CH629763A5 - Verfahren zur herstellung von benzolsulfochlorid. - Google Patents
Verfahren zur herstellung von benzolsulfochlorid. Download PDFInfo
- Publication number
- CH629763A5 CH629763A5 CH950777A CH950777A CH629763A5 CH 629763 A5 CH629763 A5 CH 629763A5 CH 950777 A CH950777 A CH 950777A CH 950777 A CH950777 A CH 950777A CH 629763 A5 CH629763 A5 CH 629763A5
- Authority
- CH
- Switzerland
- Prior art keywords
- benzenesulfonic acid
- thionyl chloride
- acid
- chloride
- reaction
- Prior art date
Links
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 title claims description 38
- 238000004519 manufacturing process Methods 0.000 title description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 178
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 claims description 110
- 229940092714 benzenesulfonic acid Drugs 0.000 claims description 110
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 71
- 239000003795 chemical substances by application Substances 0.000 claims description 48
- 238000000034 method Methods 0.000 claims description 47
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 40
- 238000006243 chemical reaction Methods 0.000 claims description 39
- 239000000203 mixture Substances 0.000 claims description 26
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 claims description 24
- 239000007788 liquid Substances 0.000 claims description 12
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 claims description 8
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 3
- 238000002844 melting Methods 0.000 claims description 2
- 230000008018 melting Effects 0.000 claims description 2
- 239000007789 gas Substances 0.000 description 28
- KZTYYGOKRVBIMI-UHFFFAOYSA-N diphenyl sulfone Chemical compound C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 26
- 238000004821 distillation Methods 0.000 description 20
- 239000011541 reaction mixture Substances 0.000 description 20
- 238000003756 stirring Methods 0.000 description 17
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 16
- 239000012043 crude product Substances 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 239000012535 impurity Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 9
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 9
- 238000010992 reflux Methods 0.000 description 9
- 239000002253 acid Substances 0.000 description 7
- MLWPJXZKQOPTKZ-UHFFFAOYSA-N benzenesulfonyl benzenesulfonate Chemical compound C=1C=CC=CC=1S(=O)(=O)OS(=O)(=O)C1=CC=CC=C1 MLWPJXZKQOPTKZ-UHFFFAOYSA-N 0.000 description 7
- 238000009835 boiling Methods 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 5
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000002912 waste gas Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- MIAUJDCQDVWHEV-UHFFFAOYSA-N benzene-1,2-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1S(O)(=O)=O MIAUJDCQDVWHEV-UHFFFAOYSA-N 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 238000010924 continuous production Methods 0.000 description 2
- -1 di- Chemical compound 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000002351 wastewater Substances 0.000 description 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical compound ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000005838 aromatic sulfonation reaction Methods 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000006326 desulfonation Effects 0.000 description 1
- 238000005869 desulfonation reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- UQSQSQZYBQSBJZ-UHFFFAOYSA-N fluorosulfonic acid Chemical compound OS(F)(=O)=O UQSQSQZYBQSBJZ-UHFFFAOYSA-N 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- VHHHONWQHHHLTI-UHFFFAOYSA-N hexachloroethane Chemical compound ClC(Cl)(Cl)C(Cl)(Cl)Cl VHHHONWQHHHLTI-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- BNIXVQGCZULYKV-UHFFFAOYSA-N pentachloroethane Chemical compound ClC(Cl)C(Cl)(Cl)Cl BNIXVQGCZULYKV-UHFFFAOYSA-N 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C303/00—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides
- C07C303/02—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of sulfonic acids or halides thereof
- C07C303/22—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of sulfonic acids or halides thereof from sulfonic acids, by reactions not involving the formation of sulfo or halosulfonyl groups; from sulfonic halides by reactions not involving the formation of halosulfonyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762635281 DE2635281A1 (de) | 1976-08-05 | 1976-08-05 | Verfahren zur herstellung von benzolsulfochlorid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH629763A5 true CH629763A5 (de) | 1982-05-14 |
Family
ID=5984818
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH950777A CH629763A5 (de) | 1976-08-05 | 1977-08-02 | Verfahren zur herstellung von benzolsulfochlorid. |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4105692A (OSRAM) |
| JP (1) | JPS5842865B2 (OSRAM) |
| BE (1) | BE857498A (OSRAM) |
| BR (1) | BR7705141A (OSRAM) |
| CH (1) | CH629763A5 (OSRAM) |
| DE (1) | DE2635281A1 (OSRAM) |
| ES (1) | ES461350A1 (OSRAM) |
| FR (1) | FR2360569A1 (OSRAM) |
| GB (1) | GB1540563A (OSRAM) |
| IN (1) | IN146425B (OSRAM) |
| ZA (1) | ZA774722B (OSRAM) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2743542A1 (de) * | 1977-09-28 | 1979-04-05 | Bayer Ag | Verfahren zur herstellung von sulfonsaeurechloriden |
| DE2743541A1 (de) * | 1977-09-28 | 1979-04-05 | Bayer Ag | Verfahren zur herstellung von sulfonsaeurechloriden |
| DE2743540C2 (de) * | 1977-09-28 | 1987-04-09 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Sulfonsäurechloriden |
| US4678612A (en) * | 1986-01-31 | 1987-07-07 | Stauffer Chemical Company | Process for the production of arylsulfonyl halides |
| US4696774A (en) * | 1986-03-24 | 1987-09-29 | Stauffer Chemical Company | Decolorizing arylsulfonyl halides |
| EP0289847B1 (de) * | 1987-05-01 | 1990-10-31 | Bayer Ag | Verfahren zur Herstellung von 2-Chlor-5-nitro- und 4-Chlor-3-nitrobenzolsulfonsäurechlorid |
| JP7324082B2 (ja) * | 2019-08-07 | 2023-08-09 | 東ソー・ファインケム株式会社 | カルボン酸無水物またはスルホン酸無水物の製造方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2888486A (en) * | 1953-11-20 | 1959-05-26 | Du Pont | Process for producing aromatic sulfonyl halides |
| DE1026750B (de) * | 1955-01-28 | 1958-03-27 | Ciba Geigy | Verfahren zur Herstellung organischer Saeurehalogenide |
| GB1163934A (en) * | 1966-02-28 | 1969-09-10 | Ici Ltd | Production of Sulphonyl Chlorides |
| US3701806A (en) * | 1966-06-10 | 1972-10-31 | Union Carbide Corp | Process for preparing a mixture of aromatic sulfones and aromatic sulfonyl chlorides |
| US3772373A (en) * | 1969-10-30 | 1973-11-13 | Standard Oil Co | Preparation of high molecular weight alkylbenzene sulfonyl chlorides |
-
1976
- 1976-08-05 DE DE19762635281 patent/DE2635281A1/de active Granted
-
1977
- 1977-07-02 IN IN998/CAL/77A patent/IN146425B/en unknown
- 1977-07-19 US US05/817,464 patent/US4105692A/en not_active Expired - Lifetime
- 1977-08-02 GB GB32380/77A patent/GB1540563A/en not_active Expired
- 1977-08-02 CH CH950777A patent/CH629763A5/de not_active IP Right Cessation
- 1977-08-03 JP JP52092612A patent/JPS5842865B2/ja not_active Expired
- 1977-08-04 ZA ZA00774722A patent/ZA774722B/xx unknown
- 1977-08-04 BR BR7705141A patent/BR7705141A/pt unknown
- 1977-08-04 ES ES461350A patent/ES461350A1/es not_active Expired
- 1977-08-05 FR FR7724273A patent/FR2360569A1/fr active Granted
- 1977-08-05 BE BE2056130A patent/BE857498A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IN146425B (OSRAM) | 1979-06-02 |
| DE2635281A1 (de) | 1978-02-09 |
| FR2360569A1 (fr) | 1978-03-03 |
| ZA774722B (en) | 1978-06-28 |
| BE857498A (fr) | 1978-02-06 |
| GB1540563A (en) | 1979-02-14 |
| BR7705141A (pt) | 1978-05-16 |
| ES461350A1 (es) | 1978-06-16 |
| FR2360569B1 (OSRAM) | 1983-11-04 |
| DE2635281C2 (OSRAM) | 1989-04-27 |
| JPS5318536A (en) | 1978-02-20 |
| JPS5842865B2 (ja) | 1983-09-22 |
| US4105692A (en) | 1978-08-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2635281C2 (OSRAM) | ||
| EP0010162B1 (de) | Verfahren zur Herstellung von Alkansulfonsäurechloriden | |
| EP1279664B1 (de) | Verfahren zur Herstellung von Salzen der Methallylsulfonsäure | |
| EP0018541B1 (de) | Verfahren zur Herstellung von 4-Nitrotoluol-2-sulfonsäure | |
| DE2263580A1 (de) | Verfahren zur herstellung von alphachlorcarbonsaeurechloriden | |
| DE2635279A1 (de) | Verfahren zur herstellung von benzolsulfonsaeurechlorid | |
| EP0045425B1 (de) | Verfahren zur Halogenierung von gegebenenfalls substituierten 4-tert.-Butyltoluolen sowie die daraus erhaltenen Gemische aus gegebenenfalls substituierten 4-tert.-Butylbenzalhalogeniden, 4-tert.-Butylbenzylhalogeniden und 4-tert.-Butylbenzotrihalogeniden | |
| DE2554702A1 (de) | Verfahren zur entalkylierung von tert.-alkyl-substituierten phenolen | |
| EP0518875A1 (de) | Verfahren zur herstellung von 3-nitrobenzolsulfonsäurechlorid. | |
| DE2431409C2 (de) | Verfahren zur Herstellung von 1-Aminoanthrachinon | |
| EP0001276B1 (de) | Verfahren zur Herstellung von Sulfonsäurechloriden | |
| EP0143750B1 (de) | Verfahren zur Herstellung von 4-Nitrotoluol-2-sulfonsäure | |
| DE2708388A1 (de) | Verfahren zur herstellung von 4,4'- dihydroxydiphenylsulfon | |
| EP0013558B1 (de) | Verfahren zur Herstellung von Naphthalin-1,3,5-trisulfonsäure | |
| DE3201761C2 (OSRAM) | ||
| EP0021211A1 (de) | Verfahren zur Herstellung von Dimethylcarbonat | |
| DE2743541A1 (de) | Verfahren zur herstellung von sulfonsaeurechloriden | |
| DE3802372A1 (de) | Neue fluorbenzophenone und fluorbenzoesaeurefluorphenylester sowie verfahren zu ihrer herstellung | |
| DE2509738B2 (de) | Verfahren zur kontinuierlichen Herstellung von l^-Dioxa^^-dithiacycl 2,4-tetroxid Carbylsulfat | |
| DE2721429A1 (de) | Verfahren zur herstellung von sulfonsaeurechloriden | |
| DE2049049A1 (de) | Verfahren zur Herstellung von Isopren | |
| CH634043A5 (de) | Verfahren zur herstellung von naphthalin-1,3,6-trisulfonsaeure. | |
| EP0045430A1 (de) | Verfahren zur alpha-Bromierung von gegebenenfalls substituierten Fluortoluolen und Gemische von in alpha-Stellung verschieden hoch bromierten, gegebenenfalls substituierten Fluortoluolen | |
| DE2804080C3 (de) | Verfahren zur Herstellung von 4,4'-Dihydroxy-diphenylsulfon | |
| DE2636381C3 (de) | Verfahren zur Herstellung von Dichlormaleinsäureanhydrid durch Oxidation von Hexachlorbutadien |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |