CH636351A5 - Verfahren zur herstellung von 3-amino-isoxazolen. - Google Patents
Verfahren zur herstellung von 3-amino-isoxazolen. Download PDFInfo
- Publication number
- CH636351A5 CH636351A5 CH602778A CH602778A CH636351A5 CH 636351 A5 CH636351 A5 CH 636351A5 CH 602778 A CH602778 A CH 602778A CH 602778 A CH602778 A CH 602778A CH 636351 A5 CH636351 A5 CH 636351A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- yield
- amino
- acid
- aminoisoxazoles
- Prior art date
Links
- RHFWLPWDOYJEAL-UHFFFAOYSA-N 1,2-oxazol-3-amine Chemical class NC=1C=CON=1 RHFWLPWDOYJEAL-UHFFFAOYSA-N 0.000 title description 9
- 238000004519 manufacturing process Methods 0.000 title description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 238000000034 method Methods 0.000 description 23
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- -1 imine salt Chemical class 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- GGXGVZJHUKEJHO-UHFFFAOYSA-N 5-tert-butyl-1,2-oxazol-3-amine Chemical compound CC(C)(C)C1=CC(N)=NO1 GGXGVZJHUKEJHO-UHFFFAOYSA-N 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- MXZMACXOMZKYHJ-UHFFFAOYSA-N 4,4-dimethyl-3-oxopentanenitrile Chemical compound CC(C)(C)C(=O)CC#N MXZMACXOMZKYHJ-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- IAXWZYXUKABJAN-UHFFFAOYSA-N 1,2-oxazol-5-amine Chemical class NC1=CC=NO1 IAXWZYXUKABJAN-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 125000004414 alkyl thio group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 125000005059 halophenyl group Chemical group 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 150000002923 oximes Chemical class 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 238000006798 ring closing metathesis reaction Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- ZNBNBTIDJSKEAM-UHFFFAOYSA-N 4-[7-hydroxy-2-[5-[5-[6-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-2,8-dimethyl-1,10-dioxaspiro[4.5]decan-9-yl]-2-methyl-3-propanoyloxypentanoic acid Chemical compound C1C(O)C(C)C(C(C)C(OC(=O)CC)C(C)C(O)=O)OC11OC(C)(C2OC(C)(CC2)C2C(CC(O2)C2C(CC(C)C(O)(CO)O2)C)C)CC1 ZNBNBTIDJSKEAM-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910000378 hydroxylammonium sulfate Inorganic materials 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- UTBQYHCOLZCUGD-UHFFFAOYSA-N methyl 4,4-dimethyl-3-oxopentanimidate;hydrochloride Chemical compound Cl.COC(=N)CC(=O)C(C)(C)C UTBQYHCOLZCUGD-UHFFFAOYSA-N 0.000 description 2
- SUNMBRGCANLOEG-UHFFFAOYSA-N monochloromethyl ketone Natural products ClCC(=O)CCl SUNMBRGCANLOEG-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- JSUCOYAWYDJVLG-UHFFFAOYSA-N 1-amino-1-methoxy-4,4-dimethylpent-1-en-3-one Chemical compound COC(N)=CC(=O)C(C)(C)C JSUCOYAWYDJVLG-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical class CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 229910017912 NH2OH Inorganic materials 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- BICAGYDGRXJYGD-UHFFFAOYSA-N hydrobromide;hydrochloride Chemical compound Cl.Br BICAGYDGRXJYGD-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- HZVPJXOQDCOJRJ-UHFFFAOYSA-N isoxazolin-5-one Chemical compound O=C1C=CNO1 HZVPJXOQDCOJRJ-UHFFFAOYSA-N 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- YZJPZEOHCFTNNV-UHFFFAOYSA-N methyl 4,4-dimethyl-3-oxopentanimidate Chemical compound COC(=N)CC(=O)C(C)(C)C YZJPZEOHCFTNNV-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003839 salts Chemical group 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical compound [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/14—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP52068173A JPS5927343B2 (ja) | 1977-06-08 | 1977-06-08 | 3−アミノイソオキサゾ−ル類の合成法 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH636351A5 true CH636351A5 (de) | 1983-05-31 |
Family
ID=13366106
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH602778A CH636351A5 (de) | 1977-06-08 | 1978-06-01 | Verfahren zur herstellung von 3-amino-isoxazolen. |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4200757A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5927343B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1089473A (cg-RX-API-DMAC7.html) |
| CH (1) | CH636351A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2825194A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2393796A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1582725A (cg-RX-API-DMAC7.html) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1152349B (de) * | 1960-08-12 | 1963-08-01 | Kiwi Polish Co Pty Ltd | Vorrichtung zum gleichzeitigen Ausstanzen und Auflegen eines Deckblattes, z. B. aus Aluminiumfolie, auf die glatte Oberflaeche gefuellter Dosen od. dgl. |
| US4394510A (en) * | 1981-02-02 | 1983-07-19 | Eli Lilly And Company | Process for preparing an isoxazolylurea |
| FI832754A7 (fi) * | 1982-08-09 | 1984-02-10 | Ppg Industries Inc | Menetelmä 3-amino-5- (substituoitu)isoksatsolin valmistamiseksi. |
| IL80260A0 (en) * | 1986-10-09 | 1987-01-30 | Bromine Compounds Ltd | Process for the manufacture of 3-amino-5-methylisoxazole |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD29481A (cg-RX-API-DMAC7.html) * | ||||
| DE1154482B (de) * | 1958-09-20 | 1963-09-19 | Shionogi & Co | Verfahren zur Herstellung von 3-Aminoisoxazolen |
| US3157669A (en) * | 1962-07-17 | 1964-11-17 | Hoffmann La Roche | Preparation of isoxazole compounds |
| CH421963A (de) * | 1963-08-06 | 1966-10-15 | Hoffmann La Roche | Verfahren zur Herstellung von Aminoisoxazolen |
| US3435047A (en) * | 1964-09-14 | 1969-03-25 | Sankyo Co | Process for preparing 3-aminoisoxazole derivatives |
| US3544582A (en) * | 1965-04-06 | 1970-12-01 | Hoffmann La Roche | Process for preparing aminoisoxazoles |
| DE1814116A1 (de) * | 1967-12-13 | 1969-08-21 | Takeda Chemical Industries Ltd | Verfahren zur Herstellung von 3-Aminoisoxazol |
-
1977
- 1977-06-08 JP JP52068173A patent/JPS5927343B2/ja not_active Expired
-
1978
- 1978-05-31 GB GB24935/78A patent/GB1582725A/en not_active Expired
- 1978-06-01 CH CH602778A patent/CH636351A5/de not_active IP Right Cessation
- 1978-06-01 CA CA304,564A patent/CA1089473A/en not_active Expired
- 1978-06-05 US US05/912,252 patent/US4200757A/en not_active Expired - Lifetime
- 1978-06-05 FR FR787816787A patent/FR2393796A1/fr active Granted
- 1978-06-08 DE DE19782825194 patent/DE2825194A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE2825194C2 (cg-RX-API-DMAC7.html) | 1989-01-26 |
| DE2825194A1 (de) | 1978-12-21 |
| FR2393796A1 (fr) | 1979-01-05 |
| JPS543062A (en) | 1979-01-11 |
| JPS5927343B2 (ja) | 1984-07-05 |
| US4200757A (en) | 1980-04-29 |
| GB1582725A (en) | 1981-01-14 |
| FR2393796B1 (cg-RX-API-DMAC7.html) | 1981-07-24 |
| CA1089473A (en) | 1980-11-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0370317B1 (de) | Verfahren zur Herstellung von substituierten 2-Chlorpyridinen | |
| DE69632919T2 (de) | Verfahren zur herstellung von 2-chlor-5-chloromethyl-thiazol | |
| CH636351A5 (de) | Verfahren zur herstellung von 3-amino-isoxazolen. | |
| EP1636199A2 (de) | Verfahren zur herstellung von phenylessig derivaten | |
| EP0564984B1 (de) | O-Iminooxymethylbenzoesäuren, Verfahren zu ihrer Herstellung und ihre Verwendung als Zwischenprodukte | |
| DE60103274T2 (de) | Verfahren zur herstellung von 2,2-dimethyl-5-(4-clorobenzyl) cyclopentanonen und zwischenprodukt dafür | |
| EP0217018A1 (de) | Verfahren zur Herstellung von 3-Aminoacrylsäureestern | |
| EP0439745B1 (de) | Verfahren zur Herstellung von 2-Chlor-5-methyl-pyridin | |
| EP0537534B1 (de) | Verfahren zur Herstellung von N-(Hydroxyalkyl)-carbamidsäure- alkylestern | |
| DE69527997T2 (de) | Verfahren zur Herstellung von Isoxazole-3-Carbonsäure | |
| DE60204791T2 (de) | Synthese von 4-(piperidyl) (2-pyridyl)methanon-(e)-o-methyloxim und seinen salzen | |
| DE69619402T2 (de) | Verfahren zur herstellung von methoximinophenylglyoxylsäure-derivaten | |
| EP0299277A2 (de) | Verfahren zur Herstellung von substituierten Pyridylalkylketonen | |
| CH631170A5 (de) | Verfahren zur herstellung von 2-alkyl- oder 2-cycloalkyl-4-methyl-6-hydroxypyrimidinen. | |
| CH615438A5 (cg-RX-API-DMAC7.html) | ||
| DE69018619T2 (de) | Alpha, beta-ungesättigte ketone und ketoximderivat. | |
| DE2525852C2 (cg-RX-API-DMAC7.html) | ||
| DE1134382B (de) | Verfahren zur Herstellung von Thiolphosphor-, -phosphon-, -phosphin- bzw. Thionothiolphosphor-, -phosphon-, -phosphinsaeureestern | |
| DD233373A5 (de) | Verfahren zur herstellung von imidazolidinderivaten | |
| EP0110432A1 (de) | Verfahren zur Herstellung von Fluoren-9-carbonsäure | |
| EP0446925B1 (de) | Verfahren zur Herstellung von beta-Resorcylsäurederivaten | |
| DE2443742A1 (de) | Cyclopenten-derivate und zwischenprodukte und verfahren zu ihrer herstellung | |
| EP0447950B1 (de) | Verfahren zur Herstellung von Isoxazol-4,5-dicarbonsäure-diestern | |
| CH639645A5 (de) | Verfahren zur herstellung eines niederalkyl-2-chlor-2-hydroxyiminoacetats. | |
| CH626046A5 (cg-RX-API-DMAC7.html) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |