CH634045A5 - Process for preparing mono alkali-metal salts of 1-amino-8-naphthol-3,6-disulphonic acid - Google Patents
Process for preparing mono alkali-metal salts of 1-amino-8-naphthol-3,6-disulphonic acid Download PDFInfo
- Publication number
- CH634045A5 CH634045A5 CH371478A CH371478A CH634045A5 CH 634045 A5 CH634045 A5 CH 634045A5 CH 371478 A CH371478 A CH 371478A CH 371478 A CH371478 A CH 371478A CH 634045 A5 CH634045 A5 CH 634045A5
- Authority
- CH
- Switzerland
- Prior art keywords
- acid
- naphthylamine
- salt
- mixture
- trisulfonic
- Prior art date
Links
- 239000002253 acid Substances 0.000 title claims description 89
- -1 alkali-metal salts Chemical class 0.000 title claims description 11
- 229910052783 alkali metal Inorganic materials 0.000 title claims 2
- 238000004519 manufacturing process Methods 0.000 title description 3
- 239000000203 mixture Substances 0.000 claims description 49
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 42
- 150000003839 salts Chemical class 0.000 claims description 33
- 238000006243 chemical reaction Methods 0.000 claims description 28
- 238000000034 method Methods 0.000 claims description 28
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 21
- 150000007513 acids Chemical class 0.000 claims description 19
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 claims description 14
- 238000000926 separation method Methods 0.000 claims description 8
- 239000000126 substance Substances 0.000 claims description 8
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 7
- 239000011707 mineral Substances 0.000 claims description 7
- 230000007062 hydrolysis Effects 0.000 claims description 6
- 238000006460 hydrolysis reaction Methods 0.000 claims description 6
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 60
- UBDHSURDYAETAL-UHFFFAOYSA-N 8-aminonaphthalene-1,3,6-trisulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 UBDHSURDYAETAL-UHFFFAOYSA-N 0.000 description 44
- 235000002639 sodium chloride Nutrition 0.000 description 32
- QPILZZVXGUNELN-UHFFFAOYSA-M sodium;4-amino-5-hydroxynaphthalene-2,7-disulfonate;hydron Chemical compound [Na+].OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S([O-])(=O)=O)=CC2=C1 QPILZZVXGUNELN-UHFFFAOYSA-M 0.000 description 28
- 239000000243 solution Substances 0.000 description 25
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 24
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 14
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 10
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 9
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 8
- 235000011152 sodium sulphate Nutrition 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 235000010755 mineral Nutrition 0.000 description 6
- 239000003513 alkali Substances 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical class [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 5
- GFPQSWFFPRQEHH-UHFFFAOYSA-N 7-aminonaphthalene-1,3,6-trisulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(N)=CC2=C1S(O)(=O)=O GFPQSWFFPRQEHH-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- AFGPCIMUGMJQPD-UHFFFAOYSA-L disodium;4,5-dihydroxynaphthalene-2,7-disulfonate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)C1=CC(O)=C2C(O)=CC(S([O-])(=O)=O)=CC2=C1 AFGPCIMUGMJQPD-UHFFFAOYSA-L 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 4
- 239000002351 wastewater Substances 0.000 description 4
- HKTWHHAJDJCUPC-UHFFFAOYSA-N 7-aminonaphthalene-1,3,5-trisulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 HKTWHHAJDJCUPC-UHFFFAOYSA-N 0.000 description 3
- VEUACKUBDLVUAC-UHFFFAOYSA-N [Na].[Ca] Chemical compound [Na].[Ca] VEUACKUBDLVUAC-UHFFFAOYSA-N 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 235000005985 organic acids Nutrition 0.000 description 3
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 3
- 229910052939 potassium sulfate Inorganic materials 0.000 description 3
- 235000011151 potassium sulphates Nutrition 0.000 description 3
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical class OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 description 2
- JQIUQZOYSRHTBE-UHFFFAOYSA-N 4-nitronaphthalene-1,2,3-trisulfonic acid Chemical class C1=CC=C2C(S(O)(=O)=O)=C(S(O)(=O)=O)C(S(=O)(=O)O)=C([N+]([O-])=O)C2=C1 JQIUQZOYSRHTBE-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 229910017053 inorganic salt Inorganic materials 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- GPUMPJNVOBTUFM-UHFFFAOYSA-N naphthalene-1,2,3-trisulfonic acid Chemical class C1=CC=C2C(S(O)(=O)=O)=C(S(O)(=O)=O)C(S(=O)(=O)O)=CC2=C1 GPUMPJNVOBTUFM-UHFFFAOYSA-N 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000012266 salt solution Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- RJKGJBPXVHTNJL-UHFFFAOYSA-N 1-nitronaphthalene Chemical compound C1=CC=C2C([N+](=O)[O-])=CC=CC2=C1 RJKGJBPXVHTNJL-UHFFFAOYSA-N 0.000 description 1
- YOPRSDZTTFFTDQ-UHFFFAOYSA-N 3-(2-chloro-6-fluorophenyl)-n-(2-chloropyridin-3-yl)-5-methyl-1,2-oxazole-4-carboxamide Chemical compound CC=1ON=C(C=2C(=CC=CC=2F)Cl)C=1C(=O)NC1=CC=CN=C1Cl YOPRSDZTTFFTDQ-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- GBAOBIBJACZTNA-UHFFFAOYSA-L calcium sulfite Chemical compound [Ca+2].[O-]S([O-])=O GBAOBIBJACZTNA-UHFFFAOYSA-L 0.000 description 1
- 235000010261 calcium sulphite Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 159000000014 iron salts Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- ZPBSAMLXSQCSOX-UHFFFAOYSA-N naphthalene-1,3,6-trisulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(S(=O)(=O)O)=CC=C21 ZPBSAMLXSQCSOX-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772716030 DE2716030C3 (de) | 1977-04-09 | 1977-04-09 | Verfahren zur Herstellung von Monoalkalisalzes der 1-Amino-8-naphthol-3,6-disulfonsäure |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH634045A5 true CH634045A5 (en) | 1983-01-14 |
Family
ID=6006077
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH371478A CH634045A5 (en) | 1977-04-09 | 1978-04-06 | Process for preparing mono alkali-metal salts of 1-amino-8-naphthol-3,6-disulphonic acid |
Country Status (8)
| Country | Link |
|---|---|
| JP (1) | JPS53127448A (enExample) |
| BE (1) | BE865774A (enExample) |
| BR (1) | BR7802175A (enExample) |
| CH (1) | CH634045A5 (enExample) |
| DE (1) | DE2716030C3 (enExample) |
| FR (1) | FR2386520A1 (enExample) |
| GB (1) | GB1577697A (enExample) |
| IT (1) | IT1156158B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2834166A1 (de) * | 1978-08-04 | 1980-02-28 | Bayer Ag | Verfahren zur herstellung von 1-amino-8-naphthol-3,6-disulfonsaeure (h-saeure) |
| DE2843680A1 (de) * | 1978-10-06 | 1980-04-24 | Bayer Ag | Verfahren zur herstellung von 1-amino-8-naphthol-4,6-disulfonsaeure (k-saeure) |
| DE3118147A1 (de) * | 1981-05-07 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | Verfahren zur isolierung von h-saeure und k-saeure |
| JPS6388617A (ja) * | 1986-10-01 | 1988-04-19 | Mitsubishi Electric Corp | 比例制御ガバナ |
| CN109096154A (zh) * | 2018-08-16 | 2018-12-28 | 山东裕源集团有限公司 | 一种h酸生产工艺 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR550850A (fr) * | 1921-12-12 | 1923-03-21 | Nouveau procédé de préparation de l'acide h | |
| US1670406A (en) * | 1925-05-09 | 1928-05-22 | Newport Co | Process of preparing h-acid |
| US2272272A (en) * | 1939-09-02 | 1942-02-10 | Allied Chem & Dye Corp | Process for preparing hydroxy naphthalene compounds |
| JPS52156844A (en) * | 1976-06-21 | 1977-12-27 | Sumitomo Chem Co Ltd | Preparation of 8-amino-1-naphthol-3,6-disulfonic acid |
| CH630067A5 (de) * | 1977-03-31 | 1982-05-28 | Ciba Geigy Ag | Verfahren zur herstellung von naphthylaminhydroxysulfosaeuren. |
| DE2732291A1 (de) * | 1977-07-16 | 1979-02-01 | Bayer Ag | Verfahren zur herstellung von 1-amino-8-naphthol-3,6-disulfonsaeure (h-saeure) |
-
1977
- 1977-04-09 DE DE19772716030 patent/DE2716030C3/de not_active Expired
-
1978
- 1978-04-04 GB GB13142/78A patent/GB1577697A/en not_active Expired
- 1978-04-06 CH CH371478A patent/CH634045A5/de not_active IP Right Cessation
- 1978-04-07 IT IT48792/78A patent/IT1156158B/it active
- 1978-04-07 FR FR7810429A patent/FR2386520A1/fr active Granted
- 1978-04-07 BR BR7802175A patent/BR7802175A/pt unknown
- 1978-04-07 BE BE2056856A patent/BE865774A/xx not_active IP Right Cessation
- 1978-04-07 JP JP4045178A patent/JPS53127448A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS53127448A (en) | 1978-11-07 |
| JPS5645910B2 (enExample) | 1981-10-29 |
| GB1577697A (en) | 1980-10-29 |
| BR7802175A (pt) | 1978-12-19 |
| IT1156158B (it) | 1987-01-28 |
| IT7848792A0 (it) | 1978-04-07 |
| BE865774A (fr) | 1978-10-09 |
| DE2716030C3 (de) | 1981-07-16 |
| DE2716030B2 (de) | 1980-09-11 |
| DE2716030A1 (de) | 1978-10-19 |
| FR2386520B1 (enExample) | 1984-08-31 |
| FR2386520A1 (fr) | 1978-11-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0000493B1 (de) | Verfahren zur Herstellung von 1-Amino-8-naphthol-3,6-disulfonsäure (H-Säure). | |
| EP0214543A2 (de) | Verfahren zur Herstellung von 1-Aminoaphthalin-2,4,7-trisulfonsäure und 1-Aminonaphthalin-7-sulfonsäure | |
| EP0000495B1 (de) | Verfahren zur Herstellung von 1-Amino-8-naphthol-3,6-disulfonsäure (H-Säure). | |
| CH634045A5 (en) | Process for preparing mono alkali-metal salts of 1-amino-8-naphthol-3,6-disulphonic acid | |
| US4325889A (en) | Process for the preparation of 1-amino-8-naphthol-3,6-disulphonic acid (H-acid) | |
| EP0009092B1 (de) | Verfahren zur Herstellung von 1-Amino-8-naphthol-3,6-disulfonsäure (H-Säure) | |
| EP0074024B1 (de) | Verfahren zur Isolierung von 1-Naphthylamin-4,8-disulfonsäure | |
| EP0001084B1 (de) | Verfahren zur Herstellung von 1-Amino-4-bromanthrachinon-2-sulfonsäure | |
| EP0009743B1 (de) | Verfahren zur Herstellung von 1-Amino-8-naphthol-4,6-disulfonsäure (K-Säure) | |
| DE4420777A1 (de) | Verfahren zur Herstellung von 4-Fluorthiophenol | |
| EP0143750B1 (de) | Verfahren zur Herstellung von 4-Nitrotoluol-2-sulfonsäure | |
| EP0064693B1 (de) | Verfahren zur Herstellung von 1-Benzoylamino-8-hydroxy-naphthalin-4,6-disulfonsäure (Benzoyl-K-Säure) | |
| EP0050290A1 (de) | Verfahren zur Herstellung von Alkalisalzen der Imidodisulfonsäure | |
| DE3921131A1 (de) | Verfahren zur herstellung von hellfarbigen niederen alkansulfonsaeuren, insbesondere methansulfonsaeure | |
| EP0037510B1 (de) | Verfahren zur Herstellung von 1-Naphthylamin-4,6-disulfonsäure und 1-Naphthylamin-2,4,6-trisulfonsäure | |
| EP0214544B1 (de) | Verfahren zur Herstellung von 1-Aminonaphthalin-4-sulfonsäure (Naphthionsäure) | |
| EP0270815A1 (de) | Verfahren zur Herstellung von 5-aminosalicylsäure | |
| EP0001085A1 (de) | Verfahren zur Abtrennung von 1-Amino-4-bromanthrachinon-2-sulfonsäure | |
| EP0014366B1 (de) | Verfahren zur Herstellung des Magnesiumsalzes von 2-Nitronaphthalin-4,8-disulfonsäure (Nitro-Armstrong-Säure) | |
| EP0011089B1 (de) | Verfahren zur Herstellung von Nitro-T-Säure (8-Nitronaphthalin-1,3,6-trisulfonsäure) | |
| DE816100C (de) | Verfahren zur Herstellung der Benzol-1-carbonsaeuremethylester-2-sulfinsaeure | |
| DE912092C (de) | Verfahren zur Herstellung von Sulfinsaeuren | |
| CH634043A5 (de) | Verfahren zur herstellung von naphthalin-1,3,6-trisulfonsaeure. | |
| EP0052307A1 (de) | Verfahren zur Herstellung von 1-Naphthylamin-4.6-disulfonsäure und 1-Naphthylamin-2.4.6-trisulfonsäure | |
| DE2718207A1 (de) | Verfahren zur herstellung von naphthalin-1,3,6-trisulfonsaeure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |