CH625394A5 - Herbicidal preparation - Google Patents
Herbicidal preparation Download PDFInfo
- Publication number
- CH625394A5 CH625394A5 CH368776A CH368776A CH625394A5 CH 625394 A5 CH625394 A5 CH 625394A5 CH 368776 A CH368776 A CH 368776A CH 368776 A CH368776 A CH 368776A CH 625394 A5 CH625394 A5 CH 625394A5
- Authority
- CH
- Switzerland
- Prior art keywords
- chlorine
- preparation
- allyl
- bromine
- pyrrolidinone
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 33
- 230000002363 herbicidal effect Effects 0.000 title claims description 17
- 239000000460 chlorine Chemical group 0.000 claims description 47
- 150000001875 compounds Chemical class 0.000 claims description 33
- 229910052801 chlorine Chemical group 0.000 claims description 16
- 239000002904 solvent Substances 0.000 claims description 15
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 11
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 9
- 229910052794 bromium Chemical group 0.000 claims description 9
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 claims description 6
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 238000009835 boiling Methods 0.000 claims description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 4
- 229910021575 Iron(II) bromide Inorganic materials 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000004803 chlorobenzyl group Chemical group 0.000 claims description 3
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- GYCHYNMREWYSKH-UHFFFAOYSA-L iron(ii) bromide Chemical compound [Fe+2].[Br-].[Br-] GYCHYNMREWYSKH-UHFFFAOYSA-L 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 230000008569 process Effects 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 125000005843 halogen group Chemical class 0.000 claims description 2
- 108090000623 proteins and genes Proteins 0.000 claims description 2
- 238000007363 ring formation reaction Methods 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 150000003953 γ-lactams Chemical class 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 23
- 239000000203 mixture Substances 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 14
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- -1 cyclo-55 alkylalkyl Chemical group 0.000 description 11
- 239000004009 herbicide Substances 0.000 description 11
- 239000007788 liquid Substances 0.000 description 11
- 239000000047 product Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- 238000010992 reflux Methods 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- QIKAXUAIAUOSQW-UHFFFAOYSA-N 3-chloro-4-(chloromethyl)-1-prop-2-enylpyrrolidin-2-one Chemical compound ClCC1CN(CC=C)C(=O)C1Cl QIKAXUAIAUOSQW-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 229910021577 Iron(II) chloride Inorganic materials 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 6
- 231100000208 phytotoxic Toxicity 0.000 description 6
- 230000000885 phytotoxic effect Effects 0.000 description 6
- 239000002689 soil Substances 0.000 description 6
- 241000219198 Brassica Species 0.000 description 5
- 235000003351 Brassica cretica Nutrition 0.000 description 5
- 235000003343 Brassica rupestris Nutrition 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 230000012010 growth Effects 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 235000010460 mustard Nutrition 0.000 description 5
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical group O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 238000004810 partition chromatography Methods 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- 238000005507 spraying Methods 0.000 description 4
- 244000075850 Avena orientalis Species 0.000 description 3
- 235000007319 Avena orientalis Nutrition 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 229920001213 Polysorbate 20 Polymers 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 230000008635 plant growth Effects 0.000 description 3
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 3
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000009331 sowing Methods 0.000 description 3
- FKHIFSZMMVMEQY-UHFFFAOYSA-N talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 3
- FEOZBZXSEJHJJL-UHFFFAOYSA-N 1-benzyl-3-chloro-4-(chloromethyl)pyrrolidin-2-one Chemical compound O=C1C(Cl)C(CCl)CN1CC1=CC=CC=C1 FEOZBZXSEJHJJL-UHFFFAOYSA-N 0.000 description 2
- BAZMDHDFQHPRSL-UHFFFAOYSA-N 3-chloro-4-(chloromethyl)-1-propylpyrrolidin-2-one Chemical compound CCCN1CC(CCl)C(Cl)C1=O BAZMDHDFQHPRSL-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 244000152970 Digitaria sanguinalis Species 0.000 description 2
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 244000058871 Echinochloa crus-galli Species 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 230000001276 controlling effect Effects 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- SNAUETXKUXDMFB-UHFFFAOYSA-N n-prop-2-enylbutan-1-amine Chemical compound CCCCNCC=C SNAUETXKUXDMFB-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 230000008707 rearrangement Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000004576 sand Substances 0.000 description 2
- SMYMJHWAQXWPDB-UHFFFAOYSA-N (2,4,5-trichlorophenoxy)acetic acid Chemical compound OC(=O)COC1=CC(Cl)=C(Cl)C=C1Cl SMYMJHWAQXWPDB-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 description 1
- VURDGHVFUCCHAQ-UHFFFAOYSA-N 1-butyl-3-chloro-4-(chloromethyl)pyrrolidin-2-one Chemical compound CCCCN1CC(CCl)C(Cl)C1=O VURDGHVFUCCHAQ-UHFFFAOYSA-N 0.000 description 1
- 125000006039 1-hexenyl group Chemical group 0.000 description 1
- NAMDIHYPBYVYAP-UHFFFAOYSA-N 1-methoxy-2-(2-methoxyethoxy)ethane Chemical compound COCCOCCOC.COCCOCCOC NAMDIHYPBYVYAP-UHFFFAOYSA-N 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- 239000003559 2,4,5-trichlorophenoxyacetic acid Substances 0.000 description 1
- OVSKIKFHRZPJSS-DOMIDYPGSA-N 2-(2,4-dichlorophenoxy)acetic acid Chemical compound OC(=O)[14CH2]OC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-DOMIDYPGSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- 125000006026 2-methyl-1-butenyl group Chemical group 0.000 description 1
- 125000006045 2-methyl-1-pentenyl group Chemical group 0.000 description 1
- FBMDQVBGIYSDTI-UHFFFAOYSA-N 2-n,4-n-bis(3-methoxypropyl)-6-methylsulfanyl-1,3,5-triazine-2,4-diamine Chemical compound COCCCNC1=NC(NCCCOC)=NC(SC)=N1 FBMDQVBGIYSDTI-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- NHANGIFXYRKPNC-UHFFFAOYSA-N 3,3-dichloro-4-(chloromethyl)-1-ethylpyrrolidin-2-one Chemical compound CCN1CC(CCl)C(Cl)(Cl)C1=O NHANGIFXYRKPNC-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- IYIBXZDWEFVVSU-UHFFFAOYSA-N 3-chloro-4-(chloromethyl)-1-(2-methylpropyl)pyrrolidin-2-one Chemical compound CC(C)CN1CC(CCl)C(Cl)C1=O IYIBXZDWEFVVSU-UHFFFAOYSA-N 0.000 description 1
- IMFGQLHENHLUDF-UHFFFAOYSA-N 3-chloro-4-(chloromethyl)-1-[(4-chlorophenyl)methyl]pyrrolidin-2-one Chemical compound O=C1C(Cl)C(CCl)CN1CC1=CC=C(Cl)C=C1 IMFGQLHENHLUDF-UHFFFAOYSA-N 0.000 description 1
- PRWRWDSRTHDPPE-UHFFFAOYSA-N 3-chloro-4-(chloromethyl)-1-cyclohexylpyrrolidin-2-one Chemical compound O=C1C(Cl)C(CCl)CN1C1CCCCC1 PRWRWDSRTHDPPE-UHFFFAOYSA-N 0.000 description 1
- XMUWXMNHFJSYSU-UHFFFAOYSA-N 3-chloro-4-(chloromethyl)-1-ethylpyrrolidin-2-one Chemical compound CCN1CC(CCl)C(Cl)C1=O XMUWXMNHFJSYSU-UHFFFAOYSA-N 0.000 description 1
- QITPMQYBHLZNOS-UHFFFAOYSA-N 3-chloro-4-(chloromethyl)-1-methylpyrrolidin-2-one Chemical compound CN1CC(CCl)C(Cl)C1=O QITPMQYBHLZNOS-UHFFFAOYSA-N 0.000 description 1
- QRTCMWASMUSDJF-UHFFFAOYSA-N 3-chloro-4-(chloromethyl)-1-pentylpyrrolidin-2-one Chemical compound CCCCCN1CC(CCl)C(Cl)C1=O QRTCMWASMUSDJF-UHFFFAOYSA-N 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- XZIIFPSPUDAGJM-UHFFFAOYSA-N 6-chloro-2-n,2-n-diethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=NC(N)=CC(Cl)=N1 XZIIFPSPUDAGJM-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 244000237956 Amaranthus retroflexus Species 0.000 description 1
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 1
- 235000009393 Avena byzantina Nutrition 0.000 description 1
- 244000178993 Brassica juncea Species 0.000 description 1
- 235000011332 Brassica juncea Nutrition 0.000 description 1
- 235000014700 Brassica juncea var napiformis Nutrition 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- HSSBORCLYSCBJR-UHFFFAOYSA-N Chloramben Chemical compound NC1=CC(Cl)=CC(C(O)=O)=C1Cl HSSBORCLYSCBJR-UHFFFAOYSA-N 0.000 description 1
- YRMLFORXOOIJDR-UHFFFAOYSA-N Dichlormid Chemical compound ClC(Cl)C(=O)N(CC=C)CC=C YRMLFORXOOIJDR-UHFFFAOYSA-N 0.000 description 1
- 206010013883 Dwarfism Diseases 0.000 description 1
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 239000005574 MCPA Substances 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 235000015225 Panicum colonum Nutrition 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 241000201976 Polycarpon Species 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 240000004284 Rumex crispus Species 0.000 description 1
- 235000021501 Rumex crispus Nutrition 0.000 description 1
- 244000207667 Rumex vesicarius Species 0.000 description 1
- OKUGPJPKMAEJOE-UHFFFAOYSA-N S-propyl dipropylcarbamothioate Chemical compound CCCSC(=O)N(CCC)CCC OKUGPJPKMAEJOE-UHFFFAOYSA-N 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 1
- JEDZLBFUGJTJGQ-UHFFFAOYSA-N [Na].COCCO[AlH]OCCOC Chemical compound [Na].COCCO[AlH]OCCOC JEDZLBFUGJTJGQ-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000003869 acetamides Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- RQVYBGPQFYCBGX-UHFFFAOYSA-N ametryn Chemical compound CCNC1=NC(NC(C)C)=NC(SC)=N1 RQVYBGPQFYCBGX-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- MXWJVTOOROXGIU-UHFFFAOYSA-N atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical compound [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 238000001460 carbon-13 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000002361 compost Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000035613 defoliation Effects 0.000 description 1
- FBCCMZVIWNDFMO-UHFFFAOYSA-N dichloroacetyl chloride Chemical compound ClC(Cl)C(Cl)=O FBCCMZVIWNDFMO-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 244000013123 dwarf bean Species 0.000 description 1
- 235000005489 dwarf bean Nutrition 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 208000037824 growth disorder Diseases 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003864 humus Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- WZZBXOMSMQZTAA-UHFFFAOYSA-N n-benzyl-2,2-dichloro-n-prop-2-enylacetamide Chemical compound ClC(Cl)C(=O)N(CC=C)CC1=CC=CC=C1 WZZBXOMSMQZTAA-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- FCYRUOLTLFYKQY-UHFFFAOYSA-N n-prop-2-enylbutan-1-amine;hydrochloride Chemical compound Cl.CCCCNCC=C FCYRUOLTLFYKQY-UHFFFAOYSA-N 0.000 description 1
- KTJYOKLCBAFHDD-UHFFFAOYSA-N n-prop-2-enylbutanamide Chemical compound CCCC(=O)NCC=C KTJYOKLCBAFHDD-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 235000021395 porridge Nutrition 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000006462 rearrangement reaction Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229940035044 sorbitan monolaurate Drugs 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000002426 superphosphate Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/273—2-Pyrrolidones with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyrrole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH182181A CH626778A5 (en) | 1975-03-28 | 1981-03-18 | Herbicidal preparation |
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US56328075A | 1975-03-28 | 1975-03-28 | |
| US56327975A | 1975-03-28 | 1975-03-28 | |
| US05/647,963 US4110105A (en) | 1975-03-28 | 1976-01-09 | Aromatic N-substituted halo-substituted-2-pyrrolidinones and their utility as herbicides |
| US05/647,962 US4069038A (en) | 1975-03-28 | 1976-01-09 | Acyclic and alicyclic N-substituted halo-2-pyrrolidinones and their utility as herbicides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH625394A5 true CH625394A5 (en) | 1981-09-30 |
Family
ID=27504836
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH368776A CH625394A5 (en) | 1975-03-28 | 1976-03-24 | Herbicidal preparation |
Country Status (25)
| Country | Link |
|---|---|
| JP (1) | JPS6011695B2 (https=) |
| AU (1) | AU502662B2 (https=) |
| BE (1) | BE839977A (https=) |
| BG (2) | BG29135A3 (https=) |
| BR (1) | BR7601774A (https=) |
| CA (1) | CA1076588A (https=) |
| CH (1) | CH625394A5 (https=) |
| DD (1) | DD126149A5 (https=) |
| DE (2) | DE2612731C2 (https=) |
| DK (1) | DK145891C (https=) |
| ES (1) | ES446388A1 (https=) |
| FR (1) | FR2305434A1 (https=) |
| GB (1) | GB1522869A (https=) |
| HU (1) | HU179058B (https=) |
| IL (1) | IL49289A (https=) |
| IN (1) | IN143281B (https=) |
| IT (1) | IT1057396B (https=) |
| MX (1) | MX3355E (https=) |
| MY (1) | MY8000091A (https=) |
| NL (1) | NL187313C (https=) |
| NZ (1) | NZ180424A (https=) |
| PH (1) | PH15176A (https=) |
| PL (2) | PL102693B1 (https=) |
| SU (1) | SU942590A3 (https=) |
| YU (1) | YU40279B (https=) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU527254B2 (en) * | 1979-02-26 | 1983-02-24 | Stauffer Chemical Company | Synergistic herbicides |
| EP0055215B1 (de) * | 1980-12-19 | 1985-01-30 | Ciba-Geigy Ag | Neue Fluorpyrrolidinone, Verfahren zu deren Herstellung, sie enthaltende herbizide Mittel und deren Verwendung |
| DK162087C (da) * | 1983-06-16 | 1992-02-24 | Stauffer Chemical Co | Fremgangsmaade til fremstilling af n-arylhalogenpyrrolidoner |
| FI74385C (fi) * | 1983-12-05 | 1988-02-08 | Stauffer Chemical Co | Synergistiska herbicidblandningar av tiokarbamat och pyrrolidonfoerening. |
| EP0205391B1 (fr) * | 1985-05-22 | 1988-10-26 | Rhone-Poulenc Chimie | Procédé de préparation de N alcène-2 yl M-trifluorométhylanilines |
| FR2582300B1 (fr) * | 1985-05-22 | 1987-07-10 | Rhone Poulenc Spec Chim | Procede de preparation de n-2 alcene-2 yl m-trifluoromethylanilines |
| FR2589150B2 (fr) * | 1985-10-25 | 1987-11-20 | Rhone Poulenc Spec Chim | Procede de preparation de n alcene-2 yl m.trifluoromethylanilines |
| FR2625197B1 (fr) * | 1987-12-23 | 1990-04-27 | Rhone Poulenc Chimie | Procede d'acylation d'une n,n-diallylaniline |
| FR2634761B1 (fr) * | 1988-07-29 | 1990-11-23 | Rhone Poulenc Chimie | Procede de preparation de n-allyl et de n-alkylanilines |
| FR2634762B1 (fr) * | 1988-07-29 | 1990-11-02 | Rhone Poulenc Chimie | Procede de preparation de n-allyl et alkyl-anilines |
| US5210305A (en) * | 1988-07-29 | 1993-05-11 | Rhone-Poulenc Chimie | Process for preparing n-alkylanilines and n-allylanilines |
| US5189220A (en) * | 1988-07-29 | 1993-02-23 | Rhone-Poulenc Chimie | Process for preparing N-alkylanilines and N-allylanilines catalyzed by iodides |
| FR2643902B1 (fr) * | 1989-03-03 | 1991-10-11 | Rhone Poulenc Chimie | Procede de preparation de n-allylmetatrifluoromethylaniline |
| JPH02237970A (ja) * | 1989-03-13 | 1990-09-20 | Mitsui Toatsu Chem Inc | 4―エチル―1―(3―トリフルオロメチルフェニル)―2―ピロリジノン誘導体およびこれらを有効成分とする除草剤 |
| FR2663927A1 (fr) * | 1989-06-05 | 1992-01-03 | Rhone Poulenc Chimie | Procede de preparation de n monoalkyl- ou alkenylanilines. |
| JP2728937B2 (ja) * | 1989-06-14 | 1998-03-18 | 三井東圧化学株式会社 | 1―(3―置換ベンジル)―3―ハロゲノ―4―(1―ハロゲノアルキル)―2―ピロリジノン誘導体およびこれらを有効成分とする除草剤 |
| EP0470000B1 (fr) * | 1990-08-02 | 1997-11-12 | Rhone-Poulenc Chimie | Réactif d'allylation et un procédé de synthèse utilisant ce réactif |
| FR2665439B1 (fr) * | 1990-08-02 | 1992-11-06 | Rhone Poulenc Chimie | Reactif de n-allylation et procede de synthese d'une n acyl, n allylaniline. |
| US5538985A (en) * | 1994-01-27 | 1996-07-23 | Mitsui Toatsu Chemicals, Inc. | Pyrrolidinone derivatives |
| EP2052612A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037629A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| CN114031536A (zh) * | 2021-12-14 | 2022-02-11 | 青海省农林科学院 | 一种抑制杂草种子萌发及幼苗生长的纯光学异构体化合物及应用 |
| AR129510A1 (es) | 2022-06-03 | 2024-09-04 | Adama Agan Ltd | Nuevas mezclas para la protección de cultivos |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS49134835A (https=) * | 1973-05-08 | 1974-12-25 |
-
1976
- 1976-03-17 FR FR7607683A patent/FR2305434A1/fr active Granted
- 1976-03-17 HU HU76SA2904A patent/HU179058B/hu unknown
- 1976-03-19 JP JP51030778A patent/JPS6011695B2/ja not_active Expired
- 1976-03-23 GB GB11627/76A patent/GB1522869A/en not_active Expired
- 1976-03-23 BR BR7601774A patent/BR7601774A/pt unknown
- 1976-03-23 IN IN510/CAL/1976A patent/IN143281B/en unknown
- 1976-03-24 PH PH18252A patent/PH15176A/en unknown
- 1976-03-24 CH CH368776A patent/CH625394A5/de not_active IP Right Cessation
- 1976-03-24 MX MX000109U patent/MX3355E/es unknown
- 1976-03-24 BE BE7000801A patent/BE839977A/xx not_active IP Right Cessation
- 1976-03-25 BG BG033675A patent/BG29135A3/xx unknown
- 1976-03-25 DE DE2612731A patent/DE2612731C2/de not_active Expired
- 1976-03-25 BG BG032702A patent/BG29122A3/xx unknown
- 1976-03-25 IL IL49289A patent/IL49289A/xx unknown
- 1976-03-25 DE DE2661042A patent/DE2661042C2/de not_active Expired
- 1976-03-25 NZ NZ180424A patent/NZ180424A/xx unknown
- 1976-03-25 DD DD192041A patent/DD126149A5/xx unknown
- 1976-03-26 IT IT48736/76A patent/IT1057396B/it active
- 1976-03-26 DK DK135776A patent/DK145891C/da not_active IP Right Cessation
- 1976-03-26 ES ES446388A patent/ES446388A1/es not_active Expired
- 1976-03-26 CA CA248,947A patent/CA1076588A/en not_active Expired
- 1976-03-26 NL NLAANVRAGE7603193,A patent/NL187313C/xx not_active IP Right Cessation
- 1976-03-26 YU YU800/76A patent/YU40279B/xx unknown
- 1976-03-26 AU AU12413/76A patent/AU502662B2/en not_active Expired
- 1976-03-27 PL PL1976200412A patent/PL102693B1/pl unknown
- 1976-03-27 PL PL1976188292A patent/PL100036B1/pl unknown
- 1976-11-23 SU SU762421801A patent/SU942590A3/ru active
-
1980
- 1980-12-30 MY MY91/80A patent/MY8000091A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH625394A5 (en) | Herbicidal preparation | |
| DE1567212C3 (de) | Fungicides Mittel nut bactericider Nebenwirkung | |
| DE3146309C2 (https=) | ||
| DE2911865C2 (de) | N-Halogenacetyl-phenylamino-carbonyl-oxime, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Mittel zur Bekämpfung von Unkraut | |
| DE2905650C2 (https=) | ||
| US4069038A (en) | Acyclic and alicyclic N-substituted halo-2-pyrrolidinones and their utility as herbicides | |
| CH642620A5 (de) | Herbizide n-haloacetyl-2-alkyl-6-acylaniline. | |
| DD149935A5 (de) | Verfahren zur herstellung von racemen oder optisch aktivem 2-(propargyloxyimino)-1,7,7-trimethylbicyclo(2,2,1)heptan | |
| DE2643403A1 (de) | Mikrobizide mittel | |
| DE2805525A1 (de) | Chloracetanilide und verfahren zu ihrer herstellung | |
| US4119636A (en) | Preparation of acyclic and alicyclic N-substituted halo-2-pyrrolidinones | |
| DE3782362T2 (de) | Cyanacetamid-derivate mit fungizider wirkung. | |
| DE2856974C2 (de) | 1- [N-(4-Chlor-2- trifluormethylphenyl)phenylacetimidoyl] - imidazo! und seine Metallkomplexe, Verfahren zur Herstellung dieser Verbindungen sowie deren Verwendung in Fungiziden | |
| EP0103252A2 (de) | Aryloxyalkylamine, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses | |
| DE2451512A1 (de) | Substituierte succinamide, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| US4595408A (en) | N-m-phenyl succinimide and glutarimide derivatives and their use as herbicides | |
| EP0072348A2 (de) | Neue Phenoxyphenyl-aminosäure-Derivate, ihre Herstellung, sie enthaltende Mittel sowie ihre Verwendung | |
| DE2545964C2 (de) | N-Halogenacetyl-N-aryl-glycinamide, Verfahren zu ihrer Herstellung sowie diese Verbindungen enthaltende herbizide Mittel | |
| DE2743513C2 (de) | Verfahren zur Herstellung eines Thiocarbamidsäureesters | |
| DE2557950A1 (de) | N-(trichlormethylthio)-, n-(tetrachloraethylthio)- oder n-(tetrachlorfluoraethylthio)-halo-benzoylanilide und ihre verwendung als fungizide | |
| DE2159565A1 (de) | Isoxazolinon-Verbindungen, Verfahren zu deren Herstellung und deren Anwendung als Verbindungen für die Landwirtschaft | |
| DE3038083A1 (de) | 5-(2'-chlor-4'-trifluormethylphenoxy)-2-nitrostyrolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende herbizide mittel | |
| DE1643039C3 (de) | Bromacetylharnstoffe, Verfahren zu deren Herstellung und diese enthaltende biocide Mittel | |
| US4116668A (en) | N-carbamoyl ethyl oxanilates | |
| US4090864A (en) | Herbicidal acetamidothiomethyl ureas |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUE | Assignment |
Owner name: ZENECA INC. |
|
| PL | Patent ceased |