CH626063A5 - - Google Patents
Download PDFInfo
- Publication number
- CH626063A5 CH626063A5 CH119977A CH119977A CH626063A5 CH 626063 A5 CH626063 A5 CH 626063A5 CH 119977 A CH119977 A CH 119977A CH 119977 A CH119977 A CH 119977A CH 626063 A5 CH626063 A5 CH 626063A5
- Authority
- CH
- Switzerland
- Prior art keywords
- sulfuric acid
- line
- lactam
- ammonia
- ammonium
- Prior art date
Links
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 62
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 49
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 34
- 229910021529 ammonia Inorganic materials 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 17
- 150000003951 lactams Chemical class 0.000 claims description 16
- 239000000203 mixture Substances 0.000 claims description 15
- 239000011541 reaction mixture Substances 0.000 claims description 14
- 150000003863 ammonium salts Chemical class 0.000 claims description 13
- 238000004519 manufacturing process Methods 0.000 claims description 10
- 239000007864 aqueous solution Substances 0.000 claims description 8
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 claims description 6
- 230000015572 biosynthetic process Effects 0.000 claims description 5
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 20
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 20
- 235000011130 ammonium sulphate Nutrition 0.000 description 20
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 12
- 239000007789 gas Substances 0.000 description 12
- 238000006386 neutralization reaction Methods 0.000 description 12
- WWILHZQYNPQALT-UHFFFAOYSA-N 2-methyl-2-morpholin-4-ylpropanal Chemical compound O=CC(C)(C)N1CCOCC1 WWILHZQYNPQALT-UHFFFAOYSA-N 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- VEZUQRBDRNJBJY-UHFFFAOYSA-N cyclohexanone oxime Chemical compound ON=C1CCCCC1 VEZUQRBDRNJBJY-UHFFFAOYSA-N 0.000 description 8
- 238000000354 decomposition reaction Methods 0.000 description 8
- 238000000605 extraction Methods 0.000 description 8
- 230000008707 rearrangement Effects 0.000 description 8
- 229910001868 water Inorganic materials 0.000 description 8
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 229910002092 carbon dioxide Inorganic materials 0.000 description 6
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 6
- 239000006227 byproduct Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 239000000571 coke Substances 0.000 description 3
- 238000002485 combustion reaction Methods 0.000 description 3
- 230000005611 electricity Effects 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229910003657 H2SO4 NH4HSO4 Inorganic materials 0.000 description 2
- -1 Oxime Lactam Chemical class 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 238000006237 Beckmann rearrangement reaction Methods 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000001166 ammonium sulphate Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- XTQHKBHJIVJGKJ-UHFFFAOYSA-N sulfur monoxide Inorganic materials S=O XTQHKBHJIVJGKJ-UHFFFAOYSA-N 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- LSQBSJGVGHPYAZ-UHFFFAOYSA-N triazanium;hydrogen sulfate;sulfate Chemical compound [NH4+].[NH4+].[NH4+].OS([O-])(=O)=O.[O-]S([O-])(=O)=O LSQBSJGVGHPYAZ-UHFFFAOYSA-N 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D201/00—Preparation, separation, purification or stabilisation of unsubstituted lactams
- C07D201/16—Separation or purification
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
- Removal Of Specific Substances (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7601061A NL7601061A (nl) | 1976-02-03 | 1976-02-03 | Werkwijze voor het winnen van epsilon-caprolac- tam uit een epsilon-caprolactamzwavelzuur-reac- tiemengsel. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH626063A5 true CH626063A5 (enExample) | 1981-10-30 |
Family
ID=19825559
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH119977A CH626063A5 (enExample) | 1976-02-03 | 1977-02-01 |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4081442A (enExample) |
| JP (1) | JPS6047253B2 (enExample) |
| AR (1) | AR210197A1 (enExample) |
| BE (1) | BE850374A (enExample) |
| BR (1) | BR7700655A (enExample) |
| CA (1) | CA1084919A (enExample) |
| CH (1) | CH626063A5 (enExample) |
| DE (1) | DE2704561A1 (enExample) |
| ES (1) | ES455523A1 (enExample) |
| FR (1) | FR2351959A1 (enExample) |
| GB (1) | GB1506139A (enExample) |
| IT (1) | IT1083460B (enExample) |
| MX (1) | MX144993A (enExample) |
| NL (1) | NL7601061A (enExample) |
| SU (1) | SU712023A3 (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7700882A (nl) * | 1977-01-28 | 1978-08-01 | Stamicarbon | Werkwijze voor het winnen van epsilon-caprolac- tam uit een epsilon-caprolactamzwavelzuurreac- tiemengsel. |
| DE2900426A1 (de) * | 1978-01-10 | 1979-07-12 | Inst Francais Du Petrol | Verfahren zur umwandlung von ammonium- imidodisulfat, ammoniumsulfamat und ammoniumdithionat in schwefeldioxid und ammoniak |
| US4677074A (en) * | 1984-06-21 | 1987-06-30 | The Lubrizol Corporation | Process for reducing sulfur-containing contaminants in sulfonated hydrocarbons |
| FR2786180B1 (fr) * | 1998-11-19 | 2001-11-23 | Rhone Poulenc Fibres | Procede de traitement de lactames et procede de purification d'un lactame |
| TWI520944B (zh) * | 2015-02-13 | 2016-02-11 | 中國石油化學工業開發股份有限公司 | 己內醯胺之製造方法及其系統 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3264060A (en) * | 1966-08-02 | Simultaneous recovery of pure ammoni- um sulfate and pure lactams from re- arrangement mixtures of alicyclic ketoximes | ||
| DE850746C (de) * | 1944-12-17 | 1952-09-29 | Basf Ag | Verfahren zum Aufarbeiten von durch Basen verunreinigten Lactamen |
| US2723266A (en) * | 1952-05-15 | 1955-11-08 | British Celanese | Process for producing amides and lactams |
| NL132894C (enExample) * | 1961-08-30 | 1900-01-01 | ||
| DE1220398B (de) * | 1962-11-15 | 1966-07-07 | Roehm & Haas Gmbh | Gewinnung von Ammoniak und Schwefeldioxyd aus Ammoniumbisulfat enthaltenden Abfallschwefelsaeuren |
| GB1040807A (en) * | 1963-07-03 | 1966-09-01 | Toyo Rayon Co Ltd | Process for refining crude lactams |
| NL6403701A (enExample) * | 1964-04-08 | 1965-10-11 | ||
| NL7008837A (enExample) * | 1970-06-17 | 1971-12-21 | ||
| US3725391A (en) * | 1970-11-30 | 1973-04-03 | Toray Industries | Process for the preparation of lactams from cycloalkanone oximes |
| US3852273A (en) * | 1971-05-07 | 1974-12-03 | Stamicarbon | Process for preparing and recovering lactams |
| FR2138545B1 (enExample) * | 1971-05-27 | 1973-05-25 | Inst Francais Du Petrole | |
| DE2130036B2 (de) * | 1971-06-18 | 1977-02-10 | Davy Powergas GmbH, 5000 Köln | Verfahren zur herstellung von lactamen |
| BE790692A (fr) * | 1971-10-29 | 1973-04-27 | Stamicarbon | Procede d'obtention de lactames purs |
| US3859278A (en) * | 1972-12-11 | 1975-01-07 | Stamicarbon | Process for separating lactams |
| CH593934A5 (enExample) * | 1974-09-03 | 1977-12-30 | Inventa Ag |
-
1976
- 1976-02-03 NL NL7601061A patent/NL7601061A/xx unknown
-
1977
- 1977-01-14 BE BE174071A patent/BE850374A/xx not_active IP Right Cessation
- 1977-01-17 CA CA269,877A patent/CA1084919A/en not_active Expired
- 1977-01-18 GB GB1935/77A patent/GB1506139A/en not_active Expired
- 1977-01-21 MX MX167779A patent/MX144993A/es unknown
- 1977-01-24 IT IT47772/77A patent/IT1083460B/it active
- 1977-01-24 JP JP52006685A patent/JPS6047253B2/ja not_active Expired
- 1977-01-28 AR AR266345A patent/AR210197A1/es active
- 1977-01-28 SU SU772444805A patent/SU712023A3/ru active
- 1977-01-31 FR FR7702580A patent/FR2351959A1/fr active Granted
- 1977-02-01 CH CH119977A patent/CH626063A5/de not_active IP Right Cessation
- 1977-02-01 ES ES455523A patent/ES455523A1/es not_active Expired
- 1977-02-02 US US05/765,102 patent/US4081442A/en not_active Expired - Lifetime
- 1977-02-02 BR BR7700655A patent/BR7700655A/pt unknown
- 1977-02-03 DE DE19772704561 patent/DE2704561A1/de not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| IT1083460B (it) | 1985-05-21 |
| MX144993A (es) | 1981-12-10 |
| DE2704561A1 (de) | 1977-08-04 |
| JPS5295686A (en) | 1977-08-11 |
| NL7601061A (nl) | 1977-08-05 |
| BR7700655A (pt) | 1977-10-11 |
| GB1506139A (en) | 1978-04-05 |
| FR2351959B1 (enExample) | 1981-12-24 |
| CA1084919A (en) | 1980-09-02 |
| US4081442A (en) | 1978-03-28 |
| SU712023A3 (ru) | 1980-01-25 |
| AR210197A1 (es) | 1977-06-30 |
| JPS6047253B2 (ja) | 1985-10-21 |
| ES455523A1 (es) | 1978-01-16 |
| FR2351959A1 (fr) | 1977-12-16 |
| BE850374A (nl) | 1977-07-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH626063A5 (enExample) | ||
| DE2110036C3 (de) | Verfahren zur Spaltung von Ammoniumsulfat | |
| DE2628085C3 (de) | Verfahren zur Herstellung eines Lactams | |
| DE2222216A1 (de) | Verbessertes Verfahren zu der Herstellung und Gewinnung von Lactamen | |
| DE2513602B2 (de) | Verfahren zum Entschwefeln von zerkleinerter Kohle | |
| DE2728606A1 (de) | Verfahren zur gewinnung von epsilon- caprolactam aus einem epsilon-caprolactam- schwefelsaeure-reaktionsgemisch | |
| DE2338784A1 (de) | Verfahren zur abscheidung von lactamen | |
| CH623567A5 (enExample) | ||
| EP1144304B1 (de) | Verfahren zum entfernen von stickstoffoxiden aus nitrosylschwefelsäure | |
| DE3735803C2 (de) | Verfahren zum Entfernen des Schwefelgehaltes eines Schwefeldioxid enthaltenden Schwachgases | |
| CH632250A5 (de) | Verfahren zur gewinnung von epsilon-caprolactam aus einem epsilon-caprolactam-schwefelsaeure-reaktionsgemisch. | |
| DE2818070A1 (de) | Verfahren zur gewinnung von ammoniak und schwefeldioxid aus verunreinigtem ammoniumsalz von schwefelsaeure | |
| CH532053A (de) | Verfahren zur Herstellung von Lactamen | |
| DE2408864C3 (de) | Verfahren zur gleichzeitigen Herstellung von Cyclohexanonoxim und konzentrierter Ammoniumsulfatlösung | |
| DE267870C (enExample) | ||
| DE2260014A1 (de) | Verfahren zu der abscheidung von lactam | |
| DE752821C (de) | Gewinnung von Schwefel und Schwefeldioxyd aus schwefelwasserstoffhaltigen Gasen | |
| DE526258C (de) | Verfahren zur unmittelbaren Herstellung von festem, trockenem Ammonsulfat aus seinenBestandteilen | |
| DE536719C (de) | Verfahren zur Gewinnung von Sulfit-Bisulfit-Gemischen aus schwefeldioxyd- und ammoniakhaltigen Gasgemischen | |
| AT100200B (de) | Verfahren zur Herstellung von Blausäure. | |
| DE854204C (de) | Verfahren zur Gewinnung von Schwefel aus Kokereigas oder aehnlichen Gasen | |
| DE527958C (de) | Verfahren zur Herstellung von Sulfaten des Ammoniums | |
| DE2524124A1 (de) | Verfahren zur reinigung schwefelwasserstoffhaltiger abgase | |
| AT65288B (de) | Verfahren zur Darstellung von Kalziumsulfid. | |
| DE508321C (de) | Konzentrierung und gleichzeitige Regenerierung von Sauerstoffsaeuren des Schwefels enthaltenden Loesungen, Abfallsaeuren o. dgl. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |