CH635855A5 - Verfahren zur herstellung von kuepenfarbstoffen. - Google Patents
Verfahren zur herstellung von kuepenfarbstoffen. Download PDFInfo
- Publication number
- CH635855A5 CH635855A5 CH51578A CH51578A CH635855A5 CH 635855 A5 CH635855 A5 CH 635855A5 CH 51578 A CH51578 A CH 51578A CH 51578 A CH51578 A CH 51578A CH 635855 A5 CH635855 A5 CH 635855A5
- Authority
- CH
- Switzerland
- Prior art keywords
- parts
- hours
- triazine
- acid chloride
- nitrobenzene
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 16
- 238000004519 manufacturing process Methods 0.000 title description 4
- 239000003086 colorant Substances 0.000 title 1
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 claims description 142
- 239000011541 reaction mixture Substances 0.000 claims description 63
- VWBVCOPVKXNMMZ-UHFFFAOYSA-N 1,5-diaminoanthracene-9,10-dione Chemical class O=C1C2=C(N)C=CC=C2C(=O)C2=C1C=CC=C2N VWBVCOPVKXNMMZ-UHFFFAOYSA-N 0.000 claims description 32
- 239000000725 suspension Substances 0.000 claims description 25
- 238000009833 condensation Methods 0.000 claims description 15
- 230000005494 condensation Effects 0.000 claims description 15
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 claims description 12
- 239000003795 chemical substances by application Substances 0.000 claims description 9
- 239000003960 organic solvent Substances 0.000 claims description 8
- 239000000984 vat dye Substances 0.000 claims description 8
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 239000013067 intermediate product Substances 0.000 claims description 2
- WOPHAXVWACNHPM-UHFFFAOYSA-N 2-(methylthio)-1,3,5-triazine Chemical compound CSC1=NC=NC=N1 WOPHAXVWACNHPM-UHFFFAOYSA-N 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 76
- 239000000203 mixture Substances 0.000 description 44
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 42
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 38
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 36
- MWPZLWRHHPWTFS-UHFFFAOYSA-N 2,4-dichloro-6-methylsulfanyl-1,3,5-triazine Chemical compound CSC1=NC(Cl)=NC(Cl)=N1 MWPZLWRHHPWTFS-UHFFFAOYSA-N 0.000 description 24
- 229910052757 nitrogen Inorganic materials 0.000 description 21
- 238000001291 vacuum drying Methods 0.000 description 20
- 239000012065 filter cake Substances 0.000 description 19
- 239000000975 dye Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- 238000004043 dyeing Methods 0.000 description 6
- -1 nitro, methyl Chemical group 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 4
- NSNPSJGHTQIXDO-UHFFFAOYSA-N naphthalene-1-carbonyl chloride Chemical compound C1=CC=C2C(C(=O)Cl)=CC=CC2=C1 NSNPSJGHTQIXDO-UHFFFAOYSA-N 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- STZCRXQWRGQSJD-UHFFFAOYSA-M sodium;4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate Chemical compound [Na+].C1=CC(N(C)C)=CC=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 STZCRXQWRGQSJD-UHFFFAOYSA-M 0.000 description 4
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 3
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 3
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- XNLBCXGRQWUJLU-UHFFFAOYSA-N naphthalene-2-carbonyl chloride Chemical compound C1=CC=CC2=CC(C(=O)Cl)=CC=C21 XNLBCXGRQWUJLU-UHFFFAOYSA-N 0.000 description 3
- 239000000049 pigment Substances 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 3
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 3
- 239000002966 varnish Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- PNVPNXKRAUBJGW-UHFFFAOYSA-N (2-chloroacetyl) 2-chloroacetate Chemical compound ClCC(=O)OC(=O)CCl PNVPNXKRAUBJGW-UHFFFAOYSA-N 0.000 description 2
- XPBYMVFXDJZOAW-UHFFFAOYSA-N 2,4-dichloro-6-propan-2-ylsulfanyl-1,3,5-triazine Chemical compound CC(C)SC1=NC(Cl)=NC(Cl)=N1 XPBYMVFXDJZOAW-UHFFFAOYSA-N 0.000 description 2
- OTFPBEGMQXEJJG-UHFFFAOYSA-N 2,4-dichloro-6-propylsulfanyl-1,3,5-triazine Chemical compound CCCSC1=NC(Cl)=NC(Cl)=N1 OTFPBEGMQXEJJG-UHFFFAOYSA-N 0.000 description 2
- FRCJZVRRIQZXBL-UHFFFAOYSA-N 2-butylsulfanyl-4,6-dichloro-1,3,5-triazine Chemical compound CCCCSC1=NC(Cl)=NC(Cl)=N1 FRCJZVRRIQZXBL-UHFFFAOYSA-N 0.000 description 2
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 2
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 2
- OQFYBGANSUNUAO-UHFFFAOYSA-N 4-methyl-3-nitrobenzenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1[N+]([O-])=O OQFYBGANSUNUAO-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 240000007817 Olea europaea Species 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 2
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 2
- AQIHMSVIAGNIDM-UHFFFAOYSA-N benzoyl bromide Chemical compound BrC(=O)C1=CC=CC=C1 AQIHMSVIAGNIDM-UHFFFAOYSA-N 0.000 description 2
- HPMLGNIUXVXALD-UHFFFAOYSA-N benzoyl fluoride Chemical compound FC(=O)C1=CC=CC=C1 HPMLGNIUXVXALD-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- BYVCTYDTPSKPRM-UHFFFAOYSA-N naphthalene-1-carbonyl naphthalene-1-carboxylate Chemical compound C1=CC=C2C(C(OC(=O)C=3C4=CC=CC=C4C=CC=3)=O)=CC=CC2=C1 BYVCTYDTPSKPRM-UHFFFAOYSA-N 0.000 description 2
- YKFDZICYFPICJW-UHFFFAOYSA-N naphthalene-2-carbonyl naphthalene-2-carboxylate Chemical compound C1=CC=CC2=CC(C(OC(=O)C=3C=C4C=CC=CC4=CC=3)=O)=CC=C21 YKFDZICYFPICJW-UHFFFAOYSA-N 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- ARJOQCYCJMAIFR-UHFFFAOYSA-N prop-2-enoyl prop-2-enoate Chemical compound C=CC(=O)OC(=O)C=C ARJOQCYCJMAIFR-UHFFFAOYSA-N 0.000 description 2
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000001256 steam distillation Methods 0.000 description 2
- CAXRPEAFHWDFTD-UHFFFAOYSA-N (4-nitrophenyl)methanesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=C(CS(Cl)(=O)=O)C=C1 CAXRPEAFHWDFTD-UHFFFAOYSA-N 0.000 description 1
- LUYATRCYIOILHI-UHFFFAOYSA-N (9,10-dioxoanthracene-1-carbonyl) 9,10-dioxoanthracene-1-carboxylate Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2C(=O)OC(=O)C1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O LUYATRCYIOILHI-UHFFFAOYSA-N 0.000 description 1
- SJJVEUDEMLFRMW-UHFFFAOYSA-N (9,10-dioxoanthracene-2-carbonyl) 9,10-dioxoanthracene-2-carboxylate Chemical compound C1=CC=C2C(=O)C3=CC(C(OC(=O)C=4C=C5C(=O)C6=CC=CC=C6C(=O)C5=CC=4)=O)=CC=C3C(=O)C2=C1 SJJVEUDEMLFRMW-UHFFFAOYSA-N 0.000 description 1
- WMQCLMTUOGFKHI-UHFFFAOYSA-N 1,1,1,2,2,3,3,4,4-nonafluoro-4-fluorosulfonyloxybutane Chemical compound FC(F)(F)C(F)(F)C(F)(F)C(F)(F)OS(F)(=O)=O WMQCLMTUOGFKHI-UHFFFAOYSA-N 0.000 description 1
- UMQWXUXRGLGYAF-UHFFFAOYSA-N 1,2-dihydroacenaphthylene-3-sulfonyl chloride Chemical compound C1CC=2C(=CC=C3C=CC=C1C=23)S(=O)(=O)Cl UMQWXUXRGLGYAF-UHFFFAOYSA-N 0.000 description 1
- KBMKSUPJXFQYRA-UHFFFAOYSA-N 1,2-dihydroacenaphthylene-5-sulfonyl chloride Chemical compound C1CC2=CC=CC3=C2C1=CC=C3S(=O)(=O)Cl KBMKSUPJXFQYRA-UHFFFAOYSA-N 0.000 description 1
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical group C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- ZMESHQOXZMOOQQ-UHFFFAOYSA-N 1-(naphthalen-1-ylmethyl)naphthalene Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 ZMESHQOXZMOOQQ-UHFFFAOYSA-N 0.000 description 1
- BIZVHVKTTCPVPP-UHFFFAOYSA-N 1-amino-9,10-dioxoanthracene-2-carbonyl chloride Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC(C(Cl)=O)=C2N BIZVHVKTTCPVPP-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- WNVVRCKTQSCPAC-UHFFFAOYSA-N 2,4,5-trichlorobenzenesulfonyl chloride Chemical compound ClC1=CC(Cl)=C(S(Cl)(=O)=O)C=C1Cl WNVVRCKTQSCPAC-UHFFFAOYSA-N 0.000 description 1
- ZFMHIKFWALHYFF-UHFFFAOYSA-N 2,4,5-trimethylbenzenesulfonyl chloride Chemical compound CC1=CC(C)=C(S(Cl)(=O)=O)C=C1C ZFMHIKFWALHYFF-UHFFFAOYSA-N 0.000 description 1
- GUXUMCNZMMLAJN-UHFFFAOYSA-N 2,4-dibromo-6-ethylsulfanyl-1,3,5-triazine Chemical compound CCSC1=NC(Br)=NC(Br)=N1 GUXUMCNZMMLAJN-UHFFFAOYSA-N 0.000 description 1
- RINPYRGJTFWLRS-UHFFFAOYSA-N 2,4-dibromo-6-methylsulfanyl-1,3,5-triazine Chemical compound CSC1=NC(Br)=NC(Br)=N1 RINPYRGJTFWLRS-UHFFFAOYSA-N 0.000 description 1
- ZCZJJJXYLSCYII-UHFFFAOYSA-N 2,4-dichloro-6-ethylsulfanyl-1,3,5-triazine Chemical compound CCSC1=NC(Cl)=NC(Cl)=N1 ZCZJJJXYLSCYII-UHFFFAOYSA-N 0.000 description 1
- FREOGXBZEAMJQN-UHFFFAOYSA-N 2,4-dimethylbenzenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C(C)=C1 FREOGXBZEAMJQN-UHFFFAOYSA-N 0.000 description 1
- BXCOSWRSIISQSL-UHFFFAOYSA-N 2,5-dichlorobenzenesulfonyl chloride Chemical compound ClC1=CC=C(Cl)C(S(Cl)(=O)=O)=C1 BXCOSWRSIISQSL-UHFFFAOYSA-N 0.000 description 1
- FZVZUIBYLZZOEW-UHFFFAOYSA-N 2,5-dimethylbenzenesulfonyl chloride Chemical compound CC1=CC=C(C)C(S(Cl)(=O)=O)=C1 FZVZUIBYLZZOEW-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- AHIKUUZQSJTSMX-UHFFFAOYSA-N 2-amino-4,5-dichlorobenzenesulfonyl chloride Chemical compound NC1=CC(Cl)=C(Cl)C=C1S(Cl)(=O)=O AHIKUUZQSJTSMX-UHFFFAOYSA-N 0.000 description 1
- VHJCPECPVCWFRX-UHFFFAOYSA-N 2-bromoethanesulfonyl bromide Chemical compound BrCCS(Br)(=O)=O VHJCPECPVCWFRX-UHFFFAOYSA-N 0.000 description 1
- YKFWTAJINXFFRZ-UHFFFAOYSA-N 2-butylsulfanyl-4,6-difluoro-1,3,5-triazine Chemical compound CCCCSC1=NC(F)=NC(F)=N1 YKFWTAJINXFFRZ-UHFFFAOYSA-N 0.000 description 1
- CYSUDFINAJICND-UHFFFAOYSA-N 2-chloro-2-phenoxyacetyl chloride Chemical compound ClC(=O)C(Cl)OC1=CC=CC=C1 CYSUDFINAJICND-UHFFFAOYSA-N 0.000 description 1
- COZWQPZDKVIVFS-UHFFFAOYSA-N 2-chloro-5-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(S(Cl)(=O)=O)=C1 COZWQPZDKVIVFS-UHFFFAOYSA-N 0.000 description 1
- KMVZDSQHLDGKGV-UHFFFAOYSA-N 2-chlorobenzenesulfonyl chloride Chemical compound ClC1=CC=CC=C1S(Cl)(=O)=O KMVZDSQHLDGKGV-UHFFFAOYSA-N 0.000 description 1
- ONIKNECPXCLUHT-UHFFFAOYSA-N 2-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Cl ONIKNECPXCLUHT-UHFFFAOYSA-N 0.000 description 1
- VHCSBTPOPKFYIU-UHFFFAOYSA-N 2-chloroethanesulfonyl chloride Chemical compound ClCCS(Cl)(=O)=O VHCSBTPOPKFYIU-UHFFFAOYSA-N 0.000 description 1
- GHEYBQFYTWHGMM-UHFFFAOYSA-N 2-ethylsulfanyl-1,3,5-triazine Chemical compound CCSC1=NC=NC=N1 GHEYBQFYTWHGMM-UHFFFAOYSA-N 0.000 description 1
- AQZXINSITNTAHA-UHFFFAOYSA-N 2-ethylsulfanyl-4,6-difluoro-1,3,5-triazine Chemical compound CCSC1=NC(F)=NC(F)=N1 AQZXINSITNTAHA-UHFFFAOYSA-N 0.000 description 1
- WPGVQDHXOUAJBW-UHFFFAOYSA-N 2-methyl-5-nitrobenzenesulfonyl chloride Chemical compound CC1=CC=C([N+]([O-])=O)C=C1S(Cl)(=O)=O WPGVQDHXOUAJBW-UHFFFAOYSA-N 0.000 description 1
- HDECRAPHCDXMIJ-UHFFFAOYSA-N 2-methylbenzenesulfonyl chloride Chemical compound CC1=CC=CC=C1S(Cl)(=O)=O HDECRAPHCDXMIJ-UHFFFAOYSA-N 0.000 description 1
- WPHUUIODWRNJLO-UHFFFAOYSA-N 2-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=CC=C1S(Cl)(=O)=O WPHUUIODWRNJLO-UHFFFAOYSA-N 0.000 description 1
- NYIBPWGZGSXURD-UHFFFAOYSA-N 3,4-dichlorobenzenesulfonyl chloride Chemical compound ClC1=CC=C(S(Cl)(=O)=O)C=C1Cl NYIBPWGZGSXURD-UHFFFAOYSA-N 0.000 description 1
- KXFQRJNVGBIDHA-UHFFFAOYSA-N 3,5-dichloro-2-hydroxybenzenesulfonyl chloride Chemical compound OC1=C(Cl)C=C(Cl)C=C1S(Cl)(=O)=O KXFQRJNVGBIDHA-UHFFFAOYSA-N 0.000 description 1
- KRKMAUKQDRAOFI-UHFFFAOYSA-N 3-acetamido-4-methoxybenzenesulfonyl chloride Chemical compound COC1=CC=C(S(Cl)(=O)=O)C=C1NC(C)=O KRKMAUKQDRAOFI-UHFFFAOYSA-N 0.000 description 1
- BEWAMCVOAJCEEM-UHFFFAOYSA-N 3-chloro-2-methyl-5-nitrobenzenesulfonyl chloride Chemical compound CC1=C(Cl)C=C([N+]([O-])=O)C=C1S(Cl)(=O)=O BEWAMCVOAJCEEM-UHFFFAOYSA-N 0.000 description 1
- XMJPTCBXPMZLLJ-UHFFFAOYSA-N 3-chloro-4-methyl-5-nitrobenzenesulfonyl chloride Chemical compound CC1=C(Cl)C=C(S(Cl)(=O)=O)C=C1[N+]([O-])=O XMJPTCBXPMZLLJ-UHFFFAOYSA-N 0.000 description 1
- GNYVVCRRZRVBDD-UHFFFAOYSA-N 3-chloro-4-methylbenzenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1Cl GNYVVCRRZRVBDD-UHFFFAOYSA-N 0.000 description 1
- OINWZUJVEXUHCC-UHFFFAOYSA-N 3-chlorobenzenesulfonyl chloride Chemical compound ClC1=CC=CC(S(Cl)(=O)=O)=C1 OINWZUJVEXUHCC-UHFFFAOYSA-N 0.000 description 1
- WHIHIKVIWVIIER-UHFFFAOYSA-N 3-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(Cl)=C1 WHIHIKVIWVIIER-UHFFFAOYSA-N 0.000 description 1
- GPKDGVXBXQTHRY-UHFFFAOYSA-N 3-chloropropane-1-sulfonyl chloride Chemical compound ClCCCS(Cl)(=O)=O GPKDGVXBXQTHRY-UHFFFAOYSA-N 0.000 description 1
- YTNRXWVYUCTPFF-UHFFFAOYSA-N 3-hydroxyanthracene-2-carbonyl chloride Chemical compound C1=CC=C2C=C(C=C(C(O)=C3)C(Cl)=O)C3=CC2=C1 YTNRXWVYUCTPFF-UHFFFAOYSA-N 0.000 description 1
- KFPMLWUKHQMEBU-UHFFFAOYSA-N 3-methylbenzenesulfonyl chloride Chemical compound CC1=CC=CC(S(Cl)(=O)=O)=C1 KFPMLWUKHQMEBU-UHFFFAOYSA-N 0.000 description 1
- YHOYYHYBFSYOSQ-UHFFFAOYSA-N 3-methylbenzoyl chloride Chemical compound CC1=CC=CC(C(Cl)=O)=C1 YHOYYHYBFSYOSQ-UHFFFAOYSA-N 0.000 description 1
- NXTNASSYJUXJDV-UHFFFAOYSA-N 3-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=CC(C(Cl)=O)=C1 NXTNASSYJUXJDV-UHFFFAOYSA-N 0.000 description 1
- WRGHKTBZVWARIA-UHFFFAOYSA-N 4-(acetamidomethyl)benzenesulfonyl chloride Chemical compound CC(=O)NCC1=CC=C(S(Cl)(=O)=O)C=C1 WRGHKTBZVWARIA-UHFFFAOYSA-N 0.000 description 1
- JXVJGPMIPPKYAS-UHFFFAOYSA-N 4-(chloromethyl)benzenesulfonyl chloride Chemical compound ClCC1=CC=C(S(Cl)(=O)=O)C=C1 JXVJGPMIPPKYAS-UHFFFAOYSA-N 0.000 description 1
- GRDXCFKBQWDAJH-UHFFFAOYSA-N 4-acetamidobenzenesulfonyl chloride Chemical compound CC(=O)NC1=CC=C(S(Cl)(=O)=O)C=C1 GRDXCFKBQWDAJH-UHFFFAOYSA-N 0.000 description 1
- LYESTQKHIPXVIK-UHFFFAOYSA-N 4-chloro-2-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC(Cl)=CC=C1S(Cl)(=O)=O LYESTQKHIPXVIK-UHFFFAOYSA-N 0.000 description 1
- WEPYREBDJIVOHD-UHFFFAOYSA-N 4-chloro-3-methylbenzenesulfonyl chloride Chemical compound CC1=CC(S(Cl)(=O)=O)=CC=C1Cl WEPYREBDJIVOHD-UHFFFAOYSA-N 0.000 description 1
- ZLYBFBAHAQEEQQ-UHFFFAOYSA-N 4-chlorobenzenesulfonyl chloride Chemical compound ClC1=CC=C(S(Cl)(=O)=O)C=C1 ZLYBFBAHAQEEQQ-UHFFFAOYSA-N 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- YDSCNYYRPIFOJD-UHFFFAOYSA-N 4-chlorobutane-1-sulfonyl chloride Chemical compound ClCCCCS(Cl)(=O)=O YDSCNYYRPIFOJD-UHFFFAOYSA-N 0.000 description 1
- VLBSKIZWQATQRK-UHFFFAOYSA-N 4-dodecylbenzenesulfonyl chloride Chemical compound CCCCCCCCCCCCC1=CC=C(S(Cl)(=O)=O)C=C1 VLBSKIZWQATQRK-UHFFFAOYSA-N 0.000 description 1
- YIPHYCQSJTXLFM-UHFFFAOYSA-N 4-hydroxybenzoyl chloride Chemical compound OC1=CC=C(C(Cl)=O)C=C1 YIPHYCQSJTXLFM-UHFFFAOYSA-N 0.000 description 1
- DTJVECUKADWGMO-UHFFFAOYSA-N 4-methoxybenzenesulfonyl chloride Chemical compound COC1=CC=C(S(Cl)(=O)=O)C=C1 DTJVECUKADWGMO-UHFFFAOYSA-N 0.000 description 1
- QHEMDSDRFAIOOU-UHFFFAOYSA-N 4-methoxybenzenesulfonyl fluoride Chemical compound COC1=CC=C(S(F)(=O)=O)C=C1 QHEMDSDRFAIOOU-UHFFFAOYSA-N 0.000 description 1
- NTSFJZORNYYLFW-UHFFFAOYSA-N 4-methylbenzenesulfonyl bromide Chemical compound CC1=CC=C(S(Br)(=O)=O)C=C1 NTSFJZORNYYLFW-UHFFFAOYSA-N 0.000 description 1
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 1
- JXRGUPLJCCDGKG-UHFFFAOYSA-N 4-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=C(S(Cl)(=O)=O)C=C1 JXRGUPLJCCDGKG-UHFFFAOYSA-N 0.000 description 1
- SKDHHIUENRGTHK-UHFFFAOYSA-N 4-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(C(Cl)=O)C=C1 SKDHHIUENRGTHK-UHFFFAOYSA-N 0.000 description 1
- XCVFPNHQWVSCQJ-UHFFFAOYSA-N 4-octylbenzenesulfonyl chloride Chemical compound CCCCCCCCC1=CC=C(S(Cl)(=O)=O)C=C1 XCVFPNHQWVSCQJ-UHFFFAOYSA-N 0.000 description 1
- JPVUWCPKMYXOKW-UHFFFAOYSA-N 4-phenylbenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1C1=CC=CC=C1 JPVUWCPKMYXOKW-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- FNEIMPFRVQQOMV-UHFFFAOYSA-N 5,6,7,8-tetrahydronaphthalene-2-sulfonyl chloride Chemical compound C1CCCC2=CC(S(=O)(=O)Cl)=CC=C21 FNEIMPFRVQQOMV-UHFFFAOYSA-N 0.000 description 1
- SJXHSFSHNKFRLN-UHFFFAOYSA-N 5-chlorosulfonyl-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC(S(Cl)(=O)=O)=CC=C1O SJXHSFSHNKFRLN-UHFFFAOYSA-N 0.000 description 1
- LLSVGXGSYBLMNY-UHFFFAOYSA-N 9,10-dioxoanthracene-1-carbonyl chloride Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2C(=O)Cl LLSVGXGSYBLMNY-UHFFFAOYSA-N 0.000 description 1
- DGJNWQJOASAMHY-UHFFFAOYSA-N 9,10-dioxoanthracene-2-carbonyl chloride Chemical compound C1=CC=C2C(=O)C3=CC(C(=O)Cl)=CC=C3C(=O)C2=C1 DGJNWQJOASAMHY-UHFFFAOYSA-N 0.000 description 1
- 229920002955 Art silk Polymers 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- HYFJBGRBDCUXPQ-UHFFFAOYSA-N BrC1=C(C)C=CC(=C1)S(=O)(=O)Br Chemical compound BrC1=C(C)C=CC(=C1)S(=O)(=O)Br HYFJBGRBDCUXPQ-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- VJDDQSBNUHLBTD-GGWOSOGESA-N [(e)-but-2-enoyl] (e)-but-2-enoate Chemical compound C\C=C\C(=O)OC(=O)\C=C\C VJDDQSBNUHLBTD-GGWOSOGESA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 229940081735 acetylcellulose Drugs 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052977 alkali metal sulfide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229920003180 amino resin Polymers 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- CHIHQLCVLOXUJW-UHFFFAOYSA-N benzoic anhydride Chemical compound C=1C=CC=CC=1C(=O)OC(=O)C1=CC=CC=C1 CHIHQLCVLOXUJW-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Chemical group 0.000 description 1
- ZUQDPSRFJGYOPL-UHFFFAOYSA-N bromomethanesulfonyl bromide Chemical compound BrCS(Br)(=O)=O ZUQDPSRFJGYOPL-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- GWOWVOYJLHSRJJ-UHFFFAOYSA-L cadmium stearate Chemical compound [Cd+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O GWOWVOYJLHSRJJ-UHFFFAOYSA-L 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- GTRGJJDVSJFNTE-UHFFFAOYSA-N chembl2009633 Chemical compound OC1=CC=C2C=C(S(O)(=O)=O)C=CC2=C1N=NC1=CC=CC=C1 GTRGJJDVSJFNTE-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- KQDDQXNVESLJNO-UHFFFAOYSA-N chloromethanesulfonyl chloride Chemical compound ClCS(Cl)(=O)=O KQDDQXNVESLJNO-UHFFFAOYSA-N 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 239000000986 disperse dye Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- GRWZHXKQBITJKP-UHFFFAOYSA-L dithionite(2-) Chemical compound [O-]S(=O)S([O-])=O GRWZHXKQBITJKP-UHFFFAOYSA-L 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- SBBFZWWBMFILKH-UHFFFAOYSA-N ethanesulfonyl bromide Chemical compound CCS(Br)(=O)=O SBBFZWWBMFILKH-UHFFFAOYSA-N 0.000 description 1
- FRYHCSODNHYDPU-UHFFFAOYSA-N ethanesulfonyl chloride Chemical compound CCS(Cl)(=O)=O FRYHCSODNHYDPU-UHFFFAOYSA-N 0.000 description 1
- OIBMEBLCOQCFIT-UHFFFAOYSA-N ethanesulfonyl fluoride Chemical compound CCS(F)(=O)=O OIBMEBLCOQCFIT-UHFFFAOYSA-N 0.000 description 1
- KFOZNPPBKHYHQD-UHFFFAOYSA-N ethenesulfonyl chloride Chemical compound ClS(=O)(=O)C=C KFOZNPPBKHYHQD-UHFFFAOYSA-N 0.000 description 1
- BYPHZHGVWNKAFC-UHFFFAOYSA-N ethenesulfonyl fluoride Chemical compound FS(=O)(=O)C=C BYPHZHGVWNKAFC-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000010030 laminating Methods 0.000 description 1
- LLCOIQRNSJBFSN-UHFFFAOYSA-N methane;sulfurochloridic acid Chemical compound C.OS(Cl)(=O)=O LLCOIQRNSJBFSN-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- DASJFYAPNPUBGG-UHFFFAOYSA-N naphthalene-1-sulfonyl chloride Chemical compound C1=CC=C2C(S(=O)(=O)Cl)=CC=CC2=C1 DASJFYAPNPUBGG-UHFFFAOYSA-N 0.000 description 1
- OPECTNGATDYLSS-UHFFFAOYSA-N naphthalene-2-sulfonyl chloride Chemical compound C1=CC=CC2=CC(S(=O)(=O)Cl)=CC=C21 OPECTNGATDYLSS-UHFFFAOYSA-N 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 125000003232 p-nitrobenzoyl group Chemical group [N+](=O)([O-])C1=CC=C(C(=O)*)C=C1 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- OAHKWDDSKCRNFE-UHFFFAOYSA-N phenylmethanesulfonyl chloride Chemical compound ClS(=O)(=O)CC1=CC=CC=C1 OAHKWDDSKCRNFE-UHFFFAOYSA-N 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- UIIIBRHUICCMAI-UHFFFAOYSA-N prop-2-ene-1-sulfonic acid Chemical compound OS(=O)(=O)CC=C UIIIBRHUICCMAI-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ATBIAJXSKNPHEI-UHFFFAOYSA-N pyridine-3-carbonyl chloride Chemical compound ClC(=O)C1=CC=CN=C1 ATBIAJXSKNPHEI-UHFFFAOYSA-N 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- VJDDQSBNUHLBTD-UHFFFAOYSA-N trans-crotonic acid-anhydride Natural products CC=CC(=O)OC(=O)C=CC VJDDQSBNUHLBTD-UHFFFAOYSA-N 0.000 description 1
- ZCPSWAFANXCCOT-UHFFFAOYSA-N trichloromethanesulfonyl chloride Chemical compound ClC(Cl)(Cl)S(Cl)(=O)=O ZCPSWAFANXCCOT-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B1/00—Dyes with anthracene nucleus not condensed with any other ring
- C09B1/16—Amino-anthraquinones
- C09B1/20—Preparation from starting materials already containing the anthracene nucleus
- C09B1/36—Dyes with acylated amino groups
- C09B1/46—Dyes with acylated amino groups the acyl groups being residues of cyanuric acid or an analogous heterocyclic compound
- C09B1/467—Dyes with acylated amino groups the acyl groups being residues of cyanuric acid or an analogous heterocyclic compound attached to two or more anthraquinone rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Plural Heterocyclic Compounds (AREA)
- Optical Filters (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH51578A CH635855A5 (de) | 1978-01-18 | 1978-01-18 | Verfahren zur herstellung von kuepenfarbstoffen. |
| US06/003,327 US4265633A (en) | 1978-01-18 | 1979-01-15 | Process for the manufacture of vat dyes |
| DE19792901499 DE2901499A1 (de) | 1978-01-18 | 1979-01-16 | Verfahren zur herstellung von kuepenfarbstoffen |
| FR7901159A FR2415127A1 (fr) | 1978-01-18 | 1979-01-17 | Procede pour la preparation de colorants pour cuve |
| JP346479A JPS54110231A (en) | 1978-01-18 | 1979-01-18 | Preparation of vat dye |
| GB7901864A GB2013702B (en) | 1978-01-18 | 1979-01-18 | Process for the manufacture of vat dyes |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH51578A CH635855A5 (de) | 1978-01-18 | 1978-01-18 | Verfahren zur herstellung von kuepenfarbstoffen. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH635855A5 true CH635855A5 (de) | 1983-04-29 |
Family
ID=4188765
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH51578A CH635855A5 (de) | 1978-01-18 | 1978-01-18 | Verfahren zur herstellung von kuepenfarbstoffen. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4265633A (enExample) |
| JP (1) | JPS54110231A (enExample) |
| CH (1) | CH635855A5 (enExample) |
| DE (1) | DE2901499A1 (enExample) |
| FR (1) | FR2415127A1 (enExample) |
| GB (1) | GB2013702B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0025166A1 (de) * | 1979-08-29 | 1981-03-18 | Ciba-Geigy Ag | Verfahren zur Herstellung von Küpenfarbstoffen der Anthrachinonreihe, deren Verwendung in Färbe- und Druckpräparaten und beim Färben und Bedrucken |
| DE3103350A1 (de) * | 1981-01-31 | 1982-08-26 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von kuepenfarbstoffen aus abfallprodukten der nitroanthrachinon- und anthrachinonsulfonsaeuresynthesen |
| CZ2012723A3 (cs) * | 2012-10-24 | 2013-12-11 | Synthesia, A.S. | Zpusob prípravy antrachinonových pigmentu |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE399485C (de) | 1923-08-01 | 1924-07-23 | Chemische Ind Ges | Verfahren zur Herstellung von Farbstoffen und Farbstoffzwischenprodukten der Anthrachinonreihe |
| GB1476687A (en) * | 1973-08-22 | 1977-06-16 | Ciba Geigy Ag | Vat dyes their manufacture and their use |
-
1978
- 1978-01-18 CH CH51578A patent/CH635855A5/de not_active IP Right Cessation
-
1979
- 1979-01-15 US US06/003,327 patent/US4265633A/en not_active Expired - Lifetime
- 1979-01-16 DE DE19792901499 patent/DE2901499A1/de active Granted
- 1979-01-17 FR FR7901159A patent/FR2415127A1/fr active Granted
- 1979-01-18 GB GB7901864A patent/GB2013702B/en not_active Expired
- 1979-01-18 JP JP346479A patent/JPS54110231A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| GB2013702B (en) | 1982-06-30 |
| DE2901499A1 (de) | 1979-07-19 |
| JPS54110231A (en) | 1979-08-29 |
| DE2901499C2 (enExample) | 1988-01-14 |
| GB2013702A (en) | 1979-08-15 |
| FR2415127B1 (enExample) | 1981-07-24 |
| FR2415127A1 (fr) | 1979-08-17 |
| US4265633A (en) | 1981-05-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1768892C3 (de) | Disazopigmente und deren Verwendung | |
| DE19727079A1 (de) | Triphendioxazin | |
| CH688237A5 (de) | Triphendioxazin-Verbindungen. | |
| CH635855A5 (de) | Verfahren zur herstellung von kuepenfarbstoffen. | |
| EP0025166A1 (de) | Verfahren zur Herstellung von Küpenfarbstoffen der Anthrachinonreihe, deren Verwendung in Färbe- und Druckpräparaten und beim Färben und Bedrucken | |
| DE1807729A1 (de) | Farbstoff der Perylentetracorbonsaeurediimidreihe | |
| DE2439950C2 (enExample) | ||
| CH638547A5 (en) | Process for preparing vat dyes | |
| DE1058178B (de) | Verfahren zur Herstellung von Phthalocyaninpigmenten | |
| DE2832456A1 (de) | Neue monoazopigmente und verfahren zu deren herstellung | |
| DE2361433C2 (de) | Schwer lösliche Disazoverbindungen, ihre Herstellung und Verwendung | |
| DE1928131C3 (de) | Anthrachinonfarbstoffe, ihre Herstellung und Verwendung | |
| DE2116048C3 (de) | Farbstoff der Perylentetracarbonsäurediimidreihe | |
| DE2350797C2 (de) | Schwer lösliche Disazoverbindungen, ihre Herstellung und Verwendung als Pigmentfarbstoffe | |
| DE4444692A1 (de) | Wasserlösliche, faserreaktive Anthrachinonverbindung en | |
| CH636367A5 (de) | Verfahren zur herstellung von kuepenfarbstoffen. | |
| DE1768948C3 (de) | Wasserunlösliche Monoazofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung | |
| DE2262283A1 (de) | Schwer loesliche disazoverbindungen, ihre herstellung und verwendung | |
| DE2201242C3 (de) | Monoazopigmente, Verfahren zu deren Herstellung und ihre Verwendung | |
| DE1770960C3 (de) | Gelbe Farbstoffe der Phthalimidochinopthalonreihe, deren Herstellung und deren Verwendung | |
| DE1278646B (de) | Verfahren zur Herstellung von Kuepenfarbstoffen | |
| DE2544568B2 (de) | Sulfonsäuregruppenfreie Azofarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung als Pigmente in Lacken, Druckfarben oder Kunststoffen | |
| DE4326773A1 (de) | Polycyclische Küpenfarbstoffe | |
| DE3712946A1 (de) | Monoazopigmente | |
| DE2803992A1 (de) | Wasserunloesliche monoazofarbstoffe, verfahren zu ihrer herstellung und ihre verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |