CS214758B2 - Means for ammelioration of appearance of used and especially dirty textiles - Google Patents
Means for ammelioration of appearance of used and especially dirty textiles Download PDFInfo
- Publication number
- CS214758B2 CS214758B2 CS806449A CS644980A CS214758B2 CS 214758 B2 CS214758 B2 CS 214758B2 CS 806449 A CS806449 A CS 806449A CS 644980 A CS644980 A CS 644980A CS 214758 B2 CS214758 B2 CS 214758B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- composition
- photoactivator
- phthalocyanine
- optically
- composition according
- Prior art date
Links
- 239000004753 textile Substances 0.000 title description 9
- 239000000203 mixture Substances 0.000 claims description 134
- 238000005282 brightening Methods 0.000 claims description 46
- 239000003795 chemical substances by application Substances 0.000 claims description 35
- 239000004744 fabric Substances 0.000 claims description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 27
- 239000003599 detergent Substances 0.000 claims description 25
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 24
- -1 1,2,3-triazol-2-yl Chemical group 0.000 claims description 23
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical class N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 claims description 22
- 238000005406 washing Methods 0.000 claims description 19
- 239000000460 chlorine Substances 0.000 claims description 18
- 150000003839 salts Chemical class 0.000 claims description 18
- 229910052801 chlorine Inorganic materials 0.000 claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 15
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 14
- 239000011701 zinc Substances 0.000 claims description 14
- 229910052782 aluminium Inorganic materials 0.000 claims description 13
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 11
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 11
- 229910052708 sodium Inorganic materials 0.000 claims description 11
- 239000011734 sodium Substances 0.000 claims description 11
- 229910052725 zinc Inorganic materials 0.000 claims description 11
- 229920000742 Cotton Polymers 0.000 claims description 10
- 229910052783 alkali metal Inorganic materials 0.000 claims description 10
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 10
- 230000003287 optical effect Effects 0.000 claims description 10
- 229910001413 alkali metal ion Inorganic materials 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 8
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 8
- 239000007844 bleaching agent Substances 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- 229910052700 potassium Inorganic materials 0.000 claims description 8
- 239000011591 potassium Substances 0.000 claims description 8
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- HUVXQFBFIFIDDU-UHFFFAOYSA-N aluminum phthalocyanine Chemical class [Al+3].C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 HUVXQFBFIFIDDU-UHFFFAOYSA-N 0.000 claims description 6
- 150000001450 anions Chemical class 0.000 claims description 6
- 239000011737 fluorine Substances 0.000 claims description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 5
- 102000004190 Enzymes Human genes 0.000 claims description 5
- 108090000790 Enzymes Proteins 0.000 claims description 5
- 150000007513 acids Chemical class 0.000 claims description 5
- 150000001340 alkali metals Chemical group 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 229910052740 iodine Inorganic materials 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 229910006069 SO3H Inorganic materials 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 4
- 238000001035 drying Methods 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- 239000011630 iodine Substances 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 239000002304 perfume Substances 0.000 claims description 4
- 230000008569 process Effects 0.000 claims description 4
- 239000000047 product Substances 0.000 claims description 4
- 239000002689 soil Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 150000003863 ammonium salts Chemical class 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 239000003112 inhibitor Substances 0.000 claims description 3
- 239000003381 stabilizer Substances 0.000 claims description 3
- 239000000725 suspension Substances 0.000 claims description 3
- 238000009736 wetting Methods 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 claims description 2
- 239000004599 antimicrobial Substances 0.000 claims description 2
- 239000000872 buffer Substances 0.000 claims description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims 4
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 claims 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims 2
- 239000012043 crude product Substances 0.000 claims 2
- 239000011780 sodium chloride Substances 0.000 claims 2
- 239000000080 wetting agent Substances 0.000 claims 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- QNROKTHUNCZLEY-UHFFFAOYSA-N 6-phenyl-2,3-bis(2-phenylethenyl)benzenesulfonic acid Chemical group C=1C=CC=CC=1C=CC1=CC=C(C=2C=CC=CC=2)C(S(=O)(=O)O)=C1C=CC1=CC=CC=C1 QNROKTHUNCZLEY-UHFFFAOYSA-N 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 claims 1
- 241000795633 Olea <sea slug> Species 0.000 claims 1
- 241001085205 Prenanthella exigua Species 0.000 claims 1
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 238000005119 centrifugation Methods 0.000 claims 1
- 238000001816 cooling Methods 0.000 claims 1
- 230000008021 deposition Effects 0.000 claims 1
- 239000006260 foam Substances 0.000 claims 1
- 239000004615 ingredient Substances 0.000 claims 1
- 230000007935 neutral effect Effects 0.000 claims 1
- 238000010926 purge Methods 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 claims 1
- 239000001488 sodium phosphate Substances 0.000 claims 1
- 229910000162 sodium phosphate Inorganic materials 0.000 claims 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 description 11
- 238000012360 testing method Methods 0.000 description 10
- 238000004061 bleaching Methods 0.000 description 9
- 230000000694 effects Effects 0.000 description 8
- 239000012190 activator Substances 0.000 description 7
- 238000002791 soaking Methods 0.000 description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 6
- 239000000975 dye Substances 0.000 description 6
- 239000000654 additive Substances 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 230000006872 improvement Effects 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 125000000547 substituted alkyl group Chemical group 0.000 description 5
- 238000006277 sulfonation reaction Methods 0.000 description 5
- 125000004122 cyclic group Chemical group 0.000 description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- 230000001939 inductive effect Effects 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 239000002736 nonionic surfactant Substances 0.000 description 3
- 125000001997 phenyl group Chemical class [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- NSMMFSKPGXCMOE-UHFFFAOYSA-N 2-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1C=CC1=CC=CC=C1S(O)(=O)=O NSMMFSKPGXCMOE-UHFFFAOYSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 229910000323 aluminium silicate Inorganic materials 0.000 description 2
- 150000001412 amines Chemical group 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 235000015120 cherry juice Nutrition 0.000 description 2
- 239000008395 clarifying agent Substances 0.000 description 2
- 239000012459 cleaning agent Substances 0.000 description 2
- 125000004966 cyanoalkyl group Chemical group 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 239000006081 fluorescent whitening agent Substances 0.000 description 2
- 235000015203 fruit juice Nutrition 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 230000002165 photosensitisation Effects 0.000 description 2
- 239000003504 photosensitizing agent Substances 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000004964 sulfoalkyl group Chemical group 0.000 description 2
- 125000001273 sulfonato group Chemical class [O-]S(*)(=O)=O 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- 230000002195 synergetic effect Effects 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 1
- GELVZYOEQVJIRR-UHFFFAOYSA-N 2-chloropyrazine Chemical compound ClC1=CN=CC=N1 GELVZYOEQVJIRR-UHFFFAOYSA-N 0.000 description 1
- UNCQVRBWJWWJBF-UHFFFAOYSA-N 2-chloropyrimidine Chemical compound ClC1=NC=CC=N1 UNCQVRBWJWWJBF-UHFFFAOYSA-N 0.000 description 1
- RIOSJKSGNLGONI-UHFFFAOYSA-N 2-phenylbenzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1C1=CC=CC=C1 RIOSJKSGNLGONI-UHFFFAOYSA-N 0.000 description 1
- RTNUTCOTGVKVBR-UHFFFAOYSA-N 4-chlorotriazine Chemical group ClC1=CC=NN=N1 RTNUTCOTGVKVBR-UHFFFAOYSA-N 0.000 description 1
- KQTGCJMBUBYSLL-UHFFFAOYSA-N 4-piperidin-1-ylmorpholine Chemical compound C1CCCCN1N1CCOCC1 KQTGCJMBUBYSLL-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 235000001537 Ribes X gardonianum Nutrition 0.000 description 1
- 235000001535 Ribes X utile Nutrition 0.000 description 1
- 235000016919 Ribes petraeum Nutrition 0.000 description 1
- 244000281247 Ribes rubrum Species 0.000 description 1
- 235000002355 Ribes spicatum Nutrition 0.000 description 1
- 241001092459 Rubus Species 0.000 description 1
- 235000017848 Rubus fruticosus Nutrition 0.000 description 1
- 241000208829 Sambucus Species 0.000 description 1
- 235000018735 Sambucus canadensis Nutrition 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 244000269722 Thea sinensis Species 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-N acetoacetic acid Chemical compound CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- WDEQGLDWZMIMJM-UHFFFAOYSA-N benzyl 4-hydroxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate Chemical class OCC1CC(O)CN1C(=O)OCC1=CC=CC=C1 WDEQGLDWZMIMJM-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000021029 blackberry Nutrition 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 235000007123 blue elder Nutrition 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- REZZEXDLIUJMMS-UHFFFAOYSA-M dimethyldioctadecylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC REZZEXDLIUJMMS-UHFFFAOYSA-M 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 235000007124 elderberry Nutrition 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 238000004453 electron probe microanalysis Methods 0.000 description 1
- 239000003974 emollient agent Substances 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- YQGOJNYOYNNSMM-UHFFFAOYSA-N eosin Chemical compound [Na+].OC(=O)C1=CC=CC=C1C1=C2C=C(Br)C(=O)C(Br)=C2OC2=C(Br)C(O)=C(Br)C=C21 YQGOJNYOYNNSMM-UHFFFAOYSA-N 0.000 description 1
- UFZOPKFMKMAWLU-UHFFFAOYSA-N ethoxy(methyl)phosphinic acid Chemical compound CCOP(C)(O)=O UFZOPKFMKMAWLU-UHFFFAOYSA-N 0.000 description 1
- 235000008995 european elder Nutrition 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- GNBHRKFJIUUOQI-UHFFFAOYSA-N fluorescein Chemical compound O1C(=O)C2=CC=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 GNBHRKFJIUUOQI-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000005286 illumination Methods 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical class C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000026045 iodination Effects 0.000 description 1
- 238000006192 iodination reaction Methods 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 229910052914 metal silicate Inorganic materials 0.000 description 1
- CXKWCBBOMKCUKX-UHFFFAOYSA-M methylene blue Chemical compound [Cl-].C1=CC(N(C)C)=CC2=[S+]C3=CC(N(C)C)=CC=C3N=C21 CXKWCBBOMKCUKX-UHFFFAOYSA-M 0.000 description 1
- 229960000907 methylthioninium chloride Drugs 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- 239000001007 phthalocyanine dye Substances 0.000 description 1
- XQZYPMVTSDWCCE-UHFFFAOYSA-N phthalonitrile Chemical compound N#CC1=CC=CC=C1C#N XQZYPMVTSDWCCE-UHFFFAOYSA-N 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000008213 purified water Substances 0.000 description 1
- USPWKWBDZOARPV-UHFFFAOYSA-N pyrazolidine Chemical compound C1CNNC1 USPWKWBDZOARPV-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- VDNLFJGJEQUWRB-UHFFFAOYSA-N rose bengal free acid Chemical compound OC(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C1=C2C=C(I)C(=O)C(I)=C2OC2=C(I)C(O)=C(I)C=C21 VDNLFJGJEQUWRB-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- 229910001948 sodium oxide Inorganic materials 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- WYCXVIXKQSOLFN-UHFFFAOYSA-N sodium;stilbene Chemical compound [Na].C=1C=CC=CC=1C=CC1=CC=CC=C1 WYCXVIXKQSOLFN-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000013042 solid detergent Substances 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- FRPJTGXMTIIFIT-UHFFFAOYSA-N tetraacetylethylenediamine Chemical compound CC(=O)C(N)(C(C)=O)C(N)(C(C)=O)C(C)=O FRPJTGXMTIIFIT-UHFFFAOYSA-N 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 239000012463 white pigment Substances 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/0005—Other compounding ingredients characterised by their effect
- C11D3/0063—Photo- activating compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/40—Dyes ; Pigments
- C11D3/42—Brightening agents ; Blueing agents
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH878979 | 1979-09-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS214758B2 true CS214758B2 (en) | 1982-05-28 |
Family
ID=4344750
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS806449A CS214758B2 (en) | 1979-09-28 | 1980-09-24 | Means for ammelioration of appearance of used and especially dirty textiles |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4311605A (enFirst) |
| EP (1) | EP0026744B2 (enFirst) |
| JP (1) | JPS5679199A (enFirst) |
| AR (1) | AR225462A1 (enFirst) |
| AT (1) | ATE974T1 (enFirst) |
| AU (1) | AU538198B2 (enFirst) |
| BR (1) | BR8006210A (enFirst) |
| CA (1) | CA1151807A (enFirst) |
| CS (1) | CS214758B2 (enFirst) |
| DE (1) | DE3060373D1 (enFirst) |
| DK (1) | DK408080A (enFirst) |
| ES (1) | ES8105421A1 (enFirst) |
| GR (1) | GR70214B (enFirst) |
| IE (1) | IE50316B1 (enFirst) |
| IL (1) | IL61138A (enFirst) |
| IN (1) | IN153407B (enFirst) |
| MA (1) | MA19033A1 (enFirst) |
| MX (1) | MX152717A (enFirst) |
| NZ (1) | NZ195065A (enFirst) |
| PH (1) | PH19186A (enFirst) |
| PL (1) | PL125119B1 (enFirst) |
| PT (1) | PT71815B (enFirst) |
| ZA (1) | ZA805979B (enFirst) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IN155696B (enFirst) * | 1980-09-09 | 1985-02-23 | Ciba Geigy Ag | |
| ATE12254T1 (de) * | 1980-12-22 | 1985-04-15 | Unilever Nv | Einen photoaktivator enthaltende zusammensetzung mit verbesserter bleichwirkung. |
| JPS5842699A (ja) * | 1981-09-07 | 1983-03-12 | 花王株式会社 | 衣料用洗剤組成物 |
| CH654121A5 (de) * | 1983-03-25 | 1986-01-31 | Ciba Geigy Ag | Verfahren zur herstellung von festen photoaktivatorpraeparaten. |
| US4549980A (en) * | 1983-10-11 | 1985-10-29 | Mobay Chemical Corporation | White modification of a bis-triazinyl amino stilbene optical brightener and a process for making the same |
| US4526700A (en) * | 1983-11-04 | 1985-07-02 | The Procter & Gamble Company | Hypochlorite bleach compositions containing optical brighteners |
| CH657864A5 (de) * | 1984-02-17 | 1986-09-30 | Ciba Geigy Ag | Wasserloesliche phthalocyaninverbindungen und deren verwendung als photoaktivatoren. |
| DE3560774D1 (en) * | 1984-05-15 | 1987-11-19 | Rhone Poulenc Chimie | Detergent composition for bleaching by photoactivation and process for its use |
| EP0186386B1 (en) * | 1984-12-28 | 1992-03-04 | The Procter & Gamble Company | Liquid hypochlorite bleach containing optical brightener solubilized by amine oxide |
| US4900469A (en) * | 1986-10-21 | 1990-02-13 | The Clorox Company | Thickened peracid precursor compositions |
| US4764302A (en) * | 1986-10-21 | 1988-08-16 | The Clorox Company | Thickening system for incorporating fluorescent whitening agents |
| US4925595A (en) * | 1987-07-03 | 1990-05-15 | Ciba-Geigy Corporation | Liquid detergent compositions containing disulfonated fluorescent whitening agents: di-styryl-biphenyl or di-styryl-benzene derivatives |
| DE4230655A1 (de) * | 1992-09-14 | 1994-03-17 | Ciba Geigy | Verfahren zur Verbesserung von Weißgrad, Helligkeit und Farbort von Faserstoffen |
| DE4230656A1 (de) * | 1992-09-14 | 1994-03-17 | Ciba Geigy | Verfahren zur Verbesserung von Weissgrad, Helligkeit und Farbort von Füllstoffen und Pigmenten |
| CZ60097A3 (en) * | 1994-08-30 | 1997-07-16 | Procter & Gamble | Chelating agents increasing photobleaching |
| WO1997031994A1 (en) * | 1996-03-01 | 1997-09-04 | The Procter & Gamble Company | Chelant enhanced photobleaching |
| US6099589A (en) * | 1997-12-30 | 2000-08-08 | Kay Chemical Company | Presoak detergent with optical brightener |
| AU2001244177A1 (en) * | 2000-03-08 | 2001-09-17 | Ciba Specialty Chemicals Holding Inc. | Use of optical brighteners from the class of the stilbene compounds as antimicrobially active substances |
| EP1651744A1 (en) * | 2003-08-06 | 2006-05-03 | The Procter & Gamble Company | Composition for treating textilescomprising a photo bleaching component and a fluorescent whitening component |
| US20050288200A1 (en) * | 2004-06-24 | 2005-12-29 | Willey Alan D | Photo Bleach Compositions |
| IN2014KN02583A (enFirst) | 2012-01-18 | 2015-05-08 | Techfields Pharma Co Ltd |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH1275170A4 (enFirst) * | 1970-08-26 | 1975-03-27 | ||
| GB1372035A (en) * | 1971-05-12 | 1974-10-30 | Procter & Gamble Ltd | Bleaching process |
| US4033718A (en) * | 1973-11-27 | 1977-07-05 | The Procter & Gamble Company | Photoactivated bleaching process |
| CH630127A5 (de) * | 1977-03-25 | 1982-05-28 | Ciba Geigy Ag | Verfahren zum bleichen von textilien. |
| GR65653B (en) * | 1978-01-11 | 1980-10-16 | Procter & Gamble | Composition for combined washing and whitening cloths |
| US4309316A (en) * | 1978-12-22 | 1982-01-05 | Ciba-Geigy Corporation | Process for the production of washing powders of stabilized or enhanced appearance which contain fluorescent whitening agents |
| US4298490A (en) * | 1978-12-22 | 1981-11-03 | Ciba-Geigy Corporation | Process for the production of washing powders of stabilized or enhanced appearance which contain fluorescent whitening agents |
-
1980
- 1980-09-17 IN IN1059/CAL/80A patent/IN153407B/en unknown
- 1980-09-18 PT PT71815A patent/PT71815B/pt unknown
- 1980-09-22 MX MX184008A patent/MX152717A/es unknown
- 1980-09-22 EP EP80810299A patent/EP0026744B2/de not_active Expired
- 1980-09-22 AT AT80810299T patent/ATE974T1/de active
- 1980-09-22 US US06/189,486 patent/US4311605A/en not_active Expired - Lifetime
- 1980-09-22 DE DE8080810299T patent/DE3060373D1/de not_active Expired
- 1980-09-24 IL IL61138A patent/IL61138A/xx unknown
- 1980-09-24 CS CS806449A patent/CS214758B2/cs unknown
- 1980-09-26 BR BR8006210A patent/BR8006210A/pt unknown
- 1980-09-26 DK DK408080A patent/DK408080A/da not_active Application Discontinuation
- 1980-09-26 PL PL1980226937A patent/PL125119B1/pl unknown
- 1980-09-26 MA MA19164A patent/MA19033A1/fr unknown
- 1980-09-26 AU AU62759/80A patent/AU538198B2/en not_active Ceased
- 1980-09-26 ZA ZA00805979A patent/ZA805979B/xx unknown
- 1980-09-26 IE IE2015/80A patent/IE50316B1/en unknown
- 1980-09-26 CA CA000361121A patent/CA1151807A/en not_active Expired
- 1980-09-26 GR GR62974A patent/GR70214B/el unknown
- 1980-09-26 NZ NZ195065A patent/NZ195065A/xx unknown
- 1980-09-27 JP JP13373180A patent/JPS5679199A/ja active Pending
- 1980-09-27 ES ES495431A patent/ES8105421A1/es not_active Expired
- 1980-09-29 PH PH24646A patent/PH19186A/en unknown
-
1982
- 1982-01-01 AR AR22546282D patent/AR225462A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| EP0026744B1 (de) | 1982-05-05 |
| DK408080A (da) | 1981-03-29 |
| PT71815A (en) | 1980-10-01 |
| IN153407B (enFirst) | 1984-07-14 |
| US4311605A (en) | 1982-01-19 |
| AR225462A1 (es) | 1982-03-31 |
| PT71815B (en) | 1981-07-07 |
| ATE974T1 (de) | 1982-05-15 |
| ES495431A0 (es) | 1981-06-01 |
| JPS5679199A (en) | 1981-06-29 |
| PH19186A (en) | 1986-01-23 |
| CA1151807A (en) | 1983-08-16 |
| EP0026744A1 (de) | 1981-04-08 |
| DE3060373D1 (en) | 1982-06-24 |
| BR8006210A (pt) | 1981-04-07 |
| NZ195065A (en) | 1982-09-07 |
| ES8105421A1 (es) | 1981-06-01 |
| ZA805979B (en) | 1981-09-30 |
| AU538198B2 (en) | 1984-08-02 |
| PL226937A1 (enFirst) | 1981-07-10 |
| PL125119B1 (en) | 1983-03-31 |
| IL61138A0 (en) | 1980-11-30 |
| IE50316B1 (en) | 1986-04-02 |
| IE802015L (en) | 1981-03-28 |
| AU6275980A (en) | 1981-04-09 |
| MA19033A1 (fr) | 1981-04-01 |
| GR70214B (enFirst) | 1982-08-31 |
| MX152717A (es) | 1985-10-21 |
| IL61138A (en) | 1984-06-29 |
| EP0026744B2 (de) | 1984-10-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS214758B2 (en) | Means for ammelioration of appearance of used and especially dirty textiles | |
| US4166718A (en) | Process for bleaching textiles | |
| US4657554A (en) | Water-soluble azaphthalocyanines and their use as photoactivators in bleaching | |
| CN101023158B (zh) | 洗衣处理组合物 | |
| CN101023159B (zh) | 洗衣处理组合物 | |
| CN101679919B (zh) | 三苯并二*嗪染料 | |
| EP0153278B1 (de) | Wasserlösliche Phthalocyaninverbindungen und deren Verwendung als Photoaktivatoren | |
| KR100352540B1 (ko) | 세척액중 이동성 염료의 재흡수 억제방법 | |
| US4497741A (en) | Water-soluble zinc and aluminium phthalocyanines | |
| DK158160B (da) | Fremgangsmaade til blegning af tekstiler, herunder blegende pletfjernelse fra tekstiler samt et blegemiddel, herunder blegende pletfjernelsesmiddel | |
| KR100505528B1 (ko) | 직물유연제조성물 | |
| US4566874A (en) | Water-soluble zinc and aluminium phthalocyanines and use thereof as photoactivators | |
| KR20160111397A (ko) | 세탁용 세제 중의 광표백제로서의 오르토-치환된 에톡실화 Al 또는 Zn-프탈로시아닌 화합물의 용도 | |
| JPS63130669A (ja) | アニオンシクロジイリド化合物とその製造方法ならびに色直し染料としての洗剤中におけるその使用 | |
| EP0395588B1 (de) | Dibenzofuranylbiphenyle | |
| GB2628610A (en) | Bleach catalyst and composition comprising said catalyst | |
| US3410847A (en) | 4-(5, 6-di-substituted oxy benzotriazole-2-yl) stilbenesulfonic acid brighteners and ethods for making same | |
| MXPA98006552A (en) | Softening composition for te | |
| DK159396B (da) | Sulfonerede zink- og aluminiumphthalocyaninforbindelser samt deres fremstilling |