CH504401A - Verfahren zur reduktiven Dimerisierung olefinischer Verbindungen - Google Patents
Verfahren zur reduktiven Dimerisierung olefinischer VerbindungenInfo
- Publication number
- CH504401A CH504401A CH531865A CH531865A CH504401A CH 504401 A CH504401 A CH 504401A CH 531865 A CH531865 A CH 531865A CH 531865 A CH531865 A CH 531865A CH 504401 A CH504401 A CH 504401A
- Authority
- CH
- Switzerland
- Prior art keywords
- acrylonitrile
- alkyl
- water
- reaction
- adiponitrile
- Prior art date
Links
- BTGRAWJCKBQKAO-UHFFFAOYSA-N adiponitrile Chemical compound N#CCCCCC#N BTGRAWJCKBQKAO-UHFFFAOYSA-N 0.000 title description 52
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 80
- 229910000497 Amalgam Inorganic materials 0.000 claims abstract description 40
- 150000003839 salts Chemical class 0.000 claims abstract description 27
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims abstract description 17
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 16
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims abstract description 10
- 239000003112 inhibitor Substances 0.000 claims abstract description 9
- 150000002825 nitriles Chemical class 0.000 claims abstract description 9
- QKFFSWPNFCXGIQ-UHFFFAOYSA-M 4-methylbenzenesulfonate;tetraethylazanium Chemical compound CC[N+](CC)(CC)CC.CC1=CC=C(S([O-])(=O)=O)C=C1 QKFFSWPNFCXGIQ-UHFFFAOYSA-M 0.000 claims abstract description 7
- 150000001342 alkaline earth metals Chemical class 0.000 claims abstract description 6
- 150000001450 anions Chemical group 0.000 claims abstract description 5
- 150000003857 carboxamides Chemical class 0.000 claims abstract description 4
- 238000006471 dimerization reaction Methods 0.000 claims abstract 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 98
- 238000000034 method Methods 0.000 claims description 47
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 38
- 229910052757 nitrogen Inorganic materials 0.000 claims description 35
- 239000011541 reaction mixture Substances 0.000 claims description 23
- 239000000243 solution Substances 0.000 claims description 23
- 230000008569 process Effects 0.000 claims description 21
- 239000001569 carbon dioxide Substances 0.000 claims description 19
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 19
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 claims description 15
- 239000007788 liquid Substances 0.000 claims description 15
- 239000002609 medium Substances 0.000 claims description 15
- 150000001768 cations Chemical class 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 14
- 239000001257 hydrogen Substances 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- CMEWLCATCRTSGF-UHFFFAOYSA-N N,N-dimethyl-4-nitrosoaniline Chemical compound CN(C)C1=CC=C(N=O)C=C1 CMEWLCATCRTSGF-UHFFFAOYSA-N 0.000 claims description 10
- 230000002829 reductive effect Effects 0.000 claims description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 9
- 125000002091 cationic group Chemical group 0.000 claims description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 9
- 229910001023 sodium amalgam Inorganic materials 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- 238000006116 polymerization reaction Methods 0.000 claims description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 239000012736 aqueous medium Substances 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 6
- 239000012429 reaction media Substances 0.000 claims description 6
- 239000011734 sodium Substances 0.000 claims description 6
- 125000000304 alkynyl group Chemical group 0.000 claims description 5
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 150000003856 quaternary ammonium compounds Chemical class 0.000 claims description 5
- 238000006456 reductive dimerization reaction Methods 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 150000008360 acrylonitriles Chemical class 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 230000001105 regulatory effect Effects 0.000 claims description 4
- FHVCZJGBXWNGIZ-UHFFFAOYSA-M 4-methylbenzenesulfonate;tetramethylazanium Chemical compound C[N+](C)(C)C.CC1=CC=C(S([O-])(=O)=O)C=C1 FHVCZJGBXWNGIZ-UHFFFAOYSA-M 0.000 claims description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 239000007853 buffer solution Substances 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 230000001419 dependent effect Effects 0.000 claims 5
- 229910000567 Amalgam (chemistry) Inorganic materials 0.000 claims 1
- 125000002619 bicyclic group Chemical group 0.000 claims 1
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 claims 1
- 239000008055 phosphate buffer solution Substances 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 55
- 229910052783 alkali metal Inorganic materials 0.000 abstract description 13
- 150000001340 alkali metals Chemical class 0.000 abstract description 13
- 230000009467 reduction Effects 0.000 abstract description 4
- 150000001336 alkenes Chemical class 0.000 abstract description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 abstract description 2
- 239000008363 phosphate buffer Substances 0.000 abstract description 2
- YRRFBANPGRXQNJ-UHFFFAOYSA-M acetyl(trimethyl)azanium;bromide Chemical compound [Br-].CC(=O)[N+](C)(C)C YRRFBANPGRXQNJ-UHFFFAOYSA-M 0.000 abstract 1
- 150000001733 carboxylic acid esters Chemical class 0.000 abstract 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical group C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 45
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 37
- 230000015572 biosynthetic process Effects 0.000 description 26
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 18
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 17
- 229910052753 mercury Inorganic materials 0.000 description 17
- 239000012535 impurity Substances 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- -1 heterocyclic amine salts Chemical class 0.000 description 13
- 239000012071 phase Substances 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000000463 material Substances 0.000 description 12
- 238000002474 experimental method Methods 0.000 description 11
- 239000000376 reactant Substances 0.000 description 11
- 239000006227 byproduct Substances 0.000 description 10
- 239000007789 gas Substances 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 239000008346 aqueous phase Substances 0.000 description 9
- 239000007795 chemical reaction product Substances 0.000 description 9
- 230000001629 suppression Effects 0.000 description 9
- 230000008901 benefit Effects 0.000 description 8
- 239000000284 extract Substances 0.000 description 8
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 7
- 239000003153 chemical reaction reagent Substances 0.000 description 7
- 239000012043 crude product Substances 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- VNAZOYZEQAYHEC-UHFFFAOYSA-N hexanedinitrile propanenitrile Chemical compound C(CC)#N.C(CCCCC#N)#N VNAZOYZEQAYHEC-UHFFFAOYSA-N 0.000 description 7
- 229920000642 polymer Polymers 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- 239000011521 glass Substances 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000000178 monomer Substances 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 5
- QSWDMMVNRMROPK-UHFFFAOYSA-K chromium(3+) trichloride Chemical compound [Cl-].[Cl-].[Cl-].[Cr+3] QSWDMMVNRMROPK-UHFFFAOYSA-K 0.000 description 5
- 238000006386 neutralization reaction Methods 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- SALQMMXSINGXMI-UHFFFAOYSA-N 4-nitrosoaniline Chemical compound NC1=CC=C(N=O)C=C1 SALQMMXSINGXMI-UHFFFAOYSA-N 0.000 description 4
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 239000011651 chromium Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- 238000004811 liquid chromatography Methods 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 229910021556 Chromium(III) chloride Inorganic materials 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- RLGQACBPNDBWTB-UHFFFAOYSA-N cetyltrimethylammonium ion Chemical compound CCCCCCCCCCCCCCCC[N+](C)(C)C RLGQACBPNDBWTB-UHFFFAOYSA-N 0.000 description 3
- 239000011636 chromium(III) chloride Substances 0.000 description 3
- 235000007831 chromium(III) chloride Nutrition 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- SEACXNRNJAXIBM-UHFFFAOYSA-N triethyl(methyl)azanium Chemical compound CC[N+](C)(CC)CC SEACXNRNJAXIBM-UHFFFAOYSA-N 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 229910021555 Chromium Chloride Inorganic materials 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000498 cooling water Substances 0.000 description 2
- NKKMVIVFRUYPLQ-NSCUHMNNSA-N crotononitrile Chemical compound C\C=C\C#N NKKMVIVFRUYPLQ-NSCUHMNNSA-N 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- UMSGVWVBUHUHEH-UHFFFAOYSA-M ethyl(trimethyl)azanium;bromide Chemical compound [Br-].CC[N+](C)(C)C UMSGVWVBUHUHEH-UHFFFAOYSA-M 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- UVJUSGDDLXALCB-UHFFFAOYSA-N hexanedinitrile;prop-2-enenitrile Chemical compound C=CC#N.N#CCCCCC#N UVJUSGDDLXALCB-UHFFFAOYSA-N 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 150000002892 organic cations Chemical class 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 238000011172 small scale experimental method Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RWPRNPXSHGRVPR-UHFFFAOYSA-M 1-ethyl-1-methylpiperidin-1-ium;iodide Chemical compound [I-].CC[N+]1(C)CCCCC1 RWPRNPXSHGRVPR-UHFFFAOYSA-M 0.000 description 1
- HLNJFEXZDGURGZ-UHFFFAOYSA-M 1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC=C1 HLNJFEXZDGURGZ-UHFFFAOYSA-M 0.000 description 1
- PNYRDWUKTXFTPN-UHFFFAOYSA-M 1-methylquinolin-1-ium;iodide Chemical compound [I-].C1=CC=C2[N+](C)=CC=CC2=C1 PNYRDWUKTXFTPN-UHFFFAOYSA-M 0.000 description 1
- XZXYQEHISUMZAT-UHFFFAOYSA-N 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound CC1=CC=C(O)C(CC=2C(=CC=C(C)C=2)O)=C1 XZXYQEHISUMZAT-UHFFFAOYSA-N 0.000 description 1
- 239000001763 2-hydroxyethyl(trimethyl)azanium Substances 0.000 description 1
- ITZIDCFSZHTXJH-UHFFFAOYSA-M 2-methylisoquinolin-2-ium;iodide Chemical compound [I-].C1=CC=CC2=C[N+](C)=CC=C21 ITZIDCFSZHTXJH-UHFFFAOYSA-M 0.000 description 1
- NYLFUQXGUXOFBY-UHFFFAOYSA-N 3,4-dimethylhexanedinitrile Chemical compound N#CCC(C)C(C)CC#N NYLFUQXGUXOFBY-UHFFFAOYSA-N 0.000 description 1
- YGNXNQMVWHPUET-UHFFFAOYSA-M 4,4-dimethylmorpholin-4-ium;iodide Chemical compound [I-].C[N+]1(C)CCOCC1 YGNXNQMVWHPUET-UHFFFAOYSA-M 0.000 description 1
- GZZPUCCPDXIIKS-UHFFFAOYSA-M 4-methylbenzenesulfonate;triethyl(methyl)azanium Chemical compound CC[N+](C)(CC)CC.CC1=CC=C(S([O-])(=O)=O)C=C1 GZZPUCCPDXIIKS-UHFFFAOYSA-M 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- FRPHFZCDPYBUAU-UHFFFAOYSA-N Bromocresolgreen Chemical compound CC1=C(Br)C(O)=C(Br)C=C1C1(C=2C(=C(Br)C(O)=C(Br)C=2)C)C2=CC=CC=C2S(=O)(=O)O1 FRPHFZCDPYBUAU-UHFFFAOYSA-N 0.000 description 1
- GUGVZPJYXPLFSE-UHFFFAOYSA-M CC1=[N+](C)C=CN(C)C1.[I-] Chemical compound CC1=[N+](C)C=CN(C)C1.[I-] GUGVZPJYXPLFSE-UHFFFAOYSA-M 0.000 description 1
- 235000019743 Choline chloride Nutrition 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- VIZORQUEIQEFRT-UHFFFAOYSA-N Diethyl adipate Chemical compound CCOC(=O)CCCCC(=O)OCC VIZORQUEIQEFRT-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical class C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 1
- NQRYJNQNLNOLGT-UHFFFAOYSA-O Piperidinium(1+) Chemical compound C1CC[NH2+]CC1 NQRYJNQNLNOLGT-UHFFFAOYSA-O 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004373 acetylcholine Drugs 0.000 description 1
- ZEHGKSPCAMLJDC-UHFFFAOYSA-M acetylcholine bromide Chemical compound [Br-].CC(=O)OCC[N+](C)(C)C ZEHGKSPCAMLJDC-UHFFFAOYSA-M 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 229940107816 ammonium iodide Drugs 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- LRRJQNMXIDXNIM-UHFFFAOYSA-M benzyl(trimethyl)azanium;iodide Chemical compound [I-].C[N+](C)(C)CC1=CC=CC=C1 LRRJQNMXIDXNIM-UHFFFAOYSA-M 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZNFYPPCUDSCDPR-UHFFFAOYSA-M butyl(triethyl)azanium;bromide Chemical compound [Br-].CCCC[N+](CC)(CC)CC ZNFYPPCUDSCDPR-UHFFFAOYSA-M 0.000 description 1
- YGGIZRRNXQJOTI-UHFFFAOYSA-M butyl(trimethyl)azanium;bromide Chemical compound [Br-].CCCC[N+](C)(C)C YGGIZRRNXQJOTI-UHFFFAOYSA-M 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- SGMZJAMFUVOLNK-UHFFFAOYSA-M choline chloride Chemical compound [Cl-].C[N+](C)(C)CCO SGMZJAMFUVOLNK-UHFFFAOYSA-M 0.000 description 1
- 229960003178 choline chloride Drugs 0.000 description 1
- 150000001845 chromium compounds Chemical class 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 238000007278 cyanoethylation reaction Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- HCKMSHYCAFVSGW-UHFFFAOYSA-N cyclohexyl(trimethyl)azanium Chemical compound C[N+](C)(C)C1CCCCC1 HCKMSHYCAFVSGW-UHFFFAOYSA-N 0.000 description 1
- RTOVNUOKIDVFAU-UHFFFAOYSA-N cyclopentyl(trimethyl)azanium Chemical compound C[N+](C)(C)C1CCCC1 RTOVNUOKIDVFAU-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- URWCEDLDYLLXCC-UHFFFAOYSA-M decyl(triethyl)azanium;bromide Chemical compound [Br-].CCCCCCCCCC[N+](CC)(CC)CC URWCEDLDYLLXCC-UHFFFAOYSA-M 0.000 description 1
- PLMFYJJFUUUCRZ-UHFFFAOYSA-M decyltrimethylammonium bromide Chemical compound [Br-].CCCCCCCCCC[N+](C)(C)C PLMFYJJFUUUCRZ-UHFFFAOYSA-M 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- ADCFSTWINMTPQD-UHFFFAOYSA-M dibutyl(dimethyl)azanium;iodide Chemical compound [I-].CCCC[N+](C)(C)CCCC ADCFSTWINMTPQD-UHFFFAOYSA-M 0.000 description 1
- GBVPDVCJUZZSPS-UHFFFAOYSA-M didecyl(dimethyl)azanium;iodide Chemical compound [I-].CCCCCCCCCC[N+](C)(C)CCCCCCCCCC GBVPDVCJUZZSPS-UHFFFAOYSA-M 0.000 description 1
- OBEQINWXOHWYAG-UHFFFAOYSA-M diethyl(dimethyl)azanium;iodide Chemical compound [I-].CC[N+](C)(C)CC OBEQINWXOHWYAG-UHFFFAOYSA-M 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- IJUNHLQOTBSLMK-UHFFFAOYSA-M dimethyl(dipropyl)azanium;iodide Chemical compound [I-].CCC[N+](C)(C)CCC IJUNHLQOTBSLMK-UHFFFAOYSA-M 0.000 description 1
- REZZEXDLIUJMMS-UHFFFAOYSA-M dimethyldioctadecylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC REZZEXDLIUJMMS-UHFFFAOYSA-M 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000004664 distearyldimethylammonium chloride (DHTDMAC) Substances 0.000 description 1
- 239000012154 double-distilled water Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- AXGSHZVAGVXBJN-UHFFFAOYSA-M ethyl(tripropyl)azanium;bromide Chemical compound [Br-].CCC[N+](CC)(CCC)CCC AXGSHZVAGVXBJN-UHFFFAOYSA-M 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 238000001030 gas--liquid chromatography Methods 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000012844 infrared spectroscopy analysis Methods 0.000 description 1
- 238000009533 lab test Methods 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- UARUINOVQHEYKN-UHFFFAOYSA-M methyl(tripropyl)azanium;iodide Chemical compound [I-].CCC[N+](C)(CCC)CCC UARUINOVQHEYKN-UHFFFAOYSA-M 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000005673 monoalkenes Chemical class 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 125000006574 non-aromatic ring group Chemical group 0.000 description 1
- 150000002891 organic anions Chemical class 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- FIKAKWIAUPDISJ-UHFFFAOYSA-L paraquat dichloride Chemical compound [Cl-].[Cl-].C1=C[N+](C)=CC=C1C1=CC=[N+](C)C=C1 FIKAKWIAUPDISJ-UHFFFAOYSA-L 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 238000005554 pickling Methods 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000003822 preparative gas chromatography Methods 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- SZUDEHNEMMJTCQ-UHFFFAOYSA-N prop-2-enenitrile;hydrate Chemical compound O.C=CC#N SZUDEHNEMMJTCQ-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000005297 pyrex Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000005057 refrigeration Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- PXLIDIMHPNPGMH-UHFFFAOYSA-N sodium chromate Chemical compound [Na+].[Na+].[O-][Cr]([O-])(=O)=O PXLIDIMHPNPGMH-UHFFFAOYSA-N 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- 150000005621 tetraalkylammonium salts Chemical class 0.000 description 1
- 125000005497 tetraalkylphosphonium group Chemical group 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- TVVPMLFGPYQGTG-UHFFFAOYSA-M tetramethylphosphanium;iodide Chemical compound [I-].C[P+](C)(C)C TVVPMLFGPYQGTG-UHFFFAOYSA-M 0.000 description 1
- GKXDJYKZFZVASJ-UHFFFAOYSA-M tetrapropylazanium;iodide Chemical compound [I-].CCC[N+](CCC)(CCC)CCC GKXDJYKZFZVASJ-UHFFFAOYSA-M 0.000 description 1
- PRZSXZWFJHEZBJ-UHFFFAOYSA-N thymol blue Chemical compound C1=C(O)C(C(C)C)=CC(C2(C3=CC=CC=C3S(=O)(=O)O2)C=2C(=CC(O)=C(C(C)C)C=2)C)=C1C PRZSXZWFJHEZBJ-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- INTYQVPAIRRSRH-UHFFFAOYSA-M tributyl(ethyl)azanium;iodide Chemical compound [I-].CCCC[N+](CC)(CCCC)CCCC INTYQVPAIRRSRH-UHFFFAOYSA-M 0.000 description 1
- DXJLCRNXYNRGRA-UHFFFAOYSA-M tributyl(methyl)azanium;iodide Chemical compound [I-].CCCC[N+](C)(CCCC)CCCC DXJLCRNXYNRGRA-UHFFFAOYSA-M 0.000 description 1
- NDPWCNORTYFYDW-UHFFFAOYSA-M triethyl(methyl)azanium;iodide Chemical compound [I-].CC[N+](C)(CC)CC NDPWCNORTYFYDW-UHFFFAOYSA-M 0.000 description 1
- AEFDTACAGGUGSB-UHFFFAOYSA-M triethyl(propyl)azanium;bromide Chemical compound [Br-].CCC[N+](CC)(CC)CC AEFDTACAGGUGSB-UHFFFAOYSA-M 0.000 description 1
- LKDQWVKWYGOVJW-UHFFFAOYSA-M triethylsulfanium;iodide Chemical compound [I-].CC[S+](CC)CC LKDQWVKWYGOVJW-UHFFFAOYSA-M 0.000 description 1
- 239000013638 trimer Substances 0.000 description 1
- FCGQIZKUTMUWDC-UHFFFAOYSA-M trimethyl(propyl)azanium;bromide Chemical compound [Br-].CCC[N+](C)(C)C FCGQIZKUTMUWDC-UHFFFAOYSA-M 0.000 description 1
- JKNUDGADTOYLOC-UHFFFAOYSA-M trimethyl-(4-methylphenyl)azanium;iodide Chemical compound [I-].CC1=CC=C([N+](C)(C)C)C=C1 JKNUDGADTOYLOC-UHFFFAOYSA-M 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/34—Esters of acyclic saturated polycarboxylic acids having an esterified carboxyl group bound to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/34—Esters of acyclic saturated polycarboxylic acids having an esterified carboxyl group bound to an acyclic carbon atom
- C07C69/44—Adipic acid esters
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AU43311/64A AU279319B2 (es) | 1964-04-16 | ||
| AU48630/64A AU292745B2 (en) | 1964-08-27 | Amalgam hydrodimerisation process of olefinic nitriles and esters |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH504401A true CH504401A (de) | 1971-03-15 |
Family
ID=25626316
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH531865A CH504401A (de) | 1964-04-16 | 1965-04-15 | Verfahren zur reduktiven Dimerisierung olefinischer Verbindungen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3489789A (es) |
| BE (1) | BE662661A (es) |
| CH (1) | CH504401A (es) |
| DE (1) | DE1543062B1 (es) |
| GB (1) | GB1063497A (es) |
| NL (1) | NL140514B (es) |
| SE (1) | SE329839B (es) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1157443A (en) * | 1965-06-30 | 1969-07-09 | Ici Ltd | Reductive Dimerisation of Unsaturated Esters and Nitriles |
| US3855269A (en) * | 1972-07-27 | 1974-12-17 | Phillips Petroleum Co | Apparatus and method for separating tetraalkylammonium salt |
| US9678901B2 (en) | 2015-11-16 | 2017-06-13 | International Business Machines Corporation | Techniques for indicating a preferred virtual processor thread to service an interrupt in a data processing system |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3193480A (en) * | 1963-02-01 | 1965-07-06 | Monsanto Co | Adiponitrile process |
| FR1289071A (fr) * | 1961-05-04 | 1962-03-30 | Procédé de préparation de l'adiponitrile par dimérisation de l'acrylonitrile | |
| US3140276A (en) * | 1961-07-11 | 1964-07-07 | Exxon Research Engineering Co | Continuous electrolytic polymerization process |
| BE631302A (es) * | 1962-04-20 | |||
| FR1325977A (fr) * | 1962-05-23 | 1963-05-03 | Knapsack Ag | Procédé de préparation de dérivés d'acides dicarboxyliques aliphatiques |
| US3245889A (en) * | 1963-02-25 | 1966-04-12 | Monsanto Co | Electrolytic method for preparing low weight polymers of acrylonitrile |
| FR1366081A (fr) * | 1963-05-24 | 1964-07-10 | Rhone Poulenc Sa | Dicyano-2, 4 butène-1 |
| US3225083A (en) * | 1963-08-15 | 1965-12-21 | Shell Oil Co | Dimerization process of preparing 1,4-dicyano-1-butene from acrylonitrile |
| US3250690A (en) * | 1963-12-23 | 1966-05-10 | Monsanto Co | Electrolytic reductive coupling of cyano compounds |
| FR1472033A (fr) * | 1965-03-18 | 1967-03-10 | Rhone Poulenc Sa | Procédé de dimérisation linéaire de l'acrylonitrile |
-
0
- BE BE662661D patent/BE662661A/xx unknown
-
1965
- 1965-04-05 GB GB14325/65A patent/GB1063497A/en not_active Expired
- 1965-04-07 US US446430A patent/US3489789A/en not_active Expired - Lifetime
- 1965-04-13 SE SE04820/65A patent/SE329839B/xx unknown
- 1965-04-15 CH CH531865A patent/CH504401A/de not_active IP Right Cessation
- 1965-04-15 NL NL656504863A patent/NL140514B/xx unknown
- 1965-04-17 DE DE19651543062 patent/DE1543062B1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US3489789A (en) | 1970-01-13 |
| BE662661A (es) | |
| SE329839B (es) | 1970-10-26 |
| GB1063497A (en) | 1967-03-30 |
| NL6504863A (es) | 1965-10-18 |
| DE1543062B1 (de) | 1972-11-16 |
| NL140514B (nl) | 1973-12-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69420356T2 (de) | Verfahren zur Herstellung von Hydroxiden und Alkoxiden von hoher Reinheit | |
| DE102005012116B3 (de) | Verfahren und Vorrichtung zur Herstellung von 4-Fluorethylencarbonat | |
| EP0012215B1 (de) | 2-Hydroxybutansulfonsaures Cholin und dessen Verwendung als Leitsalz | |
| DE2522501A1 (de) | Verfahren zum herstellen von natriumbicarbonat aus dem ablauf der chlor-alkali elektrolysezelle und vorrichtung hierfuer | |
| DE69701224T2 (de) | Verfahren zur elektrochemischen synthese von n-acetylcystein aus cystein | |
| DE1493433B2 (de) | Verfahren zur herstellung von sekundaeren aminoparaffinen mit primaerer aminogruppe | |
| CH504401A (de) | Verfahren zur reduktiven Dimerisierung olefinischer Verbindungen | |
| EP0439636A1 (de) | Verfahren zur Herstellung von kohlensauren Salzen von Alkalimetallen | |
| DE2436111A1 (de) | Verfahren zur phenylendiaminen | |
| DE1543062C (es) | ||
| DE2125587A1 (de) | Verfahren zur Herstellung von Hypophosphiten | |
| DE2948343A1 (de) | Verfahren zur herstellung von vitamin b tief 1 und seinem zwischenprodukt und vorrichtung hierzu | |
| DE2153354A1 (de) | Verfahren zur Herstellung eines Alkoxids eines der Metalle Hafnium, Zirkonium und Thorium aus einem Tetrahalogenid des Metalles | |
| DE2812508C3 (de) | Verfahren zur Herstellung von N1N'dialkylsubstituierten Tetrahydro-4,4'bipyridylen | |
| DE3243008C2 (de) | Verfahren zur Herstellung von Alkoholen, wobei gleichzeitig eine konzentrierte Schwefelsäurelösung mit erhöhter thermischer Stabilität gewonnen wird | |
| DE2756588A1 (de) | Verfahren zur elektrochemischen oxidation alkoxysubstituierter aromatischer verbindungen | |
| DE2830144C2 (de) | Verfahren zur Herstellung von Sebacinsäure aus Adipinsäure | |
| DE2117750C3 (de) | Verfahren zur Gewinnung von Hydrochinon | |
| EP0589214B1 (de) | Verfahren zur Herstellung von perfluorierten Bromalkanen oder Ethergruppen enthaltenden perfluorierten Bromalkanen | |
| EP2844632B1 (de) | Verfahren zur umsetzung von glycerin zu organischen salzen | |
| DE60115663T2 (de) | Verfahren zur herstellung von alkyllithium-verbindungen | |
| DE2260126C2 (de) | Verfahren zur Herstellung von reinem, stabilem Malonsäuredinitril | |
| DE650380C (de) | Verfahren zur Darstellung von Morpholin bzw. 2, 6-Dimethylmorpholin | |
| DE1932037C3 (de) | Verfahren zur elektrolytischen Herstellung von Adipinsäuredinitril | |
| EP0071064B1 (de) | Verfahren zur Herstellung von alpha, omega-Bis-fluorsulfato-perfluoralkanen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |