CH625516A5 - - Google Patents
Download PDFInfo
- Publication number
- CH625516A5 CH625516A5 CH629776A CH629776A CH625516A5 CH 625516 A5 CH625516 A5 CH 625516A5 CH 629776 A CH629776 A CH 629776A CH 629776 A CH629776 A CH 629776A CH 625516 A5 CH625516 A5 CH 625516A5
- Authority
- CH
- Switzerland
- Prior art keywords
- och
- hcl
- mixture
- fumarate
- formula
- Prior art date
Links
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 51
- -1 alkoxy radical Chemical class 0.000 description 39
- 150000001875 compounds Chemical class 0.000 description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- 239000000203 mixture Substances 0.000 description 25
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 17
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 14
- 238000000034 method Methods 0.000 description 13
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 12
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 11
- 150000003839 salts Chemical class 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- HEBMCVBCEDMUOF-UHFFFAOYSA-N isochromane Chemical compound C1=CC=C2COCCC2=C1 HEBMCVBCEDMUOF-UHFFFAOYSA-N 0.000 description 10
- 239000003921 oil Substances 0.000 description 10
- 238000001816 cooling Methods 0.000 description 9
- 238000000921 elemental analysis Methods 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 7
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 125000000623 heterocyclic group Chemical group 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- STGNLGBPLOVYMA-MAZDBSFSSA-N (E)-but-2-enedioic acid Chemical compound OC(=O)\C=C\C(O)=O.OC(=O)\C=C\C(O)=O STGNLGBPLOVYMA-MAZDBSFSSA-N 0.000 description 4
- OVXJWSYBABKZMD-UHFFFAOYSA-N 2-chloro-1,1-diethoxyethane Chemical compound CCOC(CCl)OCC OVXJWSYBABKZMD-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 125000005530 alkylenedioxy group Chemical group 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 125000003710 aryl alkyl group Chemical group 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000002220 antihypertensive agent Substances 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 125000004193 piperazinyl group Chemical group 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- JTGZOKVZYKPXGL-UHFFFAOYSA-N 1-(chloromethyl)-5,8-dimethoxy-3,4-dihydro-1h-isochromene Chemical compound ClCC1OCCC2=C1C(OC)=CC=C2OC JTGZOKVZYKPXGL-UHFFFAOYSA-N 0.000 description 2
- IQSHYGRASVOQSI-UHFFFAOYSA-N 1-(chloromethyl)-6,7-dimethoxy-3,4-dihydro-1h-isochromene Chemical compound C1COC(CCl)C2=C1C=C(OC)C(OC)=C2 IQSHYGRASVOQSI-UHFFFAOYSA-N 0.000 description 2
- SRQAJMUHZROVHW-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)ethanol Chemical compound COC1=CC=C(CCO)C=C1OC SRQAJMUHZROVHW-UHFFFAOYSA-N 0.000 description 2
- NXHONHDWVLPPCS-UHFFFAOYSA-N 3-chloro-1,1-diethoxypropane Chemical compound CCOC(CCCl)OCC NXHONHDWVLPPCS-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229910015900 BF3 Inorganic materials 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 229940035676 analgesics Drugs 0.000 description 2
- 239000000730 antalgic agent Substances 0.000 description 2
- 239000002260 anti-inflammatory agent Substances 0.000 description 2
- 229940121363 anti-inflammatory agent Drugs 0.000 description 2
- 239000000935 antidepressant agent Substances 0.000 description 2
- 229940005513 antidepressants Drugs 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 239000002934 diuretic Substances 0.000 description 2
- 229940030606 diuretics Drugs 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 229940035363 muscle relaxants Drugs 0.000 description 2
- 239000003158 myorelaxant agent Substances 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- AWTQPNYVGDBRTD-WLHGVMLRSA-N (e)-but-2-enedioic acid;1-[(5,6-dimethoxy-3,4-dihydro-1h-isochromen-1-yl)methyl]-4-pyridin-2-ylpiperazine Chemical compound OC(=O)\C=C\C(O)=O.O1CCC2=C(OC)C(OC)=CC=C2C1CN(CC1)CCN1C1=CC=CC=N1 AWTQPNYVGDBRTD-WLHGVMLRSA-N 0.000 description 1
- BKZXBPBDSFNKAK-WLHGVMLRSA-N (e)-but-2-enedioic acid;1-[(5,8-dimethoxy-3,4-dihydro-1h-isochromen-1-yl)methyl]-4-methylpiperazine Chemical compound OC(=O)\C=C\C(O)=O.O1CCC=2C(OC)=CC=C(OC)C=2C1CN1CCN(C)CC1 BKZXBPBDSFNKAK-WLHGVMLRSA-N 0.000 description 1
- SSDGDSONOFNWHS-WLHGVMLRSA-N (e)-but-2-enedioic acid;n-ethyl-n-[(6-methoxy-3,4-dihydro-1h-isochromen-1-yl)methyl]ethanamine Chemical compound OC(=O)\C=C\C(O)=O.COC1=CC=C2C(CN(CC)CC)OCCC2=C1 SSDGDSONOFNWHS-WLHGVMLRSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- HCHSXAQALIZQQK-UHFFFAOYSA-N 1-(2-chloroethyl)-5,6-dimethoxy-3,4-dihydro-1h-isochromene Chemical compound ClCCC1OCCC2=C(OC)C(OC)=CC=C21 HCHSXAQALIZQQK-UHFFFAOYSA-N 0.000 description 1
- KYYHYSZAXGHECT-UHFFFAOYSA-N 1-(3-chlorophenyl)-4-[(5,6-dimethoxy-3,4-dihydro-1h-isochromen-1-yl)methyl]piperazine Chemical compound O1CCC2=C(OC)C(OC)=CC=C2C1CN(CC1)CCN1C1=CC=CC(Cl)=C1 KYYHYSZAXGHECT-UHFFFAOYSA-N 0.000 description 1
- QIRDDWVQKPPDJG-UHFFFAOYSA-N 1-(3-chlorophenyl)-4-[2-(6,7-dimethoxy-3,4-dihydro-1h-isochromen-1-yl)ethyl]piperazine Chemical compound C1=2C=C(OC)C(OC)=CC=2CCOC1CCN(CC1)CCN1C1=CC=CC(Cl)=C1 QIRDDWVQKPPDJG-UHFFFAOYSA-N 0.000 description 1
- YINYQHTYHZRDLO-UHFFFAOYSA-N 1-(4-chlorophenyl)-4-[(5,6-dimethoxy-3,4-dihydro-1h-isochromen-1-yl)methyl]piperazine Chemical compound O1CCC2=C(OC)C(OC)=CC=C2C1CN(CC1)CCN1C1=CC=C(Cl)C=C1 YINYQHTYHZRDLO-UHFFFAOYSA-N 0.000 description 1
- KWPVXQUMIMMOPO-UHFFFAOYSA-N 1-(4-chlorophenyl)-4-[2-(5,6-dimethoxy-3,4-dihydro-1h-isochromen-1-yl)ethyl]piperazine Chemical compound O1CCC2=C(OC)C(OC)=CC=C2C1CCN(CC1)CCN1C1=CC=C(Cl)C=C1 KWPVXQUMIMMOPO-UHFFFAOYSA-N 0.000 description 1
- QACBRXLCMQRFNA-UHFFFAOYSA-N 1-(chloromethyl)-5,6-dimethoxy-3,4-dihydro-1h-isochromene Chemical compound ClCC1OCCC2=C(OC)C(OC)=CC=C21 QACBRXLCMQRFNA-UHFFFAOYSA-N 0.000 description 1
- XUJAEJHZUWMJQG-UHFFFAOYSA-N 1-(chloromethyl)-6-methoxy-3,4-dihydro-1h-isochromene Chemical compound ClCC1OCCC2=CC(OC)=CC=C21 XUJAEJHZUWMJQG-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- GOFDACCTVUYXLK-UHFFFAOYSA-N 1-[2-(6,7-dimethoxy-3,4-dihydro-1h-isochromen-1-yl)ethyl]-4-pyridin-2-ylpiperazine Chemical compound C1=2C=C(OC)C(OC)=CC=2CCOC1CCN(CC1)CCN1C1=CC=CC=N1 GOFDACCTVUYXLK-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- ITTZJQAIUGWARA-UHFFFAOYSA-N 4-(6,7-dimethoxy-3,4-dihydro-1h-isochromen-1-yl)morpholine;hydrochloride Chemical compound Cl.C1=2C=C(OC)C(OC)=CC=2CCOC1N1CCOCC1 ITTZJQAIUGWARA-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003727 cerebral blood flow Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- VZWXIQHBIQLMPN-UHFFFAOYSA-N chromane Chemical compound C1=CC=C2CCCOC2=C1 VZWXIQHBIQLMPN-UHFFFAOYSA-N 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000002511 isochromanes Chemical class 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- GZRKXKUVVPSREJ-UHFFFAOYSA-N pyridinylpiperazine Chemical compound C1CNCCN1C1=CC=CC=N1 GZRKXKUVVPSREJ-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D493/00—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system
- C07D493/02—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system in which the condensed system contains two hetero rings
- C07D493/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/76—Benzo[c]pyrans
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP51001243A JPS5919549B2 (ja) | 1976-01-01 | 1976-01-01 | 異節環状化合物 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH625516A5 true CH625516A5 (OSRAM) | 1981-09-30 |
Family
ID=11496005
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH629776A CH625516A5 (OSRAM) | 1976-01-01 | 1976-05-19 |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4066648A (OSRAM) |
| JP (1) | JPS5919549B2 (OSRAM) |
| CH (1) | CH625516A5 (OSRAM) |
| DE (1) | DE2624693A1 (OSRAM) |
| FR (1) | FR2336927A1 (OSRAM) |
| NL (1) | NL7605361A (OSRAM) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4153612A (en) * | 1977-10-31 | 1979-05-08 | The Upjohn Company | 2-Benzoxepins |
| US4577021A (en) * | 1977-10-31 | 1986-03-18 | The Upjohn Company | 1H-2-Benzopyran-1-yl alkyl on 1-(isochroman-1-yl)alkyl piperazines |
| DE2816475A1 (de) * | 1978-04-15 | 1979-10-25 | Bayer Ag | Isochroman-derivate, verfahren zu ihrer herstellung und ihre verwendung als synergisten in insektiziden und akariziden mitteln |
| US4162256A (en) * | 1978-04-19 | 1979-07-24 | International Flavors & Fragrances Inc. | Process for the production of compounds useful in perfumery |
| US4556656A (en) * | 1978-10-23 | 1985-12-03 | The Upjohn Company | 2-Benzoxepins |
| US4360532A (en) * | 1981-01-29 | 1982-11-23 | E. R. Squibb & Sons, Inc. | Substituted chromans |
| DE3582060D1 (de) * | 1984-11-22 | 1991-04-11 | Sandoz Ag | Homopropargylamine. |
| US5185364A (en) * | 1988-01-15 | 1993-02-09 | Abbott Laboratories | Aminomethyl-chroman and -thiochroman compounds |
| WO1989006534A1 (en) * | 1988-01-15 | 1989-07-27 | Abbott Laboratories | Aminomethyl-chroman and -thiochroman compounds |
| US5140039A (en) * | 1988-01-15 | 1992-08-18 | Abbott Laboratories | Aminomethyl-thiochroman compounds |
| CA2019621A1 (en) * | 1989-06-23 | 1990-12-23 | Kuniko Hashigaki | Arylalkylamine derivatives |
| US5238939A (en) * | 1990-05-25 | 1993-08-24 | Akzo N.V. | Isochromane derivatives |
| EP0579754A1 (en) * | 1991-04-09 | 1994-01-26 | The Upjohn Company | Use of amines to sensitize multidrug-resistant cells |
| ES2133714T3 (es) * | 1993-12-28 | 1999-09-16 | Upjohn Co | Compuestos heterociclicos para el tratamiento de trastornos del snc y cardiovasculares. |
| JPWO2004024185A1 (ja) | 2002-09-11 | 2006-01-26 | 道男 石橋 | 医薬または化粧料 |
| KR102811121B1 (ko) | 2016-07-29 | 2025-05-22 | 스미토모 파마 아메리카, 인크. | 화합물 및 조성물 및 이들의 용도 |
| EP3490607A4 (en) | 2016-07-29 | 2020-04-08 | Sunovion Pharmaceuticals Inc. | CONNECTIONS AND COMPOSITIONS AND USES THEREOF |
| KR20200036008A (ko) | 2017-08-02 | 2020-04-06 | 선오비온 파마슈티컬스 인코포레이티드 | 이소크로만 화합물 및 이의 용도 |
| AU2020236225B2 (en) | 2019-03-14 | 2025-12-18 | Sumitomo Pharma America, Inc. | Salts of a isochromanyl compound and crystalline forms, processes for preparing, therapeutic uses, and pharmaceutical compositions thereof |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1143702A (OSRAM) * | 1965-03-18 | |||
| US3743659A (en) * | 1971-08-25 | 1973-07-03 | Riker Laboratories Inc | Substituted isochromans and processes therefor |
| US3840562A (en) * | 1971-08-25 | 1974-10-08 | Riker Laboratories Inc | 3-amino lower alkyl-1-phenylisochromans and their preparation |
-
1976
- 1976-01-01 JP JP51001243A patent/JPS5919549B2/ja not_active Expired
- 1976-05-19 CH CH629776A patent/CH625516A5/de not_active IP Right Cessation
- 1976-05-19 NL NL7605361A patent/NL7605361A/xx not_active Application Discontinuation
- 1976-05-28 US US05/690,928 patent/US4066648A/en not_active Expired - Lifetime
- 1976-05-31 FR FR7616373A patent/FR2336927A1/fr active Granted
- 1976-06-02 DE DE19762624693 patent/DE2624693A1/de not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| NL7605361A (nl) | 1977-07-05 |
| FR2336927A1 (fr) | 1977-07-29 |
| DE2624693A1 (de) | 1977-07-14 |
| FR2336927B1 (OSRAM) | 1978-11-17 |
| JPS5283846A (en) | 1977-07-13 |
| US4066648A (en) | 1978-01-03 |
| JPS5919549B2 (ja) | 1984-05-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH625516A5 (OSRAM) | ||
| DE69716062T2 (de) | Benzofuran-derivate und deren verwendung | |
| CH648553A5 (de) | Neue 3,4-dihydro-5h-2,3-benzodiazepin-derivate und verfahren zur herstellung derselben. | |
| EP0013894B1 (de) | Neue Arylether, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| CH632262A5 (de) | Verfahren zur herstellung von aminochromanol-derivaten. | |
| CH630912A5 (de) | Verfahren zur herstellung von 1,2-dihydronaphthalinderivaten. | |
| EP0000220A1 (de) | Dihydrouracile, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| CH633249A5 (de) | Verfahren zur herstellung von neuen polyprenylderivaten. | |
| DE2261506A1 (de) | Basische derivate von phenyl-1 alkanolen, ihre herstellung und diese enthaltende medikamente | |
| CH617689A5 (OSRAM) | ||
| DD202023A5 (de) | Verfahren zur herstellung von in 5-stellung substituierten 5,10-dihxdro-11h-dibenzo (b,e) (1,4) diazepin-11-onen | |
| DD272648A5 (de) | Chromon-derivate | |
| CH643553A5 (de) | 4-amino-2-piperidinochinazolin-derivate, verfahren zu ihrer herstellung und solche derivate enthaltende arzneimittel. | |
| DE3854991T2 (de) | Cyclische Amine und pharmakologische Verbindungen | |
| EP0072960B1 (de) | 1,5-Diphenylpyrazolin-3-on-Verbindungen sowie Verfahren und Zwischenprodukte zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2929760C2 (OSRAM) | ||
| EP0072961B1 (de) | 1-Phenylindazol-3-on-Verbindungen sowie Verfahren und Zwischenprodukte zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1076691B (de) | Verfahren zur Herstellung von Phenthiazinderivaten | |
| DE2819896A1 (de) | Chromenderivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
| DE2503436A1 (de) | 2-substituierte 4,5-diphenylthiazole, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2318273B2 (de) | Basisch substituierte 13-Benzodioxolderivate und deren pharmakologisch verträgliche Salze sowie diese Verbindungen enthaltende Arzneimittel | |
| EP0000013A1 (de) | 4-Phenyl-8-amino-tetrahydroisochinoline, diese enthaltende pharmazeutische Präparate und Verfahren zur Herstellung dieser Präparate | |
| DE2735589A1 (de) | 1-phenyl-1-methoxy-2-amino-aethan- derivate und verfahren zu ihrer herstellung | |
| DD153691A5 (de) | Verfahren zur herstellung von hexahydro-trans-4a,9b-1(h)pyridoindol-derivaten | |
| CH461489A (de) | Verfahren zur Herstellung von neuen Oxazolderivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |