CS196241B2 - Herbicide - Google Patents
Herbicide Download PDFInfo
- Publication number
- CS196241B2 CS196241B2 CS722480A CS248072A CS196241B2 CS 196241 B2 CS196241 B2 CS 196241B2 CS 722480 A CS722480 A CS 722480A CS 248072 A CS248072 A CS 248072A CS 196241 B2 CS196241 B2 CS 196241B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- carbon atoms
- alkyl
- group
- moiety
- alkenyl
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims description 49
- 239000004009 herbicide Substances 0.000 title description 48
- 125000004432 carbon atom Chemical group C* 0.000 claims description 315
- 125000000217 alkyl group Chemical group 0.000 claims description 160
- 150000001875 compounds Chemical class 0.000 claims description 59
- 125000003342 alkenyl group Chemical group 0.000 claims description 50
- 239000000729 antidote Substances 0.000 claims description 41
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 claims description 37
- 125000003545 alkoxy group Chemical group 0.000 claims description 36
- 239000000203 mixture Substances 0.000 claims description 35
- -1 halo-phenoxy Chemical group 0.000 claims description 18
- 125000000304 alkynyl group Chemical group 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 239000001257 hydrogen Substances 0.000 claims description 17
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 16
- 125000001188 haloalkyl group Chemical group 0.000 claims description 16
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- 125000001424 substituent group Chemical group 0.000 claims description 12
- 229910052799 carbon Inorganic materials 0.000 claims description 11
- 125000005843 halogen group Chemical group 0.000 claims description 11
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 125000004966 cyanoalkyl group Chemical group 0.000 claims description 9
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 8
- 125000004429 atom Chemical group 0.000 claims description 7
- 125000000262 haloalkenyl group Chemical group 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 6
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 6
- 125000003837 (C1-C20) alkyl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 claims description 3
- DFCAFRGABIXSDS-UHFFFAOYSA-N Cycloate Chemical compound CCSC(=O)N(CC)C1CCCCC1 DFCAFRGABIXSDS-UHFFFAOYSA-N 0.000 claims description 3
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 3
- 125000005277 alkyl imino group Chemical group 0.000 claims description 3
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims description 3
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000002071 phenylalkoxy group Chemical group 0.000 claims description 3
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 claims description 2
- DFDFCUAUFPAWMI-UHFFFAOYSA-N CCC1=C[S+](CC(C=C2)=CC=C2Cl)C(NC([O-])=O)=C1CC Chemical compound CCC1=C[S+](CC(C=C2)=CC=C2Cl)C(NC([O-])=O)=C1CC DFDFCUAUFPAWMI-UHFFFAOYSA-N 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims description 2
- 125000005093 alkyl carbonyl alkyl group Chemical group 0.000 claims description 2
- 125000006383 alkylpyridyl group Chemical group 0.000 claims description 2
- 125000003368 amide group Chemical group 0.000 claims description 2
- 150000001602 bicycloalkyls Chemical group 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 125000004993 haloalkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000004692 haloalkylcarbonyl group Chemical group 0.000 claims description 2
- 125000005358 mercaptoalkyl group Chemical group 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- MFOUDYKPLGXPGO-UHFFFAOYSA-N propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- ODCWYMIRDDJXKW-UHFFFAOYSA-N simazine Chemical compound CCNC1=NC(Cl)=NC(NCC)=N1 ODCWYMIRDDJXKW-UHFFFAOYSA-N 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 125000000335 thiazolyl group Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 9
- 125000005059 halophenyl group Chemical group 0.000 claims 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 2
- 125000003386 piperidinyl group Chemical group 0.000 claims 2
- 125000006710 (C2-C12) alkenyl group Chemical group 0.000 claims 1
- KCLSWFHYCKQIBJ-UHFFFAOYSA-N 3-amino-2-[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]-2-methylpropanenitrile Chemical compound CCNC1=NC(Cl)=NC(C(C)(CN)C#N)=N1 KCLSWFHYCKQIBJ-UHFFFAOYSA-N 0.000 claims 1
- 125000003358 C2-C20 alkenyl group Chemical group 0.000 claims 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims 1
- 125000005193 alkenylcarbonyloxy group Chemical group 0.000 claims 1
- 125000005080 alkoxycarbonylalkenyl group Chemical group 0.000 claims 1
- 125000005085 alkoxycarbonylalkoxy group Chemical group 0.000 claims 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 claims 1
- 125000003277 amino group Chemical group 0.000 claims 1
- 229940127218 antiplatelet drug Drugs 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical group 0.000 claims 1
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 claims 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims 1
- DEDOPGXGGQYYMW-UHFFFAOYSA-N molinate Chemical compound CCSC(=O)N1CCCCCC1 DEDOPGXGGQYYMW-UHFFFAOYSA-N 0.000 claims 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims 1
- 125000005544 phthalimido group Chemical group 0.000 claims 1
- 125000005936 piperidyl group Chemical group 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 71
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 69
- 241000196324 Embryophyta Species 0.000 description 41
- 239000000047 product Substances 0.000 description 41
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 40
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 38
- 239000000243 solution Substances 0.000 description 36
- 240000008042 Zea mays Species 0.000 description 33
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 33
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 33
- 235000009973 maize Nutrition 0.000 description 33
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- 230000006378 damage Effects 0.000 description 24
- 239000002689 soil Substances 0.000 description 24
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 20
- 235000019341 magnesium sulphate Nutrition 0.000 description 20
- 239000011541 reaction mixture Substances 0.000 description 19
- 238000003756 stirring Methods 0.000 description 18
- 238000001816 cooling Methods 0.000 description 15
- FBCCMZVIWNDFMO-UHFFFAOYSA-N dichloroacetyl chloride Chemical compound ClC(Cl)C(Cl)=O FBCCMZVIWNDFMO-UHFFFAOYSA-N 0.000 description 14
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- DYUWTXWIYMHBQS-UHFFFAOYSA-N n-prop-2-enylprop-2-en-1-amine Chemical compound C=CCNCC=C DYUWTXWIYMHBQS-UHFFFAOYSA-N 0.000 description 10
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 8
- 238000001704 evaporation Methods 0.000 description 8
- 230000008020 evaporation Effects 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 150000003254 radicals Chemical class 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 238000009331 sowing Methods 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 6
- 244000038559 crop plants Species 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 239000011550 stock solution Substances 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 239000001569 carbon dioxide Substances 0.000 description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 230000012010 growth Effects 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 239000012265 solid product Substances 0.000 description 4
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 229940075522 antidotes Drugs 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000012975 dibutyltin dilaurate Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- ZILSBZLQGRBMOR-UHFFFAOYSA-N 1,3-benzodioxol-5-ylmethanamine Chemical compound NCC1=CC=C2OCOC2=C1 ZILSBZLQGRBMOR-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- 229910014033 C-OH Inorganic materials 0.000 description 2
- 125000003860 C1-C20 alkoxy group Chemical group 0.000 description 2
- 229910014570 C—OH Inorganic materials 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- RSPISYXLHRIGJD-UHFFFAOYSA-N OOOO Chemical compound OOOO RSPISYXLHRIGJD-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- IRXBNHGNHKNOJI-UHFFFAOYSA-N butanedioyl dichloride Chemical compound ClC(=O)CCC(Cl)=O IRXBNHGNHKNOJI-UHFFFAOYSA-N 0.000 description 2
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 2
- WCGGWVOVFQNRRS-UHFFFAOYSA-N dichloroacetamide Chemical compound NC(=O)C(Cl)Cl WCGGWVOVFQNRRS-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 208000037824 growth disorder Diseases 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 230000008635 plant growth Effects 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 239000011814 protection agent Substances 0.000 description 2
- 230000036435 stunted growth Effects 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- SODZBMGDYKEZJG-DTWKUNHWSA-N (1r,2r)-2-phenylcyclopropane-1-carbonyl chloride Chemical compound ClC(=O)[C@@H]1C[C@H]1C1=CC=CC=C1 SODZBMGDYKEZJG-DTWKUNHWSA-N 0.000 description 1
- RDCXWDUHESIPFX-UHFFFAOYSA-N 1,1,4-trichlorobutane Chemical compound ClCCCC(Cl)Cl RDCXWDUHESIPFX-UHFFFAOYSA-N 0.000 description 1
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical class C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 description 1
- AYOPBIHGIWOENQ-UHFFFAOYSA-N 2,2-dichloro-4-hydroxybutanamide Chemical compound OCCC(C(=O)N)(Cl)Cl AYOPBIHGIWOENQ-UHFFFAOYSA-N 0.000 description 1
- JYWGZDGPDBDTAN-UHFFFAOYSA-N 2,2-dichloro-n-(2-hydroxyethyl)acetamide Chemical compound OCCNC(=O)C(Cl)Cl JYWGZDGPDBDTAN-UHFFFAOYSA-N 0.000 description 1
- VSHIRTNKIXRXMI-UHFFFAOYSA-N 2,2-dimethyl-1,3-oxazolidine Chemical compound CC1(C)NCCO1 VSHIRTNKIXRXMI-UHFFFAOYSA-N 0.000 description 1
- MSYLETHDEIJMAF-UHFFFAOYSA-N 2,2-diphenylacetyl chloride Chemical compound C=1C=CC=CC=1C(C(=O)Cl)C1=CC=CC=C1 MSYLETHDEIJMAF-UHFFFAOYSA-N 0.000 description 1
- FJSKXQVRKZTKSI-UHFFFAOYSA-N 2,3-dimethylfuran Chemical compound CC=1C=COC=1C FJSKXQVRKZTKSI-UHFFFAOYSA-N 0.000 description 1
- QOZOFODNIBQPGN-UHFFFAOYSA-N 2,4-dimethylpiperidine Chemical compound CC1CCNC(C)C1 QOZOFODNIBQPGN-UHFFFAOYSA-N 0.000 description 1
- LDXJRKWFNNFDSA-UHFFFAOYSA-N 2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound C1CN(CC2=NNN=C21)CC(=O)N3CCN(CC3)C4=CN=C(N=C4)NCC5=CC(=CC=C5)OC(F)(F)F LDXJRKWFNNFDSA-UHFFFAOYSA-N 0.000 description 1
- QRWRJDVVXAXGBT-UHFFFAOYSA-N 2-Methylindoline Chemical compound C1=CC=C2NC(C)CC2=C1 QRWRJDVVXAXGBT-UHFFFAOYSA-N 0.000 description 1
- JQULXIOYDDCNGR-UHFFFAOYSA-N 2-amino-2-methylpropanenitrile Chemical compound CC(C)(N)C#N JQULXIOYDDCNGR-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- ULOIAOPTGWSNHU-UHFFFAOYSA-N 2-butyl radical Chemical compound C[CH]CC ULOIAOPTGWSNHU-UHFFFAOYSA-N 0.000 description 1
- YMURLKIIDQPXRE-UHFFFAOYSA-N 2-chloro-n-(2-hydroxyethyl)acetamide Chemical compound OCCNC(=O)CCl YMURLKIIDQPXRE-UHFFFAOYSA-N 0.000 description 1
- RAAGZOYMEQDCTD-UHFFFAOYSA-N 2-fluorobenzoyl chloride Chemical compound FC1=CC=CC=C1C(Cl)=O RAAGZOYMEQDCTD-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 1
- GELMWIVBBPAMIO-UHFFFAOYSA-N 2-methylbutan-2-amine Chemical compound CCC(C)(C)N GELMWIVBBPAMIO-UHFFFAOYSA-N 0.000 description 1
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 1
- SCNRDAIXZJFMEX-UHFFFAOYSA-N 3-(3-chlorophenyl)prop-2-enoyl chloride Chemical compound ClC(=O)C=CC1=CC=CC(Cl)=C1 SCNRDAIXZJFMEX-UHFFFAOYSA-N 0.000 description 1
- NUWCDHQYCLUEDS-UHFFFAOYSA-N 3-(4-methylphenyl)propan-1-amine Chemical compound CC1=CC=C(CCCN)C=C1 NUWCDHQYCLUEDS-UHFFFAOYSA-N 0.000 description 1
- WQWVQIVJGAOWDJ-UHFFFAOYSA-N 3-methoxy-n-phenylpropanamide Chemical compound COCCC(=O)NC1=CC=CC=C1 WQWVQIVJGAOWDJ-UHFFFAOYSA-N 0.000 description 1
- PXRKCOCTEMYUEG-UHFFFAOYSA-N 5-aminoisoindole-1,3-dione Chemical compound NC1=CC=C2C(=O)NC(=O)C2=C1 PXRKCOCTEMYUEG-UHFFFAOYSA-N 0.000 description 1
- VZEBSJIOUMDNLY-UHFFFAOYSA-N 6-bromo-1,3-benzothiazol-2-amine Chemical compound C1=C(Br)C=C2SC(N)=NC2=C1 VZEBSJIOUMDNLY-UHFFFAOYSA-N 0.000 description 1
- MDBGGTQNNUOQRC-UHFFFAOYSA-N Allidochlor Chemical compound ClCC(=O)N(CC=C)CC=C MDBGGTQNNUOQRC-UHFFFAOYSA-N 0.000 description 1
- DIQHTDHADJUONG-UHFFFAOYSA-N C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C Chemical compound C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C DIQHTDHADJUONG-UHFFFAOYSA-N 0.000 description 1
- RKKMJLZFJSRZBE-UHFFFAOYSA-N CC[S+]1C(NC([O-])=O)=C(CC(C)C)C(CC(C)C)=C1 Chemical compound CC[S+]1C(NC([O-])=O)=C(CC(C)C)C(CC(C)C)=C1 RKKMJLZFJSRZBE-UHFFFAOYSA-N 0.000 description 1
- XIDZNLXGUXPSNI-UHFFFAOYSA-N CO.CO.CO.CO.CO.CO.CO.CO.CO.CO.CO.CO.CO Chemical compound CO.CO.CO.CO.CO.CO.CO.CO.CO.CO.CO.CO.CO XIDZNLXGUXPSNI-UHFFFAOYSA-N 0.000 description 1
- 101100274581 Caenorhabditis elegans chc-1 gene Proteins 0.000 description 1
- 101100275770 Caenorhabditis elegans cri-3 gene Proteins 0.000 description 1
- 101100366937 Caenorhabditis elegans sto-4 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 102100034275 Cx9C motif-containing protein 4 Human genes 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- 240000006890 Erythroxylum coca Species 0.000 description 1
- 108010093488 His-His-His-His-His-His Proteins 0.000 description 1
- 101000711004 Homo sapiens Cx9C motif-containing protein 4 Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 240000007049 Juglans regia Species 0.000 description 1
- 235000009496 Juglans regia Nutrition 0.000 description 1
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 1
- VKABIZXRANOTJN-UHFFFAOYSA-N NCSC=1NC=CC1 Chemical compound NCSC=1NC=CC1 VKABIZXRANOTJN-UHFFFAOYSA-N 0.000 description 1
- KUGRPPRAQNPSQD-UHFFFAOYSA-N OOOOO Chemical compound OOOOO KUGRPPRAQNPSQD-UHFFFAOYSA-N 0.000 description 1
- JLNTWVDSQRNWFU-UHFFFAOYSA-N OOOOOOO Chemical compound OOOOOOO JLNTWVDSQRNWFU-UHFFFAOYSA-N 0.000 description 1
- OZBZONOEYUBXTD-UHFFFAOYSA-N OOOOOOOOO Chemical compound OOOOOOOOO OZBZONOEYUBXTD-UHFFFAOYSA-N 0.000 description 1
- YAVWDJDEOLOYQO-UHFFFAOYSA-N OOOOOOOOOO Chemical compound OOOOOOOOOO YAVWDJDEOLOYQO-UHFFFAOYSA-N 0.000 description 1
- UIQWBVPFHHQZHH-UHFFFAOYSA-N OOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOO UIQWBVPFHHQZHH-UHFFFAOYSA-N 0.000 description 1
- HFEFMUSTGZNOPY-UHFFFAOYSA-N OOOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOOO HFEFMUSTGZNOPY-UHFFFAOYSA-N 0.000 description 1
- IVDBGHPEQSTHRK-UHFFFAOYSA-N OOOOOOOOOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOOOOOOOOO IVDBGHPEQSTHRK-UHFFFAOYSA-N 0.000 description 1
- PWTOMWQKTVMNMM-UHFFFAOYSA-N OOOOOOOOOOOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOOOOOOOOOOO PWTOMWQKTVMNMM-UHFFFAOYSA-N 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 241001148683 Zostera marina Species 0.000 description 1
- LJOOWESTVASNOG-UFJKPHDISA-N [(1s,3r,4ar,7s,8s,8as)-3-hydroxy-8-[2-[(4r)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2s)-2-methylbutanoate Chemical compound C([C@H]1[C@@H](C)C=C[C@H]2C[C@@H](O)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)CC1C[C@@H](O)CC(=O)O1 LJOOWESTVASNOG-UFJKPHDISA-N 0.000 description 1
- FHKPLLOSJHHKNU-INIZCTEOSA-N [(3S)-3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]-(oxan-4-yl)methanone Chemical compound C(C)N1N=CC(=C1C)C=1N(C2=NC=NC(=C2N=1)O[C@@H]1CN(CC1)C(=O)C1CCOCC1)C FHKPLLOSJHHKNU-INIZCTEOSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- DSFVQIUBODXRLL-UHFFFAOYSA-N acetamide;dihydrochloride Chemical compound Cl.Cl.CC(N)=O DSFVQIUBODXRLL-UHFFFAOYSA-N 0.000 description 1
- 150000008061 acetanilides Chemical class 0.000 description 1
- MIBQYWIOHFTKHD-UHFFFAOYSA-N adamantane-1-carbonyl chloride Chemical compound C1C(C2)CC3CC2CC1(C(=O)Cl)C3 MIBQYWIOHFTKHD-UHFFFAOYSA-N 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003927 aminopyridines Chemical class 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- UWCPYKQBIPYOLX-UHFFFAOYSA-N benzene-1,3,5-tricarbonyl chloride Chemical compound ClC(=O)C1=CC(C(Cl)=O)=CC(C(Cl)=O)=C1 UWCPYKQBIPYOLX-UHFFFAOYSA-N 0.000 description 1
- ZAENXHXQWSDUOG-UHFFFAOYSA-N benzene;iodine Chemical compound [I].C1=CC=CC=C1 ZAENXHXQWSDUOG-UHFFFAOYSA-N 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- NEEDEQSZOUAJMU-UHFFFAOYSA-N but-2-yn-1-ol Chemical compound CC#CCO NEEDEQSZOUAJMU-UHFFFAOYSA-N 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 235000008957 cocaer Nutrition 0.000 description 1
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 description 1
- 229940127204 compound 29 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- MZZBPDKVEFVLFF-UHFFFAOYSA-N cyanazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)(C)C#N)=N1 MZZBPDKVEFVLFF-UHFFFAOYSA-N 0.000 description 1
- IPIVAXLHTVNRBS-UHFFFAOYSA-N decanoyl chloride Chemical compound CCCCCCCCCC(Cl)=O IPIVAXLHTVNRBS-UHFFFAOYSA-N 0.000 description 1
- 230000035613 defoliation Effects 0.000 description 1
- 230000009025 developmental regulation Effects 0.000 description 1
- ZJULYDCRWUEPTK-UHFFFAOYSA-N dichloromethyl Chemical compound Cl[CH]Cl ZJULYDCRWUEPTK-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 230000008029 eradication Effects 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 206010016531 fetishism Diseases 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- DDRPCXLAQZKBJP-UHFFFAOYSA-N furfurylamine Chemical compound NCC1=CC=CO1 DDRPCXLAQZKBJP-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000009036 growth inhibition Effects 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- GKQPCPXONLDCMU-CCEZHUSRSA-N lacidipine Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C1=CC=CC=C1\C=C\C(=O)OC(C)(C)C GKQPCPXONLDCMU-CCEZHUSRSA-N 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- IKOSVGABACUJCD-UHFFFAOYSA-N n-(oxolan-2-ylmethyl)propan-1-amine Chemical compound CCCNCC1CCCO1 IKOSVGABACUJCD-UHFFFAOYSA-N 0.000 description 1
- ODBVEGWTXOEBIY-UHFFFAOYSA-N n-propylcyclooctanamine Chemical compound CCCNC1CCCCCCC1 ODBVEGWTXOEBIY-UHFFFAOYSA-N 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000008654 plant damage Effects 0.000 description 1
- 230000017363 positive regulation of growth Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 1
- 229940116357 potassium thiocyanate Drugs 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- SXYFKXOFMCIXQW-UHFFFAOYSA-N propanedioyl dichloride Chemical compound ClC(=O)CC(Cl)=O SXYFKXOFMCIXQW-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000026267 regulation of growth Effects 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000004557 technical material Substances 0.000 description 1
- 210000001550 testis Anatomy 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 235000020234 walnut Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/20—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylguanidines
- C07C279/22—Y being a hydrogen or a carbon atom, e.g. benzoylguanidines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/14—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/04—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/08—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D277/12—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/18—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
- C07D285/125—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
- C07D285/135—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/185—Radicals derived from carboxylic acids from aliphatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/12—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/14—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US13486871A | 1971-04-16 | 1971-04-16 | |
| US05/208,041 US4137070A (en) | 1971-04-16 | 1971-12-09 | Herbicide compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS196241B2 true CS196241B2 (en) | 1980-03-31 |
Family
ID=26832761
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS722480A CS196241B2 (en) | 1971-04-16 | 1972-04-13 | Herbicide |
Country Status (18)
| Country | Link |
|---|---|
| AR (1) | AR192928A1 (nl) |
| BE (1) | BE782120A (nl) |
| CA (1) | CA1174865A (nl) |
| CH (1) | CH577785A5 (nl) |
| CS (1) | CS196241B2 (nl) |
| DD (1) | DD102075A5 (nl) |
| DE (1) | DE2218097A1 (nl) |
| DK (1) | DK143583C (nl) |
| ES (1) | ES401779A1 (nl) |
| FR (1) | FR2133793B1 (nl) |
| GB (2) | GB1396941A (nl) |
| IL (1) | IL39219A (nl) |
| IT (1) | IT953649B (nl) |
| MY (1) | MY7700206A (nl) |
| NL (1) | NL175965C (nl) |
| PL (1) | PL99481B1 (nl) |
| RO (3) | RO83877B (nl) |
| TR (1) | TR18613A (nl) |
Families Citing this family (65)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3989503A (en) * | 1972-10-13 | 1976-11-02 | Stauffer Chemical Company | Herbicidal antidote compositions with substituted oxazolidines and thiazolidines |
| US3931313A (en) | 1972-07-17 | 1976-01-06 | Stauffer Chemical Company | Schiff's base dichloroacetamides |
| CH574207A5 (nl) * | 1973-01-25 | 1976-04-15 | Ciba Geigy Ag | |
| PH11676A (en) * | 1973-09-04 | 1978-05-19 | Stauffer Chemical Co | Sulfide herbicide antidote composition and method of use |
| US4091112A (en) | 1974-08-09 | 1978-05-23 | Burroughs Wellcome Co. | Biologically active amides |
| GB1519762A (en) | 1974-08-09 | 1978-08-02 | Wellcome Found | Cinnamamides their preparation and pharmaceutical compositions containing them |
| DE2438332A1 (de) * | 1974-08-09 | 1976-02-19 | Consortium Elektrochem Ind | Herbicide mittel |
| BR7600775A (pt) * | 1975-02-14 | 1977-05-10 | Stauffer Chemical Co | Processo para a obtencao de(tio)haloacil-(tia)oxazolidinas arisubstituidas e composicoes herbicidas sinergeticas que as contem |
| US4152442A (en) * | 1975-06-05 | 1979-05-01 | Lilly Industries Limited | Certain acylamino-oxa (or thia) diazoles in treatment of hypersensitivity conditions |
| US4166818A (en) * | 1975-06-05 | 1979-09-04 | Lilly Industries Limited | Acylamino derivatives |
| US4013681A (en) * | 1975-06-23 | 1977-03-22 | Hawaiian Sugar Planters' Association | Derivatives of thiophene |
| IN144916B (nl) * | 1975-08-08 | 1978-07-29 | Stauffer Chemical Co | |
| US4107320A (en) | 1976-08-06 | 1978-08-15 | Burroughs Wellcome Co. | Biologically active amides |
| HU178301B (en) * | 1978-02-06 | 1982-04-28 | Nitrokemia Ipartelepek | Herbicide compositions containing naphthaline-carboxylic acid derivatives as antidotes and carbamide derivatives and antidote compositions containing naphthaline-carboxylic acid derivatives |
| LU80912A1 (de) * | 1978-02-06 | 1979-06-07 | Nitrokemia Ipartelepek | Unkrautvernichtungsmittel |
| BG30323A3 (en) * | 1978-06-28 | 1981-05-15 | Bayer Aktiengesellschaft | Method for obtaining of n- dichloracethyl- 1, 2, 3, 4- tetrahydro- hinaldine |
| DE2828222A1 (de) * | 1978-06-28 | 1980-01-10 | Bayer Ag | Gegenmittel zum schutz von kulturpflanzen vor schaedigungen durch herbizide |
| DE2828303A1 (de) * | 1978-06-28 | 1980-01-17 | Bayer Ag | Verwendung von n,n-diallyl-dichloracetamid zur verbesserung der kulturpflanzen- vertraeglichkeit von herbizid wirksamen acetaniliden |
| DE2832974A1 (de) * | 1978-07-27 | 1980-02-14 | Basf Ag | Ein thiolcarbamat enthaltende herbizide mittel |
| GR66644B (nl) * | 1978-07-27 | 1981-04-03 | Basf Ag | |
| DE2832950A1 (de) * | 1978-07-27 | 1980-02-21 | Basf Ag | Herbizide mittel |
| DE2832940A1 (de) * | 1978-07-27 | 1980-02-14 | Basf Ag | Herbizide mittel |
| US4279636A (en) * | 1978-09-29 | 1981-07-21 | Gulf Oil Corporation | Dichloroacetylimino herbicide antagonists as plant protection agents |
| US4237302A (en) * | 1978-09-29 | 1980-12-02 | Gulf Oil Corporation | Dichloroacetylimino herbicide antagonists as plant protection agents |
| DE2948535A1 (de) * | 1979-12-03 | 1981-06-25 | Basf Ag, 6700 Ludwigshafen | Dichloracetamide, herbizide mittel, die acetanilide als herbizide wirkstoffe und diese dichloracetamide als antagonistische mittel enthalten, sowie ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses |
| DE2930450A1 (de) * | 1979-07-26 | 1981-02-19 | Bayer Ag | N-( alpha -chlorpropionyl)-1,2,3,4- tetrahydro-iso-chinolin, verfahren zu dessen herstellung und dessen verwendung als gegenmittel zum schutz von kulturpflanzen vor schaedigungen durch herbizide |
| DE2930448A1 (de) * | 1979-07-26 | 1981-02-26 | Bayer Ag | Gegenmittel zum schutz von kulturpflanzen vor schaedigungen durch herbizide |
| DE2930452A1 (de) | 1979-07-26 | 1981-02-26 | Bayer Ag | N,n'-bis-(halogenacyl)-diaza-cycloalkane zum schutz von kulturpflanzen vor schaedigungen durch herbizide |
| DE2930449A1 (de) * | 1979-07-26 | 1981-02-19 | Bayer Ag | N-acyl-piperidonketale, verfahren zu deren herstellung und deren verwendung als gegenmittel zum schutz von kulturpflanzen vor schaedigungen durch herbizide |
| DE2930451A1 (de) * | 1979-07-26 | 1981-02-19 | Bayer Ag | N-( alpha -chlorpropionyl)-1,2,3,4- tetrahydro-chinaldin, verfahren zu dessen herstellung und dessen verwendung als gegenmittel zum schutz von kulturpflanzen vor schaedigungen durch herbizide |
| DE2938155A1 (de) | 1979-09-21 | 1981-04-23 | Bayer Ag, 5090 Leverkusen | N-acyl-piperidone, verfahren zu deren herstellung und deren verwendung als gegenmittel zum schutz von kulturpflanzen vor schaedigungen durch herbizide |
| DE3004871A1 (de) | 1980-02-09 | 1981-08-20 | Bayer Ag, 5090 Leverkusen | Halogenalkylamide, verfahren zu deren herstellung und deren verwendung als gegenmittel zum schutz von kulturpflanzen vor schaedigungen durch herbizide |
| HU182177B (en) * | 1980-08-13 | 1983-12-28 | Eszakmagyar Vegyimuevek | Composition for influencing plant growth |
| DE3035356A1 (de) * | 1980-09-19 | 1982-05-06 | Bayer Ag, 5090 Leverkusen | Heterocyclisch substituierte amide, verfahren zu deren herstellung und deren verwendung als gegenmittel zum schutz von kulturpflanzen vor schaedigungen durch herbizide |
| DE3120859A1 (de) * | 1981-05-26 | 1982-12-23 | Basf Ag, 6700 Ludwigshafen | Dihalogenacetamide, verfahren zu ihrer herstellung und herbizide mittel, die acetanilide als herbizide wirkstoffe und diese dihalogenacetamide als antagonistische mittel enthalten |
| GB2107308B (en) * | 1981-09-30 | 1986-01-15 | Ici Plc | Herbicidal and fungicidal |
| ATE20888T1 (de) * | 1982-05-10 | 1986-08-15 | Ciba Geigy Ag | Cyclopropancarbonsaeurederivate. |
| US4518789A (en) * | 1982-06-30 | 1985-05-21 | Yu Ruey J | Phenyl alpha-acyloxyacetamide derivatives and their therapeutic use |
| HU193171B (en) * | 1983-07-21 | 1987-08-28 | Eszakmagyar Vegyimuevek | Herbicide preparations containing antidote of n-/dichlor-acetyl/-n-substituted.glycine-n', n-disubstituted-amide-type, or containing agent and antidote, as well as process for the production of the antidote |
| US4618361A (en) * | 1983-12-12 | 1986-10-21 | Ciba-Geigy Corporation | Acylamides and compositions for the protection of cultivated plants against the phytotoxic action of herbicides |
| ZA853997B (en) * | 1984-05-28 | 1986-01-29 | Ciba Geigy Ag | Composition for protecting culture plants from the phytotoxic action of herbicidally active chloracetanilides |
| EP0190105A3 (de) * | 1985-01-31 | 1988-10-26 | Ciba-Geigy Ag | Herbizides Mittel |
| HU194686B (en) * | 1985-05-10 | 1988-03-28 | Eszakmagyar Vegyimuevek | Herbicidal composition of prolonged action, comprising alpha-chlorine-acetanilide derivatives as active substance |
| US5425789A (en) * | 1986-12-22 | 1995-06-20 | Exxon Chemical Patents Inc. | Chemical compositions and their use as fuel additives |
| DE10326386A1 (de) | 2003-06-12 | 2004-12-30 | Bayer Cropscience Ag | N-Heterocyclyl-phenylsubstituierte cyclische Ketoenole |
| DE10331675A1 (de) | 2003-07-14 | 2005-02-10 | Bayer Cropscience Ag | Hetarylsubstituierte Pyrazolidindion-Derivate |
| DE10337497A1 (de) | 2003-08-14 | 2005-03-10 | Bayer Cropscience Ag | 4-Biphenylsubstituierte-Pyrazolidin-3,5-dion-Derivate |
| DE10337496A1 (de) | 2003-08-14 | 2005-04-14 | Bayer Cropscience Ag | 4-Biphenylsubstituierte-4-substituierte-pyrazolidin-3,5-dione |
| DE10354629A1 (de) | 2003-11-22 | 2005-06-30 | Bayer Cropscience Ag | 2-Ethyl-4,6-dimethyl-phenyl substituierte spirocyclische Tetramsäure-Derivate |
| DE10354628A1 (de) | 2003-11-22 | 2005-06-16 | Bayer Cropscience Ag | 2-Ethyl-4,6-dimethyl-phenyl-substituierte Tetramsäure-Derivate |
| DE102004014620A1 (de) | 2004-03-25 | 2005-10-06 | Bayer Cropscience Ag | 2,4,6-phenylsubstituierte cyclische Ketoenole |
| DE102004030753A1 (de) | 2004-06-25 | 2006-01-19 | Bayer Cropscience Ag | 3'-Alkoxy spirocyclische Tetram- und Tretronsäuren |
| DE102004035134A1 (de) | 2004-07-20 | 2006-02-16 | Bayer Cropscience Ag | Selektive Insektizide auf Basis von Halogenalkylnicotinsäurederivaten, Anthranilsäureamiden oder Phthalsäurediamiden und Safenern |
| DE102004044827A1 (de) | 2004-09-16 | 2006-03-23 | Bayer Cropscience Ag | Jod-phenylsubstituierte cyclische Ketoenole |
| DE102004053192A1 (de) | 2004-11-04 | 2006-05-11 | Bayer Cropscience Ag | 2-Alkoxy-6-alkyl-phenyl substituierte spirocyclische Tetramsäure-Derivate |
| DE102004053191A1 (de) | 2004-11-04 | 2006-05-11 | Bayer Cropscience Ag | 2,6-Diethyl-4-methyl-phenyl substituierte Tetramsäure-Derivate |
| DE102005059891A1 (de) | 2005-12-15 | 2007-06-28 | Bayer Cropscience Ag | 3'-Alkoxy-spirocyclopentyl substituierte Tetram- und Tetronsäuren |
| DE102006007882A1 (de) | 2006-02-21 | 2007-08-30 | Bayer Cropscience Ag | Cycloalkyl-phenylsubstituierte cyclische Ketoenole |
| DE102006025874A1 (de) | 2006-06-02 | 2007-12-06 | Bayer Cropscience Ag | Alkoxyalkyl-substituierte cyclische Ketoenole |
| DE102006050148A1 (de) | 2006-10-25 | 2008-04-30 | Bayer Cropscience Ag | Trifluormethoxy-phenylsubstituierte Tetramsäure-Derivate |
| DE102006057037A1 (de) | 2006-12-04 | 2008-06-05 | Bayer Cropscience Ag | cis-Alkoxyspirocyclische biphenylsubstituierte Tetramsäure-Derivate |
| DE102006057036A1 (de) | 2006-12-04 | 2008-06-05 | Bayer Cropscience Ag | Biphenylsubstituierte spirocyclische Ketoenole |
| EP2020413A1 (de) | 2007-08-02 | 2009-02-04 | Bayer CropScience AG | Oxaspirocyclische-spiro-substituierte Tetram- und Tetronsäure-Derivate |
| EP2045240A1 (de) | 2007-09-25 | 2009-04-08 | Bayer CropScience AG | Halogenalkoxyspirocyclische Tetram- und Tetronsäure-Derivate |
| EP2103615A1 (de) | 2008-03-19 | 2009-09-23 | Bayer CropScience AG | 4'4'-Dioxaspiro-spirocyclisch substituierte Tetramate |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2973258A (en) * | 1957-12-30 | 1961-02-28 | Monsanto Chemicals | Unsymmetrical alpha-haloacetamide herbicides |
| US3133810A (en) * | 1961-04-19 | 1964-05-19 | Monsanto Chemicals | Herbicidal compositions |
| US3152884A (en) * | 1961-04-24 | 1964-10-13 | Upjohn Co | Herbicidal composition and method |
| US3131509A (en) * | 1961-05-08 | 1964-05-05 | Spencer Chem Co | Compositions and methods for reducing herbicidal injury |
| US3152883A (en) * | 1961-09-12 | 1964-10-13 | Upjohn Co | Herbicidal composition and method |
| US3154400A (en) * | 1961-11-15 | 1964-10-27 | Monsanto Co | Alkyl substituted chloroacetamide weed control |
| US3321295A (en) * | 1965-11-04 | 1967-05-23 | Monsanto Co | Method of controlling undesired plants |
| US3268526A (en) * | 1962-09-12 | 1966-08-23 | Monsanto Co | Heterocyclic polyhalobenzamide derivatives |
| US3357816A (en) * | 1964-12-08 | 1967-12-12 | Monsanto Co | Herbicidal benzamides and methods |
| NL157008B (nl) * | 1966-02-01 | 1978-06-15 | Monsanto Co | Werkwijze voor het bereiden van een preparaat met fytotoxische werking, gevormde preparaten met deze werking, alsmede werkwijze voor het bereiden van n-digesubstitueerde alfa-chlooraceetamidederivaten. |
| US3362810A (en) * | 1966-08-01 | 1968-01-09 | Monsanto Co | Herbicidal clay formulation |
| US3534098A (en) * | 1967-01-10 | 1970-10-13 | Rohm & Haas | 3,5-disubstituted benzamides |
| US3469966A (en) * | 1967-01-23 | 1969-09-30 | Allied Chem | Bicyclic amides having herbicidal properties |
| US3551484A (en) * | 1968-04-01 | 1970-12-29 | Rohm & Haas | 3,5-disubstituted benzamides |
| US3564768A (en) * | 1968-10-25 | 1971-02-23 | Gulf Research Development Co | Coated corn seed |
| US3700732A (en) * | 1969-03-26 | 1972-10-24 | Rohm & Haas | N-(1,1-dimethyl-2-butynyl)-3,5-dichlorobenzamide |
| FR2078170A5 (nl) * | 1970-02-06 | 1971-11-05 | Gulf Research Development Co | |
| US3719466A (en) * | 1970-04-16 | 1973-03-06 | Gulf Research Development Co | Protection of wheat and grain sorghum from herbicidal injury |
| GB1330701A (en) * | 1970-04-21 | 1973-09-19 | Lennig Chemicals Ltd | Pesticidal compositions |
| CA1010257A (en) * | 1970-08-31 | 1977-05-17 | Duane R. Arneklev | Antidote compositions and method of use with herbicides |
-
1972
- 1972-04-06 CA CA000139060A patent/CA1174865A/en not_active Expired
- 1972-04-12 NL NLAANVRAGE7204894,A patent/NL175965C/nl not_active IP Right Cessation
- 1972-04-12 AR AR241425A patent/AR192928A1/es active
- 1972-04-12 DK DK177372A patent/DK143583C/da active
- 1972-04-12 DD DD162258A patent/DD102075A5/xx unknown
- 1972-04-13 CS CS722480A patent/CS196241B2/cs unknown
- 1972-04-14 DE DE19722218097 patent/DE2218097A1/de active Granted
- 1972-04-14 FR FR7213316A patent/FR2133793B1/fr not_active Expired
- 1972-04-14 BE BE782120A patent/BE782120A/xx not_active IP Right Cessation
- 1972-04-14 PL PL1972154732A patent/PL99481B1/pl unknown
- 1972-04-14 IL IL39219A patent/IL39219A/xx unknown
- 1972-04-15 IT IT23209/72A patent/IT953649B/it active
- 1972-04-15 ES ES401779A patent/ES401779A1/es not_active Expired
- 1972-04-16 GB GB1475472A patent/GB1396941A/en not_active Expired
- 1972-04-16 GB GB5447574A patent/GB1396942A/en not_active Expired
- 1972-04-17 RO RO108381A patent/RO83877B/ro unknown
- 1972-04-17 RO RO7270563A patent/RO78996A/ro unknown
- 1972-04-17 CH CH563772A patent/CH577785A5/xx not_active IP Right Cessation
- 1972-04-17 RO RO108380A patent/RO83875B/ro unknown
- 1972-04-17 TR TR18613A patent/TR18613A/xx unknown
-
1977
- 1977-12-30 MY MY206/77A patent/MY7700206A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1396942A (en) | 1975-06-11 |
| MY7700206A (en) | 1977-12-31 |
| AR192928A1 (es) | 1973-03-21 |
| TR18613A (tr) | 1977-05-13 |
| BE782120A (fr) | 1972-10-16 |
| GB1396941A (en) | 1975-06-11 |
| PL99481B1 (pl) | 1978-07-31 |
| NL175965C (nl) | 1985-02-01 |
| FR2133793B1 (nl) | 1977-06-24 |
| RO83875B (ro) | 1984-04-30 |
| RO78996A (ro) | 1982-06-25 |
| IT953649B (it) | 1973-08-10 |
| IL39219A0 (en) | 1972-07-26 |
| DK143583B (da) | 1981-09-14 |
| DE2218097C2 (nl) | 1987-07-30 |
| DE2218097A1 (de) | 1972-11-02 |
| IL39219A (en) | 1978-12-17 |
| ES401779A1 (es) | 1975-11-01 |
| RO83877B (ro) | 1984-04-30 |
| RO83877A (ro) | 1984-04-02 |
| DD102075A5 (nl) | 1973-12-05 |
| NL7204894A (nl) | 1972-10-18 |
| DK143583C (da) | 1982-02-01 |
| CA1174865A (en) | 1984-09-25 |
| FR2133793A1 (nl) | 1972-12-01 |
| CH577785A5 (nl) | 1976-07-30 |
| RO83875A (ro) | 1984-04-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS196241B2 (en) | Herbicide | |
| HU228370B1 (en) | Pesticidal phenyl-substituted heterocyclic ketoenol derivatives, intermediates, preparation and use thereof | |
| JPS61267576A (ja) | N−〔(4,6−ジメトキシピリミジン−2−イル)アミノカルボニル〕−3−トリフルオロメチルピリジン−2−スルホンアミド或いはその塩、それらの製造方法及びそれらを含有する除草剤 | |
| TW200418842A (en) | Amino-1,3,5-triazines n-substituted with chiral bicyclic radicals, process for their preparation, compositions thereof, and their use as herbicides and plant growth regulators | |
| US3689507A (en) | 2-organyloxy-2,3-dihydro-5-benzofuranyl esters of alkyl sulfonic acids | |
| PL153976B1 (en) | Herbicide | |
| US3984435A (en) | Herbicidal N-substituted-Δ1 -tetrahydrophthalimide | |
| FI70210B (fi) | Nya som herbicider anvaendbara n-acyl-pyrrol-2,5-dion-derivat och deras framstaellning | |
| JPS584757A (ja) | 置換シクロプロピルメトキシ尿素及び除草組成物ならびに除草方法 | |
| JPS6226281A (ja) | 除草剤性チオフエンスルホンアミド類 | |
| US4157255A (en) | Herbicides | |
| US4345932A (en) | Herbicides | |
| JPS6348248A (ja) | ベンゾヒドロキサム酸誘導体 | |
| PT79120B (en) | Process for the preparation of n-(substituted)-5-(substituted phenyl)-1,3-oxazolidines used as herbicidal antidotes | |
| PL94157B1 (en) | Sulfoxide and sulfone thiazolidines, compositions thereof and their utility as herbicide antidotes[US4137066A] | |
| CS215126B2 (en) | Herbicide means and method of making the active substance thereof | |
| US3772277A (en) | Sulfonamide compounds | |
| JPS62169785A (ja) | ナフチリジン−誘導体、その製法及びこれを含有する除草剤 | |
| JPS6011006B2 (ja) | シクロヘキサン誘導体除草剤 | |
| US3575972A (en) | Morpholino carbonyl glyoxylonitrile oximino dialkyl carbamates | |
| US2213218A (en) | Insecticide | |
| CN105859707B (zh) | (r)-n-(噻唑-2-基)-2-[4-(喹喔啉-2-氧基)苯氧基]酰胺衍生物及其制备方法和应用 | |
| JP2689093B2 (ja) | 置換ピリジンスルホンアミド系化合物、それらを含有する除草剤並びにそれらの化合物の製造方法 | |
| Okamoto et al. | Herbicidally active N-(1-arylethenyl)-2-chloroacetamides bearing an alkyloxyalkyl moiety | |
| JPH045025B2 (nl) |