CH625220A5 - - Google Patents
Download PDFInfo
- Publication number
- CH625220A5 CH625220A5 CH1447276A CH1447276A CH625220A5 CH 625220 A5 CH625220 A5 CH 625220A5 CH 1447276 A CH1447276 A CH 1447276A CH 1447276 A CH1447276 A CH 1447276A CH 625220 A5 CH625220 A5 CH 625220A5
- Authority
- CH
- Switzerland
- Prior art keywords
- carbon atoms
- formula
- radical
- atom
- weight
- Prior art date
Links
- -1 alkyl radicals Chemical class 0.000 claims description 29
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- 150000001875 compounds Chemical class 0.000 claims description 12
- 150000002540 isothiocyanates Chemical class 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 229920001059 synthetic polymer Polymers 0.000 claims description 9
- 229920000642 polymer Polymers 0.000 claims description 7
- 239000012948 isocyanate Substances 0.000 claims description 4
- 150000002513 isocyanates Chemical class 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 150000005840 aryl radicals Chemical class 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- ZUNVFGNAQYZBGO-UHFFFAOYSA-N n-(2,3,4,5-tetrahydropyridin-6-yl)hydroxylamine Chemical compound ONC1=NCCCC1 ZUNVFGNAQYZBGO-UHFFFAOYSA-N 0.000 claims description 3
- 125000000732 arylene group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000004122 cyclic group Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 230000000087 stabilizing effect Effects 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 239000003381 stabilizer Substances 0.000 description 19
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 238000002329 infrared spectrum Methods 0.000 description 8
- 229920001577 copolymer Polymers 0.000 description 7
- 239000000203 mixture Substances 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 239000004743 Polypropylene Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 4
- 239000008188 pellet Substances 0.000 description 4
- 229920001155 polypropylene Polymers 0.000 description 4
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 3
- 239000004593 Epoxy Substances 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 150000002736 metal compounds Chemical class 0.000 description 3
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 3
- 229920000098 polyolefin Polymers 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 150000005846 sugar alcohols Polymers 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- DIVGRVHJKSEMKU-UHFFFAOYSA-N N-(4-chloro-2,2,6,6-tetramethylcyclohex-3-en-1-yl)-2-hydroxyiminopiperidine-1-carboxamide Chemical compound CC1(C(C(C=C(C1)Cl)(C)C)NC(=O)N1C(CCCC1)=NO)C DIVGRVHJKSEMKU-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 2
- 239000012963 UV stabilizer Substances 0.000 description 2
- VMNKHSPZIGIPLL-UHFFFAOYSA-N [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite Chemical compound OCC(CO)(CO)COP(O)O VMNKHSPZIGIPLL-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000005442 diisocyanate group Chemical group 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 239000004611 light stabiliser Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 2
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 239000005033 polyvinylidene chloride Substances 0.000 description 2
- 229920003048 styrene butadiene rubber Polymers 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- HHIRBXHEYVDUAM-UHFFFAOYSA-N 1-chloro-3-isocyanatobenzene Chemical compound ClC1=CC=CC(N=C=O)=C1 HHIRBXHEYVDUAM-UHFFFAOYSA-N 0.000 description 1
- ADAKRBAJFHTIEW-UHFFFAOYSA-N 1-chloro-4-isocyanatobenzene Chemical compound ClC1=CC=C(N=C=O)C=C1 ADAKRBAJFHTIEW-UHFFFAOYSA-N 0.000 description 1
- IHWDIGHWDQPQMQ-UHFFFAOYSA-N 1-octadecylsulfanyloctadecane Chemical compound CCCCCCCCCCCCCCCCCCSCCCCCCCCCCCCCCCCCC IHWDIGHWDQPQMQ-UHFFFAOYSA-N 0.000 description 1
- KXTAOXNYQGASTA-UHFFFAOYSA-N 2-benzylidenepropanedioic acid Chemical compound OC(=O)C(C(O)=O)=CC1=CC=CC=C1 KXTAOXNYQGASTA-UHFFFAOYSA-N 0.000 description 1
- DHBPAQUDNKLCEJ-UHFFFAOYSA-N 2-hydroxybenzoic acid;phenol Chemical class OC1=CC=CC=C1.OC(=O)C1=CC=CC=C1O DHBPAQUDNKLCEJ-UHFFFAOYSA-N 0.000 description 1
- MGOLNIXAPIAKFM-UHFFFAOYSA-N 2-isocyanato-2-methylpropane Chemical compound CC(C)(C)N=C=O MGOLNIXAPIAKFM-UHFFFAOYSA-N 0.000 description 1
- PZRWFKGUFWPFID-UHFFFAOYSA-N 3,9-dioctadecoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane Chemical compound C1OP(OCCCCCCCCCCCCCCCCCC)OCC21COP(OCCCCCCCCCCCCCCCCCC)OC2 PZRWFKGUFWPFID-UHFFFAOYSA-N 0.000 description 1
- DPOLIKLKIFZBKJ-UHFFFAOYSA-N 3-hydroxyimino-2,2,6,6-tetramethyl-N-naphthalen-1-ylpiperidine-4-carboxamide Chemical compound ON=C1C(C)(C)NC(C)(C)CC1C(=O)NC1=CC=CC2=CC=CC=C12 DPOLIKLKIFZBKJ-UHFFFAOYSA-N 0.000 description 1
- ZCILGMFPJBRCNO-UHFFFAOYSA-N 4-phenyl-2H-benzotriazol-5-ol Chemical class OC1=CC=C2NN=NC2=C1C1=CC=CC=C1 ZCILGMFPJBRCNO-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000004709 Chlorinated polyethylene Substances 0.000 description 1
- 229920000089 Cyclic olefin copolymer Polymers 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- XHYLGRSLMMUCSZ-UHFFFAOYSA-N N-butyl-3-hydroxyimino-2,2,6,6-tetramethylpiperidine-4-carboxamide Chemical compound CCCCNC(=O)C1CC(C)(C)NC(C)(C)C1=NO XHYLGRSLMMUCSZ-UHFFFAOYSA-N 0.000 description 1
- 229920000305 Nylon 6,10 Polymers 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 239000003490 Thiodipropionic acid Substances 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- DHHINIMRHSEUHH-UHFFFAOYSA-N [(2,2,6,6-tetramethylpiperidin-4-ylidene)amino] n-(4-chlorophenyl)carbamate Chemical compound C1C(C)(C)NC(C)(C)CC1=NOC(=O)NC1=CC=C(Cl)C=C1 DHHINIMRHSEUHH-UHFFFAOYSA-N 0.000 description 1
- BMCWAVWEKBQQGB-UHFFFAOYSA-N [(2,2,6,6-tetramethylpiperidin-4-ylidene)amino] n-phenylcarbamate Chemical compound C1C(C)(C)NC(C)(C)CC1=NOC(=O)NC1=CC=CC=C1 BMCWAVWEKBQQGB-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- YJHQSBJFMDFVKK-UHFFFAOYSA-N benzene-1,2-diol;benzoic acid Chemical class OC1=CC=CC=C1O.OC(=O)C1=CC=CC=C1 YJHQSBJFMDFVKK-UHFFFAOYSA-N 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 150000001565 benzotriazoles Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-M chloroacetate Chemical compound [O-]C(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-M 0.000 description 1
- 229940089960 chloroacetate Drugs 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000000944 linseed oil Substances 0.000 description 1
- 235000021388 linseed oil Nutrition 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- WIBFFTLQMKKBLZ-SEYXRHQNSA-N n-butyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCCCC WIBFFTLQMKKBLZ-SEYXRHQNSA-N 0.000 description 1
- KEXBIBXJHSHHJM-UHFFFAOYSA-N n-cyclohexyl-3-hydroxyimino-2,2,6,6-tetramethylpiperidine-4-carboxamide Chemical compound ON=C1C(C)(C)NC(C)(C)CC1C(=O)NC1CCCCC1 KEXBIBXJHSHHJM-UHFFFAOYSA-N 0.000 description 1
- LZRUFGUDCZOYEM-UHFFFAOYSA-N n-tert-butyl-3-hydroxyimino-2,2,6,6-tetramethylpiperidine-4-carboxamide Chemical compound CC(C)(C)NC(=O)C1CC(C)(C)NC(C)(C)C1=NO LZRUFGUDCZOYEM-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920005749 polyurethane resin Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000003784 tall oil Substances 0.000 description 1
- 238000009864 tensile test Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 235000019303 thiodipropionic acid Nutrition 0.000 description 1
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 1
- 125000005628 tolylene group Chemical group 0.000 description 1
- IVIIAEVMQHEPAY-UHFFFAOYSA-N tridodecyl phosphite Chemical compound CCCCCCCCCCCCOP(OCCCCCCCCCCCC)OCCCCCCCCCCCC IVIIAEVMQHEPAY-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3412—Heterocyclic compounds having nitrogen in the ring having one nitrogen atom in the ring
- C08K5/3432—Six-membered rings
- C08K5/3435—Piperidines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/92—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with a hetero atom directly attached to the ring nitrogen atom
- C07D211/94—Oxygen atom, e.g. piperidine N-oxide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Hydrogenated Pyridines (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752552176 DE2552176A1 (de) | 1975-11-21 | 1975-11-21 | Neue piperidin-derivate, ihre herstellung und verwendung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH625220A5 true CH625220A5 (enExample) | 1981-09-15 |
Family
ID=5962245
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1447276A CH625220A5 (enExample) | 1975-11-21 | 1976-11-17 |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4104251A (enExample) |
| JP (1) | JPS5265276A (enExample) |
| AT (1) | AT353012B (enExample) |
| BE (1) | BE848604A (enExample) |
| CA (1) | CA1072099A (enExample) |
| CH (1) | CH625220A5 (enExample) |
| DE (1) | DE2552176A1 (enExample) |
| DK (1) | DK523176A (enExample) |
| FR (1) | FR2332271A1 (enExample) |
| GB (1) | GB1535070A (enExample) |
| IE (1) | IE44082B1 (enExample) |
| IT (1) | IT1123936B (enExample) |
| LU (1) | LU76241A1 (enExample) |
| NL (1) | NL7612714A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2538947A1 (fr) * | 1983-01-05 | 1984-07-06 | Telemecanique Electrique | Interrupteur a fermeture et ouverture commandees et a ouverture automatique en cas de surcharge de courant |
| IL97266A0 (en) * | 1990-03-06 | 1992-05-25 | Warner Lambert Co | Azabicyclo and azacyclo oximes and amines,their preparation and pharmaceutical compositions containing them |
| US5306718A (en) * | 1990-03-06 | 1994-04-26 | Warner-Lambert Company | Oxime and amine substituted azabicyclo and azocyclo muscarinic agonists and methods of treatment |
| US8357553B2 (en) | 2010-10-08 | 2013-01-22 | Guardian Industries Corp. | Light source with hybrid coating, device including light source with hybrid coating, and/or methods of making the same |
| CN108586320B (zh) * | 2018-04-24 | 2020-05-19 | 宿迁联盛科技股份有限公司 | 一种聚合型橡胶稳定剂及其制备方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1244483A (en) * | 1967-12-04 | 1971-09-02 | Ici Ltd | Carbamoyl piperidoneoximes and pesticidal compositions containing them |
| AU473367B2 (en) * | 1970-09-19 | 1976-06-17 | Ciba-Geigy Ag | Novel acyl hudrazone derivatives of 2,2,6,6- tetramethyl piperidine-4-one and their use as stabilizers |
| US3780178A (en) * | 1971-12-14 | 1973-12-18 | Allied Chem | Fungicidal compositions and methods of killing fungi using alkylenimine-2-oximes |
| GB1467672A (en) * | 1974-04-11 | 1977-03-16 | Ciba Geigy Ag | Stabilised epoxy resin |
-
1975
- 1975-11-21 DE DE19752552176 patent/DE2552176A1/de not_active Withdrawn
-
1976
- 1976-11-16 NL NL7612714A patent/NL7612714A/xx not_active Application Discontinuation
- 1976-11-16 US US05/742,233 patent/US4104251A/en not_active Expired - Lifetime
- 1976-11-17 CH CH1447276A patent/CH625220A5/de not_active IP Right Cessation
- 1976-11-19 GB GB48358/76A patent/GB1535070A/en not_active Expired
- 1976-11-19 LU LU76241A patent/LU76241A1/xx unknown
- 1976-11-19 IT IT29581/76A patent/IT1123936B/it active
- 1976-11-19 JP JP51138553A patent/JPS5265276A/ja active Pending
- 1976-11-19 AT AT862976A patent/AT353012B/de not_active IP Right Cessation
- 1976-11-19 CA CA266,090A patent/CA1072099A/en not_active Expired
- 1976-11-19 IE IE2554/76A patent/IE44082B1/en unknown
- 1976-11-19 DK DK523176A patent/DK523176A/da unknown
- 1976-11-22 FR FR7635073A patent/FR2332271A1/fr active Granted
- 1976-11-22 BE BE172572A patent/BE848604A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5265276A (en) | 1977-05-30 |
| IE44082L (en) | 1977-05-21 |
| IT1123936B (it) | 1986-04-30 |
| GB1535070A (en) | 1978-12-06 |
| DE2552176A1 (de) | 1977-06-02 |
| FR2332271A1 (fr) | 1977-06-17 |
| NL7612714A (nl) | 1977-05-24 |
| CA1072099A (en) | 1980-02-19 |
| BE848604A (fr) | 1977-05-23 |
| LU76241A1 (enExample) | 1977-06-07 |
| AT353012B (de) | 1979-10-25 |
| FR2332271B1 (enExample) | 1980-06-06 |
| DK523176A (da) | 1977-05-22 |
| ATA862976A (de) | 1979-03-15 |
| US4104251A (en) | 1978-08-01 |
| IE44082B1 (en) | 1981-08-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2264582C3 (de) | Synthetische Polymermasse, die gegen licht- und Wärmeeinwirkung stabilisiert ist | |
| CH632523A5 (de) | Verfahren zur herstellung von piperidyl-triazin-derivaten sowie deren verwendung in stabilisatoren fuer synthetische polymerisate. | |
| DE2636144B2 (de) | Polytriazinverbindungen | |
| EP0057885B1 (de) | Substituierte Diazaspirodecane, ihre Herstellung, ihre Verwendung als Stabilisatoren für organische Polymere, sowie die so stabilisierten Polymere | |
| DE2636143C2 (de) | Polyharnstoffgemische, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0053775A2 (de) | Poly-bis-triazinylamine, Verfahren zu ihrer Herstellung, ihre Verwendung zum Stabilisieren von synthetischen Polymeren und die so stabilisierten Polymeren | |
| CH629233A5 (de) | Verwendung von azaadamantanverbindungen zum stabilisieren von kunststoff-formmassen. | |
| EP0044499B1 (de) | Triazinylaminotriazine, ihre Herstellung, ihre Verwendung zum Stabilisieren von synthetischen Polymeren sowie die mit ihnen stabilisierten Produkte | |
| EP0008084B1 (de) | Neue Harnstoffderivate, ihre Herstellung und ihre Verwendung als Lichtschutzmittel für Polymere | |
| CH625220A5 (enExample) | ||
| DE2702205A1 (de) | N-substituierte triazaadamantanylharnstoffe als stabilisatoren fuer thermoplaste | |
| EP0001207B1 (de) | Harnstoffderivate, ihre Herstellung und Verwendung als Lichtschutzmittel | |
| DE2742582C2 (enExample) | ||
| DE2634957A1 (de) | Neue 1-oxa-4,8-diaza-spiro- eckige klammer auf 4,5 eckige klammer zu -decane, ihre herstellung und ihre verwendung als lichtschutzmittel | |
| DE2002729A1 (de) | Phosphonsaeuredialkylester,ihre Herstellung und ihre Verwendung als Antioxydantien | |
| DE2014165A1 (de) | Thiodialkanoamidophenol-Antioxydantien | |
| EP0119961A1 (de) | Oligoester mit Polyalkylpiperidingruppen | |
| DE2849444A1 (de) | Beta aminocrotonsaeurepiperidylester, verfahren zu ihrer herstellung und ihre verwendung als lichtschutzmittel | |
| EP0094350B1 (de) | 1-Diorganocarbamoyl-polyalkylpiperidine und ihre Herstellung | |
| DE3805786C2 (de) | Piperidin-Verbindungen | |
| DE2310135B2 (de) | 4-Phenylbenzylidenmalonsäurederivate und ihre Verwendung zur Stabilisierung von Polymeren gegen UV-Strahlung | |
| EP0064752A2 (de) | Durch Piperidylgruppen substituierte Phosphazene, Verfahren zu ihrer Herstellung, ihre Verwendung als Stabilisatoren und die mit ihnen stabilisierten Polymermassen | |
| DE2545645A1 (de) | Thiazolinylamino-piperidin-derivate | |
| DE4447096C2 (de) | Stabilisierte chlorhaltige Polymerisate und Verwendung von funktionellen Harnstoff-Derivaten als Stabilisatoren | |
| DE2211177A1 (de) | N-substituierte piperidinderivate, verfahren zur herstellung derselben und ihre verwendung als stabilisatoren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |