CS213377B2 - Method of making the derivatives of 6-acylaminotetrahydro-1,3,5-triazin-2,4-dion - Google Patents
Method of making the derivatives of 6-acylaminotetrahydro-1,3,5-triazin-2,4-dion Download PDFInfo
- Publication number
- CS213377B2 CS213377B2 CS793623A CS362379A CS213377B2 CS 213377 B2 CS213377 B2 CS 213377B2 CS 793623 A CS793623 A CS 793623A CS 362379 A CS362379 A CS 362379A CS 213377 B2 CS213377 B2 CS 213377B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- group
- alkyl
- phenyl
- formula
- pharmaceutically acceptable
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title abstract description 3
- -1 alkyl radical Chemical class 0.000 claims abstract description 184
- 150000001875 compounds Chemical class 0.000 claims abstract description 52
- 238000000034 method Methods 0.000 claims abstract description 37
- 150000003839 salts Chemical class 0.000 claims abstract description 23
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 22
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 17
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 8
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 claims abstract description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract 3
- 239000007858 starting material Substances 0.000 claims description 31
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 29
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 27
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical group CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 125000001424 substituent group Chemical group 0.000 claims description 11
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 10
- 125000005843 halogen group Chemical group 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 10
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- 125000001072 heteroaryl group Chemical group 0.000 claims description 6
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 5
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 claims description 4
- 150000003254 radicals Chemical group 0.000 claims description 4
- 150000001450 anions Chemical class 0.000 claims description 3
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 3
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims description 3
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 2
- JPRPJUMQRZTTED-UHFFFAOYSA-N 1,3-dioxolanyl Chemical group [CH]1OCCO1 JPRPJUMQRZTTED-UHFFFAOYSA-N 0.000 claims description 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 2
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 3
- 125000003342 alkenyl group Chemical group 0.000 claims 1
- 125000003302 alkenyloxy group Chemical group 0.000 claims 1
- 125000002091 cationic group Chemical group 0.000 claims 1
- 150000001768 cations Chemical class 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- 230000003110 anti-inflammatory effect Effects 0.000 abstract description 8
- 102000004005 Prostaglandin-endoperoxide synthases Human genes 0.000 abstract description 7
- 108090000459 Prostaglandin-endoperoxide synthases Proteins 0.000 abstract description 7
- 230000000202 analgesic effect Effects 0.000 abstract description 6
- 239000003112 inhibitor Substances 0.000 abstract description 3
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 2
- 125000002950 monocyclic group Chemical group 0.000 abstract 2
- 125000000166 1,3-dioxalanyl group Chemical group 0.000 abstract 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 54
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 42
- 230000008018 melting Effects 0.000 description 27
- 238000002844 melting Methods 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- 239000000203 mixture Substances 0.000 description 21
- 239000007787 solid Substances 0.000 description 19
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 17
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 14
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 125000003118 aryl group Chemical group 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 8
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 7
- 125000003047 N-acetyl group Chemical group 0.000 description 7
- 239000012948 isocyanate Substances 0.000 description 7
- 150000002513 isocyanates Chemical class 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 125000006316 iso-butyl amino group Chemical group [H]N(*)C([H])([H])C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 4
- 238000004452 microanalysis Methods 0.000 description 4
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 4
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- MMBDAJMDNVQFDV-UHFFFAOYSA-N methyl n-[amino(methylsulfanyl)methylidene]carbamate Chemical compound COC(=O)N=C(N)SC MMBDAJMDNVQFDV-UHFFFAOYSA-N 0.000 description 3
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 231100000161 signs of toxicity Toxicity 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 2
- GEWRKGDRYZIFNP-UHFFFAOYSA-N 1h-1,3,5-triazine-2,4-dione Chemical compound OC1=NC=NC(O)=N1 GEWRKGDRYZIFNP-UHFFFAOYSA-N 0.000 description 2
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 2
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 2
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 2
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 2
- QCIHVBCUEZQWAC-UHFFFAOYSA-N 6-methylsulfanyl-3-[3-(trifluoromethyl)phenyl]-1,3,5-triazinane-2,4-dione Chemical compound O=C1NC(SC)NC(=O)N1C1=CC=CC(C(F)(F)F)=C1 QCIHVBCUEZQWAC-UHFFFAOYSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 2
- 125000005394 methallyl group Chemical group 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 239000012262 resinous product Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000011343 solid material Substances 0.000 description 2
- 238000012289 standard assay Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 125000006727 (C1-C6) alkenyl group Chemical group 0.000 description 1
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 1
- YTFXKURWTLWPKK-UHFFFAOYSA-N 1,3,5-triazinane-2,4-dione Chemical compound O=C1NCNC(=O)N1 YTFXKURWTLWPKK-UHFFFAOYSA-N 0.000 description 1
- SXJYSIBLFGQAND-UHFFFAOYSA-N 1-isocyanato-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(N=C=O)=C1 SXJYSIBLFGQAND-UHFFFAOYSA-N 0.000 description 1
- QNKQBDZVEKZFBN-UHFFFAOYSA-N 1-isocyanato-4-methylsulfanylbenzene Chemical compound CSC1=CC=C(N=C=O)C=C1 QNKQBDZVEKZFBN-UHFFFAOYSA-N 0.000 description 1
- KNHJIEOCVVIBIV-UHFFFAOYSA-N 2,3-dimethylphenyl isocyanate Chemical compound CC1=CC=CC(N=C=O)=C1C KNHJIEOCVVIBIV-UHFFFAOYSA-N 0.000 description 1
- UIADMYLYGJYUSQ-UHFFFAOYSA-N 2-(isocyanatomethyl)furan Chemical compound O=C=NCC1=CC=CO1 UIADMYLYGJYUSQ-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- TYOUGUHTXIYXLR-UHFFFAOYSA-N 2-isocyanato-5-methylthiophene Chemical compound CC1=CC=C(N=C=O)S1 TYOUGUHTXIYXLR-UHFFFAOYSA-N 0.000 description 1
- QVLWPBIUVXZGRK-UHFFFAOYSA-N 2-isocyanatothiophene Chemical compound O=C=NC1=CC=CS1 QVLWPBIUVXZGRK-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- VZIRCHXYMBFNFD-IWQZZHSRSA-N 3-(2-furanyl)-2-propenal Chemical group O=C\C=C/C1=CC=CO1 VZIRCHXYMBFNFD-IWQZZHSRSA-N 0.000 description 1
- HHGDIPNPERRYQO-UHFFFAOYSA-N 3-(4-methylphenyl)-6-methylsulfanyl-1,3,5-triazinane-2,4-dione Chemical compound O=C1NC(SC)NC(=O)N1C1=CC=C(C)C=C1 HHGDIPNPERRYQO-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000006495 3-trifluoromethyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])*)C(F)(F)F 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- PJHWTWHVCOZCPU-UHFFFAOYSA-N 4-methylbenzenecarbothioic s-acid Chemical compound CC1=CC=C(C(O)=S)C=C1 PJHWTWHVCOZCPU-UHFFFAOYSA-N 0.000 description 1
- NWPBFGWVZQGAHM-UHFFFAOYSA-N 4-methylbenzenecarbothioyl chloride Chemical compound CC1=CC=C(C(Cl)=S)C=C1 NWPBFGWVZQGAHM-UHFFFAOYSA-N 0.000 description 1
- UUZXOZXHIFNNNW-UHFFFAOYSA-N 6-(2-methylpropylamino)-3-thiophen-2-yl-1,3,5-triazinane-2,4-dione Chemical compound O=C1NC(NCC(C)C)NC(=O)N1C1=CC=CS1 UUZXOZXHIFNNNW-UHFFFAOYSA-N 0.000 description 1
- CVYKYBQDPODGCI-UHFFFAOYSA-N 6-(butylamino)-3-[3-(trifluoromethyl)phenyl]-1,3,5-triazinane-2,4-dione Chemical compound O=C1NC(NCCCC)NC(=O)N1C1=CC=CC(C(F)(F)F)=C1 CVYKYBQDPODGCI-UHFFFAOYSA-N 0.000 description 1
- WRPHGQUIUSJMIU-UHFFFAOYSA-N 6-methylsulfanyl-3-thiophen-2-yl-1,3,5-triazinane-2,4-dione Chemical compound O=C1NC(SC)NC(=O)N1C1=CC=CS1 WRPHGQUIUSJMIU-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- PDIBWHSLECZBOM-UHFFFAOYSA-N CC1=CC=C(S1)N1C(NC(NC1=O)SC)=O Chemical compound CC1=CC=C(S1)N1C(NC(NC1=O)SC)=O PDIBWHSLECZBOM-UHFFFAOYSA-N 0.000 description 1
- UIOAQJNADLELPQ-UHFFFAOYSA-N C[C]1OCCO1 Chemical group C[C]1OCCO1 UIOAQJNADLELPQ-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- 206010013935 Dysmenorrhoea Diseases 0.000 description 1
- 208000009386 Experimental Arthritis Diseases 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 102000003960 Ligases Human genes 0.000 description 1
- 108090000364 Ligases Proteins 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- JZRWCGZRTZMZEH-UHFFFAOYSA-N Thiamine Natural products CC1=C(CCO)SC=[N+]1CC1=CN=C(C)N=C1N JZRWCGZRTZMZEH-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- BVSFXJXENQHSRN-UHFFFAOYSA-N [Na].COC1=CC=C(C=C1)N1C(NC(NC1=O)N(C(C)=O)CC(C)C)=O Chemical compound [Na].COC1=CC=C(C=C1)N1C(NC(NC1=O)N(C(C)=O)CC(C)C)=O BVSFXJXENQHSRN-UHFFFAOYSA-N 0.000 description 1
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004373 acetylcholine Drugs 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 238000004166 bioassay Methods 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical class OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- LPEPZBJOKDYZAD-UHFFFAOYSA-N flufenamic acid Chemical compound OC(=O)C1=CC=CC=C1NC1=CC=CC(C(F)(F)F)=C1 LPEPZBJOKDYZAD-UHFFFAOYSA-N 0.000 description 1
- 229960004369 flufenamic acid Drugs 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- VGGRCVDNFAQIKO-UHFFFAOYSA-N formic anhydride Chemical compound O=COC=O VGGRCVDNFAQIKO-UHFFFAOYSA-N 0.000 description 1
- DDRPCXLAQZKBJP-UHFFFAOYSA-N furfurylamine Chemical compound NCC1=CC=CO1 DDRPCXLAQZKBJP-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 208000007106 menorrhagia Diseases 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- XEPKXCYFJXYMSG-UHFFFAOYSA-N n-(4,6-dioxo-5-thiophen-2-yl-1,3,5-triazinan-2-yl)-n-(2-methylpropyl)acetamide Chemical compound O=C1NC(N(CC(C)C)C(C)=O)NC(=O)N1C1=CC=CS1 XEPKXCYFJXYMSG-UHFFFAOYSA-N 0.000 description 1
- WKTVZAYHDLSABI-UHFFFAOYSA-N n-[5-(4-methylphenyl)-4,6-dioxo-1,3,5-triazinan-2-yl]-n-(2-methylpropyl)acetamide Chemical compound O=C1NC(N(CC(C)C)C(C)=O)NC(=O)N1C1=CC=C(C)C=C1 WKTVZAYHDLSABI-UHFFFAOYSA-N 0.000 description 1
- VGARXUKVAKMUHV-UHFFFAOYSA-N n-diazonio-4-methylbenzenecarboximidothioate Chemical compound CC1=CC=C(C(=S)N=[N+]=[N-])C=C1 VGARXUKVAKMUHV-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000000538 pentafluorophenyl group Chemical group FC1=C(F)C(F)=C(*)C(F)=C1F 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 229920000636 poly(norbornene) polymer Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002599 prostaglandin synthase inhibitor Substances 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 210000001625 seminal vesicle Anatomy 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229960002218 sodium chlorite Drugs 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- KYMBYSLLVAOCFI-UHFFFAOYSA-N thiamine Chemical compound CC1=C(CCO)SCN1CC1=CN=C(C)N=C1N KYMBYSLLVAOCFI-UHFFFAOYSA-N 0.000 description 1
- 229960003495 thiamine Drugs 0.000 description 1
- 235000019157 thiamine Nutrition 0.000 description 1
- 239000011721 thiamine Substances 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 201000010653 vesiculitis Diseases 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/38—Sulfur atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/42—One nitrogen atom
- C07D251/46—One nitrogen atom with oxygen or sulfur atoms attached to the two other ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pain & Pain Management (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Biomedical Technology (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS804527A CS213378B2 (cs) | 1978-05-26 | 1980-06-25 | Způsob výroby derivátů B-acylaminotetrabydro-l,3,3-triazin-2,4-dionu |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2293878 | 1978-05-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS213377B2 true CS213377B2 (en) | 1982-04-09 |
Family
ID=10187501
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS793623A CS213377B2 (en) | 1978-05-26 | 1979-05-25 | Method of making the derivatives of 6-acylaminotetrahydro-1,3,5-triazin-2,4-dion |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US4254122A (de) |
| EP (1) | EP0005911B1 (de) |
| JP (1) | JPS54154779A (de) |
| AT (1) | ATE698T1 (de) |
| AU (1) | AU529948B2 (de) |
| CA (1) | CA1108138A (de) |
| CS (1) | CS213377B2 (de) |
| DD (1) | DD143906A5 (de) |
| DE (1) | DE2962124D1 (de) |
| DK (1) | DK213179A (de) |
| ES (1) | ES480932A1 (de) |
| FI (1) | FI66180C (de) |
| GR (1) | GR68185B (de) |
| HU (1) | HU180252B (de) |
| IE (1) | IE49170B1 (de) |
| IL (1) | IL57324A (de) |
| MW (1) | MW1379A1 (de) |
| NO (1) | NO791722L (de) |
| NZ (1) | NZ190402A (de) |
| PH (1) | PH14793A (de) |
| PT (1) | PT69650A (de) |
| ZA (1) | ZA792247B (de) |
| ZM (1) | ZM4579A1 (de) |
| ZW (1) | ZW9179A1 (de) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8629567D0 (en) * | 1986-12-10 | 1987-01-21 | Boots Co Plc | Therapeutic agents |
| US6348216B1 (en) * | 1996-06-10 | 2002-02-19 | Knoll Pharmaceutical Company | Ibuprofen and narcotic analgesic compositions |
| US6361794B1 (en) | 1996-06-12 | 2002-03-26 | Basf Corporation | Method of making ibuprofen and narcotic analgesic composition |
| AU7080298A (en) * | 1997-04-25 | 1998-11-24 | Takeda Chemical Industries Ltd. | Triazine derivatives, their production and agrochemical composition |
| US6335339B1 (en) | 1998-01-13 | 2002-01-01 | Scriptgen Pharmaceuticals, Inc. | Triazine antiviral compounds |
| WO2003089002A1 (en) * | 2002-04-17 | 2003-10-30 | Medical Research Council | Fp receptor antagonists or pgf2 alpha antagonists for treating menorrhagia |
| US20080152640A1 (en) * | 2003-07-29 | 2008-06-26 | Peter Prehm | Means and Methods For Treating a Disease Which is Associated With an Excess Transport of Hyaluronan Across a Lipid Bilayer |
| US7199156B2 (en) * | 2003-10-10 | 2007-04-03 | Milos Chvapil | Composition and method to treat solid tumors |
| TW200517114A (en) * | 2003-10-15 | 2005-06-01 | Combinatorx Inc | Methods and reagents for the treatment of immunoinflammatory disorders |
| WO2007139753A2 (en) * | 2006-05-22 | 2007-12-06 | Combinatorx, Incorporated | Methods and compositions for the treatment of diseases or conditions associated with increased c-reactive protein, interleukin-6, or interferon-gamma levels |
| US20090075955A1 (en) * | 2007-09-19 | 2009-03-19 | Combinatorx, Inc. | Therapeutic regimens for the treatment of immunoinflammatory disorders |
| CA2709561A1 (en) * | 2007-12-17 | 2009-06-25 | Combinatorx, Incorporated | Therapeutic regimens for the treatment of immunoinflammatory disorders |
| BRPI1013642A2 (pt) * | 2009-02-13 | 2016-04-19 | Shionogi & Co | derivado de triazina e composição farmacêutica compreendendo o mesmo |
| RU2565073C2 (ru) * | 2010-08-10 | 2015-10-20 | Сионоги Энд Ко., Лтд. | Триазиновое производное и включающая его фармацевтическая композиция, обладающая анальгетической активностью |
| US9212130B2 (en) | 2010-08-10 | 2015-12-15 | Shionogi & Co., Ltd. | Heterocyclic derivative and pharmaceutical composition comprising the same |
| US9550763B2 (en) | 2012-02-09 | 2017-01-24 | Shionogi & Co., Ltd. | Heterocyclic ring and carbocyclic derivative |
| TWI637949B (zh) | 2013-06-14 | 2018-10-11 | 塩野義製藥股份有限公司 | 胺基三衍生物及含有其等之醫藥組合物 |
| US20240076274A1 (en) * | 2021-01-26 | 2024-03-07 | Council Of Scientific And Industrial Research | Triazine-based self-assembling system |
| EP4308549A4 (de) * | 2021-03-17 | 2025-05-28 | Hansoh Bio LLC | Stickstoffhaltige heterocyclische ketone, herstellungsverfahren und medizinische verwendungen davon |
| CN120574183B (zh) * | 2025-07-31 | 2025-11-21 | 潍坊鑫洋化工有限公司 | 一种溴代三嗪的合成方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3983116A (en) * | 1973-04-05 | 1976-09-28 | E. I. Du Pont De Nemours And Company | Herbicidal triazines |
| GB1543037A (en) * | 1975-02-05 | 1979-03-28 | Ici Ltd | Selective herbicidal triazine-diones |
| GB1464248A (en) | 1973-11-01 | 1977-02-09 | Ici Ltd | Substituted triazinediones their preparation and use as herbicides |
| US4082536A (en) * | 1973-11-01 | 1978-04-04 | Imperial Chemical Industries Limited | Heterocyclic compounds and their use as pesticides |
| US4035365A (en) * | 1973-11-01 | 1977-07-12 | Imperial Chemical Industries Limited | Triazinediones |
| GB1504304A (en) * | 1974-02-15 | 1978-03-15 | Ici Ltd | Process of combating fungal and bacterial infections of plants with triazine dione derivatives |
| GB1599518A (en) * | 1977-02-21 | 1981-10-07 | Ici Ltd | 1,3,5-triazine-2,6-diones and pharmaceutical compositions thereof |
-
1979
- 1979-05-02 EP EP79300756A patent/EP0005911B1/de not_active Expired
- 1979-05-02 AT AT79300756T patent/ATE698T1/de not_active IP Right Cessation
- 1979-05-02 DE DE7979300756T patent/DE2962124D1/de not_active Expired
- 1979-05-07 US US06/036,508 patent/US4254122A/en not_active Expired - Lifetime
- 1979-05-07 CA CA327,103A patent/CA1108138A/en not_active Expired
- 1979-05-09 ZA ZA792247A patent/ZA792247B/xx unknown
- 1979-05-09 NZ NZ190402A patent/NZ190402A/xx unknown
- 1979-05-10 AU AU46949/79A patent/AU529948B2/en not_active Ceased
- 1979-05-15 ZW ZW91/79A patent/ZW9179A1/xx unknown
- 1979-05-17 MW MW13/79A patent/MW1379A1/xx unknown
- 1979-05-17 IL IL57324A patent/IL57324A/xx unknown
- 1979-05-19 GR GR59133A patent/GR68185B/el unknown
- 1979-05-21 PH PH22523A patent/PH14793A/en unknown
- 1979-05-22 HU HU79IE875A patent/HU180252B/hu unknown
- 1979-05-22 PT PT69650A patent/PT69650A/pt unknown
- 1979-05-23 ZM ZM45/79A patent/ZM4579A1/xx unknown
- 1979-05-23 DK DK213179A patent/DK213179A/da not_active Application Discontinuation
- 1979-05-25 NO NO791722A patent/NO791722L/no unknown
- 1979-05-25 JP JP6407279A patent/JPS54154779A/ja active Pending
- 1979-05-25 ES ES480932A patent/ES480932A1/es not_active Expired
- 1979-05-25 CS CS793623A patent/CS213377B2/cs unknown
- 1979-05-25 DD DD79213155A patent/DD143906A5/de unknown
- 1979-05-25 FI FI791670A patent/FI66180C/fi not_active IP Right Cessation
- 1979-08-08 IE IE889/79A patent/IE49170B1/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US4254122A (en) | 1981-03-03 |
| GR68185B (de) | 1981-11-09 |
| PH14793A (en) | 1981-12-09 |
| FI66180C (fi) | 1984-09-10 |
| NO791722L (no) | 1979-11-27 |
| FI791670A7 (fi) | 1979-11-27 |
| ATE698T1 (de) | 1982-03-15 |
| JPS54154779A (en) | 1979-12-06 |
| ZM4579A1 (en) | 1981-05-21 |
| IL57324A (en) | 1983-10-31 |
| IL57324A0 (en) | 1979-09-30 |
| AU4694979A (en) | 1979-11-29 |
| AU529948B2 (en) | 1983-06-30 |
| FI66180B (fi) | 1984-05-31 |
| ZW9179A1 (en) | 1981-01-21 |
| DD143906A5 (de) | 1980-09-17 |
| IE790889L (en) | 1979-11-26 |
| ZA792247B (en) | 1980-05-28 |
| NZ190402A (en) | 1982-05-31 |
| CA1108138A (en) | 1981-09-01 |
| HU180252B (en) | 1983-02-28 |
| EP0005911A1 (de) | 1979-12-12 |
| PT69650A (en) | 1979-06-01 |
| IE49170B1 (en) | 1985-08-21 |
| MW1379A1 (en) | 1981-04-08 |
| DE2962124D1 (en) | 1982-03-25 |
| ES480932A1 (es) | 1980-02-01 |
| DK213179A (da) | 1979-11-27 |
| EP0005911B1 (de) | 1982-02-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS213377B2 (en) | Method of making the derivatives of 6-acylaminotetrahydro-1,3,5-triazin-2,4-dion | |
| JP2657760B2 (ja) | ４−アミノキナゾリン誘導体およびそれを含有する医薬品 | |
| US5707992A (en) | Antiproliferative quinazolines | |
| EP0091241A2 (de) | Kondensierte Pyrrolinon-Derivate, und ihre Herstellung | |
| BG100727A (bg) | Тетрациклени производни, метод за получаване и приложение | |
| PT93823B (pt) | Processo para a preparacao de derivados de pirimidina e de composicoes farmaceuticas que os contem | |
| HU218950B (hu) | Kondenzált imidazo-piridin-származékok, az ezeket tartalmazó gyógyszerkészítmények és eljárás előállításukra | |
| JPH04230369A (ja) | イミダゾールの新規な硫黄誘導体、その製造方法、得られる新規な中間体、薬物としてのその使用、及びそれを含有する医薬組成物 | |
| Mathew et al. | Novel pyridopyrazine and pyrimidothiazine derivatives as FtsZ inhibitors | |
| US6566357B1 (en) | Spirocyclic-6,7-dihydro-5H-pyrazolo[1,2-a]pyrazol-1-ones which control inflammatory cytokines | |
| CZ195293A3 (en) | PROCESS FOR PREPARING IN 5-POSITION SUBSTITUTED PYRROLO(2,3-d) PYRIMIDINES | |
| RU2129546C1 (ru) | 6,9-бис(аминозамещенные)-бензо(g)изохинолин-5,10-дионы, способ их получения, фармацевтическая композиция на их основе и способ ингибирования опухолей у млекопитающих | |
| HU191301B (en) | Process for preparing 1-/hydroxy-methyl/-1,6,7,11b-tetrahydro-2h,4h-/1,3/-oxazino- or -thiazino/4,3-a/isoquinoline -derivatives | |
| KR870001144B1 (ko) | 삼환 옥스인돌 카복스아미드 유도체의 제조방법 | |
| US5565463A (en) | 9-subtituted-8-unsubstituted-9-deazaguanines | |
| CS241549B2 (en) | Method of 1,4-dihydropyridines production | |
| PT88260B (pt) | Processo para a preparacao de derivados de imidazopiridazina com actividade citotoxica | |
| KR20160125384A (ko) | 식물 생장 조절 화합물 | |
| US5574039A (en) | Antiproliferative compounds having nitrogen-containing tricyclic ring systems and phenyl substituents | |
| CS242894B2 (en) | Method of compounds production with a diazotized heterocyclic core | |
| ES2259704T3 (es) | Compuestos benzoilicos. | |
| US4521619A (en) | Therapeutically useful sulphur-containing benzylidene derivatives | |
| FR2711992A1 (fr) | Nouveaux dérivé hétérocycliques, procédé de préparation et composition pharmaceutique les contenant. | |
| NL193192C (nl) | Oxicamderivaat, farmaceutisch preparaat dat het derivaat bevat en werkwijze voor het bereiden van oxicamderivaten. | |
| NZ227163A (en) | Pyrimidine derivatives and pharmaceutical compositions |