CH626627A5 - Process for preparing carboxyl-containing organic phosphorus compounds - Google Patents
Process for preparing carboxyl-containing organic phosphorus compounds Download PDFInfo
- Publication number
- CH626627A5 CH626627A5 CH1053176A CH1053176A CH626627A5 CH 626627 A5 CH626627 A5 CH 626627A5 CH 1053176 A CH1053176 A CH 1053176A CH 1053176 A CH1053176 A CH 1053176A CH 626627 A5 CH626627 A5 CH 626627A5
- Authority
- CH
- Switzerland
- Prior art keywords
- reaction
- general formula
- solvent
- hydrochloric acid
- mixture
- Prior art date
Links
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 title claims description 16
- 150000002903 organophosphorus compounds Chemical class 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 29
- 238000000034 method Methods 0.000 claims description 29
- 238000006243 chemical reaction Methods 0.000 claims description 22
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims description 18
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 12
- 150000001735 carboxylic acids Chemical class 0.000 claims description 11
- 239000002904 solvent Substances 0.000 claims description 11
- 239000007795 chemical reaction product Substances 0.000 claims description 9
- 230000003647 oxidation Effects 0.000 claims description 9
- 238000007254 oxidation reaction Methods 0.000 claims description 9
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 7
- 239000007800 oxidant agent Substances 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 5
- REJGOFYVRVIODZ-UHFFFAOYSA-N phosphanium;chloride Chemical class P.Cl REJGOFYVRVIODZ-UHFFFAOYSA-N 0.000 claims description 5
- 150000003003 phosphines Chemical class 0.000 claims description 5
- 239000000047 product Substances 0.000 claims description 5
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 238000002955 isolation Methods 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 3
- 239000011261 inert gas Substances 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- 239000002253 acid Substances 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 239000007787 solid Substances 0.000 description 6
- 238000007127 saponification reaction Methods 0.000 description 5
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 4
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- SAWKFRBJGLMMES-UHFFFAOYSA-N methylphosphine Chemical compound PC SAWKFRBJGLMMES-UHFFFAOYSA-N 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- STCBUTTVBMCYJL-UHFFFAOYSA-N 3-[2-carboxyethyl(methyl)phosphoryl]propanoic acid Chemical compound OC(=O)CCP(=O)(C)CCC(O)=O STCBUTTVBMCYJL-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- -1 halocarboxylic acid esters Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000005580 one pot reaction Methods 0.000 description 2
- MEUIIHOXOWVKNP-UHFFFAOYSA-N phosphanylformic acid Chemical class OC(P)=O MEUIIHOXOWVKNP-UHFFFAOYSA-N 0.000 description 2
- 150000003018 phosphorus compounds Chemical class 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- AXQINQNZPZQNSB-UHFFFAOYSA-N 3-[2-carboxyethyl(methyl)phosphanyl]propanoic acid Chemical compound OC(=O)CCP(C)CCC(O)=O AXQINQNZPZQNSB-UHFFFAOYSA-N 0.000 description 1
- MMHHJEKZUDOAGU-UHFFFAOYSA-N 3-[2-cyanoethyl(methyl)phosphanyl]propanenitrile Chemical compound N#CCCP(C)CCC#N MMHHJEKZUDOAGU-UHFFFAOYSA-N 0.000 description 1
- LNESPAROBMUDRI-UHFFFAOYSA-N 3-[2-cyanoethyl(methyl)phosphoryl]propanenitrile Chemical compound N#CCCP(=O)(C)CCC#N LNESPAROBMUDRI-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 238000005654 Michaelis-Arbuzov synthesis reaction Methods 0.000 description 1
- SGGXJIHKGXZXTQ-UHFFFAOYSA-N OC(=O)[PH2]=O Chemical class OC(=O)[PH2]=O SGGXJIHKGXZXTQ-UHFFFAOYSA-N 0.000 description 1
- DWWZQNMVKNZOHR-UHFFFAOYSA-N OC([P])=O Chemical class OC([P])=O DWWZQNMVKNZOHR-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 125000004036 acetal group Chemical group 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- LSKVBJHJMLFTDB-UHFFFAOYSA-N chloro(methyl)phosphane Chemical compound CPCl LSKVBJHJMLFTDB-UHFFFAOYSA-N 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- CDPKWOKGVUHZFR-UHFFFAOYSA-N dichloro(methyl)phosphane Chemical compound CP(Cl)Cl CDPKWOKGVUHZFR-UHFFFAOYSA-N 0.000 description 1
- YOTZYFSGUCFUKA-UHFFFAOYSA-N dimethylphosphine Chemical compound CPC YOTZYFSGUCFUKA-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 1
- 150000003977 halocarboxylic acids Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229940071125 manganese acetate Drugs 0.000 description 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- AUONHKJOIZSQGR-UHFFFAOYSA-N oxophosphane Chemical group P=O AUONHKJOIZSQGR-UHFFFAOYSA-N 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- UNQNIRQQBJCMQR-UHFFFAOYSA-N phosphorine Chemical compound C1=CC=PC=C1 UNQNIRQQBJCMQR-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 150000007934 α,β-unsaturated carboxylic acids Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/50—Organo-phosphines
- C07F9/53—Organo-phosphine oxides; Organo-phosphine thioxides
- C07F9/5304—Acyclic saturated phosphine oxides or thioxides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2540283A DE2540283C3 (de) | 1975-09-10 | 1975-09-10 | Verfahren zur Herstellung von carboxylgruppenhaltigen organischen Phosphorverbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH626627A5 true CH626627A5 (en) | 1981-11-30 |
Family
ID=5956081
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1053176A CH626627A5 (en) | 1975-09-10 | 1976-08-18 | Process for preparing carboxyl-containing organic phosphorus compounds |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS5233628A (OSRAM) |
| AT (1) | AT341542B (OSRAM) |
| BE (1) | BE845987A (OSRAM) |
| CA (1) | CA1066715A (OSRAM) |
| CH (1) | CH626627A5 (OSRAM) |
| DD (1) | DD126885A5 (OSRAM) |
| DE (1) | DE2540283C3 (OSRAM) |
| DK (1) | DK406976A (OSRAM) |
| FR (1) | FR2323695A1 (OSRAM) |
| GB (1) | GB1517865A (OSRAM) |
| IE (1) | IE43625B1 (OSRAM) |
| IT (1) | IT1076807B (OSRAM) |
| NL (1) | NL7609964A (OSRAM) |
| SE (1) | SE422802B (OSRAM) |
| SU (1) | SU618047A3 (OSRAM) |
| ZA (1) | ZA765384B (OSRAM) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4537993A (en) * | 1984-03-19 | 1985-08-27 | American Cyanamid Company | Bis(β-carboxyethyl)isobutyl, sec. butyl and t-butyl phosphine oxide and polyamides containing the same |
| DE19613067C2 (de) * | 1996-04-01 | 1998-12-03 | Clariant Gmbh | Phosphormodifizierte Epoxidharzmischungen aus Epoxidharzen, phosphorhaltigen Verbindungen und einem Härter, ein Verfahren zu deren Herstellung und ihre Verwendung |
| DE19613066C2 (de) * | 1996-04-01 | 1998-09-10 | Clariant Gmbh | Verfahren zur Herstellung phosphormodifizierter Epoxidharze |
| DE19828863C1 (de) * | 1998-06-29 | 1999-09-02 | Clariant Gmbh | Verfahren zur Herstellung von Phosphinsäureestern und deren Verwendung |
| DE19828861C1 (de) * | 1998-06-29 | 1999-12-02 | Clariant Gmbh | Verfahren zur Herstellung von Phosphonigsäureestern und deren Verwendung |
| DE19923617C2 (de) | 1999-05-25 | 2001-10-31 | Clariant Gmbh | Verfahren zur Herstellung von Phosphinsäureestern |
| DE10153780C1 (de) | 2001-11-02 | 2002-11-28 | Clariant Gmbh | Verfahren zur Herstellung von Carboxyethylmethylphosphinsäureglykolester und ihre Verwendung |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2957931A (en) * | 1949-07-28 | 1960-10-25 | Socony Mobil Oil Co Inc | Synthesis of compounds having a carbonphosphorus linkage |
| US3029272A (en) * | 1958-10-17 | 1962-04-10 | Commercial Solvents Corp | Alkylation of phosphonates |
| DE2100779A1 (de) * | 1971-01-08 | 1972-07-20 | Farbwerke Hoechst AG vormals Meister Lucius & Brüning, 6000 Frankfurt | Verfahren zur Herstellung von Dialkylphosphinsäureestern |
-
1975
- 1975-09-10 DE DE2540283A patent/DE2540283C3/de not_active Expired
-
1976
- 1976-08-18 CH CH1053176A patent/CH626627A5/de not_active IP Right Cessation
- 1976-08-23 CA CA259,647A patent/CA1066715A/en not_active Expired
- 1976-08-26 GB GB35553/76A patent/GB1517865A/en not_active Expired
- 1976-08-30 SE SE7609574A patent/SE422802B/xx unknown
- 1976-08-30 SU SU762391504A patent/SU618047A3/ru active
- 1976-09-08 AT AT665176A patent/AT341542B/de not_active IP Right Cessation
- 1976-09-08 NL NL7609964A patent/NL7609964A/xx not_active Application Discontinuation
- 1976-09-08 DD DD194694A patent/DD126885A5/xx unknown
- 1976-09-08 IT IT51168/76A patent/IT1076807B/it active
- 1976-09-09 JP JP51108399A patent/JPS5233628A/ja active Pending
- 1976-09-09 ZA ZA765384A patent/ZA765384B/xx unknown
- 1976-09-09 BE BE170461A patent/BE845987A/xx not_active IP Right Cessation
- 1976-09-09 IE IE2019/76A patent/IE43625B1/en unknown
- 1976-09-09 DK DK406976A patent/DK406976A/da unknown
- 1976-09-10 FR FR7627378A patent/FR2323695A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| IE43625B1 (en) | 1981-04-22 |
| DE2540283B2 (de) | 1980-07-10 |
| NL7609964A (nl) | 1977-03-14 |
| IE43625L (en) | 1977-03-10 |
| ZA765384B (en) | 1977-09-28 |
| SE422802B (sv) | 1982-03-29 |
| DE2540283C3 (de) | 1981-10-01 |
| DD126885A5 (OSRAM) | 1977-08-17 |
| IT1076807B (it) | 1985-04-27 |
| FR2323695A1 (fr) | 1977-04-08 |
| SU618047A3 (ru) | 1978-07-30 |
| JPS5233628A (en) | 1977-03-14 |
| DE2540283A1 (de) | 1977-03-17 |
| CA1066715A (en) | 1979-11-20 |
| AT341542B (de) | 1978-02-10 |
| BE845987A (fr) | 1977-03-09 |
| FR2323695B1 (OSRAM) | 1980-05-23 |
| SE7609574L (sv) | 1977-03-11 |
| GB1517865A (en) | 1978-07-12 |
| DK406976A (da) | 1977-03-11 |
| ATA665176A (de) | 1977-06-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2236036C3 (de) | Diphosphinsäureester | |
| DE1248654B (de) | Verfahren zur Herstellung von Phosphonsäuren und deren Salzen | |
| CH626627A5 (en) | Process for preparing carboxyl-containing organic phosphorus compounds | |
| EP0665237B1 (de) | Verfahren zur Herstellung phosphorhaltiger Dicarbonsäurealkylester und Dicarbonsäuren | |
| EP0150739A1 (de) | Verfahren zur Herstellung alkanphosphoniger Säuren | |
| EP0080149A1 (de) | Verfahren zur Herstellung phosphoniger Säuren | |
| DE2605307C2 (de) | Verfahren zur Herstellung von Hydroxyalkylphosphinoxiden und -sulfiden | |
| EP0176026A1 (de) | Verfahren zur Herstellung von 2,4-Dichlor-5-fluor-benzoesäure | |
| EP0082472B1 (de) | Verfahren zur Herstellung von 3-Amino-1-hydroxypropan-1,1-diphosphonsäure | |
| DE3025377C2 (de) | Verfahren zur Herstellung von Benzolphosphonsäurediphenylester | |
| DE2511932C2 (de) | Verfahren zur Herstellung von tert.-Hydroxyalkylphosphinoxiden | |
| EP0022546A2 (de) | Verfahren zur Herstellung von 1-Oxophospholan-chlorhydrinen sowie einige spezielle dieser Verbindungen | |
| DE60105171T2 (de) | Verfahren zur herstellung von gehinderten phosphiten | |
| EP0144743B1 (de) | Verfahren zur Herstellung organischer Chlorphosphane | |
| DE19502331C1 (de) | Verfahren zur Herstellung von Alkalimetallsalzen von Phosphonsäuremonomethylestern | |
| DE3323392A1 (de) | Verfahren zur herstellung von derivaten der vinylphosphon-, oder vinylpyrophosphonsaeure | |
| DE1793778C3 (de) | Neues sekundäres Phosphinoxyd | |
| DE605174C (de) | Verfahren zur Herstellung tertiaerer organischer Phosphate | |
| DE2226406C3 (de) | Verfahren zur Herstellung von Alkylhydroxymethylphosphinsäureestern | |
| DE1216278B (de) | Verfahren zur Herstellung von unsymmetrischen Phosphorigsaeure-O, O-diestern | |
| DE2619574C3 (de) | Verfahren zur Herstellung von 3-Brompropionsäureamid | |
| DE2719385C3 (de) | Verfahren zur Herstellung von Phosphon- und Phosphinsäuren | |
| DE2516343A1 (de) | Verfahren zur herstellung phosphorhaltiger aldehyddiacylate | |
| DE19708722A1 (de) | Verfahren zur Herstellung von Alkyl-1-alkoxyethylphosphinsäuren | |
| DE2647042A1 (de) | Neue phosphoncarbonsaeureverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |