CH639065A5 - Process for the preparation of 1-isopropylamino-3-[4-(2-methoxy- ethyl)phenoxy]-2-propanol - Google Patents
Process for the preparation of 1-isopropylamino-3-[4-(2-methoxy- ethyl)phenoxy]-2-propanol Download PDFInfo
- Publication number
- CH639065A5 CH639065A5 CH301279A CH301279A CH639065A5 CH 639065 A5 CH639065 A5 CH 639065A5 CH 301279 A CH301279 A CH 301279A CH 301279 A CH301279 A CH 301279A CH 639065 A5 CH639065 A5 CH 639065A5
- Authority
- CH
- Switzerland
- Prior art keywords
- metoprolol
- propanol
- isopropylamino
- reaction
- phenoxy
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 26
- IUBSYMUCCVWXPE-UHFFFAOYSA-N metoprolol Chemical compound COCCC1=CC=C(OCC(O)CNC(C)C)C=C1 IUBSYMUCCVWXPE-UHFFFAOYSA-N 0.000 title claims abstract description 23
- 238000002360 preparation method Methods 0.000 title claims description 10
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims abstract description 35
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims abstract description 25
- 238000006243 chemical reaction Methods 0.000 claims abstract description 23
- 229960002237 metoprolol Drugs 0.000 claims abstract description 22
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims abstract description 19
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims abstract description 15
- 229910000033 sodium borohydride Inorganic materials 0.000 claims abstract description 14
- 239000012279 sodium borohydride Substances 0.000 claims abstract description 14
- 102000012740 beta Adrenergic Receptors Human genes 0.000 claims abstract description 8
- 108010079452 beta Adrenergic Receptors Proteins 0.000 claims abstract description 8
- 239000002253 acid Substances 0.000 claims abstract description 7
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 claims abstract description 6
- 239000012442 inert solvent Substances 0.000 claims abstract description 6
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 claims abstract description 5
- 150000003839 salts Chemical class 0.000 claims abstract description 5
- 239000002904 solvent Substances 0.000 claims abstract description 5
- 239000002876 beta blocker Substances 0.000 claims abstract description 3
- 210000004204 blood vessel Anatomy 0.000 claims abstract description 3
- 229940030602 cardiac therapy drug Drugs 0.000 claims abstract description 3
- 230000003197 catalytic effect Effects 0.000 claims abstract description 3
- 239000003814 drug Substances 0.000 claims abstract description 3
- 210000004072 lung Anatomy 0.000 claims abstract description 3
- 239000000543 intermediate Substances 0.000 claims description 16
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 13
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims description 10
- 238000004519 manufacturing process Methods 0.000 claims description 7
- -1 methoxymethylcarbonyl Chemical group 0.000 claims description 7
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 5
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 3
- QJHVDSYWXROTEP-UHFFFAOYSA-N 1-[4-(2-methoxyethyl)phenoxy]propan-2-ol Chemical compound COCCC1=CC=C(OCC(C)O)C=C1 QJHVDSYWXROTEP-UHFFFAOYSA-N 0.000 claims description 2
- 239000012445 acidic reagent Substances 0.000 claims description 2
- 208000006673 asthma Diseases 0.000 claims description 2
- 229940079593 drug Drugs 0.000 claims description 2
- 230000000694 effects Effects 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical group CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 claims description 2
- 150000003152 propanolamines Chemical class 0.000 claims description 2
- 102000005962 receptors Human genes 0.000 claims description 2
- 108020003175 receptors Proteins 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 abstract description 4
- CLTYDMIYCODWLE-UHFFFAOYSA-N 1-[4-(3-chloro-2-hydroxypropoxy)phenyl]-2-methoxyethanone Chemical compound ClCC(COC1=CC=C(C=C1)C(=O)COC)O CLTYDMIYCODWLE-UHFFFAOYSA-N 0.000 abstract 1
- CYGMBGZUOIIVSF-UHFFFAOYSA-N 1-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-2-methoxyethanone Chemical compound COCC(=O)C1=CC=C(OCC(O)CNC(C)C)C=C1 CYGMBGZUOIIVSF-UHFFFAOYSA-N 0.000 abstract 1
- 230000000903 blocking effect Effects 0.000 abstract 1
- 239000012467 final product Substances 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229940098779 methanesulfonic acid Drugs 0.000 description 9
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 5
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000002329 infrared spectrum Methods 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 150000008062 acetophenones Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- QWXYZCJEXYQNEI-OSZHWHEXSA-N intermediate I Chemical compound COC(=O)[C@@]1(C=O)[C@H]2CC=[N+](C\C2=C\C)CCc2c1[nH]c1ccccc21 QWXYZCJEXYQNEI-OSZHWHEXSA-N 0.000 description 2
- 125000000468 ketone group Chemical group 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- DWPLEOPKBWNPQV-UHFFFAOYSA-N 1-(2-methoxyphenyl)ethanone Chemical compound COC1=CC=CC=C1C(C)=O DWPLEOPKBWNPQV-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- 238000006471 dimerization reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000003670 easy-to-clean Effects 0.000 description 1
- 150000005194 ethylbenzenes Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229960001300 metoprolol tartrate Drugs 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003458 sulfonic acid derivatives Chemical class 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- WUBVEMGCQRSBBT-UHFFFAOYSA-N tert-butyl 4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2h-pyridine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(OS(=O)(=O)C(F)(F)F)=CC1 WUBVEMGCQRSBBT-UHFFFAOYSA-N 0.000 description 1
- 239000012485 toluene extract Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/28—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines
- C07C217/30—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring
- C07C217/32—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/84—Ketones containing a keto group bound to a six-membered aromatic ring containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI781001A FI59392C (fi) | 1978-04-01 | 1978-04-01 | Foerfarande foer framstaellning av terapeutiskt aktiv 1-isopropylamino-3-(4-(2-metoxietyl)fenoxi)-2-propanol samt dess syraadditionssalter |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH639065A5 true CH639065A5 (en) | 1983-10-31 |
Family
ID=8511594
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH301279A CH639065A5 (en) | 1978-04-01 | 1979-03-30 | Process for the preparation of 1-isopropylamino-3-[4-(2-methoxy- ethyl)phenoxy]-2-propanol |
Country Status (8)
| Country | Link |
|---|---|
| JP (1) | JPS54145623A (enrdf_load_stackoverflow) |
| AT (1) | AT364349B (enrdf_load_stackoverflow) |
| CH (1) | CH639065A5 (enrdf_load_stackoverflow) |
| DK (1) | DK145195C (enrdf_load_stackoverflow) |
| FI (1) | FI59392C (enrdf_load_stackoverflow) |
| NL (1) | NL7902407A (enrdf_load_stackoverflow) |
| NO (1) | NO145402C (enrdf_load_stackoverflow) |
| SE (1) | SE444677B (enrdf_load_stackoverflow) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI59985C (fi) * | 1980-05-26 | 1982-01-08 | Farmos Oy | Foerfarande foer framstaellning av terapeutiskt aktiv 1-isopropylamino-3-(4-(2-metoxietyl)fenoxi)-2-propanol samt dess syra-additionssalter |
-
1978
- 1978-04-01 FI FI781001A patent/FI59392C/fi not_active IP Right Cessation
-
1979
- 1979-03-12 NO NO790825A patent/NO145402C/no unknown
- 1979-03-15 AT AT0196479A patent/AT364349B/de not_active IP Right Cessation
- 1979-03-28 NL NL7902407A patent/NL7902407A/xx not_active Application Discontinuation
- 1979-03-29 SE SE7902821A patent/SE444677B/sv not_active IP Right Cessation
- 1979-03-30 DK DK131079A patent/DK145195C/da not_active IP Right Cessation
- 1979-03-30 JP JP3923679A patent/JPS54145623A/ja active Granted
- 1979-03-30 CH CH301279A patent/CH639065A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SE7902821L (sv) | 1979-10-02 |
| DK131079A (da) | 1979-10-02 |
| SE444677B (sv) | 1986-04-28 |
| AT364349B (de) | 1981-10-12 |
| NO790825L (no) | 1979-10-02 |
| DK145195B (da) | 1982-10-04 |
| ATA196479A (de) | 1981-03-15 |
| NO145402C (no) | 1982-03-17 |
| FI59392B (fi) | 1981-04-30 |
| NL7902407A (nl) | 1979-10-03 |
| FI59392C (fi) | 1982-02-02 |
| FI781001A7 (fi) | 1979-10-02 |
| JPS6130653B2 (enrdf_load_stackoverflow) | 1986-07-15 |
| DK145195C (da) | 1983-04-05 |
| JPS54145623A (en) | 1979-11-14 |
| NO145402B (no) | 1981-12-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE68923250T2 (de) | Chalcon-Derivate und Verfahren zu deren Herstellung. | |
| NO161467B (no) | Isolerende belegg. | |
| DE112007000790T5 (de) | Einstufiges mikrowelleninduziertes Verfahren zur Herstellung von substituierten Stilbenen und deren Analoga | |
| DE1543181A1 (de) | -phenylessigsaeuren und Verfahren zu deren Herstellung | |
| DE2310141A1 (de) | Verfahren zur herstellung von 1phenyl-2-aminoaethanolderivaten | |
| DE69412598T2 (de) | Formylierungsverfahren für aromatische aldehyde | |
| CH639065A5 (en) | Process for the preparation of 1-isopropylamino-3-[4-(2-methoxy- ethyl)phenoxy]-2-propanol | |
| DE2360318B2 (de) | 1-phenyl-2-propanon-derivate und ihre herstellung | |
| DE2332707A1 (de) | Tricyclische tetrahydronaphthalinderivate, ihre salze, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2461069A1 (de) | Neue cholesterinsenkende verbindungen | |
| DE69001397T2 (de) | Sulfoniertes Polystyrol. | |
| DE2914166A1 (de) | Arylsubstituierte furane und verfahren zu ihrer herstellung | |
| DE2360317C3 (de) | Zwischenprodukte für neue Phenyläthylaminderivate und Verfahren zu deren Herstellung | |
| DE2123319A1 (de) | S-Sulfonamido^-hydroxyphenyl^piperidylcarbinole, Verfahren zu ihrer Herstellung und Arzeneipräparate | |
| DE2047937A1 (de) | Hydroxyphenyl 2 pipendtnylcarbi nole und ihre Verwendung in Arzneimitteln | |
| DE1959513C3 (enrdf_load_stackoverflow) | ||
| DE1695499A1 (de) | Phenoxyaminoalkanole und Verfahren zu deren Herstellung | |
| AT346838B (de) | Verfahren zur herstellung von neuen optisch aktiven anthracyclinonen | |
| DE1518020C (de) | 4 (4 Chlorphenoxy) 3 hydroxy 4 methylvaleriansaure, deren Niedrig alkylester und physiologisch vertrag liehen Salze, Verfahren zu deren Her stellung sowie diese Verbindungen enthaltende Arzneimittel | |
| DE2024614C3 (de) | Neues Verfahren zur Herstellung von d-trans-Pyrethrinsäure-(1R.2R) | |
| DE2004818C3 (de) | Basisch substituierte Chinobenzazepine | |
| DE2362877A1 (de) | 5,8-dihydro-5,8-methanonaphthaline mit kardiovaskulaerer wirkung | |
| DE69129341T2 (de) | Verfahren zur Herstellung von 5-oxohexannitrilen und die Verbindung 2,4-dimethyl-5-oxo-hexannitrile | |
| DE1445996A1 (de) | Benzylpiperidyl-ketone | |
| AT214450B (de) | Verfahren zur Herstellung von d-2-Phenyl-3-methyltetrahydro-1,4-oxazin |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |