CS219348B2 - Means for suppressing the plant-louses and method of making the active substances - Google Patents
Means for suppressing the plant-louses and method of making the active substances Download PDFInfo
- Publication number
- CS219348B2 CS219348B2 CS81439A CS43981A CS219348B2 CS 219348 B2 CS219348 B2 CS 219348B2 CS 81439 A CS81439 A CS 81439A CS 43981 A CS43981 A CS 43981A CS 219348 B2 CS219348 B2 CS 219348B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- group
- carbon atoms
- alkyl
- substituted
- amino
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 239000013543 active substance Substances 0.000 title description 23
- 150000001875 compounds Chemical class 0.000 claims abstract description 71
- 239000000203 mixture Substances 0.000 claims abstract description 68
- 241001124076 Aphididae Species 0.000 claims abstract description 54
- -1 sulphonyl compounds Chemical class 0.000 claims abstract description 54
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 44
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 38
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 29
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 19
- 125000005843 halogen group Chemical group 0.000 claims abstract description 17
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 13
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 10
- 125000003277 amino group Chemical group 0.000 claims abstract description 10
- 125000004663 dialkyl amino group Chemical group 0.000 claims abstract description 9
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 9
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 8
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 8
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 6
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 6
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims abstract description 6
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims abstract description 6
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical group NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 claims abstract description 4
- 125000001841 imino group Chemical group [H]N=* 0.000 claims abstract description 4
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims abstract 2
- 239000004480 active ingredient Substances 0.000 claims description 45
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 23
- 239000002904 solvent Substances 0.000 claims description 22
- GCJSHQQIDPHFGX-UHFFFAOYSA-N 4-chloro-1,1-dioxo-1,2-benzothiazol-3-amine Chemical group C1=CC(Cl)=C2C(N)=NS(=O)(=O)C2=C1 GCJSHQQIDPHFGX-UHFFFAOYSA-N 0.000 claims description 14
- 239000000654 additive Substances 0.000 claims description 13
- 239000007788 liquid Substances 0.000 claims description 12
- 239000011492 sheep wool Substances 0.000 claims description 11
- 229910052717 sulfur Chemical group 0.000 claims description 11
- 229920003171 Poly (ethylene oxide) Chemical class 0.000 claims description 10
- 238000009835 boiling Methods 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 150000001412 amines Chemical class 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 239000003495 polar organic solvent Substances 0.000 claims description 8
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 7
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 6
- 239000000194 fatty acid Substances 0.000 claims description 6
- 229930195729 fatty acid Natural products 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 231100000674 Phytotoxicity Toxicity 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 239000012876 carrier material Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- VPKDCDLSJZCGKE-UHFFFAOYSA-N methanediimine Chemical group N=C=N VPKDCDLSJZCGKE-UHFFFAOYSA-N 0.000 claims description 5
- 239000001301 oxygen Chemical group 0.000 claims description 5
- 239000011593 sulfur Chemical group 0.000 claims description 5
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 4
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 239000003638 chemical reducing agent Substances 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000002480 mineral oil Substances 0.000 claims description 4
- 229920000136 polysorbate Polymers 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- 239000004094 surface-active agent Substances 0.000 claims description 4
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- 150000005215 alkyl ethers Chemical class 0.000 claims description 3
- 239000004202 carbamide Substances 0.000 claims description 3
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 3
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 3
- 150000002989 phenols Chemical class 0.000 claims description 3
- 229920000151 polyglycol Polymers 0.000 claims description 3
- 239000010695 polyglycol Substances 0.000 claims description 3
- 239000002952 polymeric resin Substances 0.000 claims description 3
- 150000003856 quaternary ammonium compounds Chemical class 0.000 claims description 3
- 229920003002 synthetic resin Polymers 0.000 claims description 3
- 235000015112 vegetable and seed oil Nutrition 0.000 claims description 3
- 239000008158 vegetable oil Substances 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 150000002191 fatty alcohols Chemical class 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 2
- 210000002268 wool Anatomy 0.000 claims 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 abstract description 6
- 239000000126 substance Substances 0.000 abstract description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract description 4
- 230000002824 aphicidal effect Effects 0.000 abstract 1
- DOTMOQHOJINYBL-UHFFFAOYSA-N molecular nitrogen;molecular oxygen Chemical compound N#N.O=O DOTMOQHOJINYBL-UHFFFAOYSA-N 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 40
- 241000196324 Embryophyta Species 0.000 description 33
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 30
- 238000006243 chemical reaction Methods 0.000 description 24
- 230000000694 effects Effects 0.000 description 24
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 20
- 208000015181 infectious disease Diseases 0.000 description 18
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 15
- 241001425390 Aphis fabae Species 0.000 description 15
- 238000002360 preparation method Methods 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- 235000019441 ethanol Nutrition 0.000 description 13
- 239000004615 ingredient Substances 0.000 description 13
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 12
- 235000008753 Papaver somniferum Nutrition 0.000 description 11
- 239000008187 granular material Substances 0.000 description 11
- 240000001090 Papaver somniferum Species 0.000 description 10
- 239000002689 soil Substances 0.000 description 10
- 239000005995 Aluminium silicate Substances 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 235000012211 aluminium silicate Nutrition 0.000 description 9
- 238000009472 formulation Methods 0.000 description 9
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 235000019198 oils Nutrition 0.000 description 9
- JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Chemical compound Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 8
- 239000004563 wettable powder Substances 0.000 description 8
- 229910021529 ammonia Inorganic materials 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- DLBPTOMGZXBZOX-UHFFFAOYSA-N 1,2-thiazole 1,1-dioxide Chemical compound O=S1(=O)C=CC=N1 DLBPTOMGZXBZOX-UHFFFAOYSA-N 0.000 description 6
- 244000046052 Phaseolus vulgaris Species 0.000 description 6
- 229920000847 nonoxynol Polymers 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- DXCVGMHEKUUZCL-UHFFFAOYSA-N 2-cyano-3-fluorobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC(F)=C1C#N DXCVGMHEKUUZCL-UHFFFAOYSA-N 0.000 description 5
- RRBGNTJNFBGSOB-UHFFFAOYSA-N 4-fluoro-1,1-dioxo-1,2-benzothiazol-3-amine Chemical compound C1=CC(F)=C2C(N)=NS(=O)(=O)C2=C1 RRBGNTJNFBGSOB-UHFFFAOYSA-N 0.000 description 5
- 240000006677 Vicia faba Species 0.000 description 5
- 230000000996 additive effect Effects 0.000 description 5
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 5
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 5
- 229920005610 lignin Polymers 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- MRHPLGJUVLKEIN-UHFFFAOYSA-N n,n-dichloro-2-cyano-3-fluorobenzenesulfonamide Chemical compound FC1=CC=CC(S(=O)(=O)N(Cl)Cl)=C1C#N MRHPLGJUVLKEIN-UHFFFAOYSA-N 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- BHZBRPQOYFDTAB-UHFFFAOYSA-N 2-(4-bromophenyl)-2-hydroxyacetic acid Chemical compound OC(=O)C(O)C1=CC=C(Br)C=C1 BHZBRPQOYFDTAB-UHFFFAOYSA-N 0.000 description 4
- HPUWBSKJNPBOIR-UHFFFAOYSA-N 2-cyano-3-fluoro-n-propan-2-ylbenzenesulfonamide Chemical compound CC(C)NS(=O)(=O)C1=CC=CC(F)=C1C#N HPUWBSKJNPBOIR-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 229920001732 Lignosulfonate Polymers 0.000 description 4
- 241000721621 Myzus persicae Species 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 230000000855 fungicidal effect Effects 0.000 description 4
- 239000012948 isocyanate Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- KUFTUXFTFBRRLM-UHFFFAOYSA-N 2-cyano-3-fluoro-n,n-dimethylbenzenesulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC=CC(F)=C1C#N KUFTUXFTFBRRLM-UHFFFAOYSA-N 0.000 description 3
- KYSGBLDQRDJGKM-UHFFFAOYSA-N 2-cyano-n,n-diethyl-3-fluorobenzenesulfonamide Chemical compound CCN(CC)S(=O)(=O)C1=CC=CC(F)=C1C#N KYSGBLDQRDJGKM-UHFFFAOYSA-N 0.000 description 3
- RUNBDDGLZNFBCO-UHFFFAOYSA-N 3-chloro-2-cyano-n-propan-2-ylbenzenesulfonamide Chemical compound CC(C)NS(=O)(=O)C1=CC=CC(Cl)=C1C#N RUNBDDGLZNFBCO-UHFFFAOYSA-N 0.000 description 3
- SLVIFRAJHNNOMS-UHFFFAOYSA-N 3-chloro-2-cyanobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC(Cl)=C1C#N SLVIFRAJHNNOMS-UHFFFAOYSA-N 0.000 description 3
- DXHGBVFWBUIQSD-UHFFFAOYSA-N 4-chloro-3-(2-chloroethyl)-1,1-dioxo-1,2-benzothiazol-5-amine Chemical compound NC1=CC=C2S(=O)(=O)N=C(CCCl)C2=C1Cl DXHGBVFWBUIQSD-UHFFFAOYSA-N 0.000 description 3
- KNWTYMAORZWJRF-UHFFFAOYSA-N 4-methoxy-1,1-dioxo-1,2-benzothiazol-3-amine Chemical compound COC1=CC=CC2=C1C(N)=NS2(=O)=O KNWTYMAORZWJRF-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 244000061456 Solanum tuberosum Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 235000010749 Vicia faba Nutrition 0.000 description 3
- 235000002098 Vicia faba var. major Nutrition 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000000417 fungicide Substances 0.000 description 3
- 238000002372 labelling Methods 0.000 description 3
- MWUXSHHQAYIFBG-UHFFFAOYSA-N nitrogen oxide Inorganic materials O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 3
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 3
- 229920000053 polysorbate 80 Polymers 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 3
- 150000003462 sulfoxides Chemical class 0.000 description 3
- 230000009885 systemic effect Effects 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- SHCSDWMQDARMQF-UHFFFAOYSA-N 1,1-dioxo-4-phenoxy-1,2-benzothiazol-3-amine Chemical compound C=12C(N)=NS(=O)(=O)C2=CC=CC=1OC1=CC=CC=C1 SHCSDWMQDARMQF-UHFFFAOYSA-N 0.000 description 2
- AWFHHEGIZNFTGA-UHFFFAOYSA-N 1-(4-chloro-1,1-dioxo-1,2-benzothiazol-3-yl)-3-methylurea Chemical compound C1=CC(Cl)=C2C(NC(=O)NC)=NS(=O)(=O)C2=C1 AWFHHEGIZNFTGA-UHFFFAOYSA-N 0.000 description 2
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 2
- JBQLFMGYMRWOCG-UHFFFAOYSA-N 2-cyano-n,n,3-trimethylbenzenesulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC=CC(C)=C1C#N JBQLFMGYMRWOCG-UHFFFAOYSA-N 0.000 description 2
- VQUSODCVRIEHEJ-UHFFFAOYSA-N 2-cyano-n,n-dimethyl-5-(trifluoromethoxy)benzenesulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC(OC(F)(F)F)=CC=C1C#N VQUSODCVRIEHEJ-UHFFFAOYSA-N 0.000 description 2
- FDJLJKDTMIIISE-UHFFFAOYSA-N 2-fluoro-6-piperidin-1-ylsulfonylbenzonitrile Chemical compound FC1=CC=CC(S(=O)(=O)N2CCCCC2)=C1C#N FDJLJKDTMIIISE-UHFFFAOYSA-N 0.000 description 2
- IISNHJHMDOVHRG-UHFFFAOYSA-N 2-fluoro-6-pyrrolidin-1-ylsulfonylbenzonitrile Chemical compound FC1=CC=CC(S(=O)(=O)N2CCCC2)=C1C#N IISNHJHMDOVHRG-UHFFFAOYSA-N 0.000 description 2
- FJRVDPLJNHWGSE-UHFFFAOYSA-N 3-chloro-2-cyanobenzenesulfonyl chloride Chemical compound ClC1=CC=CC(S(Cl)(=O)=O)=C1C#N FJRVDPLJNHWGSE-UHFFFAOYSA-N 0.000 description 2
- NTKGHYKWGUZNTR-UHFFFAOYSA-N 4-fluoro-2-methyl-1,1-dioxo-1,2-benzothiazol-3-imine Chemical compound O=S1(=O)N(C)C(=N)C2=C1C=CC=C2F NTKGHYKWGUZNTR-UHFFFAOYSA-N 0.000 description 2
- XLAVHWCGNBFDQB-UHFFFAOYSA-N 5-chloro-2-cyano-n,n-dimethylbenzenesulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC(Cl)=CC=C1C#N XLAVHWCGNBFDQB-UHFFFAOYSA-N 0.000 description 2
- 241001600408 Aphis gossypii Species 0.000 description 2
- 241000982105 Brevicoryne brassicae Species 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- 229920001213 Polysorbate 20 Polymers 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 241000180219 Sitobion avenae Species 0.000 description 2
- 239000005708 Sodium hypochlorite Substances 0.000 description 2
- 230000000895 acaricidal effect Effects 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- 238000003898 horticulture Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 230000000749 insecticidal effect Effects 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- CABZJKBKPKZQKK-UHFFFAOYSA-N n-butyl-4-chloro-1,1-dioxo-1,2-benzothiazol-3-amine Chemical compound C1=CC(Cl)=C2C(NCCCC)=NS(=O)(=O)C2=C1 CABZJKBKPKZQKK-UHFFFAOYSA-N 0.000 description 2
- 230000000361 pesticidal effect Effects 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 2
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 2
- 230000000630 rising effect Effects 0.000 description 2
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 2
- 239000011343 solid material Substances 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical class OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- QNOQSOJREDRYBC-UHFFFAOYSA-N 1,1-dioxo-1,2-benzothiazol-3-amine Chemical compound C1=CC=C2C(N)=NS(=O)(=O)C2=C1 QNOQSOJREDRYBC-UHFFFAOYSA-N 0.000 description 1
- BTNAZHHYONIOIV-UHFFFAOYSA-N 1,2-benzothiazole 1,1-dioxide Chemical compound C1=CC=C2S(=O)(=O)N=CC2=C1 BTNAZHHYONIOIV-UHFFFAOYSA-N 0.000 description 1
- JHQWTJKJAWPALF-UHFFFAOYSA-N 1-(4-chloro-1,1-dioxo-1,2-benzothiazol-3-yl)-3-cyclohexylurea Chemical compound ClC1=CC=CC(S(N=2)(=O)=O)=C1C=2NC(=O)NC1CCCCC1 JHQWTJKJAWPALF-UHFFFAOYSA-N 0.000 description 1
- FMYVTFRADSNGDN-UHFFFAOYSA-N 1-ethoxy-4-isocyanatobenzene Chemical compound CCOC1=CC=C(N=C=O)C=C1 FMYVTFRADSNGDN-UHFFFAOYSA-N 0.000 description 1
- QQGRFMIMXPWKPM-UHFFFAOYSA-N 2,3,4-tributylphenol Chemical compound CCCCC1=CC=C(O)C(CCCC)=C1CCCC QQGRFMIMXPWKPM-UHFFFAOYSA-N 0.000 description 1
- 125000006508 2,6-difluorobenzyl group Chemical group [H]C1=C([H])C(F)=C(C(F)=C1[H])C([H])([H])* 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical compound CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 1
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 1
- YAUCKEPYKXHCFF-UHFFFAOYSA-N 2-carbamothioylsulfanylethyl carbamodithioate;manganese Chemical compound [Mn].NC(=S)SCCSC(N)=S YAUCKEPYKXHCFF-UHFFFAOYSA-N 0.000 description 1
- JMZRZEXRYJUHEB-UHFFFAOYSA-N 2-carbamothioylsulfanylethyl carbamodithioate;zinc Chemical compound [Zn].NC(=S)SCCSC(N)=S JMZRZEXRYJUHEB-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- BGAALQGGQLDGFK-UHFFFAOYSA-N 2-cyano-3-fluorobenzenesulfonyl chloride Chemical compound FC1=CC=CC(S(Cl)(=O)=O)=C1C#N BGAALQGGQLDGFK-UHFFFAOYSA-N 0.000 description 1
- RHDSLWKUFCLHGB-UHFFFAOYSA-N 2-ethyl-4-fluoro-1,1-dioxo-1,2-benzothiazol-3-imine Chemical compound O=S1(=O)N(CC)C(=N)C2=C1C=CC=C2F RHDSLWKUFCLHGB-UHFFFAOYSA-N 0.000 description 1
- XPYOORHZRLSTSG-UHFFFAOYSA-N 2-sulfonylpiperidine Chemical compound O=S(=O)=C1CCCCN1 XPYOORHZRLSTSG-UHFFFAOYSA-N 0.000 description 1
- SZZUPBADTVDQTB-UHFFFAOYSA-N 3,4-dichloro-1,2-benzothiazole 1,1-dioxide Chemical compound C1=CC(Cl)=C2C(Cl)=NS(=O)(=O)C2=C1 SZZUPBADTVDQTB-UHFFFAOYSA-N 0.000 description 1
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 1
- CDIJOYCNNFLOAX-UHFFFAOYSA-N 4-(trichloromethylsulfanyl)isoindole-1,3-dione Chemical compound ClC(Cl)(Cl)SC1=CC=CC2=C1C(=O)NC2=O CDIJOYCNNFLOAX-UHFFFAOYSA-N 0.000 description 1
- DHARLSCYRBTMED-UHFFFAOYSA-N 4-methoxy-2-methyl-1,1-dioxo-1,2-benzothiazol-3-imine Chemical compound COC1=CC=CC2=C1C(=N)N(C)S2(=O)=O DHARLSCYRBTMED-UHFFFAOYSA-N 0.000 description 1
- GYIZLMDUQRZVMZ-UHFFFAOYSA-N 4-methyl-1,1-dioxo-1,2-benzothiazol-3-amine Chemical compound CC1=CC=CC2=C1C(N)=NS2(=O)=O GYIZLMDUQRZVMZ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000253994 Acyrthosiphon pisum Species 0.000 description 1
- 244000144730 Amygdalus persica Species 0.000 description 1
- 241000193830 Bacillus <bacterium> Species 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- 241000256593 Brachycaudus schwartzi Species 0.000 description 1
- 235000004221 Brassica oleracea var gemmifera Nutrition 0.000 description 1
- 244000308368 Brassica oleracea var. gemmifera Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 241000192700 Cyanobacteria Species 0.000 description 1
- OVBJJZOQPCKUOR-UHFFFAOYSA-L EDTA disodium salt dihydrate Chemical compound O.O.[Na+].[Na+].[O-]C(=O)C[NH+](CC([O-])=O)CC[NH+](CC([O-])=O)CC([O-])=O OVBJJZOQPCKUOR-UHFFFAOYSA-L 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical class CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 240000002024 Gossypium herbaceum Species 0.000 description 1
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- HRYILSDLIGTCOP-UHFFFAOYSA-N N-benzoylurea Chemical class NC(=O)NC(=O)C1=CC=CC=C1 HRYILSDLIGTCOP-UHFFFAOYSA-N 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- PKUWKAXTAVNIJR-UHFFFAOYSA-N O,O-diethyl hydrogen thiophosphate Chemical compound CCOP(O)(=S)OCC PKUWKAXTAVNIJR-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- QUCHFDAIMZEACQ-UHFFFAOYSA-N OCC(CC)C1=NS(C2=C1C(=C(C=C2)N)Cl)(=O)=O Chemical compound OCC(CC)C1=NS(C2=C1C(=C(C=C2)N)Cl)(=O)=O QUCHFDAIMZEACQ-UHFFFAOYSA-N 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 241000219843 Pisum Species 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920002675 Polyoxyl Chemical class 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 235000006040 Prunus persica var persica Nutrition 0.000 description 1
- 208000035415 Reinfection Diseases 0.000 description 1
- ISRUGXGCCGIOQO-UHFFFAOYSA-N Rhoden Chemical compound CNC(=O)OC1=CC=CC=C1OC(C)C ISRUGXGCCGIOQO-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 241001300423 Strophostyles Species 0.000 description 1
- WPMWEFXCIYCJSA-UHFFFAOYSA-N Tetraethylene glycol monododecyl ether Chemical compound CCCCCCCCCCCCOCCOCCOCCOCCO WPMWEFXCIYCJSA-UHFFFAOYSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- FOANIXZHAMJWOI-UHFFFAOYSA-N bromopropylate Chemical compound C=1C=C(Br)C=CC=1C(O)(C(=O)OC(C)C)C1=CC=C(Br)C=C1 FOANIXZHAMJWOI-UHFFFAOYSA-N 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- CRQQGFGUEAVUIL-UHFFFAOYSA-N chlorothalonil Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(C#N)=C1Cl CRQQGFGUEAVUIL-UHFFFAOYSA-N 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 1
- WCMMILVIRZAPLE-UHFFFAOYSA-M cyhexatin Chemical compound C1CCCCC1[Sn](C1CCCCC1)(O)C1CCCCC1 WCMMILVIRZAPLE-UHFFFAOYSA-M 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- BZVCTTJRBWHTOF-UHFFFAOYSA-N diethoxy-ethylsulfanyl-sulfanylidene-$l^{5}-phosphane Chemical compound CCOP(=S)(OCC)SCC BZVCTTJRBWHTOF-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- ZJXZSIYSNXKHEA-UHFFFAOYSA-N ethyl dihydrogen phosphate Chemical class CCOP(O)(O)=O ZJXZSIYSNXKHEA-UHFFFAOYSA-N 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- BFWMWWXRWVJXSE-UHFFFAOYSA-M fentin hydroxide Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(O)C1=CC=CC=C1 BFWMWWXRWVJXSE-UHFFFAOYSA-M 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 1
- 229940091173 hydantoin Drugs 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000002458 infectious effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical class C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 239000004533 oil dispersion Substances 0.000 description 1
- PZXOQEXFMJCDPG-UHFFFAOYSA-N omethoate Chemical compound CNC(=O)CSP(=O)(OC)OC PZXOQEXFMJCDPG-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical class O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- LFGREXWGYUGZLY-UHFFFAOYSA-N phosphoryl Chemical group [P]=O LFGREXWGYUGZLY-UHFFFAOYSA-N 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- YFGYUFNIOHWBOB-UHFFFAOYSA-N pirimicarb Chemical compound CN(C)C(=O)OC1=NC(N(C)C)=NC(C)=C1C YFGYUFNIOHWBOB-UHFFFAOYSA-N 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000259 polyoxyethylene lauryl ether Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 210000003296 saliva Anatomy 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000002641 tar oil Substances 0.000 description 1
- WJCNZQLZVWNLKY-UHFFFAOYSA-N thiabendazole Chemical compound S1C=NC(C=2NC3=CC=CC=C3N=2)=C1 WJCNZQLZVWNLKY-UHFFFAOYSA-N 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/04—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems
- C07D275/06—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to the ring sulfur atom
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N41/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a sulfur atom bound to a hetero atom
- A01N41/02—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a sulfur atom bound to a hetero atom containing a sulfur-to-oxygen double bond
- A01N41/04—Sulfonic acids; Derivatives thereof
- A01N41/06—Sulfonic acid amides
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/80—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,2
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Dentistry (AREA)
- Wood Science & Technology (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL8000414 | 1980-01-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS219348B2 true CS219348B2 (en) | 1983-03-25 |
Family
ID=19834728
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS81439A CS219348B2 (en) | 1980-01-23 | 1981-01-21 | Means for suppressing the plant-louses and method of making the active substances |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4379157A (es) |
| EP (1) | EP0033984B1 (es) |
| JP (1) | JPS56120664A (es) |
| AR (1) | AR226871A1 (es) |
| AT (1) | ATE7787T1 (es) |
| AU (1) | AU6636081A (es) |
| BR (1) | BR8100281A (es) |
| CA (1) | CA1167043A (es) |
| CS (1) | CS219348B2 (es) |
| DD (1) | DD157071A5 (es) |
| DE (1) | DE3162624D1 (es) |
| DK (1) | DK24181A (es) |
| ES (2) | ES8200654A1 (es) |
| GR (1) | GR72782B (es) |
| HU (1) | HU186379B (es) |
| IE (1) | IE50835B1 (es) |
| IL (1) | IL61942A (es) |
| NZ (1) | NZ196046A (es) |
| PL (1) | PL229285A1 (es) |
| RO (1) | RO81451A (es) |
| SU (1) | SU1093247A3 (es) |
| YU (1) | YU14981A (es) |
| ZA (1) | ZA81382B (es) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4492705A (en) * | 1982-02-12 | 1985-01-08 | Ciba-Geigy Corporation | 3-Amidino-benzisothiazole-1,1-dioxides and their use for controlling pests |
| DE3382093D1 (de) * | 1982-11-26 | 1991-02-07 | Ciba Geigy Ag | Schaedlingsbekaempfungsmittel. |
| ZA838810B (en) * | 1982-11-26 | 1984-07-25 | Ciba Geigy Ag | Pesticidal compositions |
| DE3408540A1 (de) * | 1984-03-08 | 1985-09-19 | Bayer Ag, 5090 Leverkusen | Fungizide mittel |
| ZA861026B (en) * | 1985-02-13 | 1986-09-24 | Ciba Geigy Ag | Pesticidal compositions |
| US6376530B1 (en) | 1999-05-10 | 2002-04-23 | Merck & Co., Inc. | Cyclic amidines useful as NMDA NR2B antagonists |
| UA79404C2 (en) * | 2003-10-02 | 2007-06-11 | Basf Ag | 2-cyanobenzenesulfonamide for controlling pests |
| AU2005308962A1 (en) | 2004-11-26 | 2006-06-01 | Basf Aktiengesellschaft | Novel 2-cyano-3-(halo)alkoxy-benzenesulfonamide compounds for combating animal pests |
| EP1863349A1 (en) * | 2005-03-24 | 2007-12-12 | Basf Aktiengesellschaft | Sulphonyl compounds for seed treatment |
| DE602006019560D1 (de) * | 2005-03-24 | 2011-02-24 | Basf Se | 2-cyanobenzolsulfonamidverbindungen zur behandlung von samen |
| ES2326434T3 (es) * | 2005-07-29 | 2009-10-09 | Basf Se | Pesticidas de cianopiridina. |
| ES2339159T3 (es) * | 2005-10-21 | 2010-05-17 | Basf Se | Isotiazolpiridin-3-ilenaminas para combatir las plagas animales. |
| EP1954138A2 (en) * | 2005-11-21 | 2008-08-13 | Basf Se | Insecticidal methods using 3-amino-1,2-benzisothiazole derivatives |
| AR057988A1 (es) * | 2005-11-25 | 2008-01-09 | Basf Ag | Compuestos de cianobenceno para combatir plagas animales |
| PE20071233A1 (es) * | 2006-02-16 | 2008-01-10 | Basf Ag | Compuestos de tioamida para combatir pestes animales |
| EP2003975B1 (en) | 2006-03-31 | 2009-11-18 | Basf Se | 3-amino-1,2-benzisothiazole compounds for combating animal pest |
| WO2008031712A2 (en) * | 2006-09-11 | 2008-03-20 | Basf Se | Pesticidal active mixtures comprising sulfonamides |
| KR20090107070A (ko) | 2007-01-26 | 2009-10-12 | 바스프 에스이 | 동물 해충 ⅱ의 퇴치를 위한 3-아미노-1,2-벤즈이소티아졸 화합물 |
| DE102007024575A1 (de) * | 2007-05-25 | 2008-11-27 | Bayer Cropscience Ag | Insektizide Zusammensetzungen von 2-Cyanobenzolsulfonamidverbindungen und ihrer isomeren Formen mit verbesserter Wirkung |
| RU2009148883A (ru) | 2007-05-31 | 2011-07-10 | Зингента Партисипейшнс Аг (Ch) | Способ защиты материала для размножения растений, растения и/или органов растений |
| WO2009007233A2 (en) * | 2007-07-11 | 2009-01-15 | Basf Se | Pesticidal mixtures comprising sulfonamides and one or more fungicides |
| GB0800271D0 (en) * | 2008-01-08 | 2008-02-13 | Syngenta Participations Ag | Chemical compounds |
| BRPI0906577A2 (pt) | 2008-01-25 | 2019-09-24 | Syngenta Partcipations Ag | compostos químicos |
| GB0804067D0 (en) | 2008-03-04 | 2008-04-09 | Syngenta Participations Ag | Chemical compounds |
| EP2123159A1 (de) | 2008-05-21 | 2009-11-25 | Bayer CropScience AG | (1,2-Benzisothiazol-3-yl)(thio)carbamate und (1,2-Benzisothiazol-3-yl)(thio)oxamate und deren Oxidationsformen als Pestizide |
| GB0809355D0 (en) * | 2008-05-22 | 2008-07-02 | Syngenta Participations Ag | Chemical compounds |
| GB0820710D0 (en) | 2008-11-12 | 2008-12-17 | Syngenta Participations Ag | Chemical compounds |
| BR112012023551A2 (pt) | 2010-03-18 | 2015-09-15 | Bayer Ip Gmbh | aril e hetaril sulfonamidas como agentes ativos contra estresse abiótico em plantas |
| EP2471363A1 (de) | 2010-12-30 | 2012-07-04 | Bayer CropScience AG | Verwendung von Aryl-, Heteroaryl- und Benzylsulfonamidocarbonsäuren, -carbonsäureestern, -carbonsäureamiden und -carbonitrilen oder deren Salze zur Steigerung der Stresstoleranz in Pflanzen |
| AU2014331111B2 (en) | 2013-10-04 | 2018-05-31 | Bayer Cropscience Aktiencesellschaft | Use of substituted dihydro-oxindolyl sulfonamides, or the salts thereof, for increasing the stress tolerance of plants |
| WO2018108627A1 (de) | 2016-12-12 | 2018-06-21 | Bayer Cropscience Aktiengesellschaft | Verwendung substituierter indolinylmethylsulfonamide oder deren salze zur steigerung der stresstoleranz in pflanzen |
| WO2019025153A1 (de) | 2017-07-31 | 2019-02-07 | Bayer Cropscience Aktiengesellschaft | Verwendung von substituierten n-sulfonyl-n'-aryldiaminoalkanen und n-sulfonyl-n'-heteroaryldiaminoalkanen oder deren salzen zur steigerung der stresstoleranz in pflanzen |
| EP3650447A1 (en) * | 2018-11-08 | 2020-05-13 | Universite de Nantes | New selective modulators of insect nicotinic acetylcholine receptors |
| CN117304098A (zh) * | 2023-09-26 | 2023-12-29 | 蓝固(湖州)新能源科技有限公司 | 一种电解液添加剂及其制备方法、电解液和锂离子电池 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2751392A (en) * | 1953-11-23 | 1956-06-19 | Geschickter Fund Med Res | Tertiary amine derivatives of nu-and omicron-saccharin |
| GB951651A (en) * | 1960-02-17 | 1964-03-11 | Shell Res Ltd | Substituted benzonitriles, their preparation and compositions containing them |
| DE1543380A1 (de) * | 1966-11-09 | 1969-09-11 | Beiersdorf Ag | 4-Chlor-5-sulfamylsalicylsaeurenitril und dessen Salze sowie Verfahren zu deren Herstellung |
| DE1670797A1 (de) * | 1967-02-10 | 1971-03-25 | Hoechst Ag | Benzisothiazol-1,1-dioxyde und Verfahren zu ihrer Herstellung |
| JPS4824735B1 (es) * | 1970-01-26 | 1973-07-24 | ||
| US3888897A (en) * | 1972-04-12 | 1975-06-10 | Du Pont | Cyano-and cyanomethyl-benzensulfonamides |
| US3901935A (en) * | 1974-02-19 | 1975-08-26 | Dow Chemical Co | Cyanophenyl sulfoxides and sulfones |
| DE2860554D1 (en) * | 1977-12-30 | 1981-04-16 | Ciba Geigy Ag | Process for preparing arylthiols and the compounds thus obtained |
-
1981
- 1981-01-15 DE DE8181200042T patent/DE3162624D1/de not_active Expired
- 1981-01-15 EP EP81200042A patent/EP0033984B1/en not_active Expired
- 1981-01-15 AT AT81200042T patent/ATE7787T1/de not_active IP Right Cessation
- 1981-01-19 BR BR8100281A patent/BR8100281A/pt unknown
- 1981-01-19 US US06/226,533 patent/US4379157A/en not_active Expired - Lifetime
- 1981-01-20 DD DD81227106A patent/DD157071A5/de unknown
- 1981-01-20 PL PL22928581A patent/PL229285A1/xx unknown
- 1981-01-20 NZ NZ196046A patent/NZ196046A/xx unknown
- 1981-01-20 GR GR63942A patent/GR72782B/el unknown
- 1981-01-20 DK DK24181A patent/DK24181A/da not_active Application Discontinuation
- 1981-01-20 AU AU66360/81A patent/AU6636081A/en not_active Abandoned
- 1981-01-20 IL IL61942A patent/IL61942A/xx not_active IP Right Cessation
- 1981-01-20 JP JP604381A patent/JPS56120664A/ja active Pending
- 1981-01-20 AR AR283996A patent/AR226871A1/es active
- 1981-01-20 YU YU00149/81A patent/YU14981A/xx unknown
- 1981-01-20 IE IE103/81A patent/IE50835B1/en not_active IP Right Cessation
- 1981-01-20 RO RO81103171A patent/RO81451A/ro unknown
- 1981-01-20 ZA ZA00810382A patent/ZA81382B/xx unknown
- 1981-01-21 CA CA000368982A patent/CA1167043A/en not_active Expired
- 1981-01-21 ES ES498695A patent/ES8200654A1/es not_active Expired
- 1981-01-21 CS CS81439A patent/CS219348B2/cs unknown
- 1981-01-22 HU HU81134A patent/HU186379B/hu unknown
- 1981-03-24 ES ES500638A patent/ES500638A0/es active Granted
- 1981-06-19 SU SU813328851A patent/SU1093247A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| ES498695A0 (es) | 1981-11-01 |
| IL61942A (en) | 1985-11-29 |
| ZA81382B (en) | 1982-02-24 |
| US4379157A (en) | 1983-04-05 |
| EP0033984B1 (en) | 1984-06-06 |
| AU6636081A (en) | 1981-07-30 |
| IE810103L (en) | 1981-07-23 |
| PL229285A1 (es) | 1982-04-13 |
| ES8201965A1 (es) | 1982-01-01 |
| GR72782B (es) | 1983-12-05 |
| ES8200654A1 (es) | 1981-11-01 |
| SU1093247A3 (ru) | 1984-05-15 |
| RO81451A (ro) | 1984-04-02 |
| DE3162624D1 (en) | 1984-07-12 |
| DK24181A (da) | 1981-07-24 |
| HU186379B (en) | 1985-07-29 |
| IL61942A0 (en) | 1981-02-27 |
| ES500638A0 (es) | 1982-01-01 |
| JPS56120664A (en) | 1981-09-22 |
| IE50835B1 (en) | 1986-07-23 |
| NZ196046A (en) | 1983-04-12 |
| CA1167043A (en) | 1984-05-08 |
| EP0033984A1 (en) | 1981-08-19 |
| BR8100281A (pt) | 1981-08-04 |
| DD157071A5 (de) | 1982-10-13 |
| ATE7787T1 (de) | 1984-06-15 |
| AR226871A1 (es) | 1982-08-31 |
| YU14981A (en) | 1983-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS219348B2 (en) | Means for suppressing the plant-louses and method of making the active substances | |
| RU2126408C1 (ru) | Производные триазолопиримидина, способ их получения, фунгицидный состав, способ борьбы с грибами | |
| JP2552811B2 (ja) | 殺虫作用のあるフェニルヒドラジン誘導体 | |
| EP0021506B1 (en) | New pyrazoline derivatives, method of preparing the new compounds, as well as insecticidal composition on the basis of these new compounds | |
| JP2525730B2 (ja) | 植物生育調整組成物及び方法 | |
| CS241538B2 (en) | Insecticide and acaricide and method of active substances production | |
| CS242895B2 (en) | Insecticide against mites,moths and method of efficient substances production | |
| US7511029B2 (en) | Pesticidal diazene oxide carboxylates | |
| IL39395A (en) | Oxazolidine and thiazolidine 2-(or4)-carbamoyloxime derivatives preparation thereof and compositions containing the | |
| HU187698B (en) | Insecticidnye kompositions containing pyrazoline derivatives further process for preparing the pyrazoline derivatives | |
| HU176584B (en) | Herbicide preparation containing of active mateirals of two types | |
| RO113989B1 (ro) | Derivati de pirazoliloxipicolinamida, procedeu pentru prepararea acestora, intermediari de sinteza, compozitie erbicida si metoda pentru combaterea cresterii plantelor nedorite | |
| JPH0248572A (ja) | 新規なチアゾール化合物及びその製造方法並びに該化合物を有効成分とする殺菌剤組成物 | |
| EP0232012B1 (en) | Dihaloformaldoximes | |
| EP0152131B1 (en) | Carboxamide derivatives, their preparation and their use as fungicides | |
| DE68928885T2 (de) | 1-Dimethylcarbamoyl-1H-1,2,4-triazole-substituiert in Stellungen 3 und 5 | |
| JP2779947B2 (ja) | 1―ジメチルカルバモイル―3―置換―5―置換―1h―1,2,4,―トリアゾール | |
| US7399757B1 (en) | Pesticidal diazene oxide carboxylates | |
| NO161719B (no) | Fremgangsmaate og anlegg for fremstilling av en fortynnet slurry inneholdende sinkstoev. | |
| HU183997B (en) | Herbicide and antidote composition resp. containing thiolcarba mate derivative and/or chloroacetanilide derivatives as herbicide and/or substituted acetamide antidote | |
| JPS62207260A (ja) | 殺菌剤 | |
| HU193707B (en) | Fungicide and bactericide compositions, and process for the preparation of iodoacetamide derivatives used as active ingredient | |
| EP0003688B1 (en) | A method of controlling mollusc pest | |
| US7446119B2 (en) | Miticidal triazolidine derivatives | |
| WO1982002713A1 (en) | Fungicides |