CH634864A5 - Azofarbstoffe. - Google Patents
Azofarbstoffe. Download PDFInfo
- Publication number
- CH634864A5 CH634864A5 CH893978A CH893978A CH634864A5 CH 634864 A5 CH634864 A5 CH 634864A5 CH 893978 A CH893978 A CH 893978A CH 893978 A CH893978 A CH 893978A CH 634864 A5 CH634864 A5 CH 634864A5
- Authority
- CH
- Switzerland
- Prior art keywords
- amino
- phenyl
- nitro
- substituted
- cyano
- Prior art date
Links
- -1 alkano-yl Chemical group 0.000 claims description 25
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- 239000000975 dye Substances 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000000460 chlorine Substances 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 8
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- CSNIZNHTOVFARY-UHFFFAOYSA-N 1,2-benzothiazole Chemical class C1=CC=C2C=NSC2=C1 CSNIZNHTOVFARY-UHFFFAOYSA-N 0.000 claims description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 239000000987 azo dye Substances 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 229930192474 thiophene Natural products 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 3
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 230000008878 coupling Effects 0.000 claims description 2
- 238000010168 coupling process Methods 0.000 claims description 2
- 238000005859 coupling reaction Methods 0.000 claims description 2
- 150000001989 diazonium salts Chemical class 0.000 claims description 2
- 125000001072 heteroaryl group Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000000335 thiazolyl group Chemical group 0.000 claims 1
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- UHGULLIUJBCTEF-UHFFFAOYSA-N 2-aminobenzothiazole Chemical compound C1=CC=C2SC(N)=NC2=C1 UHGULLIUJBCTEF-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- ZIRGWUZHKJDYKT-UHFFFAOYSA-N 1,3-thiazole-2-carbonitrile Chemical compound N#CC1=NC=CS1 ZIRGWUZHKJDYKT-UHFFFAOYSA-N 0.000 description 1
- MIHADVKEHAFNPG-UHFFFAOYSA-N 2-Amino-5-nitrothiazole Chemical compound NC1=NC=C([N+]([O-])=O)S1 MIHADVKEHAFNPG-UHFFFAOYSA-N 0.000 description 1
- QTGIFTCDTLWDQE-UHFFFAOYSA-N 2-amino-1,3-thiazole-4,5-dicarbonitrile Chemical compound NC1=NC(C#N)=C(C#N)S1 QTGIFTCDTLWDQE-UHFFFAOYSA-N 0.000 description 1
- WNXWDETZPAYBPB-UHFFFAOYSA-N 2-amino-1-benzothiophene-3-carbonitrile Chemical compound C1=CC=C2C(C#N)=C(N)SC2=C1 WNXWDETZPAYBPB-UHFFFAOYSA-N 0.000 description 1
- CFBYBPOBHYGXNZ-UHFFFAOYSA-N 2-amino-4-methyl-5-nitrothiophene-3-carbonitrile Chemical compound CC1=C([N+]([O-])=O)SC(N)=C1C#N CFBYBPOBHYGXNZ-UHFFFAOYSA-N 0.000 description 1
- RMSVWOYCWFNSCM-UHFFFAOYSA-N 2-amino-4-phenylthiophene-3-carbonitrile Chemical compound N#CC1=C(N)SC=C1C1=CC=CC=C1 RMSVWOYCWFNSCM-UHFFFAOYSA-N 0.000 description 1
- 229940018167 2-amino-5-nitrothiazole Drugs 0.000 description 1
- CFKZMYPOJOKAAD-UHFFFAOYSA-N 2-amino-5-nitrothiophene-3-carbonitrile Chemical compound NC=1SC([N+]([O-])=O)=CC=1C#N CFKZMYPOJOKAAD-UHFFFAOYSA-N 0.000 description 1
- QMOLZZMBUADGRJ-UHFFFAOYSA-N 2-amino-6-nitro-1-benzothiophene-3-carbonitrile Chemical compound [O-][N+](=O)C1=CC=C2C(C#N)=C(N)SC2=C1 QMOLZZMBUADGRJ-UHFFFAOYSA-N 0.000 description 1
- XVGHZFWFGXDIOU-UHFFFAOYSA-N 2-aminothiophene-3-carbonitrile Chemical compound NC=1SC=CC=1C#N XVGHZFWFGXDIOU-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- DZRZHFOFVWAKGT-UHFFFAOYSA-N 3,5-dinitrothiophen-2-amine Chemical compound NC=1SC([N+]([O-])=O)=CC=1[N+]([O-])=O DZRZHFOFVWAKGT-UHFFFAOYSA-N 0.000 description 1
- UZGRZSHGRZYCQV-UHFFFAOYSA-N 4,6-dichloro-1,3-benzothiazol-2-amine Chemical compound C1=C(Cl)C=C2SC(N)=NC2=C1Cl UZGRZSHGRZYCQV-UHFFFAOYSA-N 0.000 description 1
- OUQMXTJYCAJLGO-UHFFFAOYSA-N 4-methyl-1,3-thiazol-2-amine Chemical compound CC1=CSC(N)=N1 OUQMXTJYCAJLGO-UHFFFAOYSA-N 0.000 description 1
- KDILIMALWBUMCY-UHFFFAOYSA-N 4-methyl-3,5-dinitrothiophen-2-amine Chemical compound CC1=C([N+]([O-])=O)SC(N)=C1[N+]([O-])=O KDILIMALWBUMCY-UHFFFAOYSA-N 0.000 description 1
- KXCQDIWJQBSUJF-UHFFFAOYSA-N 4-phenyl-1,3-thiazole Chemical compound S1C=NC(C=2C=CC=CC=2)=C1 KXCQDIWJQBSUJF-UHFFFAOYSA-N 0.000 description 1
- LVGMTUUJQJESMM-UHFFFAOYSA-N 4-phenyl-5-phenyldiazenyl-1,3-thiazol-2-amine Chemical compound C1(=CC=CC=C1)C=1N=C(SC=1N=NC1=CC=CC=C1)N LVGMTUUJQJESMM-UHFFFAOYSA-N 0.000 description 1
- MAKQREKUUHPPIS-UHFFFAOYSA-N 5-amino-1-phenyl-1H-pyrazole-4-carbonitrile Chemical compound NC1=C(C#N)C=NN1C1=CC=CC=C1 MAKQREKUUHPPIS-UHFFFAOYSA-N 0.000 description 1
- MUSYUMGBNGNWIC-UHFFFAOYSA-N 5-methylsulfanyl-[1,2]thiazolo[3,4-d][1,3]thiazol-3-amine Chemical compound S1C(N)=C2SC(SC)=NC2=N1 MUSYUMGBNGNWIC-UHFFFAOYSA-N 0.000 description 1
- UHZHEOAEJRHUBW-UHFFFAOYSA-N 5-phenyl-1,3,4-thiadiazol-2-amine Chemical compound S1C(N)=NN=C1C1=CC=CC=C1 UHZHEOAEJRHUBW-UHFFFAOYSA-N 0.000 description 1
- GPNAVOJCQIEKQF-UHFFFAOYSA-N 6-nitro-1,3-benzothiazol-2-amine Chemical compound C1=C([N+]([O-])=O)C=C2SC(N)=NC2=C1 GPNAVOJCQIEKQF-UHFFFAOYSA-N 0.000 description 1
- RWKFDXGAOHGWDD-UHFFFAOYSA-N C1=CC=C(C=C1)N2C3=C(C=CC(=C3)N)C(=N2)C(=O)O Chemical compound C1=CC=C(C=C1)N2C3=C(C=CC(=C3)N)C(=N2)C(=O)O RWKFDXGAOHGWDD-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 125000005079 alkoxycarbonylmethyl group Chemical group 0.000 description 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- WYTAFFGWAKJBTC-UHFFFAOYSA-N diethyl 2-amino-1,3-thiazole-4,5-dicarboxylate Chemical compound CCOC(=O)C=1N=C(N)SC=1C(=O)OCC WYTAFFGWAKJBTC-UHFFFAOYSA-N 0.000 description 1
- QAEVZTMQPXIJGP-UHFFFAOYSA-N dimethyl 2-amino-1,3-thiazole-4,5-dicarboxylate Chemical compound COC(=O)C=1N=C(N)SC=1C(=O)OC QAEVZTMQPXIJGP-UHFFFAOYSA-N 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- VYJSGJXWKSDUSG-UHFFFAOYSA-N ethyl 2-amino-1,3-benzothiazole-6-carboxylate Chemical compound CCOC(=O)C1=CC=C2N=C(N)SC2=C1 VYJSGJXWKSDUSG-UHFFFAOYSA-N 0.000 description 1
- XNASJEQIJMDBQN-UHFFFAOYSA-N ethyl 2-amino-1-benzothiophene-3-carboxylate Chemical compound C1=CC=C2C(C(=O)OCC)=C(N)SC2=C1 XNASJEQIJMDBQN-UHFFFAOYSA-N 0.000 description 1
- MKJQYFVTEPGXIE-UHFFFAOYSA-N ethyl 2-aminothiophene-3-carboxylate Chemical compound CCOC(=O)C=1C=CSC=1N MKJQYFVTEPGXIE-UHFFFAOYSA-N 0.000 description 1
- NYXZOVWQCSRKMZ-UHFFFAOYSA-N ethyl 5-methylthiophene-2-carboxylate Chemical compound CCOC(=O)C1=CC=C(C)S1 NYXZOVWQCSRKMZ-UHFFFAOYSA-N 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- PYGSKMBEVAICCR-UHFFFAOYSA-N hexa-1,5-diene Chemical group C=CCCC=C PYGSKMBEVAICCR-UHFFFAOYSA-N 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical group ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 150000002473 indoazoles Chemical class 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- OVLUSSXPOANNKZ-UHFFFAOYSA-N methyl 2-amino-5-nitrothiophene-3-carboxylate Chemical compound COC(=O)C=1C=C([N+]([O-])=O)SC=1N OVLUSSXPOANNKZ-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B31/00—Disazo and polyazo dyes of the type A->B->C, A->B->C->D, or the like, prepared by diazotising and coupling
- C09B31/02—Disazo dyes
- C09B31/12—Disazo dyes from other coupling components "C"
- C09B31/14—Heterocyclic components
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/34—Monoazo dyes prepared by diazotising and coupling from other coupling components
- C09B29/36—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds
- C09B29/3691—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing nitrogen and sulfur as heteroatom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772738885 DE2738885A1 (de) | 1977-08-29 | 1977-08-29 | Azofarbstoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH634864A5 true CH634864A5 (de) | 1983-02-28 |
Family
ID=6017579
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH893978A CH634864A5 (de) | 1977-08-29 | 1978-08-23 | Azofarbstoffe. |
Country Status (6)
| Country | Link |
|---|---|
| JP (1) | JPS5446226A (enExample) |
| CH (1) | CH634864A5 (enExample) |
| DE (1) | DE2738885A1 (enExample) |
| FR (1) | FR2401960A1 (enExample) |
| GB (1) | GB2004561B (enExample) |
| IT (1) | IT1097943B (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2816507A1 (de) * | 1978-04-15 | 1979-10-25 | Basf Ag | Saure azofarbstoffe mit thiazolkupplungskomponenten |
| DE2910806A1 (de) * | 1979-03-20 | 1980-10-02 | Basf Ag | Farbstoffe der thiazolreihe |
| DE3427201A1 (de) * | 1984-07-24 | 1986-01-30 | Basf Ag, 6700 Ludwigshafen | Heterocyclische azofarbstoffe |
| GB8704727D0 (en) * | 1987-02-27 | 1987-08-05 | Ici Plc | Aromatic disazo compound |
| JPS63315602A (ja) * | 1987-06-12 | 1988-12-23 | 美津濃株式会社 | パツド |
| DE3833442A1 (de) * | 1988-10-01 | 1990-04-12 | Basf Ag | Thiophenazofarbstoffe mit einer kupplungskomponente aus der thiazolreihe |
| US5132412A (en) * | 1988-10-01 | 1992-07-21 | Basf Aktiengesellschaft | Thiazoleazo dyes having a diazo component from the isothiazole or thiadiazole series |
| US5216139A (en) * | 1988-10-01 | 1993-06-01 | Basf Aktiengesellschaft | Thiopheneazo dye based on a coupling component of the thiazole series |
| DE3910289A1 (de) * | 1989-03-30 | 1990-10-04 | Basf Ag | Azofarbstoffe mit einer diazokomponente aus der aminobenzisothiazolreihe |
| DE3910408A1 (de) * | 1989-03-31 | 1990-10-04 | Basf Ag | Azofarbstoffe, deren diazo- und kupplungskomponente aus der thiazolreihe stammt |
| DE3917455A1 (de) * | 1989-05-30 | 1990-12-06 | Basf Ag | Benzisothiazolazofarbstoffe mit einer kupplungskomponente aus der thiazol- oder pyridinreihe |
| JP2008248211A (ja) * | 2007-03-30 | 2008-10-16 | Fujifilm Corp | アゾ色素およびアゾ化合物 |
| JP2008248212A (ja) * | 2007-03-30 | 2008-10-16 | Fujifilm Corp | アゾ色素およびアゾ化合物 |
| US10926276B2 (en) | 2015-12-09 | 2021-02-23 | Joseph A. McDonnell | Dual sprayer and foam sprayer attachment |
| US10272457B2 (en) | 2015-12-09 | 2019-04-30 | Joseph A. McDonnell | Dual sprayer, and dual sprayer with dual chamber bottle |
| USD821541S1 (en) | 2015-12-30 | 2018-06-26 | Joseph A. McDonnell | Dual sprayer |
| USD944924S1 (en) | 2018-05-08 | 2022-03-01 | For Life Products, Llc | Dual sprayer with screw connection and foam sprayer attachment |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3770719A (en) * | 1967-12-07 | 1973-11-06 | Eastman Kodak Co | 2-amino-4-(azoyl)-azo-thiazole compounds and quaternary derivative thereof |
| US3816391A (en) * | 1971-12-01 | 1974-06-11 | Eastman Kodak Co | 2-amino-4-aryl-5-(2-cyano-4,6-dinitro-phenylazo)thiazole compounds |
-
1977
- 1977-08-29 DE DE19772738885 patent/DE2738885A1/de active Granted
-
1978
- 1978-08-10 IT IT26691/78A patent/IT1097943B/it active
- 1978-08-17 FR FR7823988A patent/FR2401960A1/fr active Granted
- 1978-08-23 CH CH893978A patent/CH634864A5/de not_active IP Right Cessation
- 1978-08-25 GB GB7834704A patent/GB2004561B/en not_active Expired
- 1978-08-29 JP JP10449878A patent/JPS5446226A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB2004561A (en) | 1979-04-04 |
| IT1097943B (it) | 1985-08-31 |
| IT7826691A0 (it) | 1978-08-10 |
| JPS6228818B2 (enExample) | 1987-06-23 |
| JPS5446226A (en) | 1979-04-12 |
| DE2738885C2 (enExample) | 1988-07-21 |
| FR2401960B3 (enExample) | 1981-03-27 |
| FR2401960A1 (fr) | 1979-03-30 |
| GB2004561B (en) | 1982-04-21 |
| DE2738885A1 (de) | 1979-03-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH634864A5 (de) | Azofarbstoffe. | |
| DE2263007C3 (de) | Neue Azofarbstoffe und Verfahren zum Färben und Bedrucken | |
| DE10028686A1 (de) | Hydroxypyridonmethidazofarbstoffe | |
| DE2202820A1 (de) | Pyrimidin-dispersionsfarbstoffe | |
| DE2211663C3 (de) | Azofarbstoffe mit 2,6-Diaminopyrfdinen als Kupplungskomponenten, Verfahren zu deren Herstellung und Farbstoffzubereitungen | |
| DE1644086A1 (de) | Verfahren zur Herstellung wasserunloeslicher Monoazofarbstoffe | |
| EP0681004B1 (de) | Verdoppelte saure Azofarbstoffe mit einer Kupplungskomponente aus der Hydroxypyridonreihe sowie deren Zwischenprodukte | |
| DE2309638A1 (de) | Dispersionsfarbstoffe der 2,6diaminopyridinreihe | |
| DE2702627A1 (de) | Monoazofarbstoffe | |
| EP0039054A1 (de) | Wasserunlösliche Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0017769B1 (de) | Farbstoffe der Thiazolreihe und ihre Verwendung | |
| DE2226933C3 (de) | Azofarbstoffe mit 2,6 Diaminopyridinen als Kupplungskomponenten, Verfahren zu deren Herstellung und ihre Verwendung | |
| CH637673A5 (de) | Azofarbstoffe mit thiazolresten. | |
| DE2251702A1 (de) | Dispersionsfarbstoffe der 2,6diaminopyridinreihe | |
| DE3007518A1 (de) | Wasserunloesliche azofarbstoffe, verfahren zu ihrer herstellung und verwendung zum faerben und bedrucken von synthetischem, hydrophobem fasermaterial | |
| EP0349486A2 (de) | Azofarbstoffe, deren Herstellung und Verwendung | |
| DE2258823A1 (de) | 2,6-diaminopyridinfarbstoffe | |
| AT204665B (de) | Verfahren zur Herstellung von neuen Monoazofarbstoffen | |
| EP0083009A1 (de) | Dispersionsfarbstoffe | |
| CH639404A5 (de) | Azofarbstoffe. | |
| DE2259684A1 (de) | Azofarbstoffe mit 2,6-diaminopyridinen als kupplungskomponenten | |
| DE2500064A1 (de) | Azofarbstoffe | |
| DE2259103C3 (de) | 2,6-Diaminopyridinazofarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| DE2263109A1 (de) | Neue basische azofarbstoffe und verfahren zu deren herstellung | |
| DE2255525C3 (de) | Diaminopyrimidin-DispersionsazoterbsUttte, Verfahren zu deren Herstellung und Ihre Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |