt) * | 1969-07-18 | 1973-03-13 | Farmaceutici Italia | Processo para a preparacao de derivados de ergolina |
| US3966941A (en) * | 1970-09-23 | 1976-06-29 | Spofa United Pharmaceutical Works | Composition for preventing lactation or pregnancy in mammals and the method for using the same |
| SE393615B (sv) * | 1971-05-19 | 1977-05-16 | Sandoz Ag | Forfarande for framstellning av 6-metyl-8 beta-ureidometyl-ergolener |
| NL7416120A (nl) * | 1973-12-21 | 1975-06-24 | Farmaceutici Italia | Werkwijze voor het bereiden van pyrimidinoami- nomethylergolinederivaten. |
| US3996228A (en) * | 1973-12-21 | 1976-12-07 | Societa' Farmaceutici Italia S.P.A. | Pyrimidinoaminoethyl ergoline derivatives |
| GB1573621A (en) * | 1976-01-02 | 1980-08-28 | Sandoz Ltd | Acylated 6-methyl-8a-amino-ergoline i compounds |
| DE2656344A1 (de) * | 1975-12-23 | 1977-07-07 | Sandoz Ag | Ergolinderivate, ihre verwendung und herstellung |
| HU178396B (en) * | 1978-03-20 | 1982-04-28 | Vianova Kunstharz Ag | Process for producing new 8-beta-hydrazion-methyl-ergoline-and -ergolene derivatives |
| DD138979A1 (de) * | 1978-09-27 | 1979-12-05 | Karlheinz Seifert | Verfahren zur herstellung von acylthioharnstoffen mit ergolinstruktur |
| US4201862A (en) * | 1979-03-16 | 1980-05-06 | Eli Lilly And Company | 2-Azaergolines and 2-aza-8(or 9)-ergolenes |
| DE3129714A1 (de) * | 1981-07-23 | 1983-02-10 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Anti-psychotikum |
-
1982
- 1982-10-29 GB GB08231053A patent/GB2112382B/en not_active Expired
- 1982-11-01 SU SU823506255A patent/SU1189347A3/ru active
- 1982-11-01 CS CS827752A patent/CS232000B2/cs unknown
- 1982-11-01 US US06/438,259 patent/US4500712A/en not_active Expired - Fee Related
- 1982-11-01 FI FI823727A patent/FI73214C/fi not_active IP Right Cessation
- 1982-11-01 NL NL8204225A patent/NL8204225A/nl not_active Application Discontinuation
- 1982-11-02 IL IL67155A patent/IL67155A/xx unknown
- 1982-11-02 IE IE2614/82A patent/IE54327B1/en unknown
- 1982-11-02 AT AT0399682A patent/AT381091B/de not_active IP Right Cessation
- 1982-11-02 AU AU90090/82A patent/AU553903B2/en not_active Ceased
- 1982-11-03 FR FR8218418A patent/FR2516083A1/fr active Granted
- 1982-11-03 GR GR69718A patent/GR77055B/el unknown
- 1982-11-04 CA CA000414917A patent/CA1191841A/en not_active Expired
- 1982-11-04 SE SE8206282A patent/SE452884B/sv not_active IP Right Cessation
- 1982-11-04 DE DE19823240727 patent/DE3240727A1/de not_active Ceased
- 1982-11-04 JP JP57192620A patent/JPS5885886A/ja active Granted
- 1982-11-04 ZA ZA828095A patent/ZA828095B/xx unknown
- 1982-11-04 IT IT24077/82A patent/IT1205272B/it active
- 1982-11-05 BE BE0/209409A patent/BE894927A/fr not_active IP Right Cessation
- 1982-11-05 DK DK494882A patent/DK494882A/da not_active Application Discontinuation
- 1982-11-05 CH CH6452/82A patent/CH650506A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SU1189347A3 (ru) | 1985-10-30 |
| IE54327B1 (en) | 1989-08-30 |
| US4500712A (en) | 1985-02-19 |
| AT381091B (de) | 1986-08-25 |
| SE452884B (sv) | 1987-12-21 |
| GR77055B (show.php) | 1984-09-05 |
| SE8206282L (sv) | 1983-05-07 |
| CH650506A5 (de) | 1985-07-31 |
| JPS5885886A (ja) | 1983-05-23 |
| IE822614L (en) | 1983-05-06 |
| FI73214C (fi) | 1987-09-10 |
| IT1205272B (it) | 1989-03-15 |
| FR2516083B1 (show.php) | 1984-05-25 |
| GB2112382A (en) | 1983-07-20 |
| AU9009082A (en) | 1983-05-12 |
| DE3240727A1 (de) | 1983-05-19 |
| IL67155A (en) | 1985-07-31 |
| GB2112382B (en) | 1985-03-06 |
| IL67155A0 (en) | 1983-03-31 |
| FI73214B (fi) | 1987-05-29 |
| IT8224077A0 (it) | 1982-11-04 |
| AU553903B2 (en) | 1986-07-31 |
| SE8206282D0 (sv) | 1982-11-04 |
| NL8204225A (nl) | 1983-06-01 |
| CA1191841A (en) | 1985-08-13 |
| FI823727A0 (fi) | 1982-11-01 |
| ATA399682A (de) | 1986-01-15 |
| DK494882A (da) | 1983-05-07 |
| FI823727L (fi) | 1983-05-07 |
| BE894927A (fr) | 1983-05-05 |
| CS775282A2 (en) | 1984-01-16 |
| ZA828095B (en) | 1983-09-28 |
| FR2516083A1 (fr) | 1983-05-13 |
| JPS628433B2 (show.php) | 1987-02-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4076820A (en) | Benzoquinolizines and hypotensive compositions containing them | |
| CS232000B2 (en) | Manufacturing process of new ergoline derovatives | |
| US4125620A (en) | 2-[(2',6'-Disubstituted-phenyl)-imino]-imidazolidines and salts thereof | |
| HUP0102313A2 (hu) | Imidazo-piridin-származékok, eljárás előállításukra, ezeket tartalmazó gyógyszerkészítmények, valamint intermedierek | |
| KR100717489B1 (ko) | 피리도피리미디논 화합물, 이의 제조 방법 및 이를함유하는 약제 조성물 | |
| GB2071095A (en) | Heterocyclic compounds processes for their preparation and pharmaceutical compositions containing them | |
| KR880001317B1 (ko) | 이미다졸릴페닐 아미딘 유도체의 제조방법 | |
| HU198713B (en) | Process for producing ergolin derivatives and pharmaceutical compositions containing them as active components | |
| NZ203956A (en) | Imidazo(1,2,-a)pyridine derivatives and pharmaceutical compositions | |
| EP0216247A2 (en) | Use of alpha 2 adrenergic receptor antagonists for the production of pharmaceutical compositions for treating colonic spasm, irritable bowel syndrome and constipation and process for preparing such pharmaceutical compositions | |
| CA1051878A (en) | Compounds with ergoline skeleton and a process for the preparation thereof | |
| US4472398A (en) | Condensed pyrimidines | |
| US4734501A (en) | N-alkylation of dihydrolysergic acid | |
| US4432990A (en) | 5-Aminoimidazoles as immunoregulants | |
| US3822262A (en) | Phenyl acetylimino-imidazolines and-hexahydropyrimidines | |
| IL112364A (en) | Pharmaceutical compositions containing 3-phenylsulphonyl-3, 7-diazabicyclo £3.3.1| nonane compounds for the treatment of cardiac arrhythmias, some new such compounds and their preparation | |
| US4024258A (en) | Composition of and method for reducing hypertension with a 1-[1-(indol-3-ylethyl)-piperazin-4-yl]-3-substituted urea | |
| US4452982A (en) | Process for the preparation of nitrogen-bridgehead condensed pyrimidine compounds, and pharmaceutical compositions containing them | |
| US4495189A (en) | Condensed pyrimidines | |
| CS220336B2 (en) | Method of producing new guanidine derivatives | |
| US4681881A (en) | 5-alkoxy-pyrido[4,3-d]pyrimidine derivatives | |
| US4499269A (en) | Fused 1,3,5-triazines | |
| US4681885A (en) | 5-oxo-pyrido[4,3-]pyrimidine derivatives | |
| US4720499A (en) | Treating blood vessel diseases with pyrido[4,3-b][1,6]naphthyridine-derivatives | |
| EP1047668B1 (en) | Triazepinones, process for their preparation and their therapeutic application |