CH626355A5 - - Google Patents
Download PDFInfo
- Publication number
- CH626355A5 CH626355A5 CH167076A CH167076A CH626355A5 CH 626355 A5 CH626355 A5 CH 626355A5 CH 167076 A CH167076 A CH 167076A CH 167076 A CH167076 A CH 167076A CH 626355 A5 CH626355 A5 CH 626355A5
- Authority
- CH
- Switzerland
- Prior art keywords
- reaction
- cyanuric chloride
- chloro
- amine
- triazines
- Prior art date
Links
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 83
- 150000001412 amines Chemical class 0.000 claims description 41
- 238000000034 method Methods 0.000 claims description 37
- 238000006243 chemical reaction Methods 0.000 claims description 30
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 claims description 30
- 239000000047 product Substances 0.000 claims description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 25
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 23
- 150000002576 ketones Chemical class 0.000 claims description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 21
- 239000011541 reaction mixture Substances 0.000 claims description 21
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 17
- 230000015572 biosynthetic process Effects 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 14
- 239000012071 phase Substances 0.000 claims description 13
- 239000000370 acceptor Substances 0.000 claims description 12
- 238000003786 synthesis reaction Methods 0.000 claims description 11
- FVFVNNKYKYZTJU-UHFFFAOYSA-N 6-chloro-1,3,5-triazine-2,4-diamine Chemical class NC1=NC(N)=NC(Cl)=N1 FVFVNNKYKYZTJU-UHFFFAOYSA-N 0.000 claims description 9
- 229930195733 hydrocarbon Natural products 0.000 claims description 9
- 150000002430 hydrocarbons Chemical class 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 9
- 230000035484 reaction time Effects 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 9
- 239000006227 byproduct Substances 0.000 claims description 8
- MCLXKFUCPVGZEN-UHFFFAOYSA-N 4,6-dichloro-1,3,5-triazin-2-amine Chemical class NC1=NC(Cl)=NC(Cl)=N1 MCLXKFUCPVGZEN-UHFFFAOYSA-N 0.000 claims description 7
- 239000003513 alkali Substances 0.000 claims description 7
- 229910021529 ammonia Inorganic materials 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 238000010586 diagram Methods 0.000 claims description 6
- 238000005755 formation reaction Methods 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 239000007795 chemical reaction product Substances 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 239000011877 solvent mixture Substances 0.000 claims description 5
- MCNLTUITFWBDSX-UHFFFAOYSA-N 4-chlorotriazin-5-amine Chemical compound NC1=CN=NN=C1Cl MCNLTUITFWBDSX-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 238000001816 cooling Methods 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 230000000694 effects Effects 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 238000007086 side reaction Methods 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 238000001704 evaporation Methods 0.000 claims description 3
- 230000007062 hydrolysis Effects 0.000 claims description 3
- 238000006460 hydrolysis reaction Methods 0.000 claims description 3
- 125000006431 methyl cyclopropyl group Chemical group 0.000 claims description 3
- 230000000269 nucleophilic effect Effects 0.000 claims description 3
- 239000000376 reactant Substances 0.000 claims description 3
- 239000000725 suspension Substances 0.000 claims description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims description 2
- 230000006735 deficit Effects 0.000 claims description 2
- 230000008020 evaporation Effects 0.000 claims description 2
- -1 for example Substances 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 229910000069 nitrogen hydride Inorganic materials 0.000 claims description 2
- 239000012074 organic phase Substances 0.000 claims description 2
- 238000005576 amination reaction Methods 0.000 claims 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims 3
- 125000001931 aliphatic group Chemical group 0.000 claims 2
- MXWJVTOOROXGIU-UHFFFAOYSA-N atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 claims 2
- 239000000460 chlorine Substances 0.000 claims 2
- 238000006467 substitution reaction Methods 0.000 claims 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims 1
- 125000004414 alkyl thio group Chemical group 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- 239000003153 chemical reaction reagent Substances 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 239000013067 intermediate product Substances 0.000 claims 1
- 230000020477 pH reduction Effects 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- WJNRPILHGGKWCK-UHFFFAOYSA-N propazine Chemical compound CC(C)NC1=NC(Cl)=NC(NC(C)C)=N1 WJNRPILHGGKWCK-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 13
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 12
- 239000004215 Carbon black (E152) Substances 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 5
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 238000010626 work up procedure Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 150000003973 alkyl amines Chemical class 0.000 description 3
- 239000012062 aqueous buffer Substances 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 2
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 2
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- XIPUIGPNIDKXJU-UHFFFAOYSA-N [CH]1CC1 Chemical compound [CH]1CC1 XIPUIGPNIDKXJU-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 238000010924 continuous production Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- BKIMMITUMNQMOS-UHFFFAOYSA-N nonane Chemical compound CCCCCCCCC BKIMMITUMNQMOS-UHFFFAOYSA-N 0.000 description 2
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 238000007614 solvation Methods 0.000 description 2
- 238000000935 solvent evaporation Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- HUMMCZRNZCKXHL-UHFFFAOYSA-N 1-aminocyclohexane-1-carbonitrile Chemical compound N#CC1(N)CCCCC1 HUMMCZRNZCKXHL-UHFFFAOYSA-N 0.000 description 1
- JCLSEQJEXYHVTC-UHFFFAOYSA-N 2-amino-2-methylbutanenitrile Chemical compound CCC(C)(N)C#N JCLSEQJEXYHVTC-UHFFFAOYSA-N 0.000 description 1
- RHLVCLIPMVJYKS-UHFFFAOYSA-N 3-octanone Chemical compound CCCCCC(=O)CC RHLVCLIPMVJYKS-UHFFFAOYSA-N 0.000 description 1
- CCCIYAQYQZQDIZ-UHFFFAOYSA-N 6-methylheptan-3-one Chemical compound CCC(=O)CCC(C)C CCCIYAQYQZQDIZ-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000012430 organic reaction media Substances 0.000 description 1
- 238000010979 pH adjustment Methods 0.000 description 1
- 238000001139 pH measurement Methods 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000003303 reheating Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- ODCWYMIRDDJXKW-UHFFFAOYSA-N simazine Chemical compound CCNC1=NC(Cl)=NC(NCC)=N1 ODCWYMIRDDJXKW-UHFFFAOYSA-N 0.000 description 1
- 235000002639 sodium chloride Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- QXADHXQCAQTNGW-UHFFFAOYSA-M sodium;boric acid;hydroxide Chemical compound [OH-].[Na+].OB(O)O QXADHXQCAQTNGW-UHFFFAOYSA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/48—Two nitrogen atoms
- C07D251/50—Two nitrogen atoms with a halogen atom attached to the third ring carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/42—One nitrogen atom
- C07D251/44—One nitrogen atom with halogen atoms attached to the two other ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2505704A DE2505704C3 (de) | 1975-02-12 | 1975-02-12 | Verfahren zur Herstellung von gegebenenfalls substituierten 2-Alkylamino-4,6-dichlor-s-triazinen und 2,4-Bis alkylamino-6-chlor-s-triazinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH626355A5 true CH626355A5 (enExample) | 1981-11-13 |
Family
ID=5938607
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH167076A CH626355A5 (enExample) | 1975-02-12 | 1976-02-11 |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4058662A (enExample) |
| JP (1) | JPS51105085A (enExample) |
| AT (1) | AT350578B (enExample) |
| AU (1) | AU1103776A (enExample) |
| BE (1) | BE838471A (enExample) |
| BR (1) | BR7600819A (enExample) |
| CA (1) | CA1041508A (enExample) |
| CH (1) | CH626355A5 (enExample) |
| DD (1) | DD124383A5 (enExample) |
| DE (1) | DE2505704C3 (enExample) |
| ES (1) | ES444742A1 (enExample) |
| FR (1) | FR2300764A1 (enExample) |
| GB (1) | GB1523362A (enExample) |
| HU (1) | HU175456B (enExample) |
| IL (1) | IL49013A (enExample) |
| IT (1) | IT1060487B (enExample) |
| MX (1) | MX4470E (enExample) |
| NL (1) | NL7600865A (enExample) |
| RO (1) | RO76667A (enExample) |
| SU (1) | SU725556A1 (enExample) |
| ZA (1) | ZA76831B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1027241B (it) * | 1975-01-03 | 1978-11-20 | Rumianca Spa | Procedimento per la produzione di cloro amino s triazine |
| IT1081516B (it) * | 1977-07-07 | 1985-05-21 | Rumianca Spa | Procedimetno per la produzione di cloro-bis(alchilammine)-s-triazine |
| US4166909A (en) * | 1978-01-23 | 1979-09-04 | Shell Oil Company | Process for preparation of a substituted triazine |
| IT1099676B (it) * | 1978-09-29 | 1985-09-28 | Rumianca Spa | Procedimento per la preparazione di cloro-bis (alchilammino)-s-triazine |
| DE2912267A1 (de) * | 1979-03-28 | 1980-10-09 | Rumianca Spa | Verfahren zur kontinuierlichen herstellung von chlor-di-(alkylamino)- s-triazinen |
| US4275204A (en) * | 1979-09-07 | 1981-06-23 | Rumianca S.P.A. | Preparation of chloro-bis(alkylamino)-s-triazines |
| US4224444A (en) * | 1979-10-01 | 1980-09-23 | Rumianca S.P.A. | Process for the preparation of chloro-bis(alkylamino)-s-triazines |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3244712A (en) * | 1960-02-19 | 1966-04-05 | Geigy Ag J R | Acylamino symmetrical triazines |
| CH476746A (de) * | 1965-12-13 | 1969-08-15 | Agripat Sa | Verfahren zur Herstellung von Chlor-diamino-s-triazinen |
| US3505325A (en) * | 1966-07-16 | 1970-04-07 | Degussa | Cyanoalkylamino substituted triazines having plant growth regulating action |
| CH546247A (de) * | 1968-12-27 | 1974-02-28 | Agripat Sa | Adiabatisches verfahren zur herstellung von n-monosubstituierten 2,4-dichlor-6-amino-s-triazinen. |
| US3766182A (en) * | 1971-05-26 | 1973-10-16 | Ciba Geigy Corp | S-triazine derivatives |
| US3821220A (en) * | 1972-01-04 | 1974-06-28 | Ciba Geigy Corp | Reducing hydrogen cyanide levels in the formation of cyanoalkylamino substituted triazines |
| US3947374A (en) * | 1973-03-21 | 1976-03-30 | American Cyanamid Company | Substituted halotriazines as peroxygen bleach activators |
-
1975
- 1975-01-29 ES ES444742A patent/ES444742A1/es not_active Expired
- 1975-02-12 DE DE2505704A patent/DE2505704C3/de not_active Expired
-
1976
- 1976-01-28 MX MX763638U patent/MX4470E/es unknown
- 1976-01-28 NL NL7600865A patent/NL7600865A/xx not_active Application Discontinuation
- 1976-02-09 GB GB4900/76A patent/GB1523362A/en not_active Expired
- 1976-02-09 FR FR7603452A patent/FR2300764A1/fr active Granted
- 1976-02-10 US US05/656,849 patent/US4058662A/en not_active Expired - Lifetime
- 1976-02-10 BR BR7600819A patent/BR7600819A/pt unknown
- 1976-02-10 HU HU76DE905A patent/HU175456B/hu unknown
- 1976-02-10 SU SU2323877A patent/SU725556A1/ru active
- 1976-02-10 DD DD191179A patent/DD124383A5/xx unknown
- 1976-02-10 IT IT48021/76A patent/IT1060487B/it active
- 1976-02-11 AT AT96376A patent/AT350578B/de not_active IP Right Cessation
- 1976-02-11 CH CH167076A patent/CH626355A5/de not_active IP Right Cessation
- 1976-02-11 RO RO7684758A patent/RO76667A/ro unknown
- 1976-02-11 BE BE6045361A patent/BE838471A/xx unknown
- 1976-02-11 IL IL49013A patent/IL49013A/xx unknown
- 1976-02-12 CA CA245,605A patent/CA1041508A/en not_active Expired
- 1976-02-12 JP JP51014356A patent/JPS51105085A/ja active Pending
- 1976-02-12 AU AU11037/76A patent/AU1103776A/en not_active Expired
- 1976-02-12 ZA ZA831A patent/ZA76831B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL49013A (en) | 1980-02-29 |
| AU1103776A (en) | 1977-08-18 |
| DE2505704B2 (de) | 1979-12-13 |
| RO76667A (ro) | 1981-04-30 |
| IL49013A0 (en) | 1976-04-30 |
| CA1041508A (en) | 1978-10-31 |
| NL7600865A (nl) | 1976-08-16 |
| BE838471A (fr) | 1976-08-11 |
| IT1060487B (it) | 1982-08-20 |
| DE2505704A1 (de) | 1976-08-26 |
| GB1523362A (en) | 1978-08-31 |
| ATA96376A (de) | 1978-11-15 |
| FR2300764B1 (enExample) | 1980-05-09 |
| AT350578B (de) | 1979-06-11 |
| ES444742A1 (es) | 1977-08-16 |
| DD124383A5 (enExample) | 1977-02-16 |
| DE2505704C3 (de) | 1980-08-21 |
| US4058662A (en) | 1977-11-15 |
| MX4470E (es) | 1982-05-18 |
| HU175456B (hu) | 1980-08-28 |
| FR2300764A1 (fr) | 1976-09-10 |
| JPS51105085A (enExample) | 1976-09-17 |
| SU725556A3 (en) | 1980-03-30 |
| BR7600819A (pt) | 1976-09-14 |
| SU725556A1 (ru) | 1980-03-30 |
| ZA76831B (en) | 1977-01-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2909650C2 (enExample) | ||
| EP0172515B1 (de) | Alpha-(o-chlorphenyl)-aminomethylen-beta-formylaminopropionitril, Verfahren zu seiner Herstellung sowie Verwendung zur Herstellung von 2-Methyl-4-amino-5-formylaminomethylpyrimidin | |
| DE2502893C2 (de) | Cycloaliphatische Amine | |
| CH626355A5 (enExample) | ||
| EP0697406B1 (de) | Verfahren zur Herstellung von 4,6-Dichlor- oder 2,4,6-Trichlorpyrimidin aus 4,6-Dihydroxypyrimidin oder Barbitursäure | |
| EP0075174B1 (de) | Verfahren zur Herstellung von 4-Nitrodiphenylaminen | |
| DE2505703C3 (de) | Verfahren zur Herstellung von gegebenenfalls substituierten 2-Alkylamino-4,6-dichlor-s-triazinen und 2,4-Bisalkylamino-6-chlor-s-triazinen | |
| EP0135833B1 (de) | Verfahren zur Herstellung von 2-Amino-alkylpyridinen | |
| DE1964619A1 (de) | Adiabatisches Verfahren zur Herstellung von 2,4-Dichlor-6-amino-s-triazinen | |
| DE69527719T2 (de) | Synthese penta-substituierter guanidine | |
| EP0003052B1 (de) | Verfahren zur Herstellung von 4-Methyl-5-chlormethylimidazol | |
| DE1232127B (de) | Verfahren zur Herstellung von gesaettigten aliphatischen oder aromatischen Nitrilen | |
| EP0158928A1 (de) | Verfahren zur Herstellung von reinem 2,6-Dichlorbenzonitril | |
| EP3490972B1 (de) | Verfahren zur herstellung von fluoralkylnitrilen und den entsprechenden fluoralkyltetrazolen | |
| EP0158115B1 (de) | Verfahren zur Herstellung von Iminodibenzyl | |
| EP0013007A1 (de) | Verfahren zur Herstellung von 4-Methyl-2-aminobenzthiazol | |
| EP0306453B1 (de) | Verfahren zur Herstellung von 2-(2-Chloroäthoxy)-benzosulfonamid | |
| DE2742158A1 (de) | Herstellung substituierter harnstoffe | |
| EP0523619A2 (de) | Verfahren zur Herstellung von N-Cyanimidocarbonaten | |
| DE2261272C3 (de) | Verfahren zur Herstellung von Diaminomaleinsäuredinitril | |
| DE3101650A1 (de) | "verfahren zur herstellung von reinem, lagerbestaendigem acetoacetamid" | |
| DE2043378C3 (de) | Verfahren zur Herstellung von Lactamkomplexen | |
| EP0924189A2 (de) | Herstellung von N-Phenyl-1-naphthylamin | |
| DE2261272B2 (de) | Verfahren zur herstellung von diaminomaleinsaeuredinitril | |
| DE2045905A1 (de) | Substituierte Thioätherverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |