CH644143A5 - Mischung auf basis von vulkanisierbarem, halogenfreiem kautschuk. - Google Patents
Mischung auf basis von vulkanisierbarem, halogenfreiem kautschuk. Download PDFInfo
- Publication number
- CH644143A5 CH644143A5 CH618980A CH618980A CH644143A5 CH 644143 A5 CH644143 A5 CH 644143A5 CH 618980 A CH618980 A CH 618980A CH 618980 A CH618980 A CH 618980A CH 644143 A5 CH644143 A5 CH 644143A5
- Authority
- CH
- Switzerland
- Prior art keywords
- weight
- parts
- mixture
- rubber
- mixtures
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 165
- 229920001971 elastomer Polymers 0.000 title claims description 100
- 239000005060 rubber Substances 0.000 title claims description 97
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 84
- 239000000945 filler Substances 0.000 claims description 63
- 239000000377 silicon dioxide Substances 0.000 claims description 37
- 238000004073 vulcanization Methods 0.000 claims description 25
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 24
- 229910052717 sulfur Inorganic materials 0.000 claims description 23
- 239000011593 sulfur Substances 0.000 claims description 23
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 claims description 19
- -1 methoxyethyl Chemical group 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 18
- 239000006229 carbon black Substances 0.000 claims description 15
- 150000001282 organosilanes Chemical class 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 12
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- 238000004519 manufacturing process Methods 0.000 claims description 11
- 150000002367 halogens Chemical class 0.000 claims description 10
- 230000008569 process Effects 0.000 claims description 10
- KSCAZPYHLGGNPZ-UHFFFAOYSA-N 3-chloropropyl(triethoxy)silane Chemical compound CCO[Si](OCC)(OCC)CCCCl KSCAZPYHLGGNPZ-UHFFFAOYSA-N 0.000 claims description 7
- 238000010438 heat treatment Methods 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 claims description 6
- MTHSVFCYNBDYFN-UHFFFAOYSA-N anhydrous diethylene glycol Natural products OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 claims description 5
- 238000000465 moulding Methods 0.000 claims description 5
- 239000004014 plasticizer Substances 0.000 claims description 5
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 229920001223 polyethylene glycol Polymers 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 3
- 239000002202 Polyethylene glycol Substances 0.000 claims description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 230000003712 anti-aging effect Effects 0.000 claims description 3
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 3
- 239000000194 fatty acid Substances 0.000 claims description 3
- 229930195729 fatty acid Natural products 0.000 claims description 3
- 150000004665 fatty acids Chemical class 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 150000002739 metals Chemical class 0.000 claims description 3
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 claims description 3
- 238000001556 precipitation Methods 0.000 claims description 3
- 229960004889 salicylic acid Drugs 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000003381 stabilizer Substances 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 3
- 239000012736 aqueous medium Substances 0.000 claims 2
- 239000005711 Benzoic acid Substances 0.000 claims 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 claims 1
- 235000010233 benzoic acid Nutrition 0.000 claims 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Chemical group 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- TZMQHOJDDMFGQX-UHFFFAOYSA-N hexane-1,1,1-triol Chemical compound CCCCCC(O)(O)O TZMQHOJDDMFGQX-UHFFFAOYSA-N 0.000 claims 1
- 239000011133 lead Substances 0.000 claims 1
- 230000003647 oxidation Effects 0.000 claims 1
- 238000007254 oxidation reaction Methods 0.000 claims 1
- 239000011814 protection agent Substances 0.000 claims 1
- 150000005846 sugar alcohols Polymers 0.000 claims 1
- 230000036962 time dependent Effects 0.000 claims 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 59
- 229910000077 silane Inorganic materials 0.000 description 48
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 34
- 238000012360 testing method Methods 0.000 description 28
- 150000004756 silanes Chemical class 0.000 description 27
- 238000004132 cross linking Methods 0.000 description 20
- 229920003048 styrene butadiene rubber Polymers 0.000 description 19
- 239000011787 zinc oxide Substances 0.000 description 17
- 235000021355 Stearic acid Nutrition 0.000 description 16
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 16
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 16
- 239000008117 stearic acid Substances 0.000 description 16
- 238000007792 addition Methods 0.000 description 13
- 238000002156 mixing Methods 0.000 description 13
- 241001441571 Hiodontidae Species 0.000 description 12
- 239000003921 oil Substances 0.000 description 11
- 239000002174 Styrene-butadiene Substances 0.000 description 10
- 238000005299 abrasion Methods 0.000 description 10
- 238000007906 compression Methods 0.000 description 9
- 230000006835 compression Effects 0.000 description 9
- 229920003052 natural elastomer Polymers 0.000 description 8
- 229920001194 natural rubber Polymers 0.000 description 8
- 230000000052 comparative effect Effects 0.000 description 7
- 239000011164 primary particle Substances 0.000 description 7
- 150000004760 silicates Chemical class 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- 244000043261 Hevea brasiliensis Species 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 230000006872 improvement Effects 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- 229920002857 polybutadiene Polymers 0.000 description 6
- 239000004071 soot Substances 0.000 description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 6
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 5
- 229910044991 metal oxide Inorganic materials 0.000 description 5
- 150000004706 metal oxides Chemical class 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- QAZLUNIWYYOJPC-UHFFFAOYSA-M sulfenamide Chemical compound [Cl-].COC1=C(C)C=[N+]2C3=NC4=CC=C(OC)C=C4N3SCC2=C1C QAZLUNIWYYOJPC-UHFFFAOYSA-M 0.000 description 5
- 229920000459 Nitrile rubber Polymers 0.000 description 4
- NTXGQCSETZTARF-UHFFFAOYSA-N buta-1,3-diene;prop-2-enenitrile Chemical compound C=CC=C.C=CC#N NTXGQCSETZTARF-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 229920002943 EPDM rubber Polymers 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- 229920003244 diene elastomer Polymers 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000005516 engineering process Methods 0.000 description 3
- 239000003365 glass fiber Substances 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 239000000395 magnesium oxide Substances 0.000 description 3
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 3
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 3
- 229960002447 thiram Drugs 0.000 description 3
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 2
- OWRCNXZUPFZXOS-UHFFFAOYSA-N 1,3-diphenylguanidine Chemical compound C=1C=CC=CC=1NC(=N)NC1=CC=CC=C1 OWRCNXZUPFZXOS-UHFFFAOYSA-N 0.000 description 2
- GLISZRPOUBOZDL-UHFFFAOYSA-N 3-bromopropyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)CCCBr GLISZRPOUBOZDL-UHFFFAOYSA-N 0.000 description 2
- ZXUPDVHDDIFSEP-UHFFFAOYSA-N 3-bromopropyl(tripentoxy)silane Chemical compound CCCCCO[Si](CCCBr)(OCCCCC)OCCCCC ZXUPDVHDDIFSEP-UHFFFAOYSA-N 0.000 description 2
- OXYZDRAJMHGSMW-UHFFFAOYSA-N 3-chloropropyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)CCCCl OXYZDRAJMHGSMW-UHFFFAOYSA-N 0.000 description 2
- UUEWCQRISZBELL-UHFFFAOYSA-N 3-trimethoxysilylpropane-1-thiol Chemical compound CO[Si](OC)(OC)CCCS UUEWCQRISZBELL-UHFFFAOYSA-N 0.000 description 2
- HLBZWYXLQJQBKU-UHFFFAOYSA-N 4-(morpholin-4-yldisulfanyl)morpholine Chemical compound C1COCCN1SSN1CCOCC1 HLBZWYXLQJQBKU-UHFFFAOYSA-N 0.000 description 2
- 229910002012 Aerosil® Inorganic materials 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 2
- 241000700605 Viruses Species 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000005370 alkoxysilyl group Chemical group 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000010425 asbestos Substances 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 229920005549 butyl rubber Polymers 0.000 description 2
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- IXQMGECVDWVOFK-UHFFFAOYSA-N dichloromethyl(triethoxy)silane Chemical compound CCO[Si](OCC)(OCC)C(Cl)Cl IXQMGECVDWVOFK-UHFFFAOYSA-N 0.000 description 2
- AUZONCFQVSMFAP-UHFFFAOYSA-N disulfiram Chemical compound CCN(CC)C(=S)SSC(=S)N(CC)CC AUZONCFQVSMFAP-UHFFFAOYSA-N 0.000 description 2
- 239000012990 dithiocarbamate Substances 0.000 description 2
- 239000000806 elastomer Substances 0.000 description 2
- 239000003974 emollient agent Substances 0.000 description 2
- ZOOODBUHSVUZEM-UHFFFAOYSA-N ethoxymethanedithioic acid Chemical compound CCOC(S)=S ZOOODBUHSVUZEM-UHFFFAOYSA-N 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 2
- 239000004312 hexamethylene tetramine Substances 0.000 description 2
- 229960004011 methenamine Drugs 0.000 description 2
- DEQZTKGFXNUBJL-UHFFFAOYSA-N n-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine Chemical compound C1CCCCC1NSC1=NC2=CC=CC=C2S1 DEQZTKGFXNUBJL-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 239000005077 polysulfide Substances 0.000 description 2
- 229920001021 polysulfide Polymers 0.000 description 2
- 150000008117 polysulfides Polymers 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 229910052895 riebeckite Inorganic materials 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- TXDNPSYEJHXKMK-UHFFFAOYSA-N sulfanylsilane Chemical class S[SiH3] TXDNPSYEJHXKMK-UHFFFAOYSA-N 0.000 description 2
- 238000010059 sulfur vulcanization Methods 0.000 description 2
- 238000005987 sulfurization reaction Methods 0.000 description 2
- 230000002195 synergetic effect Effects 0.000 description 2
- 229920003051 synthetic elastomer Polymers 0.000 description 2
- 239000005061 synthetic rubber Substances 0.000 description 2
- 239000012991 xanthate Substances 0.000 description 2
- WYTZZXDRDKSJID-UHFFFAOYSA-N (3-aminopropyl)triethoxysilane Chemical compound CCO[Si](OCC)(OCC)CCCN WYTZZXDRDKSJID-UHFFFAOYSA-N 0.000 description 1
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- OPNUROKCUBTKLF-UHFFFAOYSA-N 1,2-bis(2-methylphenyl)guanidine Chemical compound CC1=CC=CC=C1N\C(N)=N\C1=CC=CC=C1C OPNUROKCUBTKLF-UHFFFAOYSA-N 0.000 description 1
- WGJCBBASTRWVJL-UHFFFAOYSA-N 1,3-thiazolidine-2-thione Chemical compound SC1=NCCS1 WGJCBBASTRWVJL-UHFFFAOYSA-N 0.000 description 1
- KEBSAHSJTAZGQU-UHFFFAOYSA-N 1-bromopropan-2-yl(tripropoxy)silane Chemical compound CCCO[Si](OCCC)(OCCC)C(C)CBr KEBSAHSJTAZGQU-UHFFFAOYSA-N 0.000 description 1
- QQONDXKKAWOWJF-UHFFFAOYSA-N 1-chloroethyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)C(C)Cl QQONDXKKAWOWJF-UHFFFAOYSA-N 0.000 description 1
- ZARCFEHBDQIZSJ-UHFFFAOYSA-N 1-triethoxysilylpropane-2-thiol Chemical compound CCO[Si](CC(C)S)(OCC)OCC ZARCFEHBDQIZSJ-UHFFFAOYSA-N 0.000 description 1
- HAZJTCQWIDBCCE-UHFFFAOYSA-N 1h-triazine-6-thione Chemical compound SC1=CC=NN=N1 HAZJTCQWIDBCCE-UHFFFAOYSA-N 0.000 description 1
- ZNRLMGFXSPUZNR-UHFFFAOYSA-N 2,2,4-trimethyl-1h-quinoline Chemical compound C1=CC=C2C(C)=CC(C)(C)NC2=C1 ZNRLMGFXSPUZNR-UHFFFAOYSA-N 0.000 description 1
- QOJJHOLECIYHDM-UHFFFAOYSA-N 2-(chloromethyl)butyl-(diethoxymethyl)silane Chemical compound CCOC(OCC)[SiH2]CC(CC)CCl QOJJHOLECIYHDM-UHFFFAOYSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- JZAMVYIJHKWFAI-UHFFFAOYSA-N 2-bromoethyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)CCBr JZAMVYIJHKWFAI-UHFFFAOYSA-N 0.000 description 1
- CASYTJWXPQRCFF-UHFFFAOYSA-N 2-chloroethyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)CCCl CASYTJWXPQRCFF-UHFFFAOYSA-N 0.000 description 1
- IDEOPBXRUBNYBN-UHFFFAOYSA-N 2-methylbutane-2,3-diol Chemical compound CC(O)C(C)(C)O IDEOPBXRUBNYBN-UHFFFAOYSA-N 0.000 description 1
- LOSLJXKHQKRRFN-UHFFFAOYSA-N 2-trimethoxysilylethanethiol Chemical compound CO[Si](OC)(OC)CCS LOSLJXKHQKRRFN-UHFFFAOYSA-N 0.000 description 1
- CFRPSVNJHLINCI-UHFFFAOYSA-N 2-trimethoxysilylpropane-1-thiol Chemical compound CO[Si](OC)(OC)C(C)CS CFRPSVNJHLINCI-UHFFFAOYSA-N 0.000 description 1
- BUZICZZQJDLXJN-UHFFFAOYSA-N 3-azaniumyl-4-hydroxybutanoate Chemical compound OCC(N)CC(O)=O BUZICZZQJDLXJN-UHFFFAOYSA-N 0.000 description 1
- JMFBXUMHVSZUKY-UHFFFAOYSA-N 3-bromopropyl(triethoxy)silane Chemical compound CCO[Si](OCC)(OCC)CCCBr JMFBXUMHVSZUKY-UHFFFAOYSA-N 0.000 description 1
- WTYVNIBMVLSLQZ-UHFFFAOYSA-N 3-bromopropyl(triphenoxy)silane Chemical compound C=1C=CC=CC=1O[Si](OC=1C=CC=CC=1)(CCCBr)OC1=CC=CC=C1 WTYVNIBMVLSLQZ-UHFFFAOYSA-N 0.000 description 1
- QMOURSXDRYVWHW-UHFFFAOYSA-N 3-bromopropyl-tris[(2-methylpropan-2-yl)oxy]silane Chemical compound CC(C)(C)O[Si](OC(C)(C)C)(OC(C)(C)C)CCCBr QMOURSXDRYVWHW-UHFFFAOYSA-N 0.000 description 1
- FXULSOCBPSWCCL-UHFFFAOYSA-N 3-chloropropyl-cyclohexyl-dicyclohexyloxysilane Chemical compound C1CCCCC1O[Si](C1CCCCC1)(CCCCl)OC1CCCCC1 FXULSOCBPSWCCL-UHFFFAOYSA-N 0.000 description 1
- KNTKCYKJRSMRMZ-UHFFFAOYSA-N 3-chloropropyl-dimethoxy-methylsilane Chemical compound CO[Si](C)(OC)CCCCl KNTKCYKJRSMRMZ-UHFFFAOYSA-N 0.000 description 1
- YZAHKILJHJDHAX-UHFFFAOYSA-N 3-chloropropyl-ethoxy-(2-phenoxyethyl)silane Chemical compound ClCCC[SiH](CCOC1=CC=CC=C1)OCC YZAHKILJHJDHAX-UHFFFAOYSA-N 0.000 description 1
- XUZIBXWZLMCBRH-UHFFFAOYSA-N 3-chloropropyl-tris(phenylmethoxy)silane Chemical compound C=1C=CC=CC=1CO[Si](OCC=1C=CC=CC=1)(CCCCl)OCC1=CC=CC=C1 XUZIBXWZLMCBRH-UHFFFAOYSA-N 0.000 description 1
- ICHAUYNXFWOLPC-UHFFFAOYSA-N 3-tributoxysilylpropane-1-thiol Chemical compound CCCCO[Si](CCCS)(OCCCC)OCCCC ICHAUYNXFWOLPC-UHFFFAOYSA-N 0.000 description 1
- DCQBZYNUSLHVJC-UHFFFAOYSA-N 3-triethoxysilylpropane-1-thiol Chemical compound CCO[Si](OCC)(OCC)CCCS DCQBZYNUSLHVJC-UHFFFAOYSA-N 0.000 description 1
- GIUBHMDTOCBOPA-UHFFFAOYSA-N 3h-1,3-benzothiazole-2-thione;zinc Chemical compound [Zn].C1=CC=C2SC(S)=NC2=C1 GIUBHMDTOCBOPA-UHFFFAOYSA-N 0.000 description 1
- VJPGPCCOXUQRLT-UHFFFAOYSA-N 4-chlorobutyl(triethoxy)silane Chemical compound CCO[Si](OCC)(OCC)CCCCCl VJPGPCCOXUQRLT-UHFFFAOYSA-N 0.000 description 1
- LSAUHWRNBBMZIC-UHFFFAOYSA-N 4-sulfanyl-1h-triazine-6-thione Chemical class SC1=CC(=S)NN=N1 LSAUHWRNBBMZIC-UHFFFAOYSA-N 0.000 description 1
- RVAVYOJYNISEQK-UHFFFAOYSA-N 4-triethoxysilylbutane-1-thiol Chemical compound CCO[Si](OCC)(OCC)CCCCS RVAVYOJYNISEQK-UHFFFAOYSA-N 0.000 description 1
- PVSRROCZULRIRM-UHFFFAOYSA-N 5-bromopentan-2-yl-cyclooctyloxy-dimethoxysilane Chemical compound BrCCCC(C)[Si](OC)(OC)OC1CCCCCCC1 PVSRROCZULRIRM-UHFFFAOYSA-N 0.000 description 1
- PJXMLLMYUMWDSC-UHFFFAOYSA-N 5-chloropentyl(triethoxy)silane Chemical compound CCO[Si](OCC)(OCC)CCCCCCl PJXMLLMYUMWDSC-UHFFFAOYSA-N 0.000 description 1
- HDSQGILQHJLCFA-UHFFFAOYSA-N 5-trimethoxysilylpentane-1-thiol Chemical compound CO[Si](OC)(OC)CCCCCS HDSQGILQHJLCFA-UHFFFAOYSA-N 0.000 description 1
- KQYRGOWWPDNMTK-UHFFFAOYSA-N 8-trimethoxysilyloctane-1-thiol Chemical class CO[Si](OC)(OC)CCCCCCCCS KQYRGOWWPDNMTK-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 229920004394 Baypren® Polymers 0.000 description 1
- OWAMHAWEEZFJKY-UHFFFAOYSA-N C(C)NN1NC(=CC(=N1)N(CC)CC)SSC1=CC(=NN(N1)NCC)N(CC)CC Chemical compound C(C)NN1NC(=CC(=N1)N(CC)CC)SSC1=CC(=NN(N1)NCC)N(CC)CC OWAMHAWEEZFJKY-UHFFFAOYSA-N 0.000 description 1
- IKYWBFYSVRFOLA-UHFFFAOYSA-N C1(CCCCC1)NSC=1SC2=C(N1)C=CC=C2.CN(C(SSC(N(C)C)=S)=S)C Chemical compound C1(CCCCC1)NSC=1SC2=C(N1)C=CC=C2.CN(C(SSC(N(C)C)=S)=S)C IKYWBFYSVRFOLA-UHFFFAOYSA-N 0.000 description 1
- VEUATSBQTGLOLT-UHFFFAOYSA-N CNN1NC(=CC(=N1)N(C(C)C)C(C)C)SSC1=CC(=NN(N1)NC)N(C(C)C)C(C)C Chemical compound CNN1NC(=CC(=N1)N(C(C)C)C(C)C)SSC1=CC(=NN(N1)NC)N(C(C)C)C(C)C VEUATSBQTGLOLT-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 239000005046 Chlorosilane Substances 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- PDQAZBWRQCGBEV-UHFFFAOYSA-N Ethylenethiourea Chemical compound S=C1NCCN1 PDQAZBWRQCGBEV-UHFFFAOYSA-N 0.000 description 1
- 239000006237 Intermediate SAF Substances 0.000 description 1
- VHOQXEIFYTTXJU-UHFFFAOYSA-N Isobutylene-isoprene copolymer Chemical group CC(C)=C.CC(=C)C=C VHOQXEIFYTTXJU-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- FCSHMCFRCYZTRQ-UHFFFAOYSA-N N,N'-diphenylthiourea Chemical compound C=1C=CC=CC=1NC(=S)NC1=CC=CC=C1 FCSHMCFRCYZTRQ-UHFFFAOYSA-N 0.000 description 1
- OUBMGJOQLXMSNT-UHFFFAOYSA-N N-isopropyl-N'-phenyl-p-phenylenediamine Chemical compound C1=CC(NC(C)C)=CC=C1NC1=CC=CC=C1 OUBMGJOQLXMSNT-UHFFFAOYSA-N 0.000 description 1
- 229920004940 NATSYN® Polymers 0.000 description 1
- 235000021314 Palmitic acid Nutrition 0.000 description 1
- ALQSHHUCVQOPAS-UHFFFAOYSA-N Pentane-1,5-diol Chemical compound OCCCCCO ALQSHHUCVQOPAS-UHFFFAOYSA-N 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- JYYAMHTVKVGSEP-UHFFFAOYSA-N [S].C1CCCCC1NSC1=NC2=CC=CC=C2S1 Chemical compound [S].C1CCCCC1NSC1=NC2=CC=CC=C2S1 JYYAMHTVKVGSEP-UHFFFAOYSA-N 0.000 description 1
- WUFRAKOFLITOHU-UHFFFAOYSA-N [SiH4].C(CCCCCCCCCCCCCCCCC)(=O)O Chemical class [SiH4].C(CCCCCCCCCCCCCCCCC)(=O)O WUFRAKOFLITOHU-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 230000002929 anti-fatigue Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229920005557 bromobutyl Polymers 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- ULHIDKVNBFIQKP-UHFFFAOYSA-N butanal;butan-1-amine Chemical compound CCCCN.CCCC=O ULHIDKVNBFIQKP-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical class CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- JHLNERQLKQQLRZ-UHFFFAOYSA-N calcium silicate Chemical compound [Ca+2].[Ca+2].[O-][Si]([O-])([O-])[O-] JHLNERQLKQQLRZ-UHFFFAOYSA-N 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 229920005556 chlorobutyl Polymers 0.000 description 1
- ZDOBWJOCPDIBRZ-UHFFFAOYSA-N chloromethyl(triethoxy)silane Chemical compound CCO[Si](CCl)(OCC)OCC ZDOBWJOCPDIBRZ-UHFFFAOYSA-N 0.000 description 1
- FPOSCXQHGOVVPD-UHFFFAOYSA-N chloromethyl(trimethoxy)silane Chemical compound CO[Si](CCl)(OC)OC FPOSCXQHGOVVPD-UHFFFAOYSA-N 0.000 description 1
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 description 1
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical compound Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000013016 damping Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- AFZSMODLJJCVPP-UHFFFAOYSA-N dibenzothiazol-2-yl disulfide Chemical compound C1=CC=C2SC(SSC=3SC4=CC=CC=C4N=3)=NC2=C1 AFZSMODLJJCVPP-UHFFFAOYSA-N 0.000 description 1
- MDDOYARZUXISII-UHFFFAOYSA-N dibromomethyl(triethoxy)silane Chemical compound CCO[Si](OCC)(OCC)C(Br)Br MDDOYARZUXISII-UHFFFAOYSA-N 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- REQPQFUJGGOFQL-UHFFFAOYSA-N dimethylcarbamothioyl n,n-dimethylcarbamodithioate Chemical compound CN(C)C(=S)SC(=S)N(C)C REQPQFUJGGOFQL-UHFFFAOYSA-N 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000010292 electrical insulation Methods 0.000 description 1
- NKSJNEHGWDZZQF-UHFFFAOYSA-N ethenyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)C=C NKSJNEHGWDZZQF-UHFFFAOYSA-N 0.000 description 1
- CWAFVXWRGIEBPL-UHFFFAOYSA-N ethoxysilane Chemical compound CCO[SiH3] CWAFVXWRGIEBPL-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 229910021485 fumed silica Inorganic materials 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- 229940083094 guanine derivative acting on arteriolar smooth muscle Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229920005555 halobutyl Polymers 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000012432 intermediate storage Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229920003049 isoprene rubber Polymers 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- IUJLOAKJZQBENM-UHFFFAOYSA-N n-(1,3-benzothiazol-2-ylsulfanyl)-2-methylpropan-2-amine Chemical compound C1=CC=C2SC(SNC(C)(C)C)=NC2=C1 IUJLOAKJZQBENM-UHFFFAOYSA-N 0.000 description 1
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 1
- LPXPSTWBTULMJE-UHFFFAOYSA-N n-phenylbutan-1-imine Chemical compound CCCC=NC1=CC=CC=C1 LPXPSTWBTULMJE-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000012763 reinforcing filler Substances 0.000 description 1
- 238000010057 rubber processing Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- FZHAPNGMFPVSLP-UHFFFAOYSA-N silanamine Chemical class [SiH3]N FZHAPNGMFPVSLP-UHFFFAOYSA-N 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- CCEKAJIANROZEO-UHFFFAOYSA-N sulfluramid Chemical group CCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F CCEKAJIANROZEO-UHFFFAOYSA-N 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- IKRMQEUTISXXQP-UHFFFAOYSA-N tetrasulfane Chemical class SSSS IKRMQEUTISXXQP-UHFFFAOYSA-N 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- OCSDOVUUUVPQBR-UHFFFAOYSA-N triethoxy(2-methylbutyl)silane Chemical compound CC(C[Si](OCC)(OCC)OCC)CC OCSDOVUUUVPQBR-UHFFFAOYSA-N 0.000 description 1
- VTHOKNTVYKTUPI-UHFFFAOYSA-N triethoxy-[3-(3-triethoxysilylpropyltetrasulfanyl)propyl]silane Chemical compound CCO[Si](OCC)(OCC)CCCSSSSCCC[Si](OCC)(OCC)OCC VTHOKNTVYKTUPI-UHFFFAOYSA-N 0.000 description 1
- XSIGLRIVXRKQRA-UHFFFAOYSA-N triethoxysilylmethanethiol Chemical compound CCO[Si](CS)(OCC)OCC XSIGLRIVXRKQRA-UHFFFAOYSA-N 0.000 description 1
- QJOOZNCPHALTKK-UHFFFAOYSA-N trimethoxysilylmethanethiol Chemical compound CO[Si](CS)(OC)OC QJOOZNCPHALTKK-UHFFFAOYSA-N 0.000 description 1
- UKRDPEFKFJNXQM-UHFFFAOYSA-N vinylsilane Chemical class [SiH3]C=C UKRDPEFKFJNXQM-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- WPZFNRZRCODGMX-UHFFFAOYSA-L zinc;ethoxymethanedithioate Chemical compound [Zn+2].CCOC([S-])=S.CCOC([S-])=S WPZFNRZRCODGMX-UHFFFAOYSA-L 0.000 description 1
- KMNUDJAXRXUZQS-UHFFFAOYSA-L zinc;n-ethyl-n-phenylcarbamodithioate Chemical compound [Zn+2].CCN(C([S-])=S)C1=CC=CC=C1.CCN(C([S-])=S)C1=CC=CC=C1 KMNUDJAXRXUZQS-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/54—Silicon-containing compounds
- C08K5/5406—Silicon-containing compounds containing elements other than oxygen or nitrogen
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2933345A DE2933345C2 (de) | 1979-08-17 | 1979-08-17 | Vulkanisierbare Kautschuk-Mischung auf Basis von halogenfreien Kautschuken und Verfahren zum Vulkanisieren dieser Kautschukmischungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH644143A5 true CH644143A5 (de) | 1984-07-13 |
Family
ID=6078678
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH618980A CH644143A5 (de) | 1979-08-17 | 1980-08-15 | Mischung auf basis von vulkanisierbarem, halogenfreiem kautschuk. |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4278587A (enExample) |
| JP (1) | JPS5836009B2 (enExample) |
| AR (1) | AR224650A1 (enExample) |
| AT (1) | AT379404B (enExample) |
| AU (1) | AU532295B2 (enExample) |
| BE (1) | BE884773A (enExample) |
| BR (1) | BR8005063A (enExample) |
| CA (1) | CA1161185A (enExample) |
| CH (1) | CH644143A5 (enExample) |
| DE (1) | DE2933345C2 (enExample) |
| ES (1) | ES494253A0 (enExample) |
| FR (1) | FR2463790A1 (enExample) |
| GB (1) | GB2056460B (enExample) |
| IN (1) | IN155262B (enExample) |
| IT (1) | IT1146235B (enExample) |
| LU (1) | LU82714A1 (enExample) |
| MY (1) | MY8500424A (enExample) |
| NL (1) | NL189141C (enExample) |
| SE (1) | SE448733B (enExample) |
| SG (1) | SG4684G (enExample) |
| ZA (1) | ZA804727B (enExample) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5667348A (en) * | 1979-11-08 | 1981-06-06 | Mitsuboshi Belting Ltd | Rubber composition |
| DE3314742C2 (de) * | 1983-04-23 | 1987-04-02 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von an der Oberfläche modifizierten natürlichen, oxidischen oder silikatischen Füllstoffen und deren Verwendung |
| US4522970A (en) * | 1984-06-25 | 1985-06-11 | The Goodyear Tire & Rubber Company | Tire with tread rubber containing medium vinyl polybutadiene with clay and carbon black |
| CA1284405C (en) * | 1986-01-13 | 1991-05-28 | Dow Corning Corporation | Mineral filled rubber composites |
| JPH0689180B2 (ja) * | 1986-05-27 | 1994-11-09 | バンドー化学株式会社 | 明色ゴム組成物 |
| JPS63245452A (ja) * | 1987-03-31 | 1988-10-12 | アクシュネット カンパニー | 飲料水と共に用いられるゴム組成物 |
| DE3720210A1 (de) * | 1987-06-17 | 1988-12-29 | Bayer Ag | Matte, elastisch-thermoplastische formmassen |
| DE69119125T3 (de) * | 1990-03-02 | 2001-01-11 | Bridgestone Corp., Tokio/Tokyo | Luftreifen |
| US20010005946A1 (en) * | 1991-05-07 | 2001-07-05 | Brown Jeffrey W. | Shock reducing footwear and method of manufacture |
| CA2104537A1 (en) * | 1993-06-18 | 1994-12-19 | Paul Harry Sandstrom | Silica reinforced rubber composition |
| US5394919A (en) * | 1993-06-18 | 1995-03-07 | The Goodyear Tire & Rubber Company | Tire with rubber/cord belt laminate |
| CA2104529A1 (en) * | 1993-06-18 | 1994-12-19 | Paul Harry Sandstrom | Tire with silica reinforced tread |
| CA2108763A1 (en) * | 1993-09-07 | 1995-03-08 | David John Zanzig | Tire with silica reinforced tread |
| KR100375043B1 (ko) * | 1994-11-30 | 2003-04-18 | 제온 코포레이션 | 가황성 고무조성물, 동적상태에서 사용되는 시일 및 그 재료 |
| US5719207A (en) * | 1996-03-18 | 1998-02-17 | The Goodyear Tire & Rubber Company | Silica reinforced rubber composition and tire with tread |
| DE19735813A1 (de) * | 1997-08-18 | 1999-02-25 | Wacker Chemie Gmbh | Kompressiblen Schwefel enthaltender Siliconkautschuk |
| CA2216062A1 (en) * | 1997-09-19 | 1999-03-19 | Bayer Inc. | Silica-containing rubber composition |
| US6230773B1 (en) * | 1998-03-17 | 2001-05-15 | The Goodyear Tire & Rubber Company | Tire with sidewall carcass reinforcement |
| US6114465A (en) * | 1998-04-24 | 2000-09-05 | Paguag Gmbh & Co. | Tear propagation-resistant rubber compound |
| US6147147A (en) * | 1998-05-08 | 2000-11-14 | Flow Polymers, Inc. | Coupling agent composition |
| DE60041630D1 (de) * | 1999-07-15 | 2009-04-09 | Arakawa Chem Ind | Enthaltend glycidylethergruppe partielles alkoxysilan-kondensat, silanmodifiziertes harz, zusammensetzung daraus und verfahren zu deren herstellung |
| DE10045166A1 (de) | 2000-09-13 | 2002-03-21 | Rhein Chemie Rheinau Gmbh | Kieselgelhaltige Kautschukcompounds mit Organosiliciumverbindungen als Compoundiermittel |
| DE10130500A1 (de) * | 2001-06-25 | 2003-01-09 | Degussa | Kautschukmischungen |
| US7288323B2 (en) * | 2003-11-13 | 2007-10-30 | Fisher Controls International, Llc | Vulcanized rubber composition and articles manufactured therefrom |
| DE102004061014A1 (de) * | 2004-12-18 | 2006-06-29 | Degussa Ag | Kautschukmischungen |
| DE102005038791A1 (de) * | 2005-08-17 | 2007-02-22 | Degussa Ag | Organosiliciumverbindungen, ihre Herstellung und ihre Verwendung |
| DE102005060122A1 (de) * | 2005-12-16 | 2007-06-21 | Degussa Gmbh | Verfahren zur Herstellung von (Mercaptoorganyl)alkylpolyethersilanen |
| DE102006027235A1 (de) * | 2006-06-09 | 2008-01-17 | Evonik Degussa Gmbh | Kautschukmischungen |
| US7595360B2 (en) * | 2006-11-30 | 2009-09-29 | The Goodyear Tire & Rubber Company | Rubber composition containing diene-based elastomer, precipitated silica, coupling agent and alcohol-adsorbing activated carbon and pneumatic tire with component |
| DE102008037593B4 (de) * | 2008-11-26 | 2021-04-22 | Continental Reifen Deutschland Gmbh | Kautschukmischung und deren Verwendung für Laufstreifen und Reifen |
| EP2771397A4 (en) | 2011-10-24 | 2015-06-10 | Bridgestone Americas Tire | SILICA-CHARGED RUBBER COMPOSITION AND METHOD FOR MANUFACTURING THE SAME |
| EP3954743A1 (de) | 2020-08-12 | 2022-02-16 | Evonik Operations GmbH | Verwendung von siliziumdioxid zur verbesserung der leitfähigkeit von beschichtungen |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1669954A1 (de) | 1951-01-28 | 1970-08-20 | Degussa | Verfahren zur Verbesserung der Gebrauchseigenschaften von Vulkanisaten |
| DE1298706B (de) | 1964-12-24 | 1969-07-03 | Degussa | Verfahren zum Vulkanisieren von verstaerkende Fuellstoffe enthaltenden synthetischen Kautschuken |
| AU2222370A (en) * | 1970-05-04 | 1972-05-18 | Dow Corning Corporation | Chloropropylsilane coupling agents |
| DE2029899A1 (de) | 1970-06-18 | 1971-12-30 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zum Vernetzen von Füllstoffen enthaltendem natürlichem und synthetischem Kautschuk bzw. diese enthaltenden Mischungen |
| FR2135520B1 (enExample) * | 1971-05-06 | 1973-05-11 | Sifrance | |
| BE787487A (fr) * | 1971-08-13 | 1973-02-12 | Ciba Geigy | Agents pour la regulation de la croissance des plantes |
| US3997356A (en) * | 1971-08-17 | 1976-12-14 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler | Reinforcing additive |
| US3873489A (en) * | 1971-08-17 | 1975-03-25 | Degussa | Rubber compositions containing silica and an organosilane |
| US3928406A (en) * | 1973-04-04 | 1975-12-23 | Amchem Prod | Plant growth regulant compositions and methods |
| DE2536674C3 (de) * | 1975-08-18 | 1979-09-27 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Vernetzbare Mischungen auf Basis von Kautschuk, Organosilanen und silikatischen Füllstoffen |
| DE2542534C3 (de) * | 1975-09-24 | 1979-08-02 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von schwefelhaltigen Organosiliciumverbindungen |
| CA1100659A (en) * | 1977-04-14 | 1981-05-05 | Douglas C. Edwards | Vulcanizates containing siliceous fillers |
| DE2819638C3 (de) * | 1978-05-05 | 1986-11-13 | Degussa Ag, 6000 Frankfurt | Vulkanisierbare Halogenkautschuk-Mischungen |
-
1979
- 1979-08-17 DE DE2933345A patent/DE2933345C2/de not_active Expired
-
1980
- 1980-07-23 NL NLAANVRAGE8004245,A patent/NL189141C/xx not_active IP Right Cessation
- 1980-08-04 ZA ZA00804727A patent/ZA804727B/xx unknown
- 1980-08-08 AU AU61182/80A patent/AU532295B2/en not_active Ceased
- 1980-08-08 IN IN910/CAL/80A patent/IN155262B/en unknown
- 1980-08-11 GB GB8026114A patent/GB2056460B/en not_active Expired
- 1980-08-12 BR BR8005063A patent/BR8005063A/pt not_active IP Right Cessation
- 1980-08-13 IT IT49485/80A patent/IT1146235B/it active
- 1980-08-13 BE BE6/47240A patent/BE884773A/fr not_active IP Right Cessation
- 1980-08-13 FR FR8017830A patent/FR2463790A1/fr active Granted
- 1980-08-14 ES ES494253A patent/ES494253A0/es active Granted
- 1980-08-14 AT AT0417980A patent/AT379404B/de not_active IP Right Cessation
- 1980-08-14 LU LU82714A patent/LU82714A1/de unknown
- 1980-08-14 JP JP55111159A patent/JPS5836009B2/ja not_active Expired
- 1980-08-14 US US06/178,160 patent/US4278587A/en not_active Expired - Lifetime
- 1980-08-15 AR AR282181A patent/AR224650A1/es active
- 1980-08-15 SE SE8005782A patent/SE448733B/sv not_active IP Right Cessation
- 1980-08-15 CA CA000358299A patent/CA1161185A/en not_active Expired
- 1980-08-15 CH CH618980A patent/CH644143A5/de not_active IP Right Cessation
-
1984
- 1984-01-18 SG SG46/84A patent/SG4684G/en unknown
-
1985
- 1985-12-30 MY MY424/85A patent/MY8500424A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2463790B1 (enExample) | 1984-04-27 |
| JPS5630445A (en) | 1981-03-27 |
| BR8005063A (pt) | 1981-02-24 |
| AR224650A1 (es) | 1981-12-30 |
| SE8005782L (sv) | 1981-04-03 |
| DE2933345C2 (de) | 1983-01-20 |
| ES8106920A1 (es) | 1981-09-01 |
| CA1161185A (en) | 1984-01-24 |
| US4278587A (en) | 1981-07-14 |
| AU532295B2 (en) | 1983-09-22 |
| BE884773A (fr) | 1981-02-13 |
| ZA804727B (en) | 1981-07-29 |
| NL8004245A (nl) | 1981-02-19 |
| NL189141C (nl) | 1993-01-18 |
| ATA417980A (de) | 1985-05-15 |
| SG4684G (en) | 1985-02-01 |
| IT8049485A0 (it) | 1980-08-13 |
| MY8500424A (en) | 1985-12-31 |
| AU6118280A (en) | 1981-02-19 |
| ES494253A0 (es) | 1981-09-01 |
| SE448733B (sv) | 1987-03-16 |
| JPS5836009B2 (ja) | 1983-08-06 |
| LU82714A1 (de) | 1982-05-10 |
| IN155262B (enExample) | 1985-01-12 |
| AT379404B (de) | 1986-01-10 |
| GB2056460A (en) | 1981-03-18 |
| IT1146235B (it) | 1986-11-12 |
| GB2056460B (en) | 1983-06-08 |
| FR2463790A1 (fr) | 1981-02-27 |
| DE2933345A1 (de) | 1981-02-26 |
| NL189141B (nl) | 1992-08-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH644143A5 (de) | Mischung auf basis von vulkanisierbarem, halogenfreiem kautschuk. | |
| EP1533336B1 (de) | Kautschukmischungen | |
| DE2933346C2 (de) | Silan/Füllstoff-Präparationen, Verfahren zu deren Herstellung und Anwendung derselben | |
| DE2819638C3 (de) | Vulkanisierbare Halogenkautschuk-Mischungen | |
| DE2536674C3 (de) | Vernetzbare Mischungen auf Basis von Kautschuk, Organosilanen und silikatischen Füllstoffen | |
| EP0731824B1 (de) | Verstärkungsadditive | |
| DE4023537A1 (de) | Mit organosiliciumverbindungen chemisch modifizierte russe, verfahren zu deren herstellung und deren verwendung | |
| EP1505126B1 (de) | Organische Thiocyanatgruppen enthaltender Russ | |
| EP1273634B1 (de) | Silanmodifizierter oxidischer oder silikatischer Füllstoff, Verfahren zu dessen Herstellung und dessen Verwendung | |
| EP3152253B1 (de) | Diphenylguanidin-freie kautschukmischungen enthaltend kurzkettige alkylester des glyzerins | |
| DE60306779T3 (de) | Organosilankonzentrat | |
| EP0992505A2 (de) | Sulfanylsilane | |
| DE19915281A1 (de) | Kautschukmischungen | |
| EP0126870A1 (de) | Vulkanisierbare Halogenkautschukmischungen und Verfahren zum Vulkanisieren bzw. Vernetzen | |
| EP1148092B1 (de) | Abmischungen von mindestens einem Füllstoff und Organosiliciumverbindungen, Verfahren zu deren Herstellung und deren Verwendung | |
| EP1754749B1 (de) | Kautschukmischungen | |
| DE102008037593B4 (de) | Kautschukmischung und deren Verwendung für Laufstreifen und Reifen | |
| DE102014200563A1 (de) | Oligomere Organosilane, deren Herstellung und Verwendung in Kautschukmischungen | |
| EP1094067B1 (de) | Organosiliciumverbindung, Verfahren zu ihrer Herstellung und deren Verwendung | |
| DE10163941C1 (de) | Organosiliciumverbindungen, ein Verfahren zu ihrer Herstellung, sowie ihre Verwendung | |
| DE4233197A1 (de) | Neue, zur Einführung von polaren Substituenten geeignete Vulkanisationsbeschleuniger | |
| EP1215235B1 (de) | Kautschukmischung und Kieselsäure für eine Kautschukmischung | |
| WO2024240312A1 (de) | Verbindung als alterungsschutzmittel in kautschukmischungen und fahrzeugreifen | |
| DE2255577C3 (de) | Verstärkungsadditive in vulkanisierbaren Kautschukmischungen | |
| WO2024240313A1 (de) | Verbindung als alterungsschutzmittel in kautschukmischungen und fahrzeugreifen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |