CA1191140A - 2-quinolone derivatives - Google Patents
2-quinolone derivativesInfo
- Publication number
- CA1191140A CA1191140A CA000430732A CA430732A CA1191140A CA 1191140 A CA1191140 A CA 1191140A CA 000430732 A CA000430732 A CA 000430732A CA 430732 A CA430732 A CA 430732A CA 1191140 A CA1191140 A CA 1191140A
- Authority
- CA
- Canada
- Prior art keywords
- quinolone
- hydroxy
- benzoyl
- compound
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical class C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 title claims abstract description 8
- 150000001875 compounds Chemical class 0.000 claims abstract description 45
- 238000000034 method Methods 0.000 claims abstract description 28
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 16
- 238000002360 preparation method Methods 0.000 claims abstract description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 12
- 239000001257 hydrogen Substances 0.000 claims abstract description 12
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 4
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 30
- 239000000126 substance Substances 0.000 claims description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 12
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 8
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- 239000002585 base Substances 0.000 claims description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 6
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 6
- 239000012312 sodium hydride Substances 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 230000000694 effects Effects 0.000 claims description 4
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 claims description 3
- RQBVTOCQMWLYSH-UHFFFAOYSA-N 3-benzoyl-4-hydroxy-7-nitro-1H-quinolin-2-one Chemical compound OC=1NC2=CC([N+]([O-])=O)=CC=C2C(=O)C=1C(=O)C1=CC=CC=C1 RQBVTOCQMWLYSH-UHFFFAOYSA-N 0.000 claims description 3
- RVGAPZYPPPGAPP-UHFFFAOYSA-N 4-hydroxy-3-(2,3,4-trimethoxybenzoyl)-1H-quinolin-2-one Chemical compound COC1=C(OC)C(OC)=CC=C1C(=O)C1=C(O)NC2=CC=CC=C2C1=O RVGAPZYPPPGAPP-UHFFFAOYSA-N 0.000 claims description 3
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 claims description 3
- AEEZZQATQVVLLY-UHFFFAOYSA-N 3-benzoyl-6-hexyl-4-hydroxy-1H-quinolin-2-one Chemical compound O=C1C2=CC(CCCCCC)=CC=C2NC(O)=C1C(=O)C1=CC=CC=C1 AEEZZQATQVVLLY-UHFFFAOYSA-N 0.000 claims description 2
- HXUIDZOMTRMIOE-UHFFFAOYSA-N 3-oxo-3-phenylpropionic acid Chemical compound OC(=O)CC(=O)C1=CC=CC=C1 HXUIDZOMTRMIOE-UHFFFAOYSA-N 0.000 claims description 2
- 238000005618 Fries rearrangement reaction Methods 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 238000007363 ring formation reaction Methods 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 4
- CYZLGTAWCVICMN-UHFFFAOYSA-N methyl 3-benzoyl-4-hydroxy-2-oxo-1H-quinoline-8-carboxylate Chemical compound COC(=O)C1=CC=CC(C2=O)=C1NC(O)=C2C(=O)C1=CC=CC=C1 CYZLGTAWCVICMN-UHFFFAOYSA-N 0.000 claims 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 claims 3
- YFGPNCNXQWODDZ-UHFFFAOYSA-N 3-(2-chlorobenzoyl)-4-hydroxy-1h-quinolin-2-one Chemical compound OC=1NC2=CC=CC=C2C(=O)C=1C(=O)C1=CC=CC=C1Cl YFGPNCNXQWODDZ-UHFFFAOYSA-N 0.000 claims 2
- KMPAJGCBVAJBSR-UHFFFAOYSA-N 3-benzoyl-4-hydroxy-2-oxo-1H-quinoline-8-carboxylic acid Chemical compound OC(=O)C1=CC=CC(C2=O)=C1NC(O)=C2C(=O)C1=CC=CC=C1 KMPAJGCBVAJBSR-UHFFFAOYSA-N 0.000 claims 2
- RJLAQNKPADLNMS-UHFFFAOYSA-N 4-hydroxy-3-(4-nitrobenzoyl)-1H-quinolin-2-one Chemical compound OC=1NC2=CC=CC=C2C(=O)C=1C(=O)C1=CC=C([N+]([O-])=O)C=C1 RJLAQNKPADLNMS-UHFFFAOYSA-N 0.000 claims 2
- TWLLPUMZVVGILS-UHFFFAOYSA-N Ethyl 2-aminobenzoate Chemical compound CCOC(=O)C1=CC=CC=C1N TWLLPUMZVVGILS-UHFFFAOYSA-N 0.000 claims 2
- 230000003301 hydrolyzing effect Effects 0.000 claims 2
- ONIKNECPXCLUHT-UHFFFAOYSA-N 2-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Cl ONIKNECPXCLUHT-UHFFFAOYSA-N 0.000 claims 1
- OVEMTTZEBOCJDV-UHFFFAOYSA-N 4-hexylaniline Chemical compound CCCCCCC1=CC=C(N)C=C1 OVEMTTZEBOCJDV-UHFFFAOYSA-N 0.000 claims 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 claims 1
- GKKZMYDNDDMXSE-UHFFFAOYSA-N Ethyl 3-oxo-3-phenylpropanoate Chemical compound CCOC(=O)CC(=O)C1=CC=CC=C1 GKKZMYDNDDMXSE-UHFFFAOYSA-N 0.000 claims 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 claims 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 150000001768 cations Chemical class 0.000 claims 1
- 238000009833 condensation Methods 0.000 claims 1
- 230000005494 condensation Effects 0.000 claims 1
- QVBQPOJYBWWILD-UHFFFAOYSA-N dimethyl 2-aminobenzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC=CC(C(=O)OC)=C1N QVBQPOJYBWWILD-UHFFFAOYSA-N 0.000 claims 1
- WTHFROVMUKFWCO-UHFFFAOYSA-N ethyl 2-amino-4-nitrobenzoate Chemical compound CCOC(=O)C1=CC=C([N+]([O-])=O)C=C1N WTHFROVMUKFWCO-UHFFFAOYSA-N 0.000 claims 1
- NGRXSVFCLHVGKU-UHFFFAOYSA-N ethyl 3-(4-nitrophenyl)-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)C1=CC=C([N+]([O-])=O)C=C1 NGRXSVFCLHVGKU-UHFFFAOYSA-N 0.000 claims 1
- IEORXFCOYQQQQA-UHFFFAOYSA-N ethyl 3-oxo-3-(2,3,4-trimethoxyphenyl)propanoate Chemical compound CCOC(=O)CC(=O)C1=CC=C(OC)C(OC)=C1OC IEORXFCOYQQQQA-UHFFFAOYSA-N 0.000 claims 1
- PMZDQRJGMBOQBF-UHFFFAOYSA-N quinolin-4-ol Chemical compound C1=CC=C2C(O)=CC=NC2=C1 PMZDQRJGMBOQBF-UHFFFAOYSA-N 0.000 claims 1
- 238000006798 ring closing metathesis reaction Methods 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 208000006673 asthma Diseases 0.000 abstract description 6
- 201000009961 allergic asthma Diseases 0.000 abstract description 3
- 208000026935 allergic disease Diseases 0.000 abstract description 3
- 239000003172 expectorant agent Substances 0.000 abstract description 3
- 230000003419 expectorant effect Effects 0.000 abstract description 3
- 230000000954 anitussive effect Effects 0.000 abstract description 2
- 239000003434 antitussive agent Substances 0.000 abstract description 2
- 229940124584 antitussives Drugs 0.000 abstract description 2
- 229940066493 expectorants Drugs 0.000 abstract description 2
- 125000001188 haloalkyl group Chemical group 0.000 abstract 1
- -1 methoxy, ethoxy Chemical group 0.000 description 19
- 239000013078 crystal Substances 0.000 description 15
- 239000000203 mixture Substances 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 11
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 241000700159 Rattus Species 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 7
- 238000004458 analytical method Methods 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- 239000002775 capsule Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 230000005764 inhibitory process Effects 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 235000010418 carrageenan Nutrition 0.000 description 4
- 229920001525 carrageenan Polymers 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 4
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 244000215068 Acacia senegal Species 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 241000416162 Astragalus gummifer Species 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 229920000084 Gum arabic Polymers 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 239000002202 Polyethylene glycol Substances 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 3
- 229930006000 Sucrose Natural products 0.000 description 3
- 229920001615 Tragacanth Polymers 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 235000010489 acacia gum Nutrition 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 230000003266 anti-allergic effect Effects 0.000 description 3
- 230000003110 anti-inflammatory effect Effects 0.000 description 3
- 150000007514 bases Chemical class 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 231100000518 lethal Toxicity 0.000 description 3
- 230000001665 lethal effect Effects 0.000 description 3
- RWZYAGGXGHYGMB-UHFFFAOYSA-N o-aminobenzenecarboxylic acid Natural products NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- 235000010356 sorbitol Nutrition 0.000 description 3
- 239000005720 sucrose Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- JEGSIXHMXJOPKV-UHFFFAOYSA-N 3-benzoyl-4-hydroxy-6-propan-2-yl-1H-quinolin-2-one Chemical compound OC=1C2=CC(C(C)C)=CC=C2NC(=O)C=1C(=O)C1=CC=CC=C1 JEGSIXHMXJOPKV-UHFFFAOYSA-N 0.000 description 2
- HDHQZCHIXUUSMK-UHFFFAOYSA-N 4-hydroxy-2-quinolone Chemical compound C1=CC=C2C(O)=CC(=O)NC2=C1 HDHQZCHIXUUSMK-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 241000700198 Cavia Species 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 230000003042 antagnostic effect Effects 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 210000002683 foot Anatomy 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229940014259 gelatin Drugs 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 208000008384 ileus Diseases 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000004526 pharmaceutical effect Effects 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 239000002504 physiological saline solution Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229920001592 potato starch Polymers 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- UJTRRNALUYKHQE-UHFFFAOYSA-N sodium;diphenylmethylbenzene Chemical compound [Na+].C1=CC=CC=C1[C-](C=1C=CC=CC=1)C1=CC=CC=C1 UJTRRNALUYKHQE-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- CZHHVPCYLWANKA-UHFFFAOYSA-N 3-(2,4-dimethylbenzoyl)-4-hydroxy-1h-quinolin-2-one Chemical compound CC1=CC(C)=CC=C1C(=O)C1=C(O)NC2=CC=CC=C2C1=O CZHHVPCYLWANKA-UHFFFAOYSA-N 0.000 description 1
- GWVUXXYHRHQYOC-UHFFFAOYSA-N 3-(2,5-dichloro-4-methylbenzoyl)-4-hydroxy-1H-quinolin-2-one Chemical compound C1=C(Cl)C(C)=CC(Cl)=C1C(=O)C1=C(O)C2=CC=CC=C2NC1=O GWVUXXYHRHQYOC-UHFFFAOYSA-N 0.000 description 1
- VMKZATFHDNKIHI-UHFFFAOYSA-N 3-(2-chlorobenzoyl)-4-hydroxy-6,8-dimethyl-1h-quinolin-2-one Chemical compound O=C1C2=CC(C)=CC(C)=C2NC(O)=C1C(=O)C1=CC=CC=C1Cl VMKZATFHDNKIHI-UHFFFAOYSA-N 0.000 description 1
- IGJZFBWXWPPVJF-UHFFFAOYSA-N 3-(2-chlorobenzoyl)-4-hydroxy-6-propan-2-yl-1h-quinolin-2-one Chemical compound O=C1C2=CC(C(C)C)=CC=C2NC(O)=C1C(=O)C1=CC=CC=C1Cl IGJZFBWXWPPVJF-UHFFFAOYSA-N 0.000 description 1
- FAUSNNYBSWIXMI-UHFFFAOYSA-N 3-(3,4-dichlorobenzoyl)-4-hydroxy-1H-quinolin-2-one Chemical compound OC=1NC2=CC=CC=C2C(=O)C=1C(=O)C1=CC=C(Cl)C(Cl)=C1 FAUSNNYBSWIXMI-UHFFFAOYSA-N 0.000 description 1
- FMZHOGJAOHHWFV-UHFFFAOYSA-N 3-(3,4-dimethoxybenzoyl)-4-hydroxy-1H-quinolin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)C1=C(O)NC2=CC=CC=C2C1=O FMZHOGJAOHHWFV-UHFFFAOYSA-N 0.000 description 1
- QZJDBXUFHQTRKG-UHFFFAOYSA-N 3-(3,4-dimethoxybenzoyl)-4-hydroxy-7-nitro-1H-quinolin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)C1=C(O)NC2=CC([N+]([O-])=O)=CC=C2C1=O QZJDBXUFHQTRKG-UHFFFAOYSA-N 0.000 description 1
- NOJXRHBIVBIMQY-UHFFFAOYSA-N 3-anilino-3-oxopropanoic acid Chemical compound OC(=O)CC(=O)NC1=CC=CC=C1 NOJXRHBIVBIMQY-UHFFFAOYSA-N 0.000 description 1
- KYRSLEPTGNFBFK-UHFFFAOYSA-N 3-benzoyl-4-hydroxy-2-oxo-1H-quinoline-5-carboxylic acid Chemical compound O=C1C=2C(C(=O)O)=CC=CC=2NC(O)=C1C(=O)C1=CC=CC=C1 KYRSLEPTGNFBFK-UHFFFAOYSA-N 0.000 description 1
- PLBSQHARIALJGV-UHFFFAOYSA-N 3-benzoyl-4-hydroxy-2-oxo-1H-quinoline-6-carboxylic acid Chemical compound O=C1C2=CC(C(=O)O)=CC=C2NC(O)=C1C(=O)C1=CC=CC=C1 PLBSQHARIALJGV-UHFFFAOYSA-N 0.000 description 1
- UKBOFWZGKSKOQB-UHFFFAOYSA-N 3-benzoyl-4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one Chemical compound O=C1C=2C=C(OC)C(OC)=CC=2NC(O)=C1C(=O)C1=CC=CC=C1 UKBOFWZGKSKOQB-UHFFFAOYSA-N 0.000 description 1
- CHYRNISKZUHWLA-UHFFFAOYSA-N 3-benzoyl-4-hydroxy-7-methyl-1H-quinolin-2-one Chemical compound C=1C(C)=CC=C(C2=O)C=1NC(O)=C2C(=O)C1=CC=CC=C1 CHYRNISKZUHWLA-UHFFFAOYSA-N 0.000 description 1
- UURKQIBNHHKXQZ-UHFFFAOYSA-N 3-benzoyl-6-butyl-4-hydroxy-1H-quinolin-2-one Chemical compound O=C1C2=CC(CCCC)=CC=C2NC(O)=C1C(=O)C1=CC=CC=C1 UURKQIBNHHKXQZ-UHFFFAOYSA-N 0.000 description 1
- CTCDZNPOJIXPLM-UHFFFAOYSA-N 3-benzoyl-8-chloro-4-hydroxy-6-methyl-1H-quinolin-2-one Chemical compound OC=1C2=CC(C)=CC(Cl)=C2NC(=O)C=1C(=O)C1=CC=CC=C1 CTCDZNPOJIXPLM-UHFFFAOYSA-N 0.000 description 1
- COKAILNHXHUCLO-UHFFFAOYSA-N 3-bromo-4-(4-hydroxy-2-oxo-1h-quinoline-3-carbonyl)benzonitrile Chemical compound O=C1NC2=CC=CC=C2C(O)=C1C(=O)C1=CC=C(C#N)C=C1Br COKAILNHXHUCLO-UHFFFAOYSA-N 0.000 description 1
- DRJSJNVKWMTCAO-UHFFFAOYSA-N 4-hydroxy-3-(2,4,5-trimethoxybenzoyl)-1H-quinolin-2-one Chemical compound C1=C(OC)C(OC)=CC(OC)=C1C(=O)C1=C(O)NC2=CC=CC=C2C1=O DRJSJNVKWMTCAO-UHFFFAOYSA-N 0.000 description 1
- IQMNCOJLWGVZAI-UHFFFAOYSA-N 4-hydroxy-3-(2-methoxybenzoyl)-1H-quinolin-2-one Chemical compound COC1=CC=CC=C1C(=O)C1=C(O)NC2=CC=CC=C2C1=O IQMNCOJLWGVZAI-UHFFFAOYSA-N 0.000 description 1
- CPSWNAVAURAWAS-UHFFFAOYSA-N 4-hydroxy-3-(2-propan-2-yloxybenzoyl)-1H-quinolin-2-one Chemical compound CC(C)OC1=CC=CC=C1C(=O)C1=C(O)NC2=CC=CC=C2C1=O CPSWNAVAURAWAS-UHFFFAOYSA-N 0.000 description 1
- XDIAWOSHYDNLPY-UHFFFAOYSA-N 4-hydroxy-3-(4-methoxybenzoyl)-1H-quinolin-2-one Chemical compound C1=CC(OC)=CC=C1C(=O)C1=C(O)NC2=CC=CC=C2C1=O XDIAWOSHYDNLPY-UHFFFAOYSA-N 0.000 description 1
- RDQHVSRVUBYKRW-UHFFFAOYSA-N 4-hydroxy-3-(4-nitrobenzoyl)-6-propan-2-yl-1H-quinolin-2-one Chemical compound O=C1C2=CC(C(C)C)=CC=C2NC(O)=C1C(=O)C1=CC=C([N+]([O-])=O)C=C1 RDQHVSRVUBYKRW-UHFFFAOYSA-N 0.000 description 1
- FDGCLEYOZYMBSA-UHFFFAOYSA-N 4-hydroxy-3-(4-pentylbenzoyl)-1H-quinolin-2-one Chemical compound C1=CC(CCCCC)=CC=C1C(=O)C1=C(O)NC2=CC=CC=C2C1=O FDGCLEYOZYMBSA-UHFFFAOYSA-N 0.000 description 1
- ZPRGYMVHPWPWEQ-UHFFFAOYSA-N 4-hydroxy-3-(4-propan-2-ylbenzoyl)-1H-quinolin-2-one Chemical compound C1=CC(C(C)C)=CC=C1C(=O)C1=C(O)NC2=CC=CC=C2C1=O ZPRGYMVHPWPWEQ-UHFFFAOYSA-N 0.000 description 1
- XEXODBJWOGIZDZ-UHFFFAOYSA-N 4-hydroxy-3-(5-methoxy-2-propan-2-yloxybenzoyl)-1H-quinolin-2-one Chemical compound COC1=CC=C(OC(C)C)C(C(=O)C=2C(NC3=CC=CC=C3C=2O)=O)=C1 XEXODBJWOGIZDZ-UHFFFAOYSA-N 0.000 description 1
- XXQPTAGEACZFKL-UHFFFAOYSA-N 4-hydroxy-6,8-dimethyl-3-(4-nitrobenzoyl)-1H-quinolin-2-one Chemical compound O=C1C2=CC(C)=CC(C)=C2NC(O)=C1C(=O)C1=CC=C([N+]([O-])=O)C=C1 XXQPTAGEACZFKL-UHFFFAOYSA-N 0.000 description 1
- OGFUFHTVEMNUFZ-UHFFFAOYSA-N 4-hydroxy-6-propan-2-yl-1h-quinolin-2-one Chemical compound N1C(=O)C=C(O)C2=CC(C(C)C)=CC=C21 OGFUFHTVEMNUFZ-UHFFFAOYSA-N 0.000 description 1
- IYMLPNJEWQYNOK-UHFFFAOYSA-N 6,8-dichloro-4-hydroxy-1h-quinolin-2-one Chemical compound C1=C(Cl)C=C2C(O)=CC(=O)NC2=C1Cl IYMLPNJEWQYNOK-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 235000006491 Acacia senegal Nutrition 0.000 description 1
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- 241000244186 Ascaris Species 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 229930003347 Atropine Natural products 0.000 description 1
- 101100134298 Bacillus subtilis (strain 168) nucA gene Proteins 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 101150110330 CRAT gene Proteins 0.000 description 1
- 101100382321 Caenorhabditis elegans cal-1 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 206010012438 Dermatitis atopic Diseases 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 239000004233 Indanthrene blue RS Substances 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 101150071986 LRAT gene Proteins 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 101100248652 Mus musculus Rinl gene Proteins 0.000 description 1
- QSACCXVHEVWNMX-UHFFFAOYSA-N N-acetylanthranilic acid Chemical compound CC(=O)NC1=CC=CC=C1C(O)=O QSACCXVHEVWNMX-UHFFFAOYSA-N 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 208000002193 Pain Diseases 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000005764 Theobroma cacao ssp. cacao Nutrition 0.000 description 1
- 235000005767 Theobroma cacao ssp. sphaerocarpum Nutrition 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 208000003455 anaphylaxis Diseases 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- VMPVEPPRYRXYNP-UHFFFAOYSA-I antimony(5+);pentachloride Chemical compound Cl[Sb](Cl)(Cl)(Cl)Cl VMPVEPPRYRXYNP-UHFFFAOYSA-I 0.000 description 1
- 229940064004 antiseptic throat preparations Drugs 0.000 description 1
- 210000002376 aorta thoracic Anatomy 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 201000008937 atopic dermatitis Diseases 0.000 description 1
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 1
- 229960000396 atropine Drugs 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 210000000621 bronchi Anatomy 0.000 description 1
- 235000001046 cacaotero Nutrition 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 1
- UYFAYPWGILNFND-UHFFFAOYSA-N chembl421396 Chemical compound OC=1NC2=CC(Cl)=CC=C2C(=O)C=1C(=O)C1=CC=CC=C1 UYFAYPWGILNFND-UHFFFAOYSA-N 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 229960000265 cromoglicic acid Drugs 0.000 description 1
- WASQWSOJHCZDFK-UHFFFAOYSA-N diketene Chemical compound C=C1CC(=O)O1 WASQWSOJHCZDFK-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VLARUOGDXDTHEH-UHFFFAOYSA-L disodium cromoglycate Chemical compound [Na+].[Na+].O1C(C([O-])=O)=CC(=O)C2=C1C=CC=C2OCC(O)COC1=CC=CC2=C1C(=O)C=C(C([O-])=O)O2 VLARUOGDXDTHEH-UHFFFAOYSA-L 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- XWWBMLMEVRIPSX-UHFFFAOYSA-N ethyl 2-amino-5-chlorobenzoate Chemical compound CCOC(=O)C1=CC(Cl)=CC=C1N XWWBMLMEVRIPSX-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 229960002089 ferrous chloride Drugs 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 210000000548 hind-foot Anatomy 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 210000003630 histaminocyte Anatomy 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 230000003053 immunization Effects 0.000 description 1
- 238000002649 immunization Methods 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000002075 main ingredient Substances 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- YECBIJXISLIIDS-UHFFFAOYSA-N mepyramine Chemical compound C1=CC(OC)=CC=C1CN(CCN(C)C)C1=CC=CC=N1 YECBIJXISLIIDS-UHFFFAOYSA-N 0.000 description 1
- 229960000582 mepyramine Drugs 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- ITMGAICGEHVDES-UHFFFAOYSA-N methyl 3-benzoyl-4-hydroxy-2-oxo-1H-quinoline-5-carboxylate Chemical compound O=C1C=2C(C(=O)OC)=CC=CC=2NC(O)=C1C(=O)C1=CC=CC=C1 ITMGAICGEHVDES-UHFFFAOYSA-N 0.000 description 1
- QMJIZUQYOGVNPE-UHFFFAOYSA-N methyl 3-benzoyl-4-hydroxy-2-oxo-1H-quinoline-6-carboxylate Chemical compound O=C1C2=CC(C(=O)OC)=CC=C2NC(O)=C1C(=O)C1=CC=CC=C1 QMJIZUQYOGVNPE-UHFFFAOYSA-N 0.000 description 1
- XZWULNZNBCDREL-UHFFFAOYSA-N methyl 3-benzoyl-4-hydroxy-2-oxo-1H-quinoline-7-carboxylate Chemical compound C=1C(C(=O)OC)=CC=C(C2=O)C=1NC(O)=C2C(=O)C1=CC=CC=C1 XZWULNZNBCDREL-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 239000002687 nonaqueous vehicle Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 230000036407 pain Effects 0.000 description 1
- LRTFPLFDLJYEKT-UHFFFAOYSA-N para-isopropylaniline Chemical compound CC(C)C1=CC=C(N)C=C1 LRTFPLFDLJYEKT-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229940066827 pertussis vaccine Drugs 0.000 description 1
- 239000008025 pharmaceutical bulking agent Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000010773 plant oil Substances 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000020374 simple syrup Nutrition 0.000 description 1
- 210000003491 skin Anatomy 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- UCSJYZPVAKXKNQ-HZYVHMACSA-N streptomycin Chemical compound CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@@H]1[C@](C=O)(O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@H](O)[C@H]1O UCSJYZPVAKXKNQ-HZYVHMACSA-N 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 208000004371 toothache Diseases 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/10—Expectorants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/14—Antitussive agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Public Health (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Pulmonology (AREA)
- Hematology (AREA)
- Diabetes (AREA)
- Immunology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP57107366A JPS58225065A (ja) | 1982-06-21 | 1982-06-21 | 2−キノロン誘導体 |
| JPSHO-57-107366 | 1982-06-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1191140A true CA1191140A (en) | 1985-07-30 |
Family
ID=14457260
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000430732A Expired CA1191140A (en) | 1982-06-21 | 1983-06-20 | 2-quinolone derivatives |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4526894A (enExample) |
| EP (1) | EP0101330B1 (enExample) |
| JP (1) | JPS58225065A (enExample) |
| KR (1) | KR900004041B1 (enExample) |
| CA (1) | CA1191140A (enExample) |
| DE (1) | DE3377797D1 (enExample) |
| ES (4) | ES8504130A1 (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5916878A (ja) * | 1982-07-20 | 1984-01-28 | Mitsubishi Yuka Yakuhin Kk | 2,4−ジヒドロキシ−3−アセチルキノリン類の製造方法 |
| US5179107A (en) * | 1990-09-07 | 1993-01-12 | Schering Corporation | Antiviral quinolinone compounds |
| EP0549729B1 (en) * | 1990-09-07 | 1997-12-17 | Schering Corporation | Antiviral compounds and antihypertensive compounds |
| WO1992004328A1 (en) * | 1990-09-07 | 1992-03-19 | Schering Corporation | Antiviral compounds and antihypertensive compounds |
| US5179093A (en) * | 1991-05-10 | 1993-01-12 | Schering Corporation | Quinoline-diones |
| JP2943725B2 (ja) * | 1996-01-17 | 1999-08-30 | 大日本インキ化学工業株式会社 | キノリノン誘導体及びそれを有効成分とする抗アレルギー剤 |
| KR100908418B1 (ko) | 2001-06-20 | 2009-07-21 | 액티버스 파마 컴퍼니 리미티드 | 퀴놀리논 유도체 의약 조성물 및 그의 제조 방법 |
| NZ566537A (en) | 2005-09-30 | 2010-10-29 | Pulmagen Therapeutics Asthma L | Quinolines and their therapeutic use |
| GB0519969D0 (en) * | 2005-09-30 | 2005-11-09 | Argenta Discovery Ltd | Quinoline compounds |
| EP2139881B1 (en) * | 2007-04-04 | 2011-11-09 | Pulmagen Therapeutics (Asthma) Limited | Quinolines and their therapeutic use |
| KR101846029B1 (ko) | 2008-08-06 | 2018-04-06 | 메디베이션 테크놀로지즈 엘엘씨 | 폴리(adp-리보오스)폴리머라아제 (parp)의 디히드로피리도프탈라지논 억제제 |
| US8541403B2 (en) | 2010-02-03 | 2013-09-24 | Biomarin Pharmaceutical Inc. | Dihydropyridophthalazinone inhibitors of poly(ADP-ribose)polymerase (PARP) for use in treatment of diseases associated with a PTEN deficiency |
| PL2533640T3 (pl) | 2010-02-08 | 2017-06-30 | Medivation Technologies, Inc. | Sposób syntezy pochodnych dihydropirydoftalazynonu |
| WO2012054698A1 (en) | 2010-10-21 | 2012-04-26 | Biomarin Pharmaceutical Inc. | Crystalline (8s,9r)-5-fluoro-8-(4-fluorophenyl)-9-(1-methyl-1h-1,2,4-triazol-5-yl)-8,9-dihydro-2h-pyrido[4,3,2-de]phthalazin-3(7h)-one tosylate salt |
| CN102146068A (zh) * | 2011-01-20 | 2011-08-10 | 南开大学 | 3-苯甲酰基-4-羟基香豆素衍生物及其类似物与在除草方面的应用 |
| IT202000023815A1 (it) * | 2020-10-09 | 2022-04-09 | Igm Resins Italia Srl | Ketoquinolones as photonitiators |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1770480B2 (de) * | 1968-05-22 | 1977-09-29 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von 2,4- dihydroxychinolin |
| CH606285A5 (enExample) * | 1974-12-17 | 1978-10-31 | Ciba Geigy Ag | |
| US4086349A (en) * | 1975-07-30 | 1978-04-25 | Mitsubishi Yuka Pharmaceutical Co., Ltd. | Quinolopyran-4-one-2-carboxylic acid derivatives and salts thereof as novel compounds and as medicines for treatment of allergic asthma |
| DE2806879A1 (de) * | 1978-02-17 | 1979-08-23 | Sandoz Ag | 4-hydroxy-2-chinolinon-3-carbonsaeure- esterderivate |
| EP0062001B1 (de) * | 1981-03-24 | 1987-05-27 | Ciba-Geigy Ag | Acyl-chinolinonderivate, Verfahren zu ihrer Herstellung, diese enthaltende pharmazeutische Präparate und ihre Verwendung |
-
1982
- 1982-06-21 JP JP57107366A patent/JPS58225065A/ja active Granted
-
1983
- 1983-06-10 DE DE8383401198T patent/DE3377797D1/de not_active Expired
- 1983-06-10 EP EP83401198A patent/EP0101330B1/en not_active Expired
- 1983-06-14 KR KR1019830002645A patent/KR900004041B1/ko not_active Expired
- 1983-06-20 ES ES523419A patent/ES8504130A1/es not_active Expired
- 1983-06-20 CA CA000430732A patent/CA1191140A/en not_active Expired
- 1983-06-21 US US06/506,503 patent/US4526894A/en not_active Expired - Fee Related
-
1984
- 1984-03-08 ES ES530391A patent/ES530391A0/es active Granted
- 1984-03-08 ES ES530393A patent/ES530393A0/es active Granted
- 1984-03-08 ES ES530392A patent/ES530392A0/es active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4526894A (en) | 1985-07-02 |
| ES8504723A1 (es) | 1985-05-01 |
| ES8504718A1 (es) | 1985-05-01 |
| JPS58225065A (ja) | 1983-12-27 |
| JPH0249306B2 (enExample) | 1990-10-29 |
| ES530393A0 (es) | 1985-05-01 |
| KR840005101A (ko) | 1984-11-03 |
| EP0101330A2 (en) | 1984-02-22 |
| ES8504719A1 (es) | 1985-05-01 |
| ES530391A0 (es) | 1985-05-01 |
| EP0101330A3 (en) | 1984-08-22 |
| ES523419A0 (es) | 1985-04-01 |
| ES8504130A1 (es) | 1985-04-01 |
| ES530392A0 (es) | 1985-05-01 |
| DE3377797D1 (en) | 1988-09-29 |
| KR900004041B1 (ko) | 1990-06-09 |
| EP0101330B1 (en) | 1988-08-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1191140A (en) | 2-quinolone derivatives | |
| US4929636A (en) | Positive inotrophic benzothiazole and benzothiophene compositions and method of use therefor | |
| US5480873A (en) | Pharmaceutical compounds | |
| US3484445A (en) | Derivatives of chromone-2-carboxylic acid | |
| HU183087B (en) | Process for producing substituted pyrano- and thiopyrano-quinolines | |
| Althuis et al. | Structure-activity relationships in a series of novel 3, 4-dihydro-4-oxopyrimido [4, 5-b] quinoline-2-carboxylic acid antiallergy agents | |
| US4474787A (en) | 7,6 Dioxo-4H,6H-pyrano[3,2-g]quinoline dicarboxylic acids and anti-allergic use thereof | |
| US4924004A (en) | 1-phenyl-2-aminocarbonylindole compounds, preparation thereof and pharmaceutical compositions containing them | |
| EP0100250B1 (en) | Methylflavone derivatives | |
| EP0250361B1 (de) | Disubstituierte Piperazine | |
| EP0104959A1 (en) | 4-Quinolone derivatives | |
| US4390541A (en) | Quinolone derivatives and their use in a method of controlling an immediate hypersensitivity disease | |
| AT372955B (de) | Verfahren zur herstellung neuer benzopyranderivate | |
| US4698345A (en) | Quinoline derivatives and their use as anti-asthmatic agents | |
| KR100210879B1 (ko) | 퀴놀리논 유도체 및 전기 퀴놀리논 유도체를 유효성분으로 함유 하는 항알러지제 | |
| EP0012925B1 (de) | Neue Chinoloncarbonsäure-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende pharmazeutische Präparate | |
| US3818090A (en) | Novel quinolines in the treatment of pain and inflammation | |
| CA1095914A (en) | 4-hydroxy-2-quinolinone-3-carboxylic acid compounds | |
| US4116972A (en) | Anti-inflammatory 1-oxo-isoindoline derivatives and processes for their preparation | |
| DE3138121A1 (de) | Chinolone, verfahren zur ihrer herstellung und ihre verwendung in therapeutischen zubereitungen | |
| US4521538A (en) | Ester of the 1-methyl-5-p-toluoylpyrrole-2-acetic acid having antiinflammatory, mucolytic and antitussive properties, process for its preparation and pharmaceutical compositions containing them | |
| US5250541A (en) | Kynurenic acid derivatives, their preparation and pharmaceutical compositions containing them | |
| US4624949A (en) | Dibenzo[b,d]thiopyran derivatives, pharmaceutical composition and use | |
| NZ264420A (en) | Quinoline derivatives and medicaments thereof | |
| US5292751A (en) | 5,7-dihydroxy-2-methyl-8-(4-(3-hydroxy-1-(1-propyl))piperidinyl)-4H-1-benzopyran-4-one, its preparation and its use |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEC | Expiry (correction) | ||
| MKEX | Expiry |