CA2095009A1 - Cyclic imino derivatives - Google Patents
Cyclic imino derivativesInfo
- Publication number
- CA2095009A1 CA2095009A1 CA002095009A CA2095009A CA2095009A1 CA 2095009 A1 CA2095009 A1 CA 2095009A1 CA 002095009 A CA002095009 A CA 002095009A CA 2095009 A CA2095009 A CA 2095009A CA 2095009 A1 CA2095009 A1 CA 2095009A1
- Authority
- CA
- Canada
- Prior art keywords
- group
- denotes
- methyl
- substituted
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000000203 mixture Substances 0.000 claims abstract description 45
- 150000003839 salts Chemical class 0.000 claims abstract description 42
- -1 1,3-dihydro-3-oxo-1-isobenzofuranyloxy-carbonyl Chemical group 0.000 claims description 287
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 222
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 112
- 150000001875 compounds Chemical class 0.000 claims description 75
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 51
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 50
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 44
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 37
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 34
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 28
- 239000000460 chlorine Substances 0.000 claims description 28
- 229910052799 carbon Inorganic materials 0.000 claims description 27
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 26
- 150000001721 carbon Chemical group 0.000 claims description 26
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 26
- 229910052801 chlorine Inorganic materials 0.000 claims description 25
- 229910052731 fluorine Inorganic materials 0.000 claims description 24
- 239000011737 fluorine Substances 0.000 claims description 24
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 23
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 20
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 19
- 229910052757 nitrogen Inorganic materials 0.000 claims description 18
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 18
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical group O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 claims description 18
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 16
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 16
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 15
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 14
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 12
- 125000005805 dimethoxy phenyl group Chemical group 0.000 claims description 12
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 12
- 125000005842 heteroatom Chemical group 0.000 claims description 12
- 125000001424 substituent group Chemical group 0.000 claims description 12
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 11
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 10
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 10
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 10
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 10
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 10
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 10
- 125000004076 pyridyl group Chemical group 0.000 claims description 10
- 125000000304 alkynyl group Chemical group 0.000 claims description 9
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 9
- 125000006239 protecting group Chemical group 0.000 claims description 9
- 239000007787 solid Substances 0.000 claims description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- 150000001602 bicycloalkyls Chemical group 0.000 claims description 8
- 125000001246 bromo group Chemical group Br* 0.000 claims description 8
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 8
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 8
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 8
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 230000008569 process Effects 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 7
- 125000003277 amino group Chemical group 0.000 claims description 7
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 7
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 7
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 7
- 206010027476 Metastases Diseases 0.000 claims description 6
- 206010028980 Neoplasm Diseases 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 claims description 6
- 201000010099 disease Diseases 0.000 claims description 6
- 125000005567 fluorenylene group Chemical group 0.000 claims description 6
- 125000001153 fluoro group Chemical group F* 0.000 claims description 6
- 230000009401 metastasis Effects 0.000 claims description 6
- 125000006518 morpholino carbonyl group Chemical group [H]C1([H])OC([H])([H])C([H])([H])N(C(*)=O)C1([H])[H] 0.000 claims description 6
- 230000000269 nucleophilic effect Effects 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 125000006678 phenoxycarbonyl group Chemical group 0.000 claims description 6
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 claims description 5
- 206010003210 Arteriosclerosis Diseases 0.000 claims description 5
- 208000005189 Embolism Diseases 0.000 claims description 5
- 206010061216 Infarction Diseases 0.000 claims description 5
- 208000001132 Osteoporosis Diseases 0.000 claims description 5
- 208000011775 arteriosclerosis disease Diseases 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 230000000747 cardiac effect Effects 0.000 claims description 5
- 208000026106 cerebrovascular disease Diseases 0.000 claims description 5
- 230000007574 infarction Effects 0.000 claims description 5
- 210000004072 lung Anatomy 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- HQMNSHRXANDFSM-WVQMWBIHSA-N 1-cyclohexyloxycarbonyloxyethyl 2-[(3s,5s)-2-oxo-5-[[4-[4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]pyrrolidin-3-yl]acetate Chemical compound C([C@@H]1C[C@H](C(N1)=O)CC(=O)OC(C)OC(=O)OC1CCCCC1)OC(C=C1)=CC=C1C(C=C1)=CC=C1C(=N)NC(=O)OCC1=CC=CC=C1 HQMNSHRXANDFSM-WVQMWBIHSA-N 0.000 claims description 4
- 206010003178 Arterial thrombosis Diseases 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 206010047249 Venous thrombosis Diseases 0.000 claims description 4
- 208000037919 acquired disease Diseases 0.000 claims description 4
- 125000005605 benzo group Chemical group 0.000 claims description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 4
- 230000008619 cell matrix interaction Effects 0.000 claims description 4
- 230000008614 cellular interaction Effects 0.000 claims description 4
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 4
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 4
- NLQHTHNDMCJUAS-BFLQJQPQSA-N 1-cyclohexyloxycarbonyloxyethyl 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate Chemical compound C([C@@H]1C[C@H](C(N1)=O)CC(=O)OC(C)OC(=O)OC1CCCCC1)OC(C=C1)=CC=C1C1=CC=C(C(N)=N)C=C1 NLQHTHNDMCJUAS-BFLQJQPQSA-N 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- JISBIHMXVKBIEQ-PMACEKPBSA-N methyl 2-[(3s,5s)-5-[[4-[4-[(e)-n'-(acetyloxymethoxycarbonyl)carbamimidoyl]phenyl]phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate Chemical compound N1C(=O)[C@H](CC(=O)OC)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(=N)NC(=O)OCOC(C)=O)C=C1 JISBIHMXVKBIEQ-PMACEKPBSA-N 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 3
- 229940124597 therapeutic agent Drugs 0.000 claims description 3
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 2
- 125000003713 acetylimino group Chemical group [H]C([H])([H])C(=O)N=[*] 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 125000000490 cinnamyl group Chemical group C(C=CC1=CC=CC=C1)* 0.000 claims description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000002933 cyclohexyloxy group Chemical group C1(CCCCC1)O* 0.000 claims description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000006260 ethylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000005835 indanylene group Chemical group 0.000 claims description 2
- 125000004458 methylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])[H] 0.000 claims description 2
- 125000004957 naphthylene group Chemical group 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 8
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims 7
- 125000000081 (C5-C8) cycloalkenyl group Chemical group 0.000 claims 6
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 5
- 125000006705 (C5-C7) cycloalkyl group Chemical group 0.000 claims 3
- 125000006701 (C1-C7) alkyl group Chemical group 0.000 claims 2
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims 2
- 125000006564 (C4-C8) cycloalkyl group Chemical group 0.000 claims 2
- 125000006645 (C3-C4) cycloalkyl group Chemical group 0.000 claims 1
- 125000006555 (C3-C5) cycloalkyl group Chemical group 0.000 claims 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims 1
- CZXJMDXJCJSAIG-FIRGRZAASA-N 1-ethoxycarbonyloxyethyl 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate Chemical compound N1C(=O)[C@H](CC(=O)OC(C)OC(=O)OCC)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(N)=N)C=C1 CZXJMDXJCJSAIG-FIRGRZAASA-N 0.000 claims 1
- VZQGAGMKYVSELS-SVBPBHIXSA-N [2-[(3s,5s)-2-oxo-5-[[4-[4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]pyrrolidin-3-yl]acetyl]oxymethyl 2,2-dimethylpropanoate Chemical compound N1C(=O)[C@H](CC(=O)OCOC(=O)C(C)(C)C)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(=N)NC(=O)OCC=2C=CC=CC=2)C=C1 VZQGAGMKYVSELS-SVBPBHIXSA-N 0.000 claims 1
- WBKAPDGVCNSAGX-SFTDATJTSA-N [2-[(3s,5s)-5-[[4-[4-[(e)-n'-methoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetyl]oxymethyl 2,2-dimethylpropanoate Chemical compound C1=CC(C(=N)NC(=O)OC)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OCOC(=O)C(C)(C)C)C1 WBKAPDGVCNSAGX-SFTDATJTSA-N 0.000 claims 1
- 239000000969 carrier Substances 0.000 claims 1
- 230000002776 aggregation Effects 0.000 abstract description 7
- 238000004220 aggregation Methods 0.000 abstract description 7
- 230000002401 inhibitory effect Effects 0.000 abstract description 4
- 230000000144 pharmacologic effect Effects 0.000 abstract description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 99
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 66
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 60
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 52
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 50
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 42
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 39
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 36
- 239000000741 silica gel Substances 0.000 description 35
- 229910002027 silica gel Inorganic materials 0.000 description 35
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 description 32
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 25
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 22
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 22
- 239000000243 solution Substances 0.000 description 19
- 239000002904 solvent Substances 0.000 description 19
- 239000012071 phase Substances 0.000 description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 18
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 15
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 15
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 15
- 239000013543 active substance Substances 0.000 description 13
- 238000001819 mass spectrum Methods 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- 229960004132 diethyl ether Drugs 0.000 description 11
- WORSOGBHENUGHF-SJEIDVEUSA-N [2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetyl]oxymethyl benzoate;hydrochloride Chemical compound Cl.C1=CC(C(=N)N)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OCOC(=O)C=2C=CC=CC=2)C1 WORSOGBHENUGHF-SJEIDVEUSA-N 0.000 description 10
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Inorganic materials [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 10
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- 239000002775 capsule Substances 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- 239000001117 sulphuric acid Substances 0.000 description 7
- 235000011149 sulphuric acid Nutrition 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- MYKISANQQRERMX-USOMEZIUSA-N oxolan-2-ylmethyl 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.C1=CC(C(=N)N)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OCC2OCCC2)C1 MYKISANQQRERMX-USOMEZIUSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 229920002261 Corn starch Polymers 0.000 description 5
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000008120 corn starch Substances 0.000 description 5
- VOOMEYSRYHRXGL-SFTDATJTSA-N ethyl 2-[(3s,5s)-5-[[4-[4-[(e)-n'-(acetyloxymethoxycarbonyl)carbamimidoyl]phenyl]phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate Chemical compound N1C(=O)[C@H](CC(=O)OCC)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(=N)NC(=O)OCOC(C)=O)C=C1 VOOMEYSRYHRXGL-SFTDATJTSA-N 0.000 description 5
- 239000008101 lactose Substances 0.000 description 5
- 235000019359 magnesium stearate Nutrition 0.000 description 5
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 5
- 238000002390 rotary evaporation Methods 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- 125000006539 C12 alkyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 102000008186 Collagen Human genes 0.000 description 4
- 108010035532 Collagen Proteins 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 4
- XJYMSRWULLLVBV-KYJUHHDHSA-N [2-[(3s,5s)-1-(2-methoxyethyl)-2-oxo-5-[[4-[4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]pyrrolidin-3-yl]acetyl]oxymethyl 2,2-dimethylpropanoate Chemical compound C1[C@@H](CC(=O)OCOC(=O)C(C)(C)C)C(=O)N(CCOC)[C@@H]1COC1=CC=C(C=2C=CC(=CC=2)C(N)=NC(=O)OCC=2C=CC=CC=2)C=C1 XJYMSRWULLLVBV-KYJUHHDHSA-N 0.000 description 4
- HRTJNSUKKPDENV-PXLJZGITSA-N [2-[(3s,5s)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-oxo-5-[[4-[4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]pyrrolidin-3-yl]acetyl]oxymethyl 2,2-dimethylpropanoate Chemical compound C1=C(OC)C(OC)=CC=C1CCN1C(=O)[C@H](CC(=O)OCOC(=O)C(C)(C)C)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(\N)=N/C(=O)OCC=2C=CC=CC=2)C=C1 HRTJNSUKKPDENV-PXLJZGITSA-N 0.000 description 4
- 210000001772 blood platelet Anatomy 0.000 description 4
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 4
- 229920001436 collagen Polymers 0.000 description 4
- HNFQUKLCCIHXPS-VMPREFPWSA-N cyclohexyloxycarbonyloxymethyl 2-[(3s,5s)-2-oxo-5-[[4-[4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]pyrrolidin-3-yl]acetate Chemical compound C=1C=C(C=2C=CC(OC[C@H]3NC(=O)[C@H](CC(=O)OCOC(=O)OC4CCCCC4)C3)=CC=2)C=CC=1C(=N)NC(=O)OCC1=CC=CC=C1 HNFQUKLCCIHXPS-VMPREFPWSA-N 0.000 description 4
- ATOQMVCIXWZNNI-VNQANMTISA-N ethyl 2-[(3s,5s)-5-[[4-[4-[(e)-n'-(1-acetyloxyethoxycarbonyl)carbamimidoyl]phenyl]phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate Chemical compound N1C(=O)[C@H](CC(=O)OCC)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(=N)NC(=O)OC(C)OC(C)=O)C=C1 ATOQMVCIXWZNNI-VNQANMTISA-N 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- KELLXPNFTSRNME-QJHJCNPRSA-N methyl 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.N1C(=O)[C@H](CC(=O)OC)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(N)=N)C=C1 KELLXPNFTSRNME-QJHJCNPRSA-N 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- GEIFONXXIQDRNY-HCYUCMLDSA-N (4-ethoxycyclohexyl) 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.C1CC(OCC)CCC1OC(=O)C[C@H]1C(=O)N[C@H](COC=2C=CC(=CC=2)C=2C=CC(=CC=2)C(N)=N)C1 GEIFONXXIQDRNY-HCYUCMLDSA-N 0.000 description 3
- RGXCMUKOHRSBLZ-RCXFFJTRSA-N (4-methoxycyclohexyl) 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.C1CC(OC)CCC1OC(=O)C[C@H]1C(=O)N[C@H](COC=2C=CC(=CC=2)C=2C=CC(=CC=2)C(N)=N)C1 RGXCMUKOHRSBLZ-RCXFFJTRSA-N 0.000 description 3
- HUTYLHUDTMCHKX-GOTSBHOMSA-N 2,2-dimethylpropyl 2-[(3s,5s)-5-[[4-[4-[(e)-n'-(acetyloxymethoxycarbonyl)carbamimidoyl]phenyl]phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate Chemical compound C1=CC(C(=N)NC(=O)OCOC(=O)C)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OCC(C)(C)C)C1 HUTYLHUDTMCHKX-GOTSBHOMSA-N 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 3
- ZHASYBJXHPITIP-WMXJXTQLSA-N [2-[(3s,5s)-1-benzyl-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride Chemical compound Cl.C([C@@H]1C[C@H](C(N1CC=1C=CC=CC=1)=O)CC(=O)OCOC(=O)C(C)(C)C)OC(C=C1)=CC=C1C1=CC=C(C(N)=N)C=C1 ZHASYBJXHPITIP-WMXJXTQLSA-N 0.000 description 3
- FFPZABYHKRSAOV-SVBPBHIXSA-N [2-[(3s,5s)-2-oxo-5-[[4-[4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]pyrrolidin-3-yl]acetyl]oxymethyl 2-methylpropanoate Chemical compound N1C(=O)[C@H](CC(=O)OCOC(=O)C(C)C)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(=N)NC(=O)OCC=2C=CC=CC=2)C=C1 FFPZABYHKRSAOV-SVBPBHIXSA-N 0.000 description 3
- XFEMJFFFDFVZKM-KYJUHHDHSA-N [2-[(3s,5s)-2-oxo-5-[[4-[4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]pyrrolidin-3-yl]acetyl]oxymethyl cyclohexanecarboxylate Chemical compound C=1C=C(C=2C=CC(OC[C@H]3NC(=O)[C@H](CC(=O)OCOC(=O)C4CCCCC4)C3)=CC=2)C=CC=1C(=N)NC(=O)OCC1=CC=CC=C1 XFEMJFFFDFVZKM-KYJUHHDHSA-N 0.000 description 3
- SCUQFWCCQDCROD-UIOOFZCWSA-N [2-[(3s,5s)-5-[[2-fluoro-4-[4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetyl]oxymethyl 2,2-dimethylpropanoate Chemical compound N1C(=O)[C@H](CC(=O)OCOC(=O)C(C)(C)C)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(=N)NC(=O)OCC=2C=CC=CC=2)C=C1F SCUQFWCCQDCROD-UIOOFZCWSA-N 0.000 description 3
- HQBRDWBKIUBFIK-FKLPMGAJSA-N [2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetyl]oxymethyl butanoate;hydrochloride Chemical compound Cl.N1C(=O)[C@H](CC(=O)OCOC(=O)CCC)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(N)=N)C=C1 HQBRDWBKIUBFIK-FKLPMGAJSA-N 0.000 description 3
- GIROJISWPLPFRP-GOTSBHOMSA-N [2-[(3s,5s)-5-[[4-[4-[(e)-n'-(acetyloxymethoxycarbonyl)carbamimidoyl]phenyl]phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetyl]oxymethyl 2,2-dimethylpropanoate Chemical compound C1=CC(C(=N)NC(=O)OCOC(=O)C)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OCOC(=O)C(C)(C)C)C1 GIROJISWPLPFRP-GOTSBHOMSA-N 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- XABZALOSAGGRKR-NSOVKSMOSA-N cyclopentyloxycarbonyloxymethyl 2-[(3s,5s)-2-oxo-5-[[4-[4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]pyrrolidin-3-yl]acetate Chemical compound C=1C=C(C=2C=CC(OC[C@H]3NC(=O)[C@H](CC(=O)OCOC(=O)OC4CCCC4)C3)=CC=2)C=CC=1C(=N)NC(=O)OCC1=CC=CC=C1 XABZALOSAGGRKR-NSOVKSMOSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 230000003993 interaction Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 150000007530 organic bases Chemical group 0.000 description 3
- 210000004623 platelet-rich plasma Anatomy 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 235000009518 sodium iodide Nutrition 0.000 description 3
- 239000011975 tartaric acid Substances 0.000 description 3
- 235000002906 tartaric acid Nutrition 0.000 description 3
- NOOLISFMXDJSKH-KXUCPTDWSA-N (-)-Menthol Chemical compound CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O NOOLISFMXDJSKH-KXUCPTDWSA-N 0.000 description 2
- FCRHCMHPSINBNK-SJEIDVEUSA-N (3,3,5,5-tetramethylcyclohexyl) 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.C1C(C)(C)CC(C)(C)CC1OC(=O)C[C@H]1C(=O)N[C@H](COC=2C=CC(=CC=2)C=2C=CC(=CC=2)C(N)=N)C1 FCRHCMHPSINBNK-SJEIDVEUSA-N 0.000 description 2
- YOEIJSSUAVAKGL-ZDQNKZLLSA-N (3,3,5-trimethylcyclohexyl) 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.C1C(C)(C)CC(C)CC1OC(=O)C[C@H]1C(=O)N[C@H](COC=2C=CC(=CC=2)C=2C=CC(=CC=2)C(N)=N)C1 YOEIJSSUAVAKGL-ZDQNKZLLSA-N 0.000 description 2
- MMCLKJPHLMFCGR-DBIRURLTSA-N (3-methylcyclohexyl) 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.C1C(C)CCCC1OC(=O)C[C@H]1C(=O)N[C@H](COC=2C=CC(=CC=2)C=2C=CC(=CC=2)C(N)=N)C1 MMCLKJPHLMFCGR-DBIRURLTSA-N 0.000 description 2
- SRRKASRMXNQGOL-DBIRURLTSA-N (4-methylcyclohexyl) 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.C1CC(C)CCC1OC(=O)C[C@H]1C(=O)N[C@H](COC=2C=CC(=CC=2)C=2C=CC(=CC=2)C(N)=N)C1 SRRKASRMXNQGOL-DBIRURLTSA-N 0.000 description 2
- OSMHZCXAXUAECC-PTBGROTBSA-N (4-propan-2-ylcyclohexyl) 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.C1CC(C(C)C)CCC1OC(=O)C[C@H]1C(=O)N[C@H](COC=2C=CC(=CC=2)C=2C=CC(=CC=2)C(N)=N)C1 OSMHZCXAXUAECC-PTBGROTBSA-N 0.000 description 2
- KRKBGZYDKFADBM-LUJCOVQUSA-N 1-butoxycarbonyloxyethyl 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.N1C(=O)[C@H](CC(=O)OC(C)OC(=O)OCCCC)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(N)=N)C=C1 KRKBGZYDKFADBM-LUJCOVQUSA-N 0.000 description 2
- JSZLGDKMZTZZHR-WLHBAFDUSA-N 1-propan-2-yloxycarbonyloxyethyl 2-[(3s,5s)-2-oxo-5-[[4-[4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]pyrrolidin-3-yl]acetate Chemical compound N1C(=O)[C@H](CC(=O)OC(C)OC(=O)OC(C)C)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(=N)NC(=O)OCC=2C=CC=CC=2)C=C1 JSZLGDKMZTZZHR-WLHBAFDUSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- WRTAADRUJXTHCV-GOTSBHOMSA-N 2-[(3s,5s)-2-oxo-5-[[4-[4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]pyrrolidin-3-yl]acetic acid Chemical compound N1C(=O)[C@H](CC(=O)O)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(=N)NC(=O)OCC=2C=CC=CC=2)C=C1 WRTAADRUJXTHCV-GOTSBHOMSA-N 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 229930195725 Mannitol Natural products 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- FCLZCOCSZQNREK-UHFFFAOYSA-N Pyrrolidine, hydrochloride Chemical compound Cl.C1CCNC1 FCLZCOCSZQNREK-UHFFFAOYSA-N 0.000 description 2
- BRRXOCNPUGIAGS-FXWHCGMYSA-N [4-(dimethylamino)cyclohexyl] 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;dihydrochloride Chemical compound Cl.Cl.C1CC(N(C)C)CCC1OC(=O)C[C@H]1C(=O)N[C@H](COC=2C=CC(=CC=2)C=2C=CC(=CC=2)C(N)=N)C1 BRRXOCNPUGIAGS-FXWHCGMYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000003146 anticoagulant agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000003125 aqueous solvent Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- KRWDGRGOFGAOHH-LJAQVGFWSA-N benzyl (5s)-2-oxo-5-(trityloxymethyl)pyrrolidine-1-carboxylate Chemical compound C([C@H]1COC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC(=O)N1C(=O)OCC1=CC=CC=C1 KRWDGRGOFGAOHH-LJAQVGFWSA-N 0.000 description 2
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000007891 compressed tablet Substances 0.000 description 2
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 2
- ILXZMTJXXHNZJS-UHFFFAOYSA-N diethyl hydrogen phosphate;hydrochloride Chemical compound Cl.CCOP(O)(=O)OCC ILXZMTJXXHNZJS-UHFFFAOYSA-N 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- IKZACQMAVUIGPY-HOTGVXAUSA-N fradafiban Chemical compound C1=CC(C(=N)N)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(O)=O)C1 IKZACQMAVUIGPY-HOTGVXAUSA-N 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- PGCFXITVMNNKON-ROUUACIJSA-N lefradafiban Chemical compound N1C(=O)[C@H](CC(=O)OC)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(=N)NC(=O)OC)C=C1 PGCFXITVMNNKON-ROUUACIJSA-N 0.000 description 2
- 239000000594 mannitol Substances 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- KPSSIOMAKSHJJG-UHFFFAOYSA-N neopentyl alcohol Chemical compound CC(C)(C)CO KPSSIOMAKSHJJG-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 125000001476 phosphono group Chemical group [H]OP(*)(=O)O[H] 0.000 description 2
- 125000001557 phthalyl group Chemical group C(=O)(O)C1=C(C(=O)*)C=CC=C1 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 2
- 239000002464 receptor antagonist Substances 0.000 description 2
- 229940044551 receptor antagonist Drugs 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 2
- MOMXJQHBQORCOR-IXOXMDGESA-N (1-ethylpiperidin-4-yl) 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;dihydrochloride Chemical compound Cl.Cl.C1CN(CC)CCC1OC(=O)C[C@H]1C(=O)N[C@H](COC=2C=CC(=CC=2)C=2C=CC(=CC=2)C(N)=N)C1 MOMXJQHBQORCOR-IXOXMDGESA-N 0.000 description 1
- NUDCYHGODKCLHF-SCNAIHOXSA-N (1-methylpyrrolidin-2-yl)methyl 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;dihydrochloride Chemical compound Cl.Cl.CN1CCCC1COC(=O)C[C@H]1C(=O)N[C@H](COC=2C=CC(=CC=2)C=2C=CC(=CC=2)C(N)=N)C1 NUDCYHGODKCLHF-SCNAIHOXSA-N 0.000 description 1
- OQHRSVUKBOJKPW-DBIRURLTSA-N (2-methylcyclohexyl) 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.CC1CCCCC1OC(=O)C[C@H]1C(=O)N[C@H](COC=2C=CC(=CC=2)C=2C=CC(=CC=2)C(N)=N)C1 OQHRSVUKBOJKPW-DBIRURLTSA-N 0.000 description 1
- GHPYJLCQYMAXGG-WCCKRBBISA-N (2R)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid hydrochloride Chemical compound Cl.N[C@@H](CSCCB(O)O)C(O)=O GHPYJLCQYMAXGG-WCCKRBBISA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- AAWZDTNXLSGCEK-LNVDRNJUSA-N (3r,5r)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid Chemical compound O[C@@H]1CC(O)(C(O)=O)C[C@@H](O)C1O AAWZDTNXLSGCEK-LNVDRNJUSA-N 0.000 description 1
- BIAOWQZUKFLTDS-ZDQNKZLLSA-N (4-ethylcyclohexyl) 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.C1CC(CC)CCC1OC(=O)C[C@H]1C(=O)N[C@H](COC=2C=CC(=CC=2)C=2C=CC(=CC=2)C(N)=N)C1 BIAOWQZUKFLTDS-ZDQNKZLLSA-N 0.000 description 1
- FQSSRLVFPQIRJK-QFIPXVFZSA-N (5s)-5-(trityloxymethyl)pyrrolidin-2-one Chemical compound N1C(=O)CC[C@H]1COC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 FQSSRLVFPQIRJK-QFIPXVFZSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- ZXSQEZNORDWBGZ-UHFFFAOYSA-N 1,3-dihydropyrrolo[2,3-b]pyridin-2-one Chemical compound C1=CN=C2NC(=O)CC2=C1 ZXSQEZNORDWBGZ-UHFFFAOYSA-N 0.000 description 1
- OFZBQOFEZGWNCB-KFTXQHHCSA-N 1-acetyloxyethyl 2-[(3s,5s)-2-oxo-5-[[4-[4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]pyrrolidin-3-yl]acetate Chemical compound N1C(=O)[C@H](CC(=O)OC(OC(C)=O)C)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(=N)NC(=O)OCC=2C=CC=CC=2)C=C1 OFZBQOFEZGWNCB-KFTXQHHCSA-N 0.000 description 1
- POIGCIAHPQEHOG-GPXQCBPSSA-N 1-ethoxycarbonyloxyethyl 2-[(3s,5s)-1-methylsulfonyl-5-[[4-[4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]pyrrolidin-3-yl]acetate Chemical compound CS(=O)(=O)N1C[C@H](CC(=O)OC(C)OC(=O)OCC)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(=N)NC(=O)OCC=2C=CC=CC=2)C=C1 POIGCIAHPQEHOG-GPXQCBPSSA-N 0.000 description 1
- HMTGILLFRNUEOR-WLHBAFDUSA-N 1-propoxycarbonyloxyethyl 2-[(3s,5s)-2-oxo-5-[[4-[4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]pyrrolidin-3-yl]acetate Chemical compound N1C(=O)[C@H](CC(=O)OC(C)OC(=O)OCCC)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(=N)NC(=O)OCC=2C=CC=CC=2)C=C1 HMTGILLFRNUEOR-WLHBAFDUSA-N 0.000 description 1
- RWNIUAKAMSJVCY-UKOKCHKQSA-N 2,3-dihydro-1h-inden-2-yl 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.C1=CC(C(=N)N)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OC2CC3=CC=CC=C3C2)C1 RWNIUAKAMSJVCY-UKOKCHKQSA-N 0.000 description 1
- LNSCNEJNLACZPA-UHFFFAOYSA-N 2,3-dihydroxy-2,3-bis(2-methylphenyl)butanedioic acid Chemical compound CC1=CC=CC=C1C(O)(C(O)=O)C(O)(C(O)=O)C1=CC=CC=C1C LNSCNEJNLACZPA-UHFFFAOYSA-N 0.000 description 1
- MDWFOUJRCVNSOJ-IRXDYDNUSA-N 2-[(3s,5s)-5-[[4-[4-[(e)-n'-methoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetic acid Chemical compound C1=CC(C(=N)NC(=O)OC)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(O)=O)C1 MDWFOUJRCVNSOJ-IRXDYDNUSA-N 0.000 description 1
- KMGUEILFFWDGFV-UHFFFAOYSA-N 2-benzoyl-2-benzoyloxy-3-hydroxybutanedioic acid Chemical compound C=1C=CC=CC=1C(=O)C(C(C(O)=O)O)(C(O)=O)OC(=O)C1=CC=CC=C1 KMGUEILFFWDGFV-UHFFFAOYSA-N 0.000 description 1
- DWBDUQHXXQFWIB-UKOKCHKQSA-N 2-cyclohexylethyl 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.C1=CC(C(=N)N)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OCCC2CCCCC2)C1 DWBDUQHXXQFWIB-UKOKCHKQSA-N 0.000 description 1
- NNSCVEJHANAFDY-OALUTQOASA-N 2-methylpropanoyloxymethyl 4-[2-carbamimidoyl-4-[[(2S,4S)-4-(2-methoxy-2-oxoethyl)-5-oxopyrrolidin-2-yl]methoxy]phenyl]benzoate Chemical compound C(C(C)C)(=O)OCOC(=O)C1=CC=C(C=C1)C1=C(C=C(C=C1)OC[C@@H]1C[C@H](C(N1)=O)CC(=O)OC)C(N)=N NNSCVEJHANAFDY-OALUTQOASA-N 0.000 description 1
- XFYXMXSIZWFWBS-GOTSBHOMSA-N 2-methylpropyl 2-[(3s,5s)-5-[[4-[4-[(e)-n'-(acetyloxymethoxycarbonyl)carbamimidoyl]phenyl]phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate Chemical compound N1C(=O)[C@H](CC(=O)OCC(C)C)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(=N)NC(=O)OCOC(C)=O)C=C1 XFYXMXSIZWFWBS-GOTSBHOMSA-N 0.000 description 1
- 125000004135 2-norbornyl group Chemical group [H]C1([H])C([H])([H])C2([H])C([H])([H])C1([H])C([H])([H])C2([H])* 0.000 description 1
- ZRMIETZFPZGBEB-UHFFFAOYSA-N 4-(4-hydroxyphenyl)benzonitrile Chemical group C1=CC(O)=CC=C1C1=CC=C(C#N)C=C1 ZRMIETZFPZGBEB-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 108010039209 Blood Coagulation Factors Proteins 0.000 description 1
- 102000015081 Blood Coagulation Factors Human genes 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- AAWZDTNXLSGCEK-UHFFFAOYSA-N Cordycepinsaeure Natural products OC1CC(O)(C(O)=O)CC(O)C1O AAWZDTNXLSGCEK-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- NOOLISFMXDJSKH-UHFFFAOYSA-N DL-menthol Natural products CC(C)C1CCC(C)CC1O NOOLISFMXDJSKH-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 102000007625 Hirudins Human genes 0.000 description 1
- 108010007267 Hirudins Proteins 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241000282560 Macaca mulatta Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- SNIOPGDIGTZGOP-UHFFFAOYSA-N Nitroglycerin Chemical compound [O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O SNIOPGDIGTZGOP-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 101800004937 Protein C Proteins 0.000 description 1
- 102000017975 Protein C Human genes 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- AAWZDTNXLSGCEK-ZHQZDSKASA-N Quinic acid Natural products O[C@H]1CC(O)(C(O)=O)C[C@H](O)C1O AAWZDTNXLSGCEK-ZHQZDSKASA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 101800001700 Saposin-D Proteins 0.000 description 1
- 108010023197 Streptokinase Proteins 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 1
- 108090000190 Thrombin Proteins 0.000 description 1
- 102000003938 Thromboxane Receptors Human genes 0.000 description 1
- 108090000300 Thromboxane Receptors Proteins 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 description 1
- 102000003990 Urokinase-type plasminogen activator Human genes 0.000 description 1
- IEGRYJUIFWKKAT-ZEQRLZLVSA-N [(e)-[amino-[4-[4-[[(2s,4s)-4-(2-cyclohexyloxy-2-oxoethyl)-5-oxopyrrolidin-2-yl]methoxy]phenyl]phenyl]methylidene]carbamoyl]oxymethyl propanoate Chemical compound C1=CC(C(=N)NC(=O)OCOC(=O)CC)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OC2CCCCC2)C1 IEGRYJUIFWKKAT-ZEQRLZLVSA-N 0.000 description 1
- YWYGUFSGIXSJGO-UIOOFZCWSA-N [2-[(3s,5s)-2-oxo-5-[[7-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]-9h-fluoren-2-yl]oxymethyl]pyrrolidin-3-yl]acetyl]oxymethyl 2,2-dimethylpropanoate Chemical compound N1C(=O)[C@H](CC(=O)OCOC(=O)C(C)(C)C)C[C@H]1COC1=CC=C2C3=CC=C(C(=N)NC(=O)OCC=4C=CC=CC=4)C=C3CC2=C1 YWYGUFSGIXSJGO-UIOOFZCWSA-N 0.000 description 1
- CJMWDBDUGPLJHJ-HLRBRJAUSA-N [2-[(3s,5s)-5-[(7-carbamimidoyl-9h-fluoren-2-yl)oxymethyl]-2-oxopyrrolidin-3-yl]acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride Chemical compound Cl.N1C(=O)[C@H](CC(=O)OCOC(=O)C(C)(C)C)C[C@H]1COC1=CC=C2C3=CC=C(C(N)=N)C=C3CC2=C1 CJMWDBDUGPLJHJ-HLRBRJAUSA-N 0.000 description 1
- CSCGNPIFSJVMEG-SJEIDVEUSA-N [2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-1-(2-methoxyethyl)-2-oxopyrrolidin-3-yl]acetyl]oxymethyl 2,2-dimethylpropanoate;hydrochloride Chemical compound Cl.C1[C@@H](CC(=O)OCOC(=O)C(C)(C)C)C(=O)N(CCOC)[C@@H]1COC1=CC=C(C=2C=CC(=CC=2)C(N)=N)C=C1 CSCGNPIFSJVMEG-SJEIDVEUSA-N 0.000 description 1
- CDZKPGHKGLLCOM-PMACEKPBSA-N [2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetyl]oxymethyl 2,2-dimethylpropanoate Chemical compound N1C(=O)[C@H](CC(=O)OCOC(=O)C(C)(C)C)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(N)=N)C=C1 CDZKPGHKGLLCOM-PMACEKPBSA-N 0.000 description 1
- OLKQFUAFINGJNJ-FKLPMGAJSA-N [2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetyl]oxymethyl 2-methylpropanoate;hydrochloride Chemical compound Cl.N1C(=O)[C@H](CC(=O)OCOC(=O)C(C)C)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(N)=N)C=C1 OLKQFUAFINGJNJ-FKLPMGAJSA-N 0.000 description 1
- KDFQLIORVJNHBG-DDWVMOBJSA-N [4-(trifluoromethyl)cyclohexyl] 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.C1=CC(C(=N)N)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OC2CCC(CC2)C(F)(F)F)C1 KDFQLIORVJNHBG-DDWVMOBJSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 238000002399 angioplasty Methods 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 230000002744 anti-aggregatory effect Effects 0.000 description 1
- 230000002785 anti-thrombosis Effects 0.000 description 1
- 229940127219 anticoagulant drug Drugs 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- QENOWAJVCMUDHM-GOTSBHOMSA-N benzyl 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate Chemical compound C1=CC(C(=N)N)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OCC=2C=CC=CC=2)C1 QENOWAJVCMUDHM-GOTSBHOMSA-N 0.000 description 1
- 125000000638 benzylaminocarbonyl group Chemical group C(C1=CC=CC=C1)NC(=O)* 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000003114 blood coagulation factor Substances 0.000 description 1
- 238000010241 blood sampling Methods 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- IYYIVELXUANFED-UHFFFAOYSA-N bromo(trimethyl)silane Chemical compound C[Si](C)(C)Br IYYIVELXUANFED-UHFFFAOYSA-N 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229940105329 carboxymethylcellulose Drugs 0.000 description 1
- 229940082638 cardiac stimulant phosphodiesterase inhibitors Drugs 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- XMPZTFVPEKAKFH-UHFFFAOYSA-P ceric ammonium nitrate Chemical compound [NH4+].[NH4+].[Ce+4].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O XMPZTFVPEKAKFH-UHFFFAOYSA-P 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- ZSZJKAPCVDUHPF-GOTSBHOMSA-N cycloheptyl 2-[(3s,5s)-5-[[4-[4-[(e)-n'-methoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate Chemical compound C1=CC(C(=N)NC(=O)OC)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OC2CCCCCC2)C1 ZSZJKAPCVDUHPF-GOTSBHOMSA-N 0.000 description 1
- 125000006622 cycloheptylmethyl group Chemical group 0.000 description 1
- GFRBESAQIPKCQB-SFTDATJTSA-N cyclohexyl 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate Chemical compound C1=CC(C(=N)N)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OC2CCCCC2)C1 GFRBESAQIPKCQB-SFTDATJTSA-N 0.000 description 1
- DUXYISXPZVQVSO-VXKWHMMOSA-N cyclohexyl 2-[(3s,5s)-5-[[4-[4-[(e)-n'-methoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate Chemical compound C1=CC(C(=N)NC(=O)OC)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OC2CCCCC2)C1 DUXYISXPZVQVSO-VXKWHMMOSA-N 0.000 description 1
- RJKYRNJVQYARAR-GOTSBHOMSA-N cyclohexylmethyl 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate Chemical compound C1=CC(C(=N)N)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OCC2CCCCC2)C1 RJKYRNJVQYARAR-GOTSBHOMSA-N 0.000 description 1
- SGMZNCHLBMXOGX-VROPFNGYSA-N cyclohexyloxycarbonyloxymethyl 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.C1=CC(C(=N)N)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OCOC(=O)OC2CCCCC2)C1 SGMZNCHLBMXOGX-VROPFNGYSA-N 0.000 description 1
- LATKUZMEPHZBBF-PMACEKPBSA-N cyclopentyl 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate Chemical compound C1=CC(C(=N)N)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OC2CCCC2)C1 LATKUZMEPHZBBF-PMACEKPBSA-N 0.000 description 1
- DWWKLYOQIRWZJG-SFTDATJTSA-N cyclopentyl 2-[(3s,5s)-5-[[4-[4-[(e)-n'-methoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate Chemical compound C1=CC(C(=N)NC(=O)OC)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OC2CCCC2)C1 DWWKLYOQIRWZJG-SFTDATJTSA-N 0.000 description 1
- ARIABDCMHIWBTA-VROPFNGYSA-N cyclopentylmethyl 2-[(3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate hydrochloride Chemical compound Cl.C(N)(=N)C1=CC=C(C=C1)C1=CC=C(C=C1)OC[C@@H]1C[C@H](C(N1)=O)CC(=O)OCC1CCCC1 ARIABDCMHIWBTA-VROPFNGYSA-N 0.000 description 1
- ORZSDEMWOBIIKR-ACLTUTAQSA-N cyclopentyloxycarbonyloxymethyl 2-[(3S,5S)-5-[(1-carbamimidoyl-4-phenylcyclohexa-2,4-dien-1-yl)oxymethyl]-2-oxopyrrolidin-3-yl]acetate hydrochloride Chemical compound Cl.C(N)(=N)C1(CC=C(C=C1)C1=CC=CC=C1)OC[C@@H]1C[C@H](C(N1)=O)CC(=O)OCOC(=O)OC1CCCC1 ORZSDEMWOBIIKR-ACLTUTAQSA-N 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000004821 effect on bone Effects 0.000 description 1
- KAQKFAOMNZTLHT-VVUHWYTRSA-N epoprostenol Chemical compound O1C(=CCCCC(O)=O)C[C@@H]2[C@@H](/C=C/[C@@H](O)CCCCC)[C@H](O)C[C@@H]21 KAQKFAOMNZTLHT-VVUHWYTRSA-N 0.000 description 1
- 229960001123 epoprostenol Drugs 0.000 description 1
- 210000003743 erythrocyte Anatomy 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 230000003480 fibrinolytic effect Effects 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229940116364 hard fat Drugs 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- WQPDUTSPKFMPDP-OUMQNGNKSA-N hirudin Chemical compound C([C@@H](C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C=CC(OS(O)(=O)=O)=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(O)=O)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]1NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@@H]2CSSC[C@@H](C(=O)N[C@@H](CCC(O)=O)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(=O)N[C@H](C(NCC(=O)N[C@@H](CCC(N)=O)C(=O)NCC(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)N2)=O)CSSC1)C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]1NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=2C=CC(O)=CC=2)NC(=O)[C@@H](NC(=O)[C@@H](N)C(C)C)C(C)C)[C@@H](C)O)CSSC1)C(C)C)[C@@H](C)O)[C@@H](C)O)C1=CC=CC=C1 WQPDUTSPKFMPDP-OUMQNGNKSA-N 0.000 description 1
- 229940006607 hirudin Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 230000002718 inhibitory effect on inflammation Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 150000002542 isoureas Chemical class 0.000 description 1
- 229960004873 levomenthol Drugs 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- QTUXHMIFCAHHMB-ZEQRLZLVSA-N methyl 2-[(3s,5s)-2-oxo-5-[[4-[4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]phenyl]phenoxy]methyl]pyrrolidin-3-yl]acetate Chemical compound N1C(=O)[C@H](CC(=O)OC)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(=N)NC(=O)OCC=2C=CC=CC=2)C=C1 QTUXHMIFCAHHMB-ZEQRLZLVSA-N 0.000 description 1
- RAEYWGZVXMLBLK-QJHJCNPRSA-N methyl 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;phenylmethanesulfonic acid Chemical compound OS(=O)(=O)CC1=CC=CC=C1.N1C(=O)[C@H](CC(=O)OC)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(N)=N)C=C1 RAEYWGZVXMLBLK-QJHJCNPRSA-N 0.000 description 1
- YXRXRKLWFVYJDY-SFTDATJTSA-N methyl 2-[(3s,5s)-5-[[4-[4-[(z)-n'-diethoxyphosphorylcarbamimidoyl]phenyl]phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate Chemical compound C1=CC(C(=N)NP(=O)(OCC)OCC)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(=O)OC)C1 YXRXRKLWFVYJDY-SFTDATJTSA-N 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- 125000005933 neopentyloxycarbonyl group Chemical group 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000002571 phosphodiesterase inhibitor Substances 0.000 description 1
- 210000002381 plasma Anatomy 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- VEZUCAHKJONDJK-HLRBRJAUSA-N propan-2-yl 2-[(3s,5s)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride Chemical compound Cl.N1C(=O)[C@H](CC(=O)OC(C)C)C[C@H]1COC1=CC=C(C=2C=CC(=CC=2)C(N)=N)C=C1 VEZUCAHKJONDJK-HLRBRJAUSA-N 0.000 description 1
- 229960004063 propylene glycol Drugs 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 229960000856 protein c Drugs 0.000 description 1
- 108010073863 saruplase Proteins 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- LKZMBDSASOBTPN-UHFFFAOYSA-L silver carbonate Substances [Ag].[O-]C([O-])=O LKZMBDSASOBTPN-UHFFFAOYSA-L 0.000 description 1
- 229910001958 silver carbonate Inorganic materials 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229940012831 stearyl alcohol Drugs 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 229960005202 streptokinase Drugs 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000010414 supernatant solution Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 229960004072 thrombin Drugs 0.000 description 1
- 230000002537 thrombolytic effect Effects 0.000 description 1
- RZWIIPASKMUIAC-VQTJNVASSA-N thromboxane Chemical compound CCCCCCCC[C@H]1OCCC[C@@H]1CCCCCCC RZWIIPASKMUIAC-VQTJNVASSA-N 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 238000002834 transmittance Methods 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229960005356 urokinase Drugs 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 229940019333 vitamin k antagonists Drugs 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/553—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having one nitrogen atom as the only ring hetero atom
- C07F9/572—Five-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biochemistry (AREA)
- Molecular Biology (AREA)
- Engineering & Computer Science (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pyrrole Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP4213919.8 | 1992-04-28 | ||
| DE4213919A DE4213919A1 (de) | 1992-04-28 | 1992-04-28 | Cyclische iminoderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2095009A1 true CA2095009A1 (en) | 1993-10-29 |
Family
ID=6457638
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002095009A Abandoned CA2095009A1 (en) | 1992-04-28 | 1993-04-27 | Cyclic imino derivatives |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US5576444A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0567966B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JP3315463B2 (cg-RX-API-DMAC7.html) |
| KR (1) | KR940005569A (cg-RX-API-DMAC7.html) |
| AT (1) | ATE170509T1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU662223B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA2095009A1 (cg-RX-API-DMAC7.html) |
| DE (2) | DE4213919A1 (cg-RX-API-DMAC7.html) |
| DK (1) | DK0567966T3 (cg-RX-API-DMAC7.html) |
| ES (1) | ES2121888T3 (cg-RX-API-DMAC7.html) |
| FI (1) | FI931880L (cg-RX-API-DMAC7.html) |
| HU (1) | HUT70039A (cg-RX-API-DMAC7.html) |
| IL (1) | IL105517A0 (cg-RX-API-DMAC7.html) |
| MX (1) | MX9302448A (cg-RX-API-DMAC7.html) |
| NO (1) | NO180045C (cg-RX-API-DMAC7.html) |
| NZ (1) | NZ247512A (cg-RX-API-DMAC7.html) |
| PL (1) | PL298717A1 (cg-RX-API-DMAC7.html) |
| TW (1) | TW232006B (cg-RX-API-DMAC7.html) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1993018058A1 (en) * | 1992-03-06 | 1993-09-16 | G.D. Searle & Co. | Peptides mimics useful as platelet aggregation inhibitors |
| DE4241632A1 (de) * | 1992-12-10 | 1994-06-16 | Thomae Gmbh Dr K | Carbonsäurederivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung |
| ATE195117T1 (de) * | 1993-03-31 | 2000-08-15 | Searle & Co | 1-amdinophenyl-pyrrolidone/piperidinone als blutblättchen-aggregations inhibitoren |
| ES2147210T3 (es) * | 1993-12-03 | 2000-09-01 | Hoffmann La Roche | Derivados de acido acetico como medicamentos. |
| BR9510360A (pt) * | 1994-12-23 | 1997-12-23 | Thomae Gmbh Dr K | Derivados de piperazina medicamentos contendo esses compostos sua aplicação e processo para sua preparação |
| ES2208737T3 (es) * | 1995-03-10 | 2004-06-16 | Berlex Laboratories, Inc. | Derivados de benzamidina, su preparacion y su utilizacion como anticoagulantes. |
| US5691364A (en) * | 1995-03-10 | 1997-11-25 | Berlex Laboratories, Inc. | Benzamidine derivatives and their use as anti-coagulants |
| US5612363A (en) * | 1995-06-02 | 1997-03-18 | Berlex Laboratories, Inc. | N,N-di(aryl) cyclic urea derivatives as anti-coagulants |
| US5849759A (en) * | 1995-12-08 | 1998-12-15 | Berlex Laboratories, Inc. | Naphthyl-substituted benzimidazole derivatives as anti-coagulants |
| US5994375A (en) | 1996-02-12 | 1999-11-30 | Berlex Laboratories, Inc. | Benzamidine derivatives substituted by amino acid and hydroxy acid derivatives and their use as anti-coagulants |
| AU1990197A (en) * | 1996-03-12 | 1997-10-01 | Bristol-Myers Squibb Company | Carbamyl guanidine and amidine prodrugs |
| US5693641A (en) * | 1996-08-16 | 1997-12-02 | Berlex Laboratories Inc. | Bicyclic pyrimidine derivatives and their use as anti-coagulants |
| US5753635A (en) * | 1996-08-16 | 1998-05-19 | Berlex Laboratories, Inc. | Purine derivatives and their use as anti-coagulants |
| CN1234798A (zh) | 1996-09-12 | 1999-11-10 | 舍林股份公司 | 环状氨基酸和环状羟基羧酸衍生物取代的苄脒衍生物和它们用作抗凝剂的用途 |
| US6008234A (en) * | 1996-09-12 | 1999-12-28 | Berlex Laboratories, Inc. | Benzamidine derivatives substituted by cyclic amino acid and cyclic hydroxy acid derivatives and their use as anti-coagulants |
| US6004985A (en) * | 1996-10-09 | 1999-12-21 | Berlex Laboratories, Inc. | Thio acid derived monocylic N-heterocyclics as anticoagulants |
| US7109326B2 (en) * | 1997-04-15 | 2006-09-19 | Genentech, Inc. | Halo-alkoxycarbonyl prodrugs |
| US6686364B2 (en) | 1997-12-08 | 2004-02-03 | Berlex Laboratories, Inc. | Benzamidine derivatives and their use as anti-coagulants |
| WO1999032477A1 (en) | 1997-12-19 | 1999-07-01 | Schering Aktiengesellschaft | Ortho-anthranilamide derivatives as anti-coagulants |
| US6140351A (en) * | 1997-12-19 | 2000-10-31 | Berlex Laboratories, Inc. | Ortho-anthranilamide derivatives as anti-coagulants |
| US6114532A (en) * | 1998-02-03 | 2000-09-05 | Boehringer Ingelheim Pharma Kg | Bicyclic heterocycles, the preparation thereof, and their use as pharmaceuticals |
| EP1060166A1 (de) * | 1998-02-03 | 2000-12-20 | Boehringer Ingelheim Pharma KG | 5-gliedrige benzokondensierte heterocyclen als antithrombotika |
| DE19844787A1 (de) * | 1998-09-30 | 2000-04-13 | Boehringer Ingelheim Pharma | Disubstituierte Pyrrolidinone, diese Verbindung enthaltende Arzneimittel und deren Verwendung sowie ihre Herstellung |
| US6262088B1 (en) | 1998-11-19 | 2001-07-17 | Berlex Laboratories, Inc. | Polyhydroxylated monocyclic N-heterocyclic derivatives as anti-coagulants |
| US6127376A (en) * | 1998-12-04 | 2000-10-03 | Berlex Laboratories, Inc. | Aryl and heterocyclyl substituted pyrimidine derivatives as anti-coagulants |
| US6350761B1 (en) | 1999-07-30 | 2002-02-26 | Berlex Laboratories, Inc. | Benzenamine derivatives as anti-coagulants |
| US7186855B2 (en) | 2001-06-11 | 2007-03-06 | Xenoport, Inc. | Prodrugs of GABA analogs, compositions and uses thereof |
| US8048917B2 (en) | 2005-04-06 | 2011-11-01 | Xenoport, Inc. | Prodrugs of GABA analogs, compositions and uses thereof |
| US7232924B2 (en) | 2001-06-11 | 2007-06-19 | Xenoport, Inc. | Methods for synthesis of acyloxyalkyl derivatives of GABA analogs |
| US6818787B2 (en) | 2001-06-11 | 2004-11-16 | Xenoport, Inc. | Prodrugs of GABA analogs, compositions and uses thereof |
| JP5440976B2 (ja) * | 2009-01-14 | 2014-03-12 | ホクト株式会社 | 血小板凝集抑制剤 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2123288A (en) * | 1982-07-16 | 1984-02-01 | Wellcome Found | Anti-thrombotic agent |
| EP0194548A3 (de) * | 1985-03-12 | 1988-08-17 | Dr. Karl Thomae GmbH | Neue Sulfonylaminoäthylverbindungen, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung |
| DK117986A (da) * | 1985-03-16 | 1986-09-17 | Wellcome Found | Arylderivater, fremgangsmaader til deres fremstilling og deres anvendelse |
| DE3823299A1 (de) * | 1988-07-07 | 1990-01-11 | Schering Ag | Substituierte phenyl-pyrrolidin-2-one, -oxazolidin-2-one und -imidazolidin-2-one, ihre herstellung sowie verwendung in arzneimitteln |
| JPH02247166A (ja) * | 1989-03-17 | 1990-10-02 | Taisho Pharmaceut Co Ltd | 3―ピロリン―2―オン誘導体 |
| DE3932403A1 (de) * | 1989-05-12 | 1991-04-11 | Thomae Gmbh Dr K | Neue arylsulfonamide, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
| US5026861A (en) * | 1989-07-17 | 1991-06-25 | Merrell Dow Pharmaceuticals | Substituted 1,5-dihydro-4-(N-methylhydroxylamino)-2H-pyrrol-2-ones |
| DE4035961A1 (de) * | 1990-11-02 | 1992-05-07 | Thomae Gmbh Dr K | Cyclische iminoderivate, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
| DE4107857A1 (de) * | 1991-03-12 | 1992-09-17 | Thomae Gmbh Dr K | Cyclische harnstoffderivate, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
| DE4124942A1 (de) * | 1991-07-27 | 1993-01-28 | Thomae Gmbh Dr K | 5-gliedrige heterocyclen, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| DE4127404A1 (de) * | 1991-08-19 | 1993-02-25 | Thomae Gmbh Dr K | Cyclische iminoderivate, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
-
1992
- 1992-04-28 DE DE4213919A patent/DE4213919A1/de not_active Withdrawn
-
1993
- 1993-03-09 TW TW082101712A patent/TW232006B/zh active
- 1993-04-26 EP EP93106724A patent/EP0567966B1/de not_active Expired - Lifetime
- 1993-04-26 ES ES93106724T patent/ES2121888T3/es not_active Expired - Lifetime
- 1993-04-26 US US08/053,037 patent/US5576444A/en not_active Expired - Lifetime
- 1993-04-26 DE DE59308940T patent/DE59308940D1/de not_active Expired - Fee Related
- 1993-04-26 AT AT93106724T patent/ATE170509T1/de not_active IP Right Cessation
- 1993-04-26 DK DK93106724T patent/DK0567966T3/da active
- 1993-04-27 NO NO931526A patent/NO180045C/no unknown
- 1993-04-27 CA CA002095009A patent/CA2095009A1/en not_active Abandoned
- 1993-04-27 FI FI931880A patent/FI931880L/fi not_active Application Discontinuation
- 1993-04-27 JP JP09993093A patent/JP3315463B2/ja not_active Expired - Fee Related
- 1993-04-27 NZ NZ247512A patent/NZ247512A/en unknown
- 1993-04-27 HU HU9301222A patent/HUT70039A/hu unknown
- 1993-04-27 PL PL29871793A patent/PL298717A1/xx unknown
- 1993-04-27 IL IL105517A patent/IL105517A0/xx unknown
- 1993-04-27 MX MX9302448A patent/MX9302448A/es unknown
- 1993-04-27 KR KR1019930007059A patent/KR940005569A/ko not_active Withdrawn
- 1993-04-28 AU AU38222/93A patent/AU662223B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| NO931526L (no) | 1993-10-29 |
| AU3822293A (en) | 1993-11-04 |
| NZ247512A (en) | 1995-12-21 |
| MX9302448A (es) | 1993-10-01 |
| AU662223B2 (en) | 1995-08-24 |
| DE4213919A1 (de) | 1993-11-04 |
| DK0567966T3 (da) | 1999-05-31 |
| FI931880A0 (fi) | 1993-04-27 |
| ATE170509T1 (de) | 1998-09-15 |
| EP0567966A1 (de) | 1993-11-03 |
| ES2121888T3 (es) | 1998-12-16 |
| IL105517A0 (en) | 1993-08-18 |
| FI931880A7 (fi) | 1993-10-29 |
| JP3315463B2 (ja) | 2002-08-19 |
| EP0567966B1 (de) | 1998-09-02 |
| NO180045B (no) | 1996-10-28 |
| PL298717A1 (en) | 1994-01-24 |
| TW232006B (cg-RX-API-DMAC7.html) | 1994-10-11 |
| US5576444A (en) | 1996-11-19 |
| DE59308940D1 (de) | 1998-10-08 |
| HU9301222D0 (en) | 1993-07-28 |
| NO931526D0 (no) | 1993-04-27 |
| HUT70039A (en) | 1995-09-28 |
| KR940005569A (ko) | 1994-03-21 |
| FI931880L (fi) | 1993-10-29 |
| NO180045C (no) | 1997-02-05 |
| JPH0673001A (ja) | 1994-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2095009A1 (en) | Cyclic imino derivatives | |
| US5591769A (en) | Cyclic imino derivatives and pharmaceutical compositions containing them | |
| AU654340B2 (en) | Urea derivatives | |
| EP1489088B1 (en) | Novel alpha-amino-n-(diaminophosphinyl)lactam derivative | |
| EP0389898A2 (de) | Peptidartige Aminosäurederivate mit reninhemmender Wirkung | |
| EP0412350A2 (de) | Renininhibitoren, Verfahren zur Herstellung und ihre Verwendung in Arzneimitteln | |
| HU185147B (en) | Process for the preparation of aza-bicyclo-alkan-dicarboxylic acid derivatives | |
| CH651548A5 (fr) | Derives mercapto-acyles de diverses prolines 4-substituees a action anti-hypertensive. | |
| HU185986B (en) | Process for preparing substituted n-/carboxy-alkyl/-amino-acyl-proline dipeptide derivatives | |
| AU659933B2 (en) | Cyclic imino derivatives | |
| DE3628650A1 (de) | Renininhibitoren, verfahren zur herstellung und ihre verwendung | |
| US4565819A (en) | Substituted imino diacids, their preparation and pharmaceutical compositions which contain them | |
| EP0403828A1 (de) | Renininhibitorische Peptide, Verfahren zur ihrer Herstellung und ihre Verwendung in Arzneimitteln | |
| DE19548797A1 (de) | Substituierte 2-Amino-imidazole, ihre Herstellung und ihre Verwendung als Arzneimittel | |
| DE3113610A1 (de) | S-acylierungsprodukte aus einer mercaptoacylaminosaeure und einem eine carboxylgruppe enthaltendem diuretikum | |
| EP0113880A2 (de) | Neue 2-Azabicyclo(2.2.1)heptan-Derivate, Verfahren zu ihrer Herstellung, diese enthaltende Mittel und deren Verwendung sowie 2-Azabicyclo(2.2.1)heptan-Derivate als Zwischenprodukte und Verfahren zu deren Herstellung | |
| NZ306451A (en) | Substituted phenyl amidines, medicaments containing these compounds and process for producing them | |
| EP0356796A2 (de) | Aminomethyl-peptide, Verfahren zur Herstellung und ihre Verwendung in Arzneimitteln | |
| DE19829964A1 (de) | Benzimidazole, deren Herstellung und deren Verwendung als Arzneimittel | |
| DE4424828A1 (de) | Neue substituierte Arylsulfonamide, ihre Herstellung und ihre Verwendung als Arzneimittel | |
| JPH0285245A (ja) | 新規化合物 | |
| CH651825A5 (de) | Prolinderivate sowie verfahren fuer ihre herstellung. | |
| EP0391180A2 (de) | Peptidartige Aminosäurederivate mit reninhemmender Wirkung | |
| JPS6011467A (ja) | 化合物および前記化合物を含有する医薬組成物 | |
| JPS61221165A (ja) | アシルアミノアルカノイルウレタン類またはチオウレタン類 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Discontinued |