CH618980A5 - - Google Patents
Download PDFInfo
- Publication number
- CH618980A5 CH618980A5 CH1437375A CH1437375A CH618980A5 CH 618980 A5 CH618980 A5 CH 618980A5 CH 1437375 A CH1437375 A CH 1437375A CH 1437375 A CH1437375 A CH 1437375A CH 618980 A5 CH618980 A5 CH 618980A5
- Authority
- CH
- Switzerland
- Prior art keywords
- compound
- formula
- carbon atoms
- alkyl
- hydrogen
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 86
- 125000004432 carbon atom Chemical group C* 0.000 claims description 36
- 238000000034 method Methods 0.000 claims description 35
- 238000002360 preparation method Methods 0.000 claims description 25
- 125000000217 alkyl group Chemical group 0.000 claims description 24
- 239000000460 chlorine Substances 0.000 claims description 22
- 239000001257 hydrogen Substances 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims description 16
- -1 hydroxy, nitro, amino Chemical group 0.000 claims description 15
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- 230000008569 process Effects 0.000 claims description 14
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- 239000012320 chlorinating reagent Substances 0.000 claims description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 7
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 239000011737 fluorine Substances 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 229910021529 ammonia Inorganic materials 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 229910052763 palladium Inorganic materials 0.000 claims description 5
- FMCAFXHLMUOIGG-IWFBPKFRSA-N (2s)-2-[[(2s)-2-[[(2s)-2-[[(2r)-2-formamido-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,5-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid Chemical compound O=CN[C@@H](CS)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(O)=O)CC1=CC(C)=C(O)C=C1C FMCAFXHLMUOIGG-IWFBPKFRSA-N 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 claims description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 4
- 238000005984 hydrogenation reaction Methods 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- HEQOJEGTZCTHCF-UHFFFAOYSA-N 2-amino-1-phenylethanone Chemical compound NCC(=O)C1=CC=CC=C1 HEQOJEGTZCTHCF-UHFFFAOYSA-N 0.000 claims description 2
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 2
- 229910006069 SO3H Inorganic materials 0.000 claims description 2
- 238000005660 chlorination reaction Methods 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- WZWKEEOAUZXNJJ-UHFFFAOYSA-N isocyanato acetate Chemical compound CC(=O)ON=C=O WZWKEEOAUZXNJJ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 229910052759 nickel Inorganic materials 0.000 claims description 2
- 229910052697 platinum Inorganic materials 0.000 claims description 2
- 229910052703 rhodium Inorganic materials 0.000 claims description 2
- 239000010948 rhodium Substances 0.000 claims description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 2
- 229910052707 ruthenium Inorganic materials 0.000 claims description 2
- 239000011877 solvent mixture Substances 0.000 claims description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 2
- 239000000243 solution Substances 0.000 description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 206010020772 Hypertension Diseases 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- XTWYTFMLZFPYCI-KQYNXXCUSA-N 5'-adenylphosphoric acid Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O XTWYTFMLZFPYCI-KQYNXXCUSA-N 0.000 description 5
- XTWYTFMLZFPYCI-UHFFFAOYSA-N Adenosine diphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(O)=O)C(O)C1O XTWYTFMLZFPYCI-UHFFFAOYSA-N 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 230000036772 blood pressure Effects 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000000338 in vitro Methods 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 102000008186 Collagen Human genes 0.000 description 3
- 108010035532 Collagen Proteins 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000002776 aggregation Effects 0.000 description 3
- 238000004220 aggregation Methods 0.000 description 3
- 210000001772 blood platelet Anatomy 0.000 description 3
- 229920001436 collagen Polymers 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 210000004623 platelet-rich plasma Anatomy 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- NTURVSFTOYPGON-UHFFFAOYSA-N Dihydroquinazoline Chemical compound C1=CC=C2C=NCNC2=C1 NTURVSFTOYPGON-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- 208000007536 Thrombosis Diseases 0.000 description 2
- 230000002744 anti-aggregatory effect Effects 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 230000001077 hypotensive effect Effects 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 230000001766 physiological effect Effects 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical class C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- GJSURZIOUXUGAL-UHFFFAOYSA-N Clonidine Chemical compound ClC1=CC=CC(Cl)=C1NC1=NCCN1 GJSURZIOUXUGAL-UHFFFAOYSA-N 0.000 description 1
- ZNIFSRGNXRYGHF-UHFFFAOYSA-N Clonidine hydrochloride Chemical compound Cl.ClC1=CC=CC(Cl)=C1NC1=NCCN1 ZNIFSRGNXRYGHF-UHFFFAOYSA-N 0.000 description 1
- 206010011091 Coronary artery thrombosis Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 206010033799 Paralysis Diseases 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 230000003182 bronchodilatating effect Effects 0.000 description 1
- 229940063628 catapres Drugs 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 208000002528 coronary thrombosis Diseases 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- BMZKPXNUGZFSPT-UHFFFAOYSA-N ethyl 2-[(2-amino-6-methylphenyl)methylamino]acetate Chemical compound CCOC(=O)CNCC1=C(C)C=CC=C1N BMZKPXNUGZFSPT-UHFFFAOYSA-N 0.000 description 1
- DUVOZUPPHBRJJO-UHFFFAOYSA-N ethyl 2-isocyanatoacetate Chemical compound CCOC(=O)CN=C=O DUVOZUPPHBRJJO-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 230000000574 ganglionic effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 210000003709 heart valve Anatomy 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 208000021822 hypotensive Diseases 0.000 description 1
- 238000001361 intraarterial administration Methods 0.000 description 1
- 230000000302 ischemic effect Effects 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- AGJSNMGHAVDLRQ-IWFBPKFRSA-N methyl (2s)-2-[[(2s)-2-[[(2s)-2-[[(2r)-2-amino-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,3-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoate Chemical compound SC[C@H](N)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)OC)CC1=CC=C(O)C(C)=C1C AGJSNMGHAVDLRQ-IWFBPKFRSA-N 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 210000002381 plasma Anatomy 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 1
- FVACZQHQBKPPMX-UHFFFAOYSA-N quinazolin-2-one Chemical compound C1=C[CH]C2=NC(=O)N=CC2=C1 FVACZQHQBKPPMX-UHFFFAOYSA-N 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/521,304 US3983119A (en) | 1974-11-06 | 1974-11-06 | Process for the preparation of optionally substituted 1,2,3,5-tetrahydroimidazo[2,1-b]quinazolin-2-ones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH618980A5 true CH618980A5 (enExample) | 1980-08-29 |
Family
ID=24076219
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1437375A CH618980A5 (enExample) | 1974-11-06 | 1975-11-06 |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3983119A (enExample) |
| JP (1) | JPS5170797A (enExample) |
| CA (1) | CA1055024A (enExample) |
| CH (1) | CH618980A5 (enExample) |
| DK (1) | DK490775A (enExample) |
| HU (1) | HU175048B (enExample) |
| NL (1) | NL7512965A (enExample) |
| SE (1) | SE7512341L (enExample) |
| YU (2) | YU40802B (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7807507A (nl) * | 1977-07-25 | 1979-01-29 | Hoffmann La Roche | Tricyclische verbindingen. |
| US4208521A (en) * | 1978-07-31 | 1980-06-17 | Bristol-Myers Company | Process for the preparation of imidazo[2,1-b]quinazolinones |
| JPS604186A (ja) * | 1983-06-21 | 1985-01-10 | Dai Ichi Seiyaku Co Ltd | イミダゾキナゾリン化合物 |
| JPS6028979A (ja) * | 1983-07-14 | 1985-02-14 | Dai Ichi Seiyaku Co Ltd | イミダゾキナゾリン類化合物 |
| US4645836A (en) * | 1983-09-12 | 1987-02-24 | Ortho Pharmaceutical Corporation | Process for the preparation of 6,7-dihydroxy-4-alkyl-2(1H) quinazolinone-1-propionic acids |
| NO164654C (no) * | 1984-02-15 | 1990-10-31 | Syntex Inc | Analogifremgangsmaate for fremstilling av terapeutisk aktive (2-okso-1,2,3,5-tetrahydroimidazo (2,1-b)kinazolinyl)-oksylakylamider. |
| US4783467A (en) * | 1985-06-05 | 1988-11-08 | Pfizer Inc. | Tetrahydroimidazoquinazolinone inotropic agents |
| US4837239A (en) * | 1985-08-23 | 1989-06-06 | Syntex (U.S.A.) Inc. | Cardiotonic phosphodiesterase inhibitors complexed with water soluble vitamins |
| AU2004206783B2 (en) * | 2003-01-23 | 2009-03-26 | Shire Holdings Ag | Formulation and methods for the treatment of thrombocythemia |
| US20060030574A1 (en) * | 2004-08-04 | 2006-02-09 | Shire Holdings Ag | Quinazoline derivatives useful for the treatment of peripheral arterial disease and as phosphodiesterase inhibitors |
| US7700608B2 (en) * | 2004-08-04 | 2010-04-20 | Shire Holdings Ag | Quinazoline derivatives and their use in the treatment of thrombocythemia |
| US8304420B2 (en) | 2006-11-28 | 2012-11-06 | Shire Llc | Substituted quinazolines for reducing platelet count |
| US7910597B2 (en) * | 2006-11-28 | 2011-03-22 | Shire Llc | Substituted quinazolines |
| GB0808967D0 (en) * | 2008-05-16 | 2008-06-25 | Shire Llc | Substitute quinazolines |
| GB0808950D0 (en) * | 2008-05-16 | 2008-06-25 | Shire Llc | Substituted quinazolines |
| GB0808953D0 (en) * | 2008-05-16 | 2008-06-25 | Shire Llc | substituted quinazolines |
| GB0808944D0 (en) * | 2008-05-16 | 2008-06-25 | Shire Llc | Substituted quinazolines |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3257401A (en) * | 1964-06-18 | 1966-06-21 | Searle & Co | 5-hydroxy-2-methylcycloalkyl[d] imidazo[1, 2-a]pyrimidines |
| US3600390A (en) * | 1968-07-01 | 1971-08-17 | Schering Corp | Novel 5-phenyl imidazolidino(5,1-a)5h-quinazolines and process therefor |
| US3745216A (en) * | 1969-12-18 | 1973-07-10 | Smith Kline French Lab | Compositions and methods for producing hypotensive activity with imidazo and pyrimido(2,1-b)quinazoline compounds |
| BE760013A (fr) * | 1969-12-18 | 1971-06-08 | Smith Kline French Lab | Imidazo et pyrimido -(2,1-b)quinazolines, leurs procedes de preparationet compositions pharmaceutiques en contenant |
| US3790576A (en) * | 1972-03-20 | 1974-02-05 | Parke Davis & Co | 9 substituted 4,9-dihydro-1,3,4,4-tetraalkyl-1h-pyrazolo(3,4-b)quinolines |
| US3859289A (en) * | 1973-01-26 | 1975-01-07 | Goetz E Hardtmann | Tricyclic pyrimidinones |
-
1974
- 1974-11-06 US US05/521,304 patent/US3983119A/en not_active Expired - Lifetime
-
1975
- 1975-10-28 CA CA238,468A patent/CA1055024A/en not_active Expired
- 1975-10-30 DK DK490775A patent/DK490775A/da not_active Application Discontinuation
- 1975-11-04 SE SE7512341A patent/SE7512341L/xx unknown
- 1975-11-05 HU HU75BI528A patent/HU175048B/hu unknown
- 1975-11-05 NL NL7512965A patent/NL7512965A/xx not_active Application Discontinuation
- 1975-11-05 YU YU2798/75A patent/YU40802B/xx unknown
- 1975-11-06 JP JP50132505A patent/JPS5170797A/ja active Granted
- 1975-11-06 CH CH1437375A patent/CH618980A5/de not_active IP Right Cessation
-
1982
- 1982-05-28 YU YU01134/82A patent/YU113482A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK490775A (da) | 1976-05-07 |
| JPS6259109B2 (enExample) | 1987-12-09 |
| JPS5170797A (en) | 1976-06-18 |
| NL7512965A (nl) | 1976-05-10 |
| SE7512341L (sv) | 1976-05-07 |
| YU113482A (en) | 1982-10-31 |
| YU279875A (en) | 1982-10-31 |
| YU40802B (en) | 1986-06-30 |
| CA1055024A (en) | 1979-05-22 |
| HU175048B (hu) | 1980-05-28 |
| US3983119A (en) | 1976-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH618980A5 (enExample) | ||
| DE68914793T2 (de) | Chinazolinon-Derivate. | |
| DE69616056T2 (de) | 3-acylindole als cb2 rezeptor agonisten | |
| DE2305575C2 (enExample) | ||
| EP0022078B1 (de) | Pyrazolochinoline, Verfahren zu ihrer Herstellung, und pharmazeutische Präparate enthaltend diese Verbindungen | |
| CH639662A5 (de) | Imidazoazine und imidazodiazine. | |
| DE2420618C2 (de) | Aminoalkylanilide, Verfahren zu ihrer Herstellung sowie pharmazeutische Zubereitungen, die diese Aminoalkylanilide enthalten | |
| CH622793A5 (enExample) | ||
| Kumar et al. | Syntheses and anthelmintic activity of alkyl 5 (6)-(substituted carbamoyl)-and 5 (6)-(disubstituted carbamoyl) benzimidazole-2-carbamates and related compounds | |
| CH649553A5 (de) | Azepinoindole und verfahren zu deren herstellung. | |
| CH643263A5 (de) | Benzodiazepine, ihre herstellung und verwendung. | |
| DE69011046T2 (de) | Pyridinderivate, Verfahren zur Herstellung und pharmazeutische Zusammensetzungen. | |
| EP0066774B1 (de) | Neue 1,4,9,10-Tetrahydro-pyrazolo(4,3-e)pyrido(3,2-b)(1,4)-diazepin-10-one, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2746550A1 (de) | Im benzolring gegebenenfalls substituierte eckige klammer auf (5-phenyl- 2-oxyzolyl)-methylenamino eckige klammer zu -imidazolin-2,4-dione | |
| DE3879378T2 (de) | Amid-verbindungen. | |
| DE2143646A1 (de) | 2-Amino-l,5-benzodiazocinderivate und Verfahren zu ihrer Herstellung | |
| EP0113911B1 (de) | Pyrido-triazolochinazoline, ihre Herstellung und Verwendung | |
| DE2601703C2 (de) | 2-(Indenyloxymethyl)morpholin-Derivate | |
| DE2114563A1 (de) | Substituierte 6 Phenyl imidazo eckige Klammer auf 2,1 b eckige Klammer zu thiazole | |
| CH634828A5 (de) | Verfahren zur herstellung neuer oximaetherverbindungen. | |
| DD236929A5 (de) | Verfahren zur herstellung von benzazolderivaten | |
| DE2102733A1 (en) | 2-arylamino-2-imidazolines | |
| DE1928704A1 (de) | Neue 2,4-Dione und Verfahren zu deren Herstellung | |
| DE2609127A1 (de) | Neue organische verbindungen und verfahren zu deren herstellung | |
| DE2203743A1 (de) | Neue Phenalendiamin-Derivate und Verfahren zu deren Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |