CH638489A5 - Process for preparing and isolating haloacylamides - Google Patents
Process for preparing and isolating haloacylamides Download PDFInfo
- Publication number
- CH638489A5 CH638489A5 CH1612577A CH1612577A CH638489A5 CH 638489 A5 CH638489 A5 CH 638489A5 CH 1612577 A CH1612577 A CH 1612577A CH 1612577 A CH1612577 A CH 1612577A CH 638489 A5 CH638489 A5 CH 638489A5
- Authority
- CH
- Switzerland
- Prior art keywords
- compound
- formula
- reaction
- product
- alkyl
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 103
- 238000000034 method Methods 0.000 claims description 96
- 238000006243 chemical reaction Methods 0.000 claims description 59
- 239000000047 product Substances 0.000 claims description 53
- 150000001875 compounds Chemical class 0.000 claims description 48
- 230000008569 process Effects 0.000 claims description 48
- 239000006227 byproduct Substances 0.000 claims description 43
- -1 polyalkoxy Chemical group 0.000 claims description 39
- 239000002253 acid Substances 0.000 claims description 35
- 239000011230 binding agent Substances 0.000 claims description 32
- XCSGPAVHZFQHGE-UHFFFAOYSA-N alachlor Chemical compound CCC1=CC=CC(CC)=C1N(COC)C(=O)CCl XCSGPAVHZFQHGE-UHFFFAOYSA-N 0.000 claims description 30
- 238000000926 separation method Methods 0.000 claims description 26
- 229910052739 hydrogen Inorganic materials 0.000 claims description 25
- 239000001257 hydrogen Substances 0.000 claims description 25
- 239000000203 mixture Substances 0.000 claims description 24
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 22
- 239000012433 hydrogen halide Substances 0.000 claims description 22
- 150000002431 hydrogen Chemical group 0.000 claims description 18
- 239000011541 reaction mixture Substances 0.000 claims description 18
- 125000003545 alkoxy group Chemical group 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 14
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- PDQMMZXYWKOZHY-UHFFFAOYSA-N 2-chloro-n-(chloromethyl)-n-(2,6-diethylphenyl)acetamide Chemical compound CCC1=CC=CC(CC)=C1N(CCl)C(=O)CCl PDQMMZXYWKOZHY-UHFFFAOYSA-N 0.000 claims description 11
- 150000002367 halogens Chemical group 0.000 claims description 11
- 125000001188 haloalkyl group Chemical group 0.000 claims description 9
- 238000011084 recovery Methods 0.000 claims description 7
- 125000000304 alkynyl group Chemical group 0.000 claims description 6
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 claims description 6
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 239000012535 impurity Substances 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 2
- 125000005188 oxoalkyl group Chemical group 0.000 claims description 2
- 238000000526 short-path distillation Methods 0.000 claims 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 2
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 claims 1
- KJRMSQTZYYYYAI-UHFFFAOYSA-N 2-chloro-N-(methoxymethyl)-N-phenylbutanamide Chemical compound C(C)C(C(=O)N(C1=CC=CC=C1)COC)Cl KJRMSQTZYYYYAI-UHFFFAOYSA-N 0.000 claims 1
- UEKQGZQLUMSLNW-UHFFFAOYSA-N Propyl isome Chemical group C1=C2C(C(=O)OCCC)C(C(=O)OCCC)C(C)CC2=CC2=C1OCO2 UEKQGZQLUMSLNW-UHFFFAOYSA-N 0.000 claims 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 1
- 229910052717 sulfur Inorganic materials 0.000 claims 1
- 239000011593 sulfur Substances 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 21
- 239000007858 starting material Substances 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 12
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 12
- 239000000376 reactant Substances 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 238000004458 analytical method Methods 0.000 description 11
- 239000000543 intermediate Substances 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- LBJVHMAYBNQJBK-UHFFFAOYSA-N N-(2,6-diethylphenyl)-2-chloroacetamide Chemical compound CCC1=CC=CC(CC)=C1NC(=O)CCl LBJVHMAYBNQJBK-UHFFFAOYSA-N 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 10
- 239000003921 oil Substances 0.000 description 9
- 235000019198 oils Nutrition 0.000 description 9
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 230000008901 benefit Effects 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 230000002411 adverse Effects 0.000 description 4
- 238000006136 alcoholysis reaction Methods 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 238000004817 gas chromatography Methods 0.000 description 4
- 238000005292 vacuum distillation Methods 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000002363 herbicidal effect Effects 0.000 description 3
- 239000004009 herbicide Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- 239000002994 raw material Substances 0.000 description 3
- 150000003334 secondary amides Chemical class 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- 239000002699 waste material Substances 0.000 description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 2
- IBYHHJPAARCAIE-UHFFFAOYSA-N 1-bromo-2-chloroethane Chemical compound ClCCBr IBYHHJPAARCAIE-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 244000248349 Citrus limon Species 0.000 description 2
- 235000005979 Citrus limon Nutrition 0.000 description 2
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 235000019501 Lemon oil Nutrition 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229960001413 acetanilide Drugs 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000005998 bromoethyl group Chemical group 0.000 description 2
- 125000005997 bromomethyl group Chemical group 0.000 description 2
- 238000001311 chemical methods and process Methods 0.000 description 2
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 150000003949 imides Chemical class 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 239000010501 lemon oil Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- KGMBZDZHRAFLBY-UHFFFAOYSA-N n-(butoxymethyl)-n-(2-tert-butyl-6-methylphenyl)-2-chloroacetamide Chemical compound CCCCOCN(C(=O)CCl)C1=C(C)C=CC=C1C(C)(C)C KGMBZDZHRAFLBY-UHFFFAOYSA-N 0.000 description 2
- 239000012038 nucleophile Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 125000000467 secondary amino group Chemical class [H]N([*:1])[*:2] 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002910 solid waste Substances 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- RXTJLDXSGNEJIT-UHFFFAOYSA-N 2,3-dihydro-1h-inden-4-amine Chemical class NC1=CC=CC2=C1CCC2 RXTJLDXSGNEJIT-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- PXOJBWMHNNIZLL-UHFFFAOYSA-N 2-chloro-n-(2,3-dihydro-1h-inden-1-yl)acetamide Chemical compound C1=CC=C2C(NC(=O)CCl)CCC2=C1 PXOJBWMHNNIZLL-UHFFFAOYSA-N 0.000 description 1
- DHXHYNLRZAZSIA-UHFFFAOYSA-N 2-chloro-n-(2,6-diethylphenyl)-n-(2-methylpropoxymethyl)acetamide Chemical compound CCC1=CC=CC(CC)=C1N(COCC(C)C)C(=O)CCl DHXHYNLRZAZSIA-UHFFFAOYSA-N 0.000 description 1
- YJKIMPGVENGVLV-UHFFFAOYSA-N 2-chloro-n-(2,6-diethylphenyl)-n-(propoxymethyl)acetamide Chemical compound CCCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC YJKIMPGVENGVLV-UHFFFAOYSA-N 0.000 description 1
- KDAONRFIZGAYNS-UHFFFAOYSA-N 2-chloro-n-(chloromethyl)-n-methylacetamide Chemical compound ClCN(C)C(=O)CCl KDAONRFIZGAYNS-UHFFFAOYSA-N 0.000 description 1
- PCJKDSWECWZMRV-UHFFFAOYSA-N 2-chloro-n-(chloromethyl)-n-phenylacetamide Chemical compound ClCC(=O)N(CCl)C1=CC=CC=C1 PCJKDSWECWZMRV-UHFFFAOYSA-N 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- ZXNMIUJDTOMBPV-UHFFFAOYSA-N 2-chloroethyl 4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(=O)(=O)OCCCl)C=C1 ZXNMIUJDTOMBPV-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- MNPZAJNFNOOTGE-UHFFFAOYSA-N 3-chloro-4-methyl-3-propan-2-ylcyclohexa-1,5-diene-1-sulfonic acid Chemical compound CC1C=CC(=CC1(C(C)C)Cl)S(=O)(=O)O MNPZAJNFNOOTGE-UHFFFAOYSA-N 0.000 description 1
- SODWJACROGQSMM-UHFFFAOYSA-N 5,6,7,8-tetrahydronaphthalen-1-amine Chemical class C1CCCC2=C1C=CC=C2N SODWJACROGQSMM-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 101100128278 Mus musculus Lins1 gene Proteins 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000004848 alkoxyethyl group Chemical group 0.000 description 1
- 125000004849 alkoxymethyl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- QFFVPLLCYGOFPU-UHFFFAOYSA-N barium chromate Chemical compound [Ba+2].[O-][Cr]([O-])(=O)=O QFFVPLLCYGOFPU-UHFFFAOYSA-N 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- HKPHPIREJKHECO-UHFFFAOYSA-N butachlor Chemical compound CCCCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC HKPHPIREJKHECO-UHFFFAOYSA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 229920005556 chlorobutyl Polymers 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000001485 cycloalkadienyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- 125000001162 cycloheptenyl group Chemical class C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical class C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 150000001941 cyclopentenes Chemical class 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000003493 decenyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 125000004982 dihaloalkyl group Chemical group 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 125000003784 fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 125000006372 monohalo methyl group Chemical group 0.000 description 1
- 125000006682 monohaloalkyl group Chemical group 0.000 description 1
- 238000003541 multi-stage reaction Methods 0.000 description 1
- IQQROELYZODUGM-UHFFFAOYSA-N n,2-dichloro-n-methylacetamide Chemical compound CN(Cl)C(=O)CCl IQQROELYZODUGM-UHFFFAOYSA-N 0.000 description 1
- PULRDMISSGAJIT-UHFFFAOYSA-N n-(2-tert-butyl-6-ethylphenyl)-2-chloro-n-(chloromethyl)acetamide Chemical compound CCC1=CC=CC(C(C)(C)C)=C1N(CCl)C(=O)CCl PULRDMISSGAJIT-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000005187 nonenyl group Chemical group C(=CCCCCCCC)* 0.000 description 1
- 125000004365 octenyl group Chemical group C(=CCCCCCC)* 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000005815 pentoxymethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 125000005767 propoxymethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])[#8]C([H])([H])* 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003254 radicals Chemical group 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000007039 two-step reaction Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/02—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Treatment Of Liquids With Adsorbents In General (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Hydrogenated Pyridines (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US75527976A | 1976-12-29 | 1976-12-29 | |
| US84454277A | 1977-10-26 | 1977-10-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH638489A5 true CH638489A5 (en) | 1983-09-30 |
Family
ID=27116061
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1612577A CH638489A5 (en) | 1976-12-29 | 1977-12-28 | Process for preparing and isolating haloacylamides |
Country Status (30)
| Country | Link |
|---|---|
| JP (1) | JPS53101312A (enExample) |
| AR (1) | AR228123A1 (enExample) |
| AT (1) | AT359996B (enExample) |
| AU (1) | AU515013B2 (enExample) |
| BG (1) | BG31363A3 (enExample) |
| BR (2) | BR7708771A (enExample) |
| CA (1) | CA1140590A (enExample) |
| CH (1) | CH638489A5 (enExample) |
| DD (1) | DD134085A5 (enExample) |
| DE (1) | DE2758418A1 (enExample) |
| DK (1) | DK149196C (enExample) |
| ES (1) | ES465723A1 (enExample) |
| FR (1) | FR2376126A1 (enExample) |
| GB (1) | GB1587851A (enExample) |
| GR (1) | GR66096B (enExample) |
| IE (1) | IE46287B1 (enExample) |
| IL (1) | IL53711A0 (enExample) |
| IT (1) | IT1090371B (enExample) |
| LU (1) | LU78777A1 (enExample) |
| MX (1) | MX6258E (enExample) |
| MY (1) | MY8400362A (enExample) |
| NL (1) | NL7714405A (enExample) |
| NO (1) | NO147303C (enExample) |
| NZ (1) | NZ186106A (enExample) |
| PL (1) | PL121520B1 (enExample) |
| PT (1) | PT67465B (enExample) |
| RO (1) | RO83713B (enExample) |
| SE (1) | SE441182B (enExample) |
| TR (1) | TR19809A (enExample) |
| YU (1) | YU41581B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU177876B (en) * | 1979-04-24 | 1982-01-28 | Nitrokemia Ipartelepek | Process for preparing 2,6-dialkyl-n-/alkoxy-methyl/-chloro-acetanilide derivatives |
| US4311858A (en) * | 1980-12-01 | 1982-01-19 | Monsanto Company | Process for producing N-(halomethyl) acyl-amides |
| DE3569523D1 (de) * | 1984-09-03 | 1989-05-24 | Ciba Geigy Ag | N-(substituted-alkyl) dichloroacetamide derivatives |
| CN116178199A (zh) * | 2022-12-04 | 2023-05-30 | 辽阳恒业化工有限公司 | 一种n-氯乙酰苯胺类除草剂的制备方法 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA867769A (en) * | 1971-04-06 | Farbenfabriken Bayer Aktiengesellschaft | Fluoracylamino-trichloromethyl-methane derivatives | |
| US2863752A (en) * | 1953-10-30 | 1958-12-09 | Monsanto Chemicals | Herbicides |
| US3287106A (en) * | 1963-11-15 | 1966-11-22 | Monsanto Co | Method for inhibiting the growth of grass type weeds |
| US3442945A (en) * | 1967-05-22 | 1969-05-06 | Monsanto Co | Phytotoxic alpha-halo-acetanilides |
| US3574746A (en) * | 1967-06-05 | 1971-04-13 | Monsanto Co | N-(cycloalken-1-yl) alpha-haloacetamides |
| DE1903198A1 (de) * | 1969-01-23 | 1970-08-06 | Basf Ag | Substituierte Anilide |
| US3547620A (en) * | 1969-01-23 | 1970-12-15 | Monsanto Co | N-(oxamethyl)alpha-halo-acetanilide herbicides |
| US3637847A (en) * | 1969-09-03 | 1972-01-25 | Monsanto Co | N-haloalkyl-anilides |
| BE795197A (fr) * | 1972-02-11 | 1973-08-09 | Ciba Geigy | Acylamines d'hydrocarbures bicycliques agissant sur la croissance des plantes |
-
1976
- 1976-12-29 ES ES465723A patent/ES465723A1/es not_active Expired
-
1977
- 1977-12-16 MX MX776727U patent/MX6258E/es unknown
- 1977-12-22 NZ NZ186106A patent/NZ186106A/xx unknown
- 1977-12-23 AU AU32015/77A patent/AU515013B2/en not_active Expired
- 1977-12-27 NL NL7714405A patent/NL7714405A/xx not_active Application Discontinuation
- 1977-12-28 CA CA000294001A patent/CA1140590A/en not_active Expired
- 1977-12-28 LU LU78777A patent/LU78777A1/xx unknown
- 1977-12-28 BG BG038247A patent/BG31363A3/xx unknown
- 1977-12-28 IT IT31350/77A patent/IT1090371B/it active
- 1977-12-28 DK DK582177A patent/DK149196C/da active
- 1977-12-28 FR FR7739526A patent/FR2376126A1/fr active Granted
- 1977-12-28 PT PT67465A patent/PT67465B/pt unknown
- 1977-12-28 IL IL53711A patent/IL53711A0/xx not_active IP Right Cessation
- 1977-12-28 AT AT935977A patent/AT359996B/de not_active IP Right Cessation
- 1977-12-28 GB GB53977/77A patent/GB1587851A/en not_active Expired
- 1977-12-28 AR AR270542A patent/AR228123A1/es active
- 1977-12-28 DD DD77202986A patent/DD134085A5/xx unknown
- 1977-12-28 RO RO92701A patent/RO83713B/ro unknown
- 1977-12-28 DE DE19772758418 patent/DE2758418A1/de active Granted
- 1977-12-28 JP JP15750477A patent/JPS53101312A/ja active Granted
- 1977-12-28 YU YU3142/77A patent/YU41581B/xx unknown
- 1977-12-28 BR BR7708771A patent/BR7708771A/pt unknown
- 1977-12-28 BR BR7708711A patent/BR7708711A/pt unknown
- 1977-12-28 CH CH1612577A patent/CH638489A5/de not_active IP Right Cessation
- 1977-12-28 GR GR55054A patent/GR66096B/el unknown
- 1977-12-28 NO NO774478A patent/NO147303C/no unknown
- 1977-12-29 SE SE7714872A patent/SE441182B/sv not_active IP Right Cessation
- 1977-12-29 PL PL1977203537A patent/PL121520B1/pl not_active IP Right Cessation
- 1977-12-29 IE IE2631/77A patent/IE46287B1/en not_active IP Right Cessation
-
1979
- 1979-12-28 TR TR19809A patent/TR19809A/xx unknown
-
1984
- 1984-12-30 MY MY362/84A patent/MY8400362A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2900231C2 (de) | Verfahren zur Herstellung von N,N- Diäthyl-m-toluamid durch katalytische Reaktion von m-Toluylsäure mit Diäthylamin in flüssiger Phase | |
| EP3663284B1 (de) | Verbessertes verfahren zur herstellung von triacetonamin | |
| EP0025843B1 (de) | Herstellung von Monoalkylethern von Hydroxyphenolen und deren Umwandlung zu Hydroxycumaranen | |
| EP1266904B1 (de) | Verbessertes Verfahren zur Herstellung kernfluorierter Aromaten | |
| EP0697406B1 (de) | Verfahren zur Herstellung von 4,6-Dichlor- oder 2,4,6-Trichlorpyrimidin aus 4,6-Dihydroxypyrimidin oder Barbitursäure | |
| EP0068219B1 (de) | Verfahren zur Herstellung von Carbonsäuren und N-tert. Alkylaminen | |
| DE69100196T2 (de) | Verfahren zur Herstellung von Benzylaminen. | |
| CH638489A5 (en) | Process for preparing and isolating haloacylamides | |
| EP0735016B1 (de) | Verfahren zur Herstellung von Alpha-Chloralkylarylketonen | |
| CH647500A5 (de) | Verfahren zur herstellung von 2',6'-dialkyl-n-(alkoxymethyl)-2-chloracetaniliden. | |
| DE69220221T2 (de) | Verfahren zur durchfuehrung von chemischen reaktionen mit formaldehyd | |
| DE69410031T2 (de) | Verfahren zur Herstellung von Lösungen von Dichlorglyoxime in organischen Lösungsmitteln | |
| DE69914361T2 (de) | Verfahren zur herstellung von tris(äther-aminen) | |
| DE69604513T2 (de) | Verfahren zur Herstellung substituierter Carbodiimide | |
| DE2756560C2 (de) | Verfahren zur Herstellung von Piperonal | |
| DE69308817T2 (de) | Verfahren zur herstellung von n-monosubstituiertem methacrylamid | |
| DE2443142C2 (de) | Verfahren zur Herstellung von Cyclopropancarbonsäurenitril | |
| DE69910867T2 (de) | Verbessertes Verfahren zur Herstellung von Chloroalkylen und Alkynylaminen | |
| DE3043230A1 (de) | Herstellung von monoalkylaethern von hydroxyphenolen | |
| DE69115758T2 (de) | Verfahren zur Herstellung von 3,5-Difluoranilin und dessen Derivat | |
| DE2950386C2 (de) | Verfahren zur Herstellung von Polymethylenpolyphenylpolycarbamaten | |
| DE2743610C3 (de) | Verfahren zur Herstellung von chlorsubstituierten aromatischen Aminen | |
| DE2737299C2 (de) | Verfahren zur Gewinnung von reinem 3-Phenoxybenzaldehyd | |
| DE69014683T2 (de) | Verfahren zur Herstellung von Lithium-Diphenylphosphino-phenyl-m-sulfonat. | |
| DE60317626T2 (de) | Verfahren zur herstellung von 2,5-bis(trifluormethyl)nitrobenzol |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |