CH625807A5 - - Google Patents
Download PDFInfo
- Publication number
- CH625807A5 CH625807A5 CH1110177A CH1110177A CH625807A5 CH 625807 A5 CH625807 A5 CH 625807A5 CH 1110177 A CH1110177 A CH 1110177A CH 1110177 A CH1110177 A CH 1110177A CH 625807 A5 CH625807 A5 CH 625807A5
- Authority
- CH
- Switzerland
- Prior art keywords
- molybdate
- amine
- melamine
- use according
- acid
- Prior art date
Links
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 claims description 67
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 67
- 229910001868 water Inorganic materials 0.000 claims description 66
- -1 amine molybdate Chemical class 0.000 claims description 48
- 239000000779 smoke Substances 0.000 claims description 46
- 238000000034 method Methods 0.000 claims description 44
- 238000010992 reflux Methods 0.000 claims description 44
- 229920000877 Melamine resin Polymers 0.000 claims description 41
- FMXPXIONARXTLI-UHFFFAOYSA-N methane;1,3,5-triazine-2,4,6-triamine Chemical compound C.NC1=NC(N)=NC(N)=N1.NC1=NC(N)=NC(N)=N1 FMXPXIONARXTLI-UHFFFAOYSA-N 0.000 claims description 32
- 239000000203 mixture Substances 0.000 claims description 32
- 150000001412 amines Chemical class 0.000 claims description 30
- 230000015572 biosynthetic process Effects 0.000 claims description 29
- 229920000642 polymer Polymers 0.000 claims description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 25
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 claims description 24
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical group NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 claims description 23
- 229910052757 nitrogen Inorganic materials 0.000 claims description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 18
- 150000007974 melamines Chemical class 0.000 claims description 18
- GLUUGHFHXGJENI-UHFFFAOYSA-N diethylenediamine Natural products C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 17
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical group CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 claims description 16
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 claims description 16
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 16
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 125000000623 heterocyclic group Chemical group 0.000 claims description 13
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 claims description 12
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims description 12
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 12
- 239000004312 hexamethylene tetramine Substances 0.000 claims description 12
- 235000010299 hexamethylene tetramine Nutrition 0.000 claims description 12
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 12
- 235000018660 ammonium molybdate Nutrition 0.000 claims description 11
- 239000000178 monomer Substances 0.000 claims description 11
- ZRALSGWEFCBTJO-UHFFFAOYSA-N guanidine group Chemical group NC(=N)N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 9
- APUPEJJSWDHEBO-UHFFFAOYSA-P ammonium molybdate Chemical group [NH4+].[NH4+].[O-][Mo]([O-])(=O)=O APUPEJJSWDHEBO-UHFFFAOYSA-P 0.000 claims description 8
- 239000011609 ammonium molybdate Substances 0.000 claims description 8
- 229940010552 ammonium molybdate Drugs 0.000 claims description 8
- 150000002148 esters Chemical class 0.000 claims description 8
- 238000010438 heat treatment Methods 0.000 claims description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 8
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 7
- UQWGRGFEKLDWFD-UHFFFAOYSA-N 2,2,4-trimethyl-3,4,4a,5,6,7,8,8a-octahydro-1h-quinoline Chemical compound C1CCCC2C(C)CC(C)(C)NC21 UQWGRGFEKLDWFD-UHFFFAOYSA-N 0.000 claims description 6
- LGSUGIFRAVRFNM-UHFFFAOYSA-N 2-n,4-n,6-n-trimethyl-2-n,4-n,6-n-triphenyl-1,3,5-triazine-2,4,6-triamine Chemical group N=1C(N(C)C=2C=CC=CC=2)=NC(N(C)C=2C=CC=CC=2)=NC=1N(C)C1=CC=CC=C1 LGSUGIFRAVRFNM-UHFFFAOYSA-N 0.000 claims description 6
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 239000005711 Benzoic acid Substances 0.000 claims description 6
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 claims description 6
- 235000011054 acetic acid Nutrition 0.000 claims description 6
- 235000010233 benzoic acid Nutrition 0.000 claims description 6
- 235000019253 formic acid Nutrition 0.000 claims description 6
- 150000002751 molybdenum Chemical class 0.000 claims description 6
- VLAPMBHFAWRUQP-UHFFFAOYSA-L molybdic acid Chemical compound O[Mo](O)(=O)=O VLAPMBHFAWRUQP-UHFFFAOYSA-L 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 6
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 6
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims description 5
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims description 5
- 239000005078 molybdenum compound Substances 0.000 claims description 5
- 150000002752 molybdenum compounds Chemical class 0.000 claims description 5
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 5
- 150000007524 organic acids Chemical class 0.000 claims description 5
- SLJCNKSUCCIRGI-UHFFFAOYSA-N 2-n-(2,4-dimethylphenyl)-4-n-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine Chemical group CC1=CC(C)=CC=C1NC1=NC(NC=2C=CC=CC=2)=NC(N2CCCCC2)=N1 SLJCNKSUCCIRGI-UHFFFAOYSA-N 0.000 claims description 4
- GHKBOCAECRMABJ-UHFFFAOYSA-N 4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)morpholine Chemical group C1COCCN1C1=NC(N2CCOCC2)=NC(N2CCOCC2)=N1 GHKBOCAECRMABJ-UHFFFAOYSA-N 0.000 claims description 4
- 125000002723 alicyclic group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 150000001735 carboxylic acids Chemical class 0.000 claims description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 4
- 235000010755 mineral Nutrition 0.000 claims description 4
- 239000011707 mineral Substances 0.000 claims description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 3
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 238000002485 combustion reaction Methods 0.000 claims description 3
- 239000001530 fumaric acid Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 3
- 239000011976 maleic acid Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000002245 particle Substances 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 229920001567 vinyl ester resin Polymers 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 150000003141 primary amines Chemical class 0.000 claims description 2
- 150000003335 secondary amines Chemical class 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 2
- 229960004011 methenamine Drugs 0.000 claims 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 2
- 239000001301 oxygen Substances 0.000 claims 2
- 239000011593 sulfur Substances 0.000 claims 2
- 125000003277 amino group Chemical group 0.000 claims 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 125000003916 ethylene diamine group Chemical group 0.000 claims 1
- 125000004193 piperazinyl group Chemical group 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 45
- 239000000243 solution Substances 0.000 description 42
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 33
- 239000007787 solid Substances 0.000 description 32
- 229910052750 molybdenum Inorganic materials 0.000 description 29
- 239000011733 molybdenum Substances 0.000 description 29
- 239000011541 reaction mixture Substances 0.000 description 21
- XUFUCDNVOXXQQC-UHFFFAOYSA-L azane;hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxomolybdenum Chemical compound N.N.O[Mo](=O)(=O)O[Mo](O)(=O)=O XUFUCDNVOXXQQC-UHFFFAOYSA-L 0.000 description 19
- 238000003786 synthesis reaction Methods 0.000 description 19
- 239000000654 additive Substances 0.000 description 17
- 239000003507 refrigerant Substances 0.000 description 16
- 239000002244 precipitate Substances 0.000 description 15
- 150000001875 compounds Chemical class 0.000 description 14
- 239000002609 medium Substances 0.000 description 13
- 239000000523 sample Substances 0.000 description 12
- 239000012265 solid product Substances 0.000 description 12
- 238000004519 manufacturing process Methods 0.000 description 11
- 239000012467 final product Substances 0.000 description 9
- 229960005141 piperazine Drugs 0.000 description 8
- 239000004800 polyvinyl chloride Substances 0.000 description 8
- 229920000915 polyvinyl chloride Polymers 0.000 description 8
- 238000005303 weighing Methods 0.000 description 8
- 230000000996 additive effect Effects 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- QGAVSDVURUSLQK-UHFFFAOYSA-N ammonium heptamolybdate Chemical compound N.N.N.N.N.N.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo] QGAVSDVURUSLQK-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 4
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 4
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 235000015393 sodium molybdate Nutrition 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- STIAPHVBRDNOAJ-UHFFFAOYSA-N carbamimidoylazanium;carbonate Chemical compound NC(N)=N.NC(N)=N.OC(O)=O STIAPHVBRDNOAJ-UHFFFAOYSA-N 0.000 description 3
- 229920001519 homopolymer Polymers 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 238000011084 recovery Methods 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 230000000979 retarding effect Effects 0.000 description 3
- 239000011684 sodium molybdate Substances 0.000 description 3
- TVXXNOYZHKPKGW-UHFFFAOYSA-N sodium molybdate (anhydrous) Chemical compound [Na+].[Na+].[O-][Mo]([O-])(=O)=O TVXXNOYZHKPKGW-UHFFFAOYSA-N 0.000 description 3
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 2
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 2
- ZNRLMGFXSPUZNR-UHFFFAOYSA-N 2,2,4-trimethyl-1h-quinoline Chemical compound C1=CC=C2C(C)=CC(C)(C)NC2=C1 ZNRLMGFXSPUZNR-UHFFFAOYSA-N 0.000 description 2
- LEJBBGNFPAFPKQ-UHFFFAOYSA-N 2-(2-prop-2-enoyloxyethoxy)ethyl prop-2-enoate Chemical compound C=CC(=O)OCCOCCOC(=O)C=C LEJBBGNFPAFPKQ-UHFFFAOYSA-N 0.000 description 2
- FWWXYLGCHHIKNY-UHFFFAOYSA-N 2-ethoxyethyl prop-2-enoate Chemical compound CCOCCOC(=O)C=C FWWXYLGCHHIKNY-UHFFFAOYSA-N 0.000 description 2
- HFCUBKYHMMPGBY-UHFFFAOYSA-N 2-methoxyethyl prop-2-enoate Chemical compound COCCOC(=O)C=C HFCUBKYHMMPGBY-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- KWCPPCKBBRBYEE-UHFFFAOYSA-N 3-chloropropyl prop-2-enoate Chemical compound ClCCCOC(=O)C=C KWCPPCKBBRBYEE-UHFFFAOYSA-N 0.000 description 2
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 239000006057 Non-nutritive feed additive Substances 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
- 238000002441 X-ray diffraction Methods 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 2
- VHRGRCVQAFMJIZ-UHFFFAOYSA-N cadaverine Chemical compound NCCCCCN VHRGRCVQAFMJIZ-UHFFFAOYSA-N 0.000 description 2
- 238000003763 carbonization Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- KBLWLMPSVYBVDK-UHFFFAOYSA-N cyclohexyl prop-2-enoate Chemical compound C=CC(=O)OC1CCCCC1 KBLWLMPSVYBVDK-UHFFFAOYSA-N 0.000 description 2
- 150000001993 dienes Chemical class 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- XJELOQYISYPGDX-UHFFFAOYSA-N ethenyl 2-chloroacetate Chemical compound ClCC(=O)OC=C XJELOQYISYPGDX-UHFFFAOYSA-N 0.000 description 2
- GLVVKKSPKXTQRB-UHFFFAOYSA-N ethenyl dodecanoate Chemical compound CCCCCCCCCCCC(=O)OC=C GLVVKKSPKXTQRB-UHFFFAOYSA-N 0.000 description 2
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 2
- 125000002573 ethenylidene group Chemical group [*]=C=C([H])[H] 0.000 description 2
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 2
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical compound CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- LNMQRPPRQDGUDR-UHFFFAOYSA-N hexyl prop-2-enoate Chemical compound CCCCCCOC(=O)C=C LNMQRPPRQDGUDR-UHFFFAOYSA-N 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- PBOSTUDLECTMNL-UHFFFAOYSA-N lauryl acrylate Chemical compound CCCCCCCCCCCCOC(=O)C=C PBOSTUDLECTMNL-UHFFFAOYSA-N 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 2
- JKQOBWVOAYFWKG-UHFFFAOYSA-N molybdenum trioxide Inorganic materials O=[Mo](=O)=O JKQOBWVOAYFWKG-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- FSAJWMJJORKPKS-UHFFFAOYSA-N octadecyl prop-2-enoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)C=C FSAJWMJJORKPKS-UHFFFAOYSA-N 0.000 description 2
- RPQRDASANLAFCM-UHFFFAOYSA-N oxiran-2-ylmethyl prop-2-enoate Chemical compound C=CC(=O)OCC1CO1 RPQRDASANLAFCM-UHFFFAOYSA-N 0.000 description 2
- HVAMZGADVCBITI-UHFFFAOYSA-M pent-4-enoate Chemical compound [O-]C(=O)CCC=C HVAMZGADVCBITI-UHFFFAOYSA-M 0.000 description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 2
- WRAQQYDMVSCOTE-UHFFFAOYSA-N phenyl prop-2-enoate Chemical compound C=CC(=O)OC1=CC=CC=C1 WRAQQYDMVSCOTE-UHFFFAOYSA-N 0.000 description 2
- JRRBJSPQEVZLPI-UHFFFAOYSA-N piperazin-1-ium;hydroxide Chemical compound O.C1CNCCN1 JRRBJSPQEVZLPI-UHFFFAOYSA-N 0.000 description 2
- 229960003641 piperazine hydrate Drugs 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- OJOWICOBYCXEKR-KRXBUXKQSA-N (5e)-5-ethylidenebicyclo[2.2.1]hept-2-ene Chemical compound C1C2C(=C/C)/CC1C=C2 OJOWICOBYCXEKR-KRXBUXKQSA-N 0.000 description 1
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical group C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 1
- OPCJOXGBLDJWRM-UHFFFAOYSA-N 1,2-diamino-2-methylpropane Chemical compound CC(C)(N)CN OPCJOXGBLDJWRM-UHFFFAOYSA-N 0.000 description 1
- PWGJDPKCLMLPJW-UHFFFAOYSA-N 1,8-diaminooctane Chemical compound NCCCCCCCCN PWGJDPKCLMLPJW-UHFFFAOYSA-N 0.000 description 1
- OZCMOJQQLBXBKI-UHFFFAOYSA-N 1-ethenoxy-2-methylpropane Chemical compound CC(C)COC=C OZCMOJQQLBXBKI-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N 1-ethenoxybutane Chemical compound CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 description 1
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 1
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- RFIMISVNSAUMBU-UHFFFAOYSA-N 2-(hydroxymethyl)-2-(prop-2-enoxymethyl)propane-1,3-diol Chemical compound OCC(CO)(CO)COCC=C RFIMISVNSAUMBU-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- SBYMUDUGTIKLCR-UHFFFAOYSA-N 2-chloroethenylbenzene Chemical compound ClC=CC1=CC=CC=C1 SBYMUDUGTIKLCR-UHFFFAOYSA-N 0.000 description 1
- HKFPXINKVCOLOD-UHFFFAOYSA-N 2-hexylsulfanylethyl prop-2-enoate Chemical compound CCCCCCSCCOC(=O)C=C HKFPXINKVCOLOD-UHFFFAOYSA-N 0.000 description 1
- RLMGHKMNVDBCSB-UHFFFAOYSA-N 2-n,2-n,4-n,4-n,6-n,6-n-hexaethyl-1,3,5-triazine-2,4,6-triamine Chemical compound CCN(CC)C1=NC(N(CC)CC)=NC(N(CC)CC)=N1 RLMGHKMNVDBCSB-UHFFFAOYSA-N 0.000 description 1
- JVUAYVUZADWJBK-UHFFFAOYSA-N 3-cyanopropyl prop-2-enoate Chemical class C=CC(=O)OCCCC#N JVUAYVUZADWJBK-UHFFFAOYSA-N 0.000 description 1
- FASUFOTUSHAIHG-UHFFFAOYSA-N 3-methoxyprop-1-ene Chemical compound COCC=C FASUFOTUSHAIHG-UHFFFAOYSA-N 0.000 description 1
- KOGSPLLRMRSADR-UHFFFAOYSA-N 4-(2-aminopropan-2-yl)-1-methylcyclohexan-1-amine Chemical compound CC(C)(N)C1CCC(C)(N)CC1 KOGSPLLRMRSADR-UHFFFAOYSA-N 0.000 description 1
- IUNVCWLKOOCPIT-UHFFFAOYSA-N 6-methylheptylsulfanyl 2-hydroxyacetate Chemical compound CC(C)CCCCCSOC(=O)CO IUNVCWLKOOCPIT-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- ICQVTDZLHBCFON-UHFFFAOYSA-N C(C=C)(=S)OCCCCCC Chemical compound C(C=C)(=S)OCCCCCC ICQVTDZLHBCFON-UHFFFAOYSA-N 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- 241000255969 Pieris brassicae Species 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229940048053 acrylate Drugs 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- IMUDHTPIFIBORV-UHFFFAOYSA-N aminoethylpiperazine Chemical compound NCCN1CCNCC1 IMUDHTPIFIBORV-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 238000012662 bulk polymerization Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 230000001055 chewing effect Effects 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- SSJXIUAHEKJCMH-UHFFFAOYSA-N cyclohexane-1,2-diamine Chemical compound NC1CCCCC1N SSJXIUAHEKJCMH-UHFFFAOYSA-N 0.000 description 1
- YQLZOAVZWJBZSY-UHFFFAOYSA-N decane-1,10-diamine Chemical compound NCCCCCCCCCCN YQLZOAVZWJBZSY-UHFFFAOYSA-N 0.000 description 1
- 125000004386 diacrylate group Chemical group 0.000 description 1
- AYOHIQLKSOJJQH-UHFFFAOYSA-N dibutyltin Chemical compound CCCC[Sn]CCCC AYOHIQLKSOJJQH-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- QFTYSVGGYOXFRQ-UHFFFAOYSA-N dodecane-1,12-diamine Chemical compound NCCCCCCCCCCCCN QFTYSVGGYOXFRQ-UHFFFAOYSA-N 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- ZTWTYVWXUKTLCP-UHFFFAOYSA-L ethenyl-dioxido-oxo-$l^{5}-phosphane Chemical compound [O-]P([O-])(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-L 0.000 description 1
- 229940052303 ethers for general anesthesia Drugs 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- PWSKHLMYTZNYKO-UHFFFAOYSA-N heptane-1,7-diamine Chemical compound NCCCCCCCN PWSKHLMYTZNYKO-UHFFFAOYSA-N 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 1
- 235000011167 hydrochloric acid Nutrition 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical compound C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 description 1
- DMOUAGOIMQRXIY-UHFFFAOYSA-N n-methyl-n-phenyl-1,3,5-triazin-2-amine Chemical compound N=1C=NC=NC=1N(C)C1=CC=CC=C1 DMOUAGOIMQRXIY-UHFFFAOYSA-N 0.000 description 1
- 239000003605 opacifier Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 239000002952 polymeric resin Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002717 polyvinylpyridine Polymers 0.000 description 1
- 229920006316 polyvinylpyrrolidine Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000010008 shearing Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010557 suspension polymerization reaction Methods 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical compound NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 description 1
- AGGKEGLBGGJEBZ-UHFFFAOYSA-N tetramethylenedisulfotetramine Chemical compound C1N(S2(=O)=O)CN3S(=O)(=O)N1CN2C3 AGGKEGLBGGJEBZ-UHFFFAOYSA-N 0.000 description 1
- 229960000834 vinyl ether Drugs 0.000 description 1
- FUSUHKVFWTUUBE-UHFFFAOYSA-N vinyl methyl ketone Natural products CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3467—Heterocyclic compounds having nitrogen in the ring having more than two nitrogen atoms in the ring
- C08K5/3477—Six-membered rings
- C08K5/3492—Triazines
- C08K5/34928—Salts
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/54—Three nitrogen atoms
- C07D251/70—Other substituted melamines
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/0008—Organic ingredients according to more than one of the "one dot" groups of C08K5/01 - C08K5/59
- C08K5/0066—Flame-proofing or flame-retarding additives
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/17—Amines; Quaternary ammonium compounds
- C08K5/19—Quaternary ammonium compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Lubricants (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Cosmetics (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/770,168 US4053455A (en) | 1977-02-14 | 1977-02-14 | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH625807A5 true CH625807A5 (enExample) | 1981-10-15 |
Family
ID=25087687
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1110177A CH625807A5 (enExample) | 1977-02-14 | 1977-09-12 |
Country Status (17)
| Country | Link |
|---|---|
| US (4) | US4053455A (enExample) |
| JP (2) | JPS6017303B2 (enExample) |
| AU (1) | AU513387B2 (enExample) |
| BE (1) | BE859205A (enExample) |
| CA (1) | CA1084518A (enExample) |
| CH (1) | CH625807A5 (enExample) |
| DE (1) | DE2739771A1 (enExample) |
| DK (1) | DK154088C (enExample) |
| FR (4) | FR2380318A1 (enExample) |
| GB (2) | GB1565450A (enExample) |
| IT (1) | IT1107748B (enExample) |
| MX (1) | MX147930A (enExample) |
| NL (1) | NL184009C (enExample) |
| NO (1) | NO149777C (enExample) |
| NZ (2) | NZ185053A (enExample) |
| SE (1) | SE424083B (enExample) |
| ZA (1) | ZA775138B (enExample) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4053455A (en) * | 1977-02-14 | 1977-10-11 | The B. F. Goodrich Company | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions |
| US4226987A (en) * | 1977-02-14 | 1980-10-07 | The B. F. Goodrich Company | Heterocyclic amine molybdate |
| US4217292A (en) * | 1979-03-01 | 1980-08-12 | The B. F. Goodrich Company | Process for making amine molybdates |
| US4266051A (en) * | 1979-03-22 | 1981-05-05 | The B. F. Goodrich Company | Hexamethylenetetramine molybdate |
| US4259491A (en) * | 1979-03-22 | 1981-03-31 | The B. F. Goodrich Company | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions with amine molybdates |
| US4235770A (en) * | 1979-06-18 | 1980-11-25 | The B. F. Goodrich Company | Ammelinium beta-octamolybdate and composition containing same |
| US4248766A (en) * | 1979-06-18 | 1981-02-03 | The B. F. Goodrich Company | Didodecylammonium beta-octamolybdate and composition containing same |
| US4240955A (en) * | 1979-06-18 | 1980-12-23 | The B. F. Goodrich Company | Octadecylammonium alpha-octamolybdate and composition containing same |
| US4247451A (en) * | 1979-06-18 | 1981-01-27 | The B. F. Goodrich Company | Dicyclohexylammonium alpha-octamolybdate and composition containing same |
| US4225484A (en) * | 1979-06-18 | 1980-09-30 | The B. F. Goodrich Company | Tripentylammonium decamolybdate and composition containing same |
| US4248767A (en) * | 1979-06-18 | 1981-02-03 | The B. F. Goodrich Company | Dodecylammonium alpha-octamolybdate and composition containing same |
| US4234473A (en) * | 1979-07-30 | 1980-11-18 | The B. F. Goodrich Company | Dodecyl-1,12-diammonium dimolybdate and composition containing same |
| US4234474A (en) * | 1979-07-30 | 1980-11-18 | The B. F. Goodrich Company | Tribenzylammonium octamolybdate and composition containing same |
| US4463175A (en) * | 1980-11-10 | 1984-07-31 | Exxon Research & Engineering Co. | Molybdenum trioxide layered compounds |
| US4355161A (en) * | 1980-11-10 | 1982-10-19 | Exxon Research And Engineering Co. | Molybdenum trioxide layered compounds |
| US4464495A (en) * | 1982-05-14 | 1984-08-07 | The B. F. Goodrich Company | Smoke retardant vinyl halide polymer compositions |
| US4410462A (en) * | 1982-07-28 | 1983-10-18 | The B. F. Goodrich Company | Didodecyldimethylammonium molybdates |
| US4410463A (en) * | 1982-07-28 | 1983-10-18 | The B. F. Goodrich Company | Tetrapentylammonium molybdates |
| US4424164A (en) | 1982-07-28 | 1984-01-03 | The B. F. Goodrich Company | Dimethyldioctadecylammonium molybdates |
| US4406837A (en) * | 1982-07-28 | 1983-09-27 | The B. F. Goodrich Company | Methyltricapryl ammonium molybdates |
| US4406838A (en) * | 1982-07-28 | 1983-09-27 | The B. F. Goodrich Company | Trioctylammonium molybdates |
| US4406840A (en) * | 1982-07-28 | 1983-09-27 | The B. F. Goodrich Company | Tri(tridecyl)ammonium molybdates |
| BR8402638A (pt) * | 1983-06-10 | 1985-04-30 | Goodrich Co B F | Composicao de cloreto de polivinila pos-clorada |
| US4816303A (en) * | 1985-04-04 | 1989-03-28 | The B. F. Goodrich Company | Process for inhibiting corrosion of metal and corrosion-inhibiting layer use therein |
| US4680334A (en) * | 1985-09-26 | 1987-07-14 | E. I. Du Pont De Nemours And Company | Flame retardant polymer compositions containing molybdenum compounds and sulfur-containing polymers |
| US4788008A (en) * | 1987-04-06 | 1988-11-29 | Gencorp Inc. | Flame retardant vinylidene chloride latexes and coatings thereof |
| US5320778A (en) * | 1988-08-23 | 1994-06-14 | Cortec Corporation | Vapor phase corrosion inhibitor-desiccant material |
| US5209869A (en) * | 1988-08-23 | 1993-05-11 | Cortec Corporation | Vapor phase corrosion inhibitor-dessiccant material |
| US5344589A (en) * | 1988-08-23 | 1994-09-06 | Cortec Corporation | Vapor phase corrosion inhibitor-desiccant material |
| US5332525A (en) * | 1988-08-23 | 1994-07-26 | Cortec Corporation | Vapor phase corrosion inhibitor-desiccant material |
| US4988751A (en) * | 1989-04-28 | 1991-01-29 | Witco Corporation | Halogenated vinyl polymer composition and method for stabilizing halogenated vinyl polymer composition containing smoke retardants |
| CA2063136A1 (en) * | 1991-09-25 | 1993-03-26 | Frederick G. Schriever | Snap fastener and tooling therefor |
| US6217797B1 (en) * | 2000-04-11 | 2001-04-17 | Unitex Chemical Corporation | Synthesis and use of amine molybdates |
| WO2001079376A1 (en) * | 2000-04-14 | 2001-10-25 | Sekisui Chemical Co., Ltd. | Resin composition for vibration-damping material, vibration-damping material, and sound-insulating member |
| US6355277B1 (en) * | 2000-07-14 | 2002-03-12 | Unitex Chemical Corporation | Use of organocopper complexes with amine molybdates as smoke suppressants in halogen containing polymeric compositions |
| US7718725B2 (en) * | 2006-06-16 | 2010-05-18 | College Of William And Mary | Smoke and fire inhibitors for PVC |
| WO2010019746A2 (en) * | 2008-08-15 | 2010-02-18 | Invista Technologies S. Ar. L. | Flame retardant polymer composites, fibers, carpets, and methods of making each |
| CN110023293A (zh) | 2016-12-19 | 2019-07-16 | J.M.休伯有限公司 | 高热稳定性三聚氰胺八钼酸盐及其在聚合物组合物中作为抑烟剂的用途 |
| CN110240595A (zh) * | 2019-07-10 | 2019-09-17 | 河南龙湖生物技术有限公司 | 用作聚氯乙烯光稳定剂的苯并三嗪类化合物的制备方法和应用 |
| CA3185244A1 (en) | 2020-07-10 | 2022-01-13 | James F. Day | Smoke suppressant compositions |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3028255A (en) * | 1956-06-28 | 1962-04-03 | Minnesota Mining & Mfg | Heat-sensitive copy-sheet |
| US3821151A (en) * | 1971-11-08 | 1974-06-28 | Ethyl Corp | Smoke retardant compositions |
| US3870679A (en) * | 1971-11-08 | 1975-03-11 | Ethyl Corp | Smoke retardant vinyl halide polymers |
| US3845001A (en) * | 1971-11-08 | 1974-10-29 | Ethyl Corp | Smoke retardant compositions |
| US3900441A (en) * | 1973-03-12 | 1975-08-19 | Armstrong Cork Co | Zinc and molybdenum-containing compounds as smoke depressants for poly(vinyl chloride) resin compositions |
| US4053453A (en) * | 1977-02-14 | 1977-10-11 | The B. F. Goodrich Company | Vinyl halide polymers having improved resistance to burning and smoke formation |
| US4053455A (en) * | 1977-02-14 | 1977-10-11 | The B. F. Goodrich Company | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions |
-
1977
- 1977-02-14 US US05/770,168 patent/US4053455A/en not_active Expired - Lifetime
- 1977-04-29 US US05/792,293 patent/US4153792A/en not_active Expired - Lifetime
- 1977-08-13 NZ NZ185053A patent/NZ185053A/xx unknown
- 1977-08-24 ZA ZA00775138A patent/ZA775138B/xx unknown
- 1977-08-25 NZ NZ185020A patent/NZ185020A/xx unknown
- 1977-08-25 GB GB29695/78A patent/GB1565450A/en not_active Expired
- 1977-08-25 DK DK377977A patent/DK154088C/da active
- 1977-08-25 AU AU28229/77A patent/AU513387B2/en not_active Expired
- 1977-08-25 CA CA285,441A patent/CA1084518A/en not_active Expired
- 1977-08-25 GB GB35635/77A patent/GB1565449A/en not_active Expired
- 1977-09-01 IT IT27193/77A patent/IT1107748B/it active
- 1977-09-03 DE DE19772739771 patent/DE2739771A1/de not_active Withdrawn
- 1977-09-07 SE SE7710031A patent/SE424083B/xx not_active IP Right Cessation
- 1977-09-12 CH CH1110177A patent/CH625807A5/fr not_active IP Right Cessation
- 1977-09-22 JP JP52113455A patent/JPS6017303B2/ja not_active Expired
- 1977-09-23 NO NO773265A patent/NO149777C/no unknown
- 1977-09-29 BE BE181314A patent/BE859205A/xx not_active IP Right Cessation
- 1977-10-03 MX MX170786A patent/MX147930A/es unknown
- 1977-10-11 US US05/841,182 patent/US4129540A/en not_active Expired - Lifetime
- 1977-10-13 FR FR7730914A patent/FR2380318A1/fr active Granted
- 1977-11-28 JP JP14171977A patent/JPS53103487A/ja active Pending
-
1978
- 1978-01-02 NL NLAANVRAGE7800013,A patent/NL184009C/xx not_active IP Right Cessation
- 1978-03-08 FR FR7806728A patent/FR2380266A1/fr active Granted
- 1978-03-08 FR FR7806730A patent/FR2380283A1/fr active Granted
- 1978-03-08 FR FR7806729A patent/FR2380249A1/fr active Granted
- 1978-09-22 US US05/944,948 patent/US4161466A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH625807A5 (enExample) | ||
| DE3880926T2 (de) | Polymergebundene UV-Stabilisatoren. | |
| JP2009280810A (ja) | 難燃剤および光安定剤としてのポリトリアジニル化合物 | |
| CH622538A5 (enExample) | ||
| US4053453A (en) | Vinyl halide polymers having improved resistance to burning and smoke formation | |
| NO167299B (no) | Roekhemmende vinylhalogenidpolymermateriale. | |
| US7589139B2 (en) | Polyvinylpyrrolidone powder composition and its production processes | |
| US4298737A (en) | Piperdinyl substituted 1,4-diaza-2-cycloalkanones and derivatives thereof | |
| JP2818607B2 (ja) | ビス―ベンゾトリアゾリル化合物及びそれで安定化したポリマー物質 | |
| US4266051A (en) | Hexamethylenetetramine molybdate | |
| US8765864B2 (en) | Melamine cyanurate in crystalline form | |
| US4259491A (en) | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions with amine molybdates | |
| US4226987A (en) | Heterocyclic amine molybdate | |
| US4053452A (en) | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions | |
| BE1012673A3 (fr) | Nouveaux derives de 6-amino-uracile, leur preparation et leur utilisation. | |
| CA1110439A (en) | Synthesis of smoke retardant and vinyl halide polymers containing same | |
| US4055537A (en) | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions | |
| MXPA04009452A (es) | Compuestos utiles para reducir el contenido de acetaldehido de tereftalato de polietileno, su uso y productos resultantes de los mismos. | |
| US4537924A (en) | Quadratic acid amide derivatives, their use as stabilizers, and synthetic resins treated therewith | |
| FR2500462A1 (enExample) | ||
| CN110204712B (zh) | 一种固相合成氰尿酸-尿嘧啶络合锌盐的方法 | |
| Farivarzadeh et al. | Preparation of a new polymeric antioxidant for polypropylene based on phenylmalonic acid | |
| JPS6016456B2 (ja) | ポリオレフイン配合物 | |
| BE606400A (enExample) | ||
| NO810535L (no) | Forbedrede stive vinylkloridpolymer-sammensetninger |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |