CH618441A5 - - Google Patents
Download PDFInfo
- Publication number
- CH618441A5 CH618441A5 CH820975A CH820975A CH618441A5 CH 618441 A5 CH618441 A5 CH 618441A5 CH 820975 A CH820975 A CH 820975A CH 820975 A CH820975 A CH 820975A CH 618441 A5 CH618441 A5 CH 618441A5
- Authority
- CH
- Switzerland
- Prior art keywords
- methyl
- amino
- oxo
- thia
- acid
- Prior art date
Links
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 148
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 140
- -1 alkyl radical Chemical class 0.000 claims description 129
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 102
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 94
- 150000001875 compounds Chemical class 0.000 claims description 68
- 239000001257 hydrogen Substances 0.000 claims description 53
- 229910052739 hydrogen Inorganic materials 0.000 claims description 53
- SCNWTQPZTZMXBG-UHFFFAOYSA-N 2-methyloct-2-enoic acid Chemical compound CCCCCC=C(C)C(O)=O SCNWTQPZTZMXBG-UHFFFAOYSA-N 0.000 claims description 52
- 125000004432 carbon atom Chemical group C* 0.000 claims description 51
- 150000002431 hydrogen Chemical group 0.000 claims description 27
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 22
- 125000003118 aryl group Chemical group 0.000 claims description 20
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 18
- 150000003254 radicals Chemical class 0.000 claims description 18
- 150000003839 salts Chemical class 0.000 claims description 17
- 239000002904 solvent Substances 0.000 claims description 16
- PEHSSTUGJUBZBI-UHFFFAOYSA-N indan-5-ol Chemical compound OC1=CC=C2CCCC2=C1 PEHSSTUGJUBZBI-UHFFFAOYSA-N 0.000 claims description 12
- 229910052757 nitrogen Inorganic materials 0.000 claims description 12
- AYLIEDQYYJIGDP-UHFFFAOYSA-N [C]1=CC=CS1 Chemical compound [C]1=CC=CS1 AYLIEDQYYJIGDP-UHFFFAOYSA-N 0.000 claims description 11
- 230000008569 process Effects 0.000 claims description 11
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 claims description 10
- 150000001412 amines Chemical class 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 9
- 125000003277 amino group Chemical group 0.000 claims description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 9
- 229910052794 bromium Inorganic materials 0.000 claims description 9
- 239000000460 chlorine Chemical group 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 7
- 150000001768 cations Chemical class 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 231100000252 nontoxic Toxicity 0.000 claims description 6
- 230000003000 nontoxic effect Effects 0.000 claims description 6
- 125000006239 protecting group Chemical group 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- 230000001476 alcoholic effect Effects 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 claims description 2
- ZBPYTVBKHKUNHG-UHFFFAOYSA-N non-3-enoic acid Chemical compound CCCCCC=CCC(O)=O ZBPYTVBKHKUNHG-UHFFFAOYSA-N 0.000 claims description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 claims 3
- 125000000539 amino acid group Chemical group 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- 239000002253 acid Substances 0.000 description 55
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 51
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 50
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 44
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 27
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 239000000203 mixture Substances 0.000 description 20
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 17
- 239000000047 product Substances 0.000 description 17
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 16
- 235000002639 sodium chloride Nutrition 0.000 description 16
- 239000000243 solution Substances 0.000 description 16
- NKBWMBRPILTCRD-UHFFFAOYSA-N 2-Methylheptanoic acid Chemical compound CCCCCC(C)C(O)=O NKBWMBRPILTCRD-UHFFFAOYSA-N 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 13
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 12
- 150000002148 esters Chemical class 0.000 description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 12
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 11
- 229930186147 Cephalosporin Natural products 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- 229940124587 cephalosporin Drugs 0.000 description 11
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 11
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 10
- 150000001780 cephalosporins Chemical class 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 9
- 239000004202 carbamide Substances 0.000 description 9
- 125000001424 substituent group Chemical group 0.000 description 9
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 8
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 7
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 7
- IHRDRARBCSMILJ-UHFFFAOYSA-N 1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCCC2CCN12 IHRDRARBCSMILJ-UHFFFAOYSA-N 0.000 description 6
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 125000001544 thienyl group Chemical group 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 5
- 239000007789 gas Substances 0.000 description 5
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- HSHGZXNAXBPPDL-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-azaniumyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C(N)C12 HSHGZXNAXBPPDL-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- UHGKYJXJYJWDAM-UHFFFAOYSA-N Propylthiourea Chemical compound CCCNC(N)=S UHGKYJXJYJWDAM-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 150000002960 penicillins Chemical class 0.000 description 4
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 4
- 235000005074 zinc chloride Nutrition 0.000 description 4
- 239000011592 zinc chloride Substances 0.000 description 4
- SXERGJJQSKIUIC-UHFFFAOYSA-N 2-Phenoxypropionic acid Chemical compound OC(=O)C(C)OC1=CC=CC=C1 SXERGJJQSKIUIC-UHFFFAOYSA-N 0.000 description 3
- GJNNLILROAPGRC-UHFFFAOYSA-N 2-[4-(chloromethyl)phenyl]acetic acid Chemical compound OC(=O)CC1=CC=C(CCl)C=C1 GJNNLILROAPGRC-UHFFFAOYSA-N 0.000 description 3
- ILPBINAXDRFYPL-UHFFFAOYSA-N 2-octene Chemical compound CCCCCC=CC ILPBINAXDRFYPL-UHFFFAOYSA-N 0.000 description 3
- DNHPKCHVSYFMCQ-UHFFFAOYSA-N 7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound OC(=O)C1CSC2CC(=O)N12 DNHPKCHVSYFMCQ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- FLVIGYVXZHLUHP-UHFFFAOYSA-N N,N'-diethylthiourea Chemical compound CCNC(=S)NCC FLVIGYVXZHLUHP-UHFFFAOYSA-N 0.000 description 3
- GMEHFXXZSWDEDB-UHFFFAOYSA-N N-ethylthiourea Chemical compound CCNC(N)=S GMEHFXXZSWDEDB-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 238000005903 acid hydrolysis reaction Methods 0.000 description 3
- VWHAMUYEURGAJM-UHFFFAOYSA-N bicyclo[3.2.0]heptane-4-carboxylic acid Chemical compound OC(=O)C1CCC2CCC12 VWHAMUYEURGAJM-UHFFFAOYSA-N 0.000 description 3
- MTJHEMHRSROWNE-UHFFFAOYSA-N bicyclo[4.2.0]oct-4-ene-5-carboxylic acid Chemical compound OC(=O)C1=CCCC2CCC12 MTJHEMHRSROWNE-UHFFFAOYSA-N 0.000 description 3
- HRQGCQVOJVTVLU-UHFFFAOYSA-N bis(chloromethyl) ether Chemical compound ClCOCCl HRQGCQVOJVTVLU-UHFFFAOYSA-N 0.000 description 3
- 230000000903 blocking effect Effects 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- HXMRAWVFMYZQMG-UHFFFAOYSA-N 1,1,3-triethylthiourea Chemical compound CCNC(=S)N(CC)CC HXMRAWVFMYZQMG-UHFFFAOYSA-N 0.000 description 2
- QOOQLKSEGVNYLA-UHFFFAOYSA-N 1-$l^{1}-oxidanylbutane Chemical compound CCCC[O] QOOQLKSEGVNYLA-UHFFFAOYSA-N 0.000 description 2
- XWKAVQKJQBISOL-UHFFFAOYSA-N 2-(phenylazaniumyl)propanoate Chemical compound OC(=O)C(C)NC1=CC=CC=C1 XWKAVQKJQBISOL-UHFFFAOYSA-N 0.000 description 2
- OWUUOJBKIIEHTJ-UHFFFAOYSA-N 2-[2-(bromomethyl)phenyl]acetic acid Chemical compound OC(=O)CC1=CC=CC=C1CBr OWUUOJBKIIEHTJ-UHFFFAOYSA-N 0.000 description 2
- NIMLTRPHNCETQM-UHFFFAOYSA-N 2-[2-(chloromethyl)-4-methoxyphenyl]-2-hydroxyacetyl chloride Chemical compound COC1=CC=C(C(O)C(Cl)=O)C(CCl)=C1 NIMLTRPHNCETQM-UHFFFAOYSA-N 0.000 description 2
- WBZLWGLHESFGHD-UHFFFAOYSA-N 2-[4-(chloromethyl)phenyl]acetyl chloride Chemical compound ClCC1=CC=C(CC(Cl)=O)C=C1 WBZLWGLHESFGHD-UHFFFAOYSA-N 0.000 description 2
- BBIHLUXQQMRAON-UHFFFAOYSA-N 2-[5-(chloromethyl)thiophen-2-yl]acetic acid Chemical compound OC(=O)CC1=CC=C(CCl)S1 BBIHLUXQQMRAON-UHFFFAOYSA-N 0.000 description 2
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 2
- SFOZYQITDQHSHW-UHFFFAOYSA-N 2-methyloct-2-enoic acid;hydrochloride Chemical compound Cl.CCCCCC=C(C)C(O)=O SFOZYQITDQHSHW-UHFFFAOYSA-N 0.000 description 2
- OBKXEAXTFZPCHS-UHFFFAOYSA-N 4-phenylbutyric acid Chemical compound OC(=O)CCCC1=CC=CC=C1 OBKXEAXTFZPCHS-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- VLCDUOXHFNUCKK-UHFFFAOYSA-N N,N'-Dimethylthiourea Chemical compound CNC(=S)NC VLCDUOXHFNUCKK-UHFFFAOYSA-N 0.000 description 2
- 102100035591 POU domain, class 2, transcription factor 2 Human genes 0.000 description 2
- 101710084411 POU domain, class 2, transcription factor 2 Proteins 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 235000004279 alanine Nutrition 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- XXTZHYXQVWRADW-UHFFFAOYSA-N diazomethanone Chemical compound [N]N=C=O XXTZHYXQVWRADW-UHFFFAOYSA-N 0.000 description 2
- FGYDHYCFHBSNPE-UHFFFAOYSA-N diethyl phenylmalonate Chemical compound CCOC(=O)C(C(=O)OCC)C1=CC=CC=C1 FGYDHYCFHBSNPE-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical compound OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 2
- 229960003424 phenylacetic acid Drugs 0.000 description 2
- 239000003279 phenylacetic acid Substances 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical group CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 description 2
- RJSMWAAYYHWITP-VIFPVBQESA-N (2S)-2-amino-3-[4-(chloromethyl)phenyl]propanethioic S-acid Chemical compound OC(=S)[C@@H](N)CC1=CC=C(CCl)C=C1 RJSMWAAYYHWITP-VIFPVBQESA-N 0.000 description 1
- JQBDLDSXPJLCFK-QMMMGPOBSA-N (2s)-2-amino-3-phenoxypropanoic acid Chemical compound OC(=O)[C@@H](N)COC1=CC=CC=C1 JQBDLDSXPJLCFK-QMMMGPOBSA-N 0.000 description 1
- FUZKHKQRFZTMJA-QMMMGPOBSA-N (2s)-2-amino-3-phenylpropanethioic s-acid Chemical compound OC(=S)[C@@H](N)CC1=CC=CC=C1 FUZKHKQRFZTMJA-QMMMGPOBSA-N 0.000 description 1
- JTGRVEPHPHGJJL-UHFFFAOYSA-N 1,1-diethyl-3-methylthiourea Chemical compound CCN(CC)C(=S)NC JTGRVEPHPHGJJL-UHFFFAOYSA-N 0.000 description 1
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 1
- KREOCUNMMFZOOS-UHFFFAOYSA-N 1,3-di(propan-2-yl)thiourea Chemical compound CC(C)NC(S)=NC(C)C KREOCUNMMFZOOS-UHFFFAOYSA-N 0.000 description 1
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- AUXGIIVHLRLBSG-UHFFFAOYSA-N 1,3-dipropylthiourea Chemical compound CCCNC(=S)NCCC AUXGIIVHLRLBSG-UHFFFAOYSA-N 0.000 description 1
- UXTFKIJKRJJXNV-UHFFFAOYSA-N 1-$l^{1}-oxidanylethanone Chemical compound CC([O])=O UXTFKIJKRJJXNV-UHFFFAOYSA-N 0.000 description 1
- VWVZFHRDLPHBEG-UHFFFAOYSA-N 1-(chloromethyl)-4-methylsulfanylbenzene Chemical group CSC1=CC=C(CCl)C=C1 VWVZFHRDLPHBEG-UHFFFAOYSA-N 0.000 description 1
- XABLWQGBNZDQKL-UHFFFAOYSA-N 1-ethyl-3-propan-2-ylthiourea Chemical compound CCNC(=S)NC(C)C XABLWQGBNZDQKL-UHFFFAOYSA-N 0.000 description 1
- WSNDAYQNZRJGMJ-UHFFFAOYSA-N 2,2,2-trifluoroethanone Chemical compound FC(F)(F)[C]=O WSNDAYQNZRJGMJ-UHFFFAOYSA-N 0.000 description 1
- UKRMLMLMUQODDB-UHFFFAOYSA-N 2,2-dimethylpropanoyloxymethyl 2-methyloct-2-enoate Chemical compound CCCCCC=C(C)C(=O)OCOC(=O)C(C)(C)C UKRMLMLMUQODDB-UHFFFAOYSA-N 0.000 description 1
- YAGZHUZBHSJSQB-UHFFFAOYSA-N 2,2-dimethylpropanoyloxymethyl 3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1CC(COC(=O)C)=C(C(=O)OCOC(=O)C(C)(C)C)N2C(=O)C(N)C12 YAGZHUZBHSJSQB-UHFFFAOYSA-N 0.000 description 1
- YUKCWVKEFQFSEC-UHFFFAOYSA-N 2,2-dimethylpropanoyloxymethyl bicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(C(C)(C)C)(=O)OCOC(=O)C=1C2CCC2CCC=1 YUKCWVKEFQFSEC-UHFFFAOYSA-N 0.000 description 1
- UFBJCMHMOXMLKC-UHFFFAOYSA-N 2,4-dinitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O UFBJCMHMOXMLKC-UHFFFAOYSA-N 0.000 description 1
- BJRRCMFYQXFGOC-UHFFFAOYSA-N 2-(2-sulfophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC=C1S(O)(=O)=O BJRRCMFYQXFGOC-UHFFFAOYSA-N 0.000 description 1
- BRKGKBKFUATGIX-UHFFFAOYSA-N 2-(bromomethyl)phenol Chemical compound OC1=CC=CC=C1CBr BRKGKBKFUATGIX-UHFFFAOYSA-N 0.000 description 1
- HNVUTJYYTYBJDI-UHFFFAOYSA-N 2-[2-(bromomethyl)phenyl]acetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1CBr HNVUTJYYTYBJDI-UHFFFAOYSA-N 0.000 description 1
- YITOXWCIEJBSSD-UHFFFAOYSA-N 2-[2-(chloromethyl)-4-methoxyphenyl]-2-hydroxyacetic acid Chemical compound COC1=CC=C(C(O)C(O)=O)C(CCl)=C1 YITOXWCIEJBSSD-UHFFFAOYSA-N 0.000 description 1
- QVFWMJNRAVHVKQ-UHFFFAOYSA-N 2-[4-(chloromethyl)-2-sulfophenyl]acetic acid Chemical compound OC(=O)CC1=CC=C(CCl)C=C1S(O)(=O)=O QVFWMJNRAVHVKQ-UHFFFAOYSA-N 0.000 description 1
- MSUYMABVSZVGSV-UHFFFAOYSA-N 2-[4-(chloromethyl)phenyl]propanedioic acid Chemical compound OC(=O)C(C(O)=O)C1=CC=C(CCl)C=C1 MSUYMABVSZVGSV-UHFFFAOYSA-N 0.000 description 1
- QOEINMYFWQMSEB-UHFFFAOYSA-N 2-[5-(chloromethyl)thiophen-2-yl]acetyl chloride Chemical compound ClCC1=CC=C(CC(Cl)=O)S1 QOEINMYFWQMSEB-UHFFFAOYSA-N 0.000 description 1
- LTEPSSCJOSLAMO-UHFFFAOYSA-N 2-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound OC(=O)C1(N)C(C)(C)SC2CC(=O)N21 LTEPSSCJOSLAMO-UHFFFAOYSA-N 0.000 description 1
- FFVBTRNOFJOHDM-UHFFFAOYSA-N 2-amino-4-[4-(chloromethyl)anilino]butanoic acid Chemical compound NC(C(=O)O)CCNC1=CC=C(C=C1)CCl FFVBTRNOFJOHDM-UHFFFAOYSA-N 0.000 description 1
- UGTSXITWHOWJKM-UHFFFAOYSA-N 2-amino-4-[4-(chloromethyl)phenoxy]butanoic acid Chemical compound NC(C(=O)O)CCOC1=CC=C(C=C1)CCl UGTSXITWHOWJKM-UHFFFAOYSA-N 0.000 description 1
- QUCOPOWXZOCMBH-UHFFFAOYSA-N 2-amino-4-[4-(chloromethyl)phenyl]butanethioic S-acid Chemical compound NC(C(=S)O)CCC1=CC=C(C=C1)CCl QUCOPOWXZOCMBH-UHFFFAOYSA-N 0.000 description 1
- XZPKWMGGHYUMDZ-UHFFFAOYSA-N 2-amino-4-[4-(chloromethyl)phenyl]butanoic acid Chemical compound NC(C(=O)O)CCC1=CC=C(C=C1)CCl XZPKWMGGHYUMDZ-UHFFFAOYSA-N 0.000 description 1
- YVCKRFISRMSXBP-UHFFFAOYSA-N 2-amino-4-anilinobutanoic acid Chemical compound NC(C(=O)O)CCNC1=CC=CC=C1 YVCKRFISRMSXBP-UHFFFAOYSA-N 0.000 description 1
- CKRQJNSETUQXJW-UHFFFAOYSA-N 2-amino-4-phenylbutanethioic S-acid Chemical compound NC(C(=S)O)CCC1=CC=CC=C1 CKRQJNSETUQXJW-UHFFFAOYSA-N 0.000 description 1
- XLMSKXASROPJNG-UHFFFAOYSA-N 2-azaniumyl-2-thiophen-2-ylacetate Chemical compound OC(=O)C(N)C1=CC=CS1 XLMSKXASROPJNG-UHFFFAOYSA-N 0.000 description 1
- WPWZFAUHXAPBFF-UHFFFAOYSA-N 2-hydroxy-2-thiophen-2-ylacetic acid Chemical compound OC(=O)C(O)C1=CC=CS1 WPWZFAUHXAPBFF-UHFFFAOYSA-N 0.000 description 1
- JNJCEALGCZSIGB-UHFFFAOYSA-N 2-hydroxy-4-phenylbutanoic acid Chemical compound OC(=O)C(O)CCC1=CC=CC=C1 JNJCEALGCZSIGB-UHFFFAOYSA-N 0.000 description 1
- YORRXZKLVDDEGM-UHFFFAOYSA-N 2-methyl-3-(2-methylphenyl)propanoic acid Chemical compound OC(=O)C(C)CC1=CC=CC=C1C YORRXZKLVDDEGM-UHFFFAOYSA-N 0.000 description 1
- OPKOBMICXSNZNM-UHFFFAOYSA-N 2-methyl-4-phenoxybutanoic acid Chemical compound OC(=O)C(C)CCOC1=CC=CC=C1 OPKOBMICXSNZNM-UHFFFAOYSA-N 0.000 description 1
- OCKZHEXBLOOGOC-UHFFFAOYSA-N 2-methyl-4-phenylbutanoic acid Chemical compound OC(=O)C(C)CCC1=CC=CC=C1 OCKZHEXBLOOGOC-UHFFFAOYSA-N 0.000 description 1
- IIVWHGMLFGNMOW-UHFFFAOYSA-N 2-methylpropane Chemical compound C[C](C)C IIVWHGMLFGNMOW-UHFFFAOYSA-N 0.000 description 1
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- IXOFPUCWZCAFJX-UHFFFAOYSA-N 2-phenylethanethioic s-acid Chemical compound SC(=O)CC1=CC=CC=C1 IXOFPUCWZCAFJX-UHFFFAOYSA-N 0.000 description 1
- FOTITZRWZUAVPH-UHFFFAOYSA-N 2-phenylpropanoyl chloride Chemical compound ClC(=O)C(C)C1=CC=CC=C1 FOTITZRWZUAVPH-UHFFFAOYSA-N 0.000 description 1
- JIRKNEAMPYVPTD-UHFFFAOYSA-N 3-(2-methylphenyl)propanoic acid Chemical compound CC1=CC=CC=C1CCC(O)=O JIRKNEAMPYVPTD-UHFFFAOYSA-N 0.000 description 1
- PDZSGPZVHSIGTA-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[2-[4-(chloromethyl)phenyl]propanoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C)(=O)OCC1=C(N2C(C(C2SC1)NC(C(C)C1=CC=C(C=C1)CCl)=O)=O)C(=O)O PDZSGPZVHSIGTA-UHFFFAOYSA-N 0.000 description 1
- PMKCODROLUVQTR-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[[2-[2-(chloromethyl)-4-methoxyphenyl]-2-hydroxyacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound ClCC1=CC(OC)=CC=C1C(O)C(=O)NC1C(=O)N2C(C(O)=O)=C(COC(C)=O)CSC21 PMKCODROLUVQTR-UHFFFAOYSA-N 0.000 description 1
- OHHNJQFXLJMIGG-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[[2-[4-(chloromethyl)anilino]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C)(=O)OCC1=C(N2C(C(C2SC1)NC(CNC1=CC=C(C=C1)CCl)=O)=O)C(=O)O OHHNJQFXLJMIGG-UHFFFAOYSA-N 0.000 description 1
- NNRDERPEDRIVNL-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[[2-[4-(chloromethyl)phenoxy]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C)(=O)OCC1=C(N2C(C(C2SC1)NC(COC1=CC=C(C=C1)CCl)=O)=O)C(=O)O NNRDERPEDRIVNL-UHFFFAOYSA-N 0.000 description 1
- WOQMRJCOGCXSGK-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[[2-[4-(chloromethyl)phenyl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N(C2=O)C1C2NC(=O)CC1=CC=C(CCl)C=C1 WOQMRJCOGCXSGK-UHFFFAOYSA-N 0.000 description 1
- JZCADRHCFMTEPJ-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[[2-[5-(chloromethyl)thiophen-2-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N(C2=O)C1C2NC(=O)CC1=CC=C(CCl)S1 JZCADRHCFMTEPJ-UHFFFAOYSA-N 0.000 description 1
- UJYMIAQQCKJYNT-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[[2-amino-2-[4-(chloromethyl)phenyl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N(C2=O)C1C2NC(=O)C(N)C1=CC=C(CCl)C=C1 UJYMIAQQCKJYNT-UHFFFAOYSA-N 0.000 description 1
- HZFZSTKXHLAREG-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[[2-amino-2-[5-(chloromethyl)thiophen-2-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N(C2=O)C1C2NC(=O)C(N)C1=CC=C(CCl)S1 HZFZSTKXHLAREG-UHFFFAOYSA-N 0.000 description 1
- SOAQUKFJTLPXQV-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[[2-amino-3-[4-(chloromethyl)phenyl]sulfanylpropanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C)(=O)OCC1=C(N2C(C(C2SC1)NC(C(CSC1=CC=C(C=C1)CCl)N)=O)=O)C(=O)O SOAQUKFJTLPXQV-UHFFFAOYSA-N 0.000 description 1
- HBDXUCLIJFCZPN-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[[2-carboxy-3-[4-(chloromethyl)anilino]propanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C)(=O)OCC1=C(N2C(C(C2SC1)NC(C(CNC1=CC=C(C=C1)CCl)C(=O)O)=O)=O)C(=O)O HBDXUCLIJFCZPN-UHFFFAOYSA-N 0.000 description 1
- NDACYGACASKQPY-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[[2-carboxy-3-[5-(chloromethyl)thiophen-2-yl]propanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C)(=O)OCC1=C(N2C(C(C2SC1)NC(C(CC=1SC(=CC=1)CCl)C(=O)O)=O)=O)C(=O)O NDACYGACASKQPY-UHFFFAOYSA-N 0.000 description 1
- RFTYZLNBEGIZRP-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-amino-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(C)=O)=C(C(O)=O)N2C(=O)C(OC)(N)C21 RFTYZLNBEGIZRP-UHFFFAOYSA-N 0.000 description 1
- RBLLZFKXJIFDCL-UHFFFAOYSA-N 3-(aminomethyl)-n-propan-2-ylbenzenesulfonamide Chemical compound CC(C)NS(=O)(=O)C1=CC=CC(CN)=C1 RBLLZFKXJIFDCL-UHFFFAOYSA-N 0.000 description 1
- BUSOTUQRURCMCM-UHFFFAOYSA-N 3-Phenoxypropionic acid Chemical compound OC(=O)CCOC1=CC=CC=C1 BUSOTUQRURCMCM-UHFFFAOYSA-N 0.000 description 1
- NYQZPIDOTMSNSK-UHFFFAOYSA-N 3-[4-(chloromethyl)phenyl]-2-hydroxypropanoic acid Chemical compound OC(=O)C(O)CC1=CC=C(CCl)C=C1 NYQZPIDOTMSNSK-UHFFFAOYSA-N 0.000 description 1
- VKFXRBZSVGYYSA-UHFFFAOYSA-N 3-ethyl-1,1-dimethylthiourea Chemical compound CCNC(=S)N(C)C VKFXRBZSVGYYSA-UHFFFAOYSA-N 0.000 description 1
- BDNJWMFQLICJBH-UHFFFAOYSA-N 3-ethyl-1,1-dipropylthiourea Chemical compound CCCN(CCC)C(S)=NCC BDNJWMFQLICJBH-UHFFFAOYSA-N 0.000 description 1
- JDXQWYKOKYUQDN-UHFFFAOYSA-N 3-hydroxypyrrolidine-2,5-dione Chemical group OC1CC(=O)NC1=O JDXQWYKOKYUQDN-UHFFFAOYSA-N 0.000 description 1
- DEEKRROIWJNPQB-UHFFFAOYSA-N 3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(OC)=C(C(O)=O)N2C(=O)CC21 DEEKRROIWJNPQB-UHFFFAOYSA-N 0.000 description 1
- IBQTWOXEJABQFD-UHFFFAOYSA-N 3-methyl-1,1-dipropylthiourea Chemical compound CCCN(CCC)C(=S)NC IBQTWOXEJABQFD-UHFFFAOYSA-N 0.000 description 1
- SCOUCKCPPIIOCC-UHFFFAOYSA-N 3-phenyl-2-sulfopropanoic acid Chemical compound C1(=CC=CC=C1)CC(C(=O)O)S(=O)(=O)O SCOUCKCPPIIOCC-UHFFFAOYSA-N 0.000 description 1
- VOXXWSYKYCBWHO-UHFFFAOYSA-N 3-phenyllactic acid Chemical compound OC(=O)C(O)CC1=CC=CC=C1 VOXXWSYKYCBWHO-UHFFFAOYSA-N 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- WHXFWSFZCBNZLK-UHFFFAOYSA-N 4-anilinobutanoic acid Chemical compound OC(=O)CCCNC1=CC=CC=C1 WHXFWSFZCBNZLK-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- OBRJBKJCXLWCTB-UHFFFAOYSA-N 4-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CC(=O)SC2CCN12 OBRJBKJCXLWCTB-UHFFFAOYSA-N 0.000 description 1
- SNYWLAYOLPGDSS-UHFFFAOYSA-N 5-(chloromethyl)thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=C(CCl)S1 SNYWLAYOLPGDSS-UHFFFAOYSA-N 0.000 description 1
- LZAIGXQGDJEQFR-UHFFFAOYSA-N 6-[2-[4-(chloromethyl)phenoxy]propanoylamino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound C12SC(C)(C)C(C(O)=O)N2C(=O)C1NC(=O)C(C)OC1=CC=C(CCl)C=C1 LZAIGXQGDJEQFR-UHFFFAOYSA-N 0.000 description 1
- PSLIYZMNCMIURN-UHFFFAOYSA-N 6-[[2-[2-(chloromethyl)-4-methoxyphenyl]-2-hydroxyacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound ClCC1=CC(OC)=CC=C1C(O)C(=O)NC1C(=O)N2C(C(O)=O)C(C)(C)SC21 PSLIYZMNCMIURN-UHFFFAOYSA-N 0.000 description 1
- UPPYBUKJOYSKTF-UHFFFAOYSA-N 6-[[2-[4-(chloromethyl)anilino]acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)CNC1=CC=C(CCl)C=C1 UPPYBUKJOYSKTF-UHFFFAOYSA-N 0.000 description 1
- ZWRJJVPLYOMQSI-UHFFFAOYSA-N 6-[[2-[4-(chloromethyl)phenyl]acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)CC1=CC=C(CCl)C=C1 ZWRJJVPLYOMQSI-UHFFFAOYSA-N 0.000 description 1
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical class [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 description 1
- ONTLCYLIKPFZOY-UHFFFAOYSA-N 7-[[2-[4-(chloromethyl)phenyl]acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CC=3C=CC(CCl)=CC=3)C2SC1 ONTLCYLIKPFZOY-UHFFFAOYSA-N 0.000 description 1
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 1
- IKWLIQXIPRUIDU-UHFFFAOYSA-N 8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCSC2CC(=O)N12 IKWLIQXIPRUIDU-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 108020004256 Beta-lactamase Proteins 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- MKGXWTIJBXMHPC-UHFFFAOYSA-N Cl.NC(C(O)=O)c1ccc(CCl)cc1 Chemical compound Cl.NC(C(O)=O)c1ccc(CCl)cc1 MKGXWTIJBXMHPC-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- 108090000204 Dipeptidase 1 Proteins 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- ZGUNAGUHMKGQNY-ZETCQYMHSA-N L-alpha-phenylglycine zwitterion Chemical compound OC(=O)[C@@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-ZETCQYMHSA-N 0.000 description 1
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- KFFQABQEJATQAT-UHFFFAOYSA-N N,N'-dibutylthiourea Chemical compound CCCCNC(=S)NCCCC KFFQABQEJATQAT-UHFFFAOYSA-N 0.000 description 1
- XNPOFXIBHOVFFH-UHFFFAOYSA-N N-cyclohexyl-N'-(2-(4-morpholinyl)ethyl)carbodiimide Chemical compound C1CCCCC1N=C=NCCN1CCOCC1 XNPOFXIBHOVFFH-UHFFFAOYSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical group N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- 206010035664 Pneumonia Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 229910006069 SO3H Inorganic materials 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- 229910008433 SnCU Inorganic materials 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241000193996 Streptococcus pyogenes Species 0.000 description 1
- 101100073357 Streptomyces halstedii sch2 gene Proteins 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- ILXDAXZQNSOSAE-UHFFFAOYSA-N [AlH3].[Cl] Chemical compound [AlH3].[Cl] ILXDAXZQNSOSAE-UHFFFAOYSA-N 0.000 description 1
- QFSGXKULRXWMLK-UHFFFAOYSA-N [phenyl(propanoyloxy)methyl] 2-methyloct-2-enoate Chemical compound C(CC)(=O)OC(C1=CC=CC=C1)OC(=O)C(C)=CCCCCC QFSGXKULRXWMLK-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- OLAAPBNMLUIRHP-UHFFFAOYSA-N acetyloxymethyl 3-(acetyloxymethyl)-7-[[2-[4-(chloromethyl)phenyl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound O=C1N2C(C(=O)OCOC(=O)C)=C(COC(C)=O)CSC2C1NC(=O)CC1=CC=C(CCl)C=C1 OLAAPBNMLUIRHP-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N benzyl alcohol Substances OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 102000006635 beta-lactamase Human genes 0.000 description 1
- 239000001582 butter acid Substances 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- FUBBGQLTSCSAON-PBFPGSCMSA-N cefaloglycin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)COC(=O)C)C(O)=O)=CC=CC=C1 FUBBGQLTSCSAON-PBFPGSCMSA-N 0.000 description 1
- 229950004030 cefaloglycin Drugs 0.000 description 1
- 229960000603 cefalotin Drugs 0.000 description 1
- ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cephalexin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 ZAIPMKNFIOOWCQ-UEKVPHQBSA-N 0.000 description 1
- 229940106164 cephalexin Drugs 0.000 description 1
- VUFGUVLLDPOSBC-XRZFDKQNSA-M cephalothin sodium Chemical compound [Na+].N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C([O-])=O)C(=O)CC1=CC=CS1 VUFGUVLLDPOSBC-XRZFDKQNSA-M 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- HKYGSMOFSFOEIP-UHFFFAOYSA-N dichloro(dichloromethoxy)methane Chemical compound ClC(Cl)OC(Cl)Cl HKYGSMOFSFOEIP-UHFFFAOYSA-N 0.000 description 1
- GPAQDGYYVLFLMP-UHFFFAOYSA-N diethyl 2-[4-(chloromethyl)phenyl]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)C1=CC=C(CCl)C=C1 GPAQDGYYVLFLMP-UHFFFAOYSA-N 0.000 description 1
- QLACLEPYLWLNTD-UHFFFAOYSA-N dihydrocinnamic acid Natural products COc1ccc(CCC(O)=O)c(O)c1OC QLACLEPYLWLNTD-UHFFFAOYSA-N 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- XQQYHIBRZYACRS-UHFFFAOYSA-N ethyl n-(chloromethyl)-n-methylcarbamate Chemical compound CCOC(=O)N(C)CCl XQQYHIBRZYACRS-UHFFFAOYSA-N 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 125000000350 glycoloyl group Chemical group O=C([*])C([H])([H])O[H] 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003165 hydrotropic effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002541 isothioureas Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N mandelic acid Chemical compound OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- TWXDDNPPQUTEOV-FVGYRXGTSA-N methamphetamine hydrochloride Chemical compound Cl.CN[C@@H](C)CC1=CC=CC=C1 TWXDDNPPQUTEOV-FVGYRXGTSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical class OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical group O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 description 1
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 1
- 229950009215 phenylbutanoic acid Drugs 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- OUXQRYOOIUOPJH-UHFFFAOYSA-N propanoyloxymethyl 2-methyloct-2-enoate Chemical compound C(CC)(=O)OCOC(=O)C(C)=CCCCCC OUXQRYOOIUOPJH-UHFFFAOYSA-N 0.000 description 1
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 description 1
- BUVBYQUZAIPDHT-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S.NC(N)=S BUVBYQUZAIPDHT-UHFFFAOYSA-N 0.000 description 1
- XJVIPPHGDPEDJL-UHFFFAOYSA-N thiourea;hydrochloride Chemical compound Cl.NC(N)=S XJVIPPHGDPEDJL-UHFFFAOYSA-N 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 230000017105 transposition Effects 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/64—Acyl halides
- C07C57/76—Acyl halides containing halogen outside the carbonyl halide groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/76—Benzo[c]pyrans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Cephalosporin Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/482,264 US3948904A (en) | 1974-06-24 | 1974-06-24 | Isothiourea substituted cephalosporin derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH618441A5 true CH618441A5 (https=) | 1980-07-31 |
Family
ID=23915385
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH820975A CH618441A5 (https=) | 1974-06-24 | 1975-06-24 |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3948904A (https=) |
| JP (1) | JPS5116689A (https=) |
| BE (1) | BE830532A (https=) |
| CA (1) | CA1100483A (https=) |
| CH (1) | CH618441A5 (https=) |
| DE (1) | DE2526990A1 (https=) |
| DK (1) | DK284275A (https=) |
| FR (2) | FR2276041A1 (https=) |
| GB (2) | GB1490451A (https=) |
| IE (1) | IE42434B1 (https=) |
| IL (1) | IL47348A (https=) |
| NL (1) | NL7506939A (https=) |
| NO (1) | NO752217L (https=) |
| SE (1) | SE7507205L (https=) |
| ZA (1) | ZA753263B (https=) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS50144228A (https=) * | 1974-05-10 | 1975-11-20 | ||
| US4049651A (en) * | 1976-04-19 | 1977-09-20 | E. R. Squibb & Sons, Inc. | Alkoxy and alkylthioalkylureido cephalosporins |
| US4125715A (en) * | 1977-11-25 | 1978-11-14 | Yeda Research And Development Co. Ltd. | 7-[(Substituted-isothioureamethyl)phenyl]-acetamidocephalosporin derivatives |
| US4789460A (en) * | 1987-08-10 | 1988-12-06 | Phillips Petroleum Company | Process for facilitating filtration of used lubricating oil |
| JPH02167938A (ja) * | 1988-12-21 | 1990-06-28 | Topy Ind Ltd | 長い鋼棒による柱と梁の接合構造 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3839329A (en) * | 1971-11-04 | 1974-10-01 | Squibb & Sons Inc | {60 -amidinothioacetamidocephalosporanic acid compounds |
-
1974
- 1974-06-24 US US05/482,264 patent/US3948904A/en not_active Expired - Lifetime
-
1975
- 1975-05-20 ZA ZA00753263A patent/ZA753263B/xx unknown
- 1975-05-22 IE IE1150/75A patent/IE42434B1/en unknown
- 1975-05-23 CA CA227,665A patent/CA1100483A/en not_active Expired
- 1975-05-26 IL IL47348A patent/IL47348A/xx unknown
- 1975-06-11 NL NL7506939A patent/NL7506939A/xx not_active Application Discontinuation
- 1975-06-13 GB GB25460/75A patent/GB1490451A/en not_active Expired
- 1975-06-13 GB GB40925/76A patent/GB1490452A/en not_active Expired
- 1975-06-18 DE DE19752526990 patent/DE2526990A1/de not_active Withdrawn
- 1975-06-23 NO NO752217A patent/NO752217L/no unknown
- 1975-06-23 JP JP50075799A patent/JPS5116689A/ja active Pending
- 1975-06-23 DK DK284275A patent/DK284275A/da unknown
- 1975-06-23 FR FR7519592A patent/FR2276041A1/fr active Granted
- 1975-06-23 BE BE157587A patent/BE830532A/xx unknown
- 1975-06-24 CH CH820975A patent/CH618441A5/de not_active IP Right Cessation
- 1975-06-24 SE SE7507205A patent/SE7507205L/xx not_active Application Discontinuation
-
1976
- 1976-04-26 FR FR7612316A patent/FR2330675A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| IL47348A (en) | 1980-11-30 |
| FR2330675A1 (fr) | 1977-06-03 |
| NL7506939A (nl) | 1975-12-30 |
| GB1490451A (en) | 1977-11-02 |
| DK284275A (da) | 1975-12-25 |
| FR2276041B1 (https=) | 1980-05-16 |
| IL47348A0 (en) | 1975-07-28 |
| NO752217L (https=) | 1975-12-30 |
| DE2526990A1 (de) | 1976-01-15 |
| FR2330675B1 (https=) | 1979-08-10 |
| BE830532A (fr) | 1975-10-16 |
| CA1100483A (en) | 1981-05-05 |
| SE7507205L (sv) | 1975-12-29 |
| GB1490452A (en) | 1977-11-02 |
| AU8133075A (en) | 1976-11-25 |
| JPS5116689A (https=) | 1976-02-10 |
| US3948904A (en) | 1976-04-06 |
| FR2276041A1 (fr) | 1976-01-23 |
| IE42434L (en) | 1975-12-24 |
| IE42434B1 (en) | 1980-08-13 |
| ZA753263B (en) | 1976-04-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2647515A1 (de) | Neue cephalosporinderivate | |
| DE2736471C2 (https=) | ||
| EP0163190B1 (de) | Beta-Lactamantibiotika, Verfahren zu deren Herstellung sowie ihre Verwendung als Arzneimittel oder Wachstumsförderer in der Tieraufzucht oder als Antioxidantien | |
| CH628902A5 (de) | Verfahren zur herstellung von 7-beta-(2-oxyimino-2-arylacetamido)-cephalosporinen. | |
| CH618441A5 (https=) | ||
| DE1966850A1 (de) | Synthetische penicilline und verfahren zu ihrer herstellung ausser alpha-sulfobenzylpenicillin | |
| JPS5917117B2 (ja) | 抗菌剤の製法 | |
| DE2647496A1 (de) | Neue cephalosporinderivate | |
| CH622523A5 (https=) | ||
| DE2444321A1 (de) | 7-(halogenmethylaryl)-acetamidocephalosporinderivate, verfahren zu ihrer herstellung und arzneimittel | |
| CA1048997A (en) | Cephalosporin derivatives | |
| DE2636962C2 (https=) | ||
| DE2847534A1 (de) | 7-eckige klammer auf (sulfomethyl) phenyl eckige klammer zu acetamido- cephalosporinderivate | |
| EP0035161B1 (de) | Cephalosporine, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2647571A1 (de) | Neue cephalosporinderivate | |
| EP0000005A1 (de) | Neue Cephalosporinderivate, Verfahren zu ihrer Herstellung und pharmazeutische Präparate | |
| US3994875A (en) | Antibiotics | |
| DE2540804A1 (de) | 3-heterothio-7-ureidocephalosporine | |
| DE2021073A1 (de) | alpha-Amino-2,4,6-cycloheptatrienyl-methylcephalosporine und Verfahren zu ihrer Herstellung | |
| KR20030080509A (ko) | 우레아, 티오우레아 및 설파마이드 유도체를 함유하는항균제 조성물 | |
| DE2404592C2 (de) | In 3-Stellung thiolierte 7-Acyl-amidocephalosporansäurederivate, Verfahren zu deren Herstellung und sie enthaltende Mittel | |
| AT349146B (de) | Verfahren zur herstellung von neuen, eine alkylsulfonylaminogruppe enthaltenden cephalosporinen | |
| JPS6052125B2 (ja) | 抗菌性医薬組成物 | |
| DE2112058A1 (de) | Chemische Verbindungen und Verfahren zu ihrer Herstellung | |
| AT353971B (de) | Verfahren zur herstellung von neuen, eine niederalkylsulfonylaminogruppe enthaltenden cephalosporinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |