CA1152845A - Granular laundry compositions - Google Patents
Granular laundry compositionsInfo
- Publication number
- CA1152845A CA1152845A CA000363781A CA363781A CA1152845A CA 1152845 A CA1152845 A CA 1152845A CA 000363781 A CA000363781 A CA 000363781A CA 363781 A CA363781 A CA 363781A CA 1152845 A CA1152845 A CA 1152845A
- Authority
- CA
- Canada
- Prior art keywords
- water
- silicate
- alkyl
- composition according
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 105
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims abstract description 67
- 239000000377 silicon dioxide Substances 0.000 claims abstract description 32
- 239000003599 detergent Substances 0.000 claims abstract description 31
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 claims abstract description 27
- 239000007844 bleaching agent Substances 0.000 claims abstract description 26
- 239000002243 precursor Substances 0.000 claims abstract description 25
- 239000002736 nonionic surfactant Substances 0.000 claims abstract description 22
- 150000004967 organic peroxy acids Chemical class 0.000 claims abstract description 12
- 239000006185 dispersion Substances 0.000 claims abstract description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 45
- 150000003839 salts Chemical class 0.000 claims description 33
- 125000004432 carbon atom Chemical group C* 0.000 claims description 30
- 239000002253 acid Substances 0.000 claims description 20
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 claims description 18
- 239000003093 cationic surfactant Substances 0.000 claims description 13
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- 239000002245 particle Substances 0.000 claims description 11
- 125000003342 alkenyl group Chemical group 0.000 claims description 9
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 9
- 229910000323 aluminium silicate Inorganic materials 0.000 claims description 9
- 239000003513 alkali Substances 0.000 claims description 8
- 239000004927 clay Substances 0.000 claims description 8
- 239000005995 Aluminium silicate Substances 0.000 claims description 7
- 235000012211 aluminium silicate Nutrition 0.000 claims description 7
- 125000002091 cationic group Chemical group 0.000 claims description 7
- 229910052681 coesite Inorganic materials 0.000 claims description 7
- 229910052906 cristobalite Inorganic materials 0.000 claims description 7
- 235000012239 silicon dioxide Nutrition 0.000 claims description 7
- 229910052682 stishovite Inorganic materials 0.000 claims description 7
- 229910052905 tridymite Inorganic materials 0.000 claims description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 6
- 150000001450 anions Chemical class 0.000 claims description 6
- 239000011164 primary particle Substances 0.000 claims description 6
- 239000003945 anionic surfactant Substances 0.000 claims description 5
- 229910052901 montmorillonite Inorganic materials 0.000 claims description 5
- 238000007046 ethoxylation reaction Methods 0.000 claims description 4
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 3
- 239000011148 porous material Substances 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 239000002563 ionic surfactant Substances 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 239000000843 powder Substances 0.000 claims description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 239000002888 zwitterionic surfactant Substances 0.000 claims 1
- -1 bleaching Substances 0.000 abstract description 58
- 239000012190 activator Substances 0.000 abstract description 27
- 238000004061 bleaching Methods 0.000 abstract description 6
- 239000000654 additive Substances 0.000 abstract description 4
- 230000000996 additive effect Effects 0.000 abstract description 3
- 239000000126 substance Substances 0.000 abstract description 3
- 150000001875 compounds Chemical class 0.000 description 36
- 239000000463 material Substances 0.000 description 25
- 150000002148 esters Chemical class 0.000 description 19
- 239000011734 sodium Substances 0.000 description 19
- 229920001296 polysiloxane Polymers 0.000 description 18
- 229910052708 sodium Inorganic materials 0.000 description 18
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 17
- 239000003795 chemical substances by application Substances 0.000 description 16
- 239000004094 surface-active agent Substances 0.000 description 15
- 239000010457 zeolite Substances 0.000 description 10
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 9
- 125000002252 acyl group Chemical group 0.000 description 9
- 125000003118 aryl group Chemical group 0.000 description 9
- 239000008187 granular material Substances 0.000 description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 9
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Natural products OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 8
- 150000002500 ions Chemical class 0.000 description 8
- 238000000034 method Methods 0.000 description 8
- 229910021536 Zeolite Inorganic materials 0.000 description 7
- 125000004429 atom Chemical group 0.000 description 7
- 230000002209 hydrophobic effect Effects 0.000 description 7
- 150000003949 imides Chemical class 0.000 description 7
- 229910052622 kaolinite Inorganic materials 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 150000001298 alcohols Chemical class 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 5
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 5
- 239000005977 Ethylene Substances 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 125000000129 anionic group Chemical group 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 230000001276 controlling effect Effects 0.000 description 5
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 5
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- 229910052500 inorganic mineral Inorganic materials 0.000 description 5
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 5
- 239000011707 mineral Substances 0.000 description 5
- 235000010755 mineral Nutrition 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- 239000011591 potassium Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- 150000001335 aliphatic alkanes Chemical class 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 150000004996 alkyl benzenes Chemical class 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 238000013459 approach Methods 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- 239000011248 coating agent Substances 0.000 description 4
- 235000019864 coconut oil Nutrition 0.000 description 4
- 239000003240 coconut oil Substances 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- 238000001033 granulometry Methods 0.000 description 4
- LUVMRKKWOQTAQD-UHFFFAOYSA-N n-acetyl-n-[6-(diacetylamino)hexyl]acetamide Chemical compound CC(=O)N(C(C)=O)CCCCCCN(C(C)=O)C(C)=O LUVMRKKWOQTAQD-UHFFFAOYSA-N 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 230000001105 regulatory effect Effects 0.000 description 4
- 150000004760 silicates Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical class C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 3
- JRZJOMJEPLMPRA-UHFFFAOYSA-N 1-nonene Chemical compound CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 3
- 239000004435 Oxo alcohol Substances 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical class C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 150000004985 diamines Chemical class 0.000 description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 3
- 229940088598 enzyme Drugs 0.000 description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 description 3
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 3
- 239000003607 modifier Substances 0.000 description 3
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 235000005985 organic acids Nutrition 0.000 description 3
- 150000002923 oximes Chemical class 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229920001983 poloxamer Polymers 0.000 description 3
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 3
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 238000005063 solubilization Methods 0.000 description 3
- 230000007928 solubilization Effects 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 239000003760 tallow Substances 0.000 description 3
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical compound OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 description 3
- 239000001993 wax Substances 0.000 description 3
- MCEUCPNTVNUOJD-UHFFFAOYSA-N 3-acetylimidazolidine-2,4-dione Chemical compound CC(=O)N1C(=O)CNC1=O MCEUCPNTVNUOJD-UHFFFAOYSA-N 0.000 description 2
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 244000060011 Cocos nucifera Species 0.000 description 2
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 2
- 101100536354 Drosophila melanogaster tant gene Proteins 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 125000003047 N-acetyl group Chemical group 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000004965 Silica aerogel Substances 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 101150057036 acyI gene Proteins 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- 150000001767 cationic compounds Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 229940096386 coconut alcohol Drugs 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000002255 enzymatic effect Effects 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000012013 faujasite Substances 0.000 description 2
- 150000002357 guanidines Chemical class 0.000 description 2
- KWLMIXQRALPRBC-UHFFFAOYSA-L hectorite Chemical compound [Li+].[OH-].[OH-].[Na+].[Mg+2].O1[Si]2([O-])O[Si]1([O-])O[Si]([O-])(O1)O[Si]1([O-])O2 KWLMIXQRALPRBC-UHFFFAOYSA-L 0.000 description 2
- 229910000271 hectorite Inorganic materials 0.000 description 2
- 150000001469 hydantoins Chemical class 0.000 description 2
- ROBFUDYVXSDBQM-UHFFFAOYSA-N hydroxymalonic acid Chemical compound OC(=O)C(O)C(O)=O ROBFUDYVXSDBQM-UHFFFAOYSA-N 0.000 description 2
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 2
- 150000002460 imidazoles Chemical class 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- 229910003002 lithium salt Inorganic materials 0.000 description 2
- 159000000002 lithium salts Chemical class 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical compound OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 2
- 239000000693 micelle Substances 0.000 description 2
- UMHTVKGNHVUENZ-UHFFFAOYSA-N n,n',n'-triacetylacetohydrazide Chemical compound CC(=O)N(C(C)=O)N(C(C)=O)C(C)=O UMHTVKGNHVUENZ-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 239000002304 perfume Substances 0.000 description 2
- 150000004965 peroxy acids Chemical class 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 150000003009 phosphonic acids Chemical class 0.000 description 2
- 235000002949 phytic acid Nutrition 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- CYIDZMCFTVVTJO-UHFFFAOYSA-N pyromellitic acid Chemical compound OC(=O)C1=CC(C(O)=O)=C(C(O)=O)C=C1C(O)=O CYIDZMCFTVVTJO-UHFFFAOYSA-N 0.000 description 2
- 229910000275 saponite Inorganic materials 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 150000003918 triazines Chemical class 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- XHDDBJAMFGYASR-UHFFFAOYSA-N (3-acetyloxyiminobutan-2-ylideneamino) acetate Chemical compound CC(=O)ON=C(C)C(C)=NOC(C)=O XHDDBJAMFGYASR-UHFFFAOYSA-N 0.000 description 1
- 239000001124 (E)-prop-1-ene-1,2,3-tricarboxylic acid Substances 0.000 description 1
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical compound OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- NJLHWZLMXFBERS-UHFFFAOYSA-N 1-(2-hydroxyphenyl)ethanone;sodium Chemical compound [Na].CC(=O)C1=CC=CC=C1O NJLHWZLMXFBERS-UHFFFAOYSA-N 0.000 description 1
- ZCXARAOFWCKHLI-UHFFFAOYSA-N 1-methylsulfonylpyrrolidine-2,5-dione Chemical compound CS(=O)(=O)N1C(=O)CCC1=O ZCXARAOFWCKHLI-UHFFFAOYSA-N 0.000 description 1
- KWKAKUADMBZCLK-UHFFFAOYSA-N 1-octene Chemical compound CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 1
- XHAXVDWUMCHTCY-UHFFFAOYSA-N 2,2,2-trichloroethyl acetate Chemical compound CC(=O)OCC(Cl)(Cl)Cl XHAXVDWUMCHTCY-UHFFFAOYSA-N 0.000 description 1
- FNRRHKQTVNDRSJ-UHFFFAOYSA-N 2,3-bis(6-methylheptyl)phenol Chemical compound CC(C)CCCCCC1=CC=CC(O)=C1CCCCCC(C)C FNRRHKQTVNDRSJ-UHFFFAOYSA-N 0.000 description 1
- JKTAIYGNOFSMCE-UHFFFAOYSA-N 2,3-di(nonyl)phenol Chemical compound CCCCCCCCCC1=CC=CC(O)=C1CCCCCCCCC JKTAIYGNOFSMCE-UHFFFAOYSA-N 0.000 description 1
- JKAPWXKZLYJQJJ-UHFFFAOYSA-N 2,4-dichloro-6-methoxy-1,3,5-triazine Chemical compound COC1=NC(Cl)=NC(Cl)=N1 JKAPWXKZLYJQJJ-UHFFFAOYSA-N 0.000 description 1
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical compound OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 1
- UURYKQHCLJWXEU-UHFFFAOYSA-N 2-(2-hydroxypropanoyloxy)butanedioic acid Chemical compound CC(O)C(=O)OC(C(O)=O)CC(O)=O UURYKQHCLJWXEU-UHFFFAOYSA-N 0.000 description 1
- LVVZBNKWTVZSIU-UHFFFAOYSA-N 2-(carboxymethoxy)propanedioic acid Chemical compound OC(=O)COC(C(O)=O)C(O)=O LVVZBNKWTVZSIU-UHFFFAOYSA-N 0.000 description 1
- SFPPDAQBHZYKRC-UHFFFAOYSA-N 2-(hexadecylamino)ethane-1,1,1-triol Chemical compound CCCCCCCCCCCCCCCCNCC(O)(O)O SFPPDAQBHZYKRC-UHFFFAOYSA-N 0.000 description 1
- HOBGCONPBCCQHM-UHFFFAOYSA-N 2-(methylamino)ethane-1,1-diol Chemical class CNCC(O)O HOBGCONPBCCQHM-UHFFFAOYSA-N 0.000 description 1
- NOJSPLRZQGUKAM-UHFFFAOYSA-N 2-(octadecylamino)ethane-1,1,1-triol Chemical class CCCCCCCCCCCCCCCCCCNCC(O)(O)O NOJSPLRZQGUKAM-UHFFFAOYSA-N 0.000 description 1
- NOBSZRRPTPDGHM-UHFFFAOYSA-N 2-(tetradecylamino)ethane-1,1,1-triol Chemical class CCCCCCCCCCCCCCNCC(O)(O)O NOBSZRRPTPDGHM-UHFFFAOYSA-N 0.000 description 1
- CQWXKASOCUAEOW-UHFFFAOYSA-N 2-[2-(carboxymethoxy)ethoxy]acetic acid Chemical compound OC(=O)COCCOCC(O)=O CQWXKASOCUAEOW-UHFFFAOYSA-N 0.000 description 1
- SBAOEHHCKZJQAY-UHFFFAOYSA-N 2-[methyl(octadecyl)amino]ethane-1,1-diol Chemical class CCCCCCCCCCCCCCCCCCN(C)CC(O)O SBAOEHHCKZJQAY-UHFFFAOYSA-N 0.000 description 1
- CYEJMVLDXAUOPN-UHFFFAOYSA-N 2-dodecylphenol Chemical compound CCCCCCCCCCCCC1=CC=CC=C1O CYEJMVLDXAUOPN-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- WYWPHTQMLPHMKP-UHFFFAOYSA-N 2-hydroxyethyl-dimethyl-tetradecylazanium Chemical compound CCCCCCCCCCCCCC[N+](C)(C)CCO WYWPHTQMLPHMKP-UHFFFAOYSA-N 0.000 description 1
- UPSVYNDQEVZTMB-UHFFFAOYSA-N 2-methyl-1,3,5-trinitrobenzene;1,3,5,7-tetranitro-1,3,5,7-tetrazocane Chemical compound CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O.[O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)CN([N+]([O-])=O)C1 UPSVYNDQEVZTMB-UHFFFAOYSA-N 0.000 description 1
- OKDGPOCKHMGDQY-UHFFFAOYSA-N 3,4-dihydropyrrol-2-one Chemical class O=C1CCC=N1 OKDGPOCKHMGDQY-UHFFFAOYSA-N 0.000 description 1
- VBBBJZGJBRFXCH-UHFFFAOYSA-N 3-(dodecylamino)propane-1,1,1-triol Chemical class CCCCCCCCCCCCNCCC(O)(O)O VBBBJZGJBRFXCH-UHFFFAOYSA-N 0.000 description 1
- LGOZKWNMOGHQIY-UHFFFAOYSA-N 3-sulfonylpyrrolidine-2,5-dione Chemical compound O=C1CC(=S(=O)=O)C(=O)N1 LGOZKWNMOGHQIY-UHFFFAOYSA-N 0.000 description 1
- SMIOEQSLJNNKQF-UHFFFAOYSA-N 4-acetoxy acetophenone Chemical compound CC(=O)OC1=CC=C(C(C)=O)C=C1 SMIOEQSLJNNKQF-UHFFFAOYSA-N 0.000 description 1
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical group COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 1
- DISOQBOCQAEMAE-UHFFFAOYSA-N 4-sulfonyl-3ah-isoindole-1,3-dione Chemical compound C1=CC(=S(=O)=O)C2C(=O)NC(=O)C2=C1 DISOQBOCQAEMAE-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 101150014742 AGE1 gene Proteins 0.000 description 1
- 101150034533 ATIC gene Proteins 0.000 description 1
- 102000013142 Amylases Human genes 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- 241000132092 Aster Species 0.000 description 1
- 108091005658 Basic proteases Proteins 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 101100087530 Caenorhabditis elegans rom-1 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- QSJXEFYPDANLFS-UHFFFAOYSA-N Diacetyl Chemical group CC(=O)C(C)=O QSJXEFYPDANLFS-UHFFFAOYSA-N 0.000 description 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- ZGTMUACCHSMWAC-UHFFFAOYSA-L EDTA disodium salt (anhydrous) Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O ZGTMUACCHSMWAC-UHFFFAOYSA-L 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 1
- IMQLKJBTEOYOSI-GPIVLXJGSA-N Inositol-hexakisphosphate Chemical compound OP(O)(=O)O[C@H]1[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H]1OP(O)(O)=O IMQLKJBTEOYOSI-GPIVLXJGSA-N 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-O Methylammonium ion Chemical compound [NH3+]C BAVYZALUXZFZLV-UHFFFAOYSA-O 0.000 description 1
- 101100490488 Mus musculus Add3 gene Proteins 0.000 description 1
- 101100305983 Mus musculus Rom1 gene Proteins 0.000 description 1
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 1
- RHYBFKMFHLPQPH-UHFFFAOYSA-N N-methylhydantoin Chemical compound CN1CC(=O)NC1=O RHYBFKMFHLPQPH-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 108091005507 Neutral proteases Proteins 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 description 1
- IMQLKJBTEOYOSI-UHFFFAOYSA-N Phytic acid Natural products OP(O)(=O)OC1C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C1OP(O)(O)=O IMQLKJBTEOYOSI-UHFFFAOYSA-N 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical class NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 240000001987 Pyrus communis Species 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 239000001083 [(2R,3R,4S,5R)-1,2,4,5-tetraacetyloxy-6-oxohexan-3-yl] acetate Substances 0.000 description 1
- UAOKXEHOENRFMP-ZJIFWQFVSA-N [(2r,3r,4s,5r)-2,3,4,5-tetraacetyloxy-6-oxohexyl] acetate Chemical compound CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C=O UAOKXEHOENRFMP-ZJIFWQFVSA-N 0.000 description 1
- OBNDGIHQAIXEAO-UHFFFAOYSA-N [O].[Si] Chemical group [O].[Si] OBNDGIHQAIXEAO-UHFFFAOYSA-N 0.000 description 1
- ZXQYGBMAQZUVMI-QQDHXZELSA-N [cyano-(3-phenoxyphenyl)methyl] (1r,3r)-3-[(z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)[C@@H](\C=C(/Cl)C(F)(F)F)[C@H]1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 ZXQYGBMAQZUVMI-QQDHXZELSA-N 0.000 description 1
- AREMQPPGVQNRIE-UHFFFAOYSA-N acetic acid;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol Chemical compound CC(O)=O.CC(O)=O.C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 AREMQPPGVQNRIE-UHFFFAOYSA-N 0.000 description 1
- 229940091181 aconitic acid Drugs 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000005263 alkylenediamine group Chemical group 0.000 description 1
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 235000019418 amylase Nutrition 0.000 description 1
- 229940025131 amylases Drugs 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M bisulphate group Chemical group S([O-])(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 238000001354 calcination Methods 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- GTZCVFVGUGFEME-IWQZZHSRSA-N cis-aconitic acid Chemical compound OC(=O)C\C(C(O)=O)=C\C(O)=O GTZCVFVGUGFEME-IWQZZHSRSA-N 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- SINKOGOPEQSHQD-UHFFFAOYSA-N cyclopentadienide Chemical compound C=1C=C[CH-]C=1 SINKOGOPEQSHQD-UHFFFAOYSA-N 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- ZFTFAPZRGNKQPU-UHFFFAOYSA-N dicarbonic acid Chemical compound OC(=O)OC(O)=O ZFTFAPZRGNKQPU-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- JXSJBGJIGXNWCI-UHFFFAOYSA-N diethyl 2-[(dimethoxyphosphorothioyl)thio]succinate Chemical compound CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC JXSJBGJIGXNWCI-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- FFYPMLJYZAEMQB-UHFFFAOYSA-N diethyl pyrocarbonate Chemical compound CCOC(=O)OC(=O)OCC FFYPMLJYZAEMQB-UHFFFAOYSA-N 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- FHESUNXRPBHDQM-UHFFFAOYSA-N diphenyl benzene-1,3-dicarboxylate Chemical compound C=1C=CC(C(=O)OC=2C=CC=CC=2)=CC=1C(=O)OC1=CC=CC=C1 FHESUNXRPBHDQM-UHFFFAOYSA-N 0.000 description 1
- BDIFKMOUQSYRRD-UHFFFAOYSA-N diphenyl hexanedioate Chemical compound C=1C=CC=CC=1OC(=O)CCCCC(=O)OC1=CC=CC=C1 BDIFKMOUQSYRRD-UHFFFAOYSA-N 0.000 description 1
- DWNAQMUDCDVSLT-UHFFFAOYSA-N diphenyl phthalate Chemical compound C=1C=CC=C(C(=O)OC=2C=CC=CC=2)C=1C(=O)OC1=CC=CC=C1 DWNAQMUDCDVSLT-UHFFFAOYSA-N 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- XQRLCLUYWUNEEH-UHFFFAOYSA-N diphosphonic acid Chemical compound OP(=O)OP(O)=O XQRLCLUYWUNEEH-UHFFFAOYSA-N 0.000 description 1
- 150000002016 disaccharides Chemical class 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- IDROXUWVODOXTL-UHFFFAOYSA-N dodecyl-(2-hydroxyethyl)-dimethylazanium Chemical class CCCCCCCCCCCC[N+](C)(C)CCO IDROXUWVODOXTL-UHFFFAOYSA-N 0.000 description 1
- OQKFOMLUQPERBK-UHFFFAOYSA-N dodecyl-(3-hydroxypropyl)-dimethylazanium Chemical class CCCCCCCCCCCC[N+](C)(C)CCCO OQKFOMLUQPERBK-UHFFFAOYSA-N 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- NFDRPXJGHKJRLJ-UHFFFAOYSA-N edtmp Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CCN(CP(O)(O)=O)CP(O)(O)=O NFDRPXJGHKJRLJ-UHFFFAOYSA-N 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 150000002085 enols Chemical class 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- XWENCHGJOCJZQO-UHFFFAOYSA-N ethane-1,1,2,2-tetracarboxylic acid Chemical compound OC(=O)C(C(O)=O)C(C(O)=O)C(O)=O XWENCHGJOCJZQO-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 125000005313 fatty acid group Chemical group 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229910021485 fumed silica Inorganic materials 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- HKZVDXUEAWCPIQ-UHFFFAOYSA-N hexane-1,2,3,4,5,6-hexacarboxylic acid Chemical compound OC(=O)CC(C(O)=O)C(C(O)=O)C(C(O)=O)C(C(O)=O)CC(O)=O HKZVDXUEAWCPIQ-UHFFFAOYSA-N 0.000 description 1
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 1
- 229940091173 hydantoin Drugs 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- VAMFXQBUQXONLZ-UHFFFAOYSA-N icos-1-ene Chemical group CCCCCCCCCCCCCCCCCCC=C VAMFXQBUQXONLZ-UHFFFAOYSA-N 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- YWXYYJSYQOXTPL-SLPGGIOYSA-N isosorbide mononitrate Chemical class [O-][N+](=O)O[C@@H]1CO[C@@H]2[C@@H](O)CO[C@@H]21 YWXYYJSYQOXTPL-SLPGGIOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 230000007775 late Effects 0.000 description 1
- 125000000400 lauroyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 235000012243 magnesium silicates Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- MBKDYNNUVRNNRF-UHFFFAOYSA-N medronic acid Chemical compound OP(O)(=O)CP(O)(O)=O MBKDYNNUVRNNRF-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- ONWPLBKWMAUFGZ-UHFFFAOYSA-N methyl 2-acetyloxybenzoate Chemical compound COC(=O)C1=CC=CC=C1OC(C)=O ONWPLBKWMAUFGZ-UHFFFAOYSA-N 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical group [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 1
- 239000004200 microcrystalline wax Substances 0.000 description 1
- 235000019808 microcrystalline wax Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 150000002772 monosaccharides Chemical class 0.000 description 1
- JPKDSLBROREYTM-UHFFFAOYSA-N n-(dimethylcarbamoyl)acetamide Chemical compound CN(C)C(=O)NC(C)=O JPKDSLBROREYTM-UHFFFAOYSA-N 0.000 description 1
- QPJQPYQZFKFTHG-UHFFFAOYSA-N n-(formamidomethyl)formamide Chemical class O=CNCNC=O QPJQPYQZFKFTHG-UHFFFAOYSA-N 0.000 description 1
- BBJPLYGBSPMDOU-UHFFFAOYSA-N n-[acetyl(methyl)carbamoyl]-n-methylacetamide Chemical compound CC(=O)N(C)C(=O)N(C)C(C)=O BBJPLYGBSPMDOU-UHFFFAOYSA-N 0.000 description 1
- APAACPVZDAGQHC-UHFFFAOYSA-N n-acetyl-n-(4-chlorophenyl)acetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=C(Cl)C=C1 APAACPVZDAGQHC-UHFFFAOYSA-N 0.000 description 1
- UJPCOKISUIXFFR-UHFFFAOYSA-N n-acetyl-n-(4-methylphenyl)acetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=C(C)C=C1 UJPCOKISUIXFFR-UHFFFAOYSA-N 0.000 description 1
- ZNQFZPCFVNOXJQ-UHFFFAOYSA-N n-acetyl-n-methylacetamide Chemical compound CC(=O)N(C)C(C)=O ZNQFZPCFVNOXJQ-UHFFFAOYSA-N 0.000 description 1
- KBDYPDHUODKDRK-UHFFFAOYSA-N n-acetyl-n-phenylacetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=CC=C1 KBDYPDHUODKDRK-UHFFFAOYSA-N 0.000 description 1
- AIDQCFHFXWPAFG-UHFFFAOYSA-N n-formylformamide Chemical compound O=CNC=O AIDQCFHFXWPAFG-UHFFFAOYSA-N 0.000 description 1
- VCWRWMWHBSZKPM-UHFFFAOYSA-N n-hydroxy-3-oxobutanamide Chemical group CC(=O)CC(=O)NO VCWRWMWHBSZKPM-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- 229910017464 nitrogen compound Inorganic materials 0.000 description 1
- 150000002830 nitrogen compounds Chemical class 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 229910000273 nontronite Inorganic materials 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 229940061319 ovide Drugs 0.000 description 1
- VSXGXPNADZQTGQ-UHFFFAOYSA-N oxirane;phenol Chemical compound C1CO1.OC1=CC=CC=C1 VSXGXPNADZQTGQ-UHFFFAOYSA-N 0.000 description 1
- SOQBVABWOPYFQZ-UHFFFAOYSA-N oxygen(2-);titanium(4+) Chemical class [O-2].[O-2].[Ti+4] SOQBVABWOPYFQZ-UHFFFAOYSA-N 0.000 description 1
- UOJMTSCORVQOHS-UHFFFAOYSA-N pachypodol Natural products COc1cc(ccc1O)C2=C(C)C(=O)c3c(O)cc(C)cc3O2 UOJMTSCORVQOHS-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 125000005342 perphosphate group Chemical group 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N phenyl acetate Chemical compound CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- YNFAEFZZHQSSDP-UHFFFAOYSA-N phenyl acetate;sodium Chemical compound [Na].CC(=O)OC1=CC=CC=C1 YNFAEFZZHQSSDP-UHFFFAOYSA-N 0.000 description 1
- FCJSHPDYVMKCHI-UHFFFAOYSA-N phenyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OC1=CC=CC=C1 FCJSHPDYVMKCHI-UHFFFAOYSA-N 0.000 description 1
- VVTMNCICAIKIRN-UHFFFAOYSA-N phenyl benzoate;sodium Chemical compound [Na].C=1C=CC=CC=1C(=O)OC1=CC=CC=C1 VVTMNCICAIKIRN-UHFFFAOYSA-N 0.000 description 1
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 1
- ZPORCTAUIXXZAI-UHFFFAOYSA-N phenyl dodecanoate Chemical compound CCCCCCCCCCCC(=O)OC1=CC=CC=C1 ZPORCTAUIXXZAI-UHFFFAOYSA-N 0.000 description 1
- WEIATHGPGPOEDH-UHFFFAOYSA-N phenyl hexadecanoate Chemical compound CCCCCCCCCCCCCCCC(=O)OC1=CC=CC=C1 WEIATHGPGPOEDH-UHFFFAOYSA-N 0.000 description 1
- KIVMVOSYCVXNDM-UHFFFAOYSA-N phenyl tetradecanoate Chemical compound CCCCCCCCCCCCCC(=O)OC1=CC=CC=C1 KIVMVOSYCVXNDM-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- XNQULTQRGBXLIA-UHFFFAOYSA-O phosphonic anhydride Chemical compound O[P+](O)=O XNQULTQRGBXLIA-UHFFFAOYSA-O 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229940068041 phytic acid Drugs 0.000 description 1
- 239000000467 phytic acid Substances 0.000 description 1
- BXRNXXXXHLBUKK-UHFFFAOYSA-N piperazine-2,5-dione Chemical class O=C1CNC(=O)CN1 BXRNXXXXHLBUKK-UHFFFAOYSA-N 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical class [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- NJKRDXUWFBJCDI-UHFFFAOYSA-N propane-1,1,2,3-tetracarboxylic acid Chemical compound OC(=O)CC(C(O)=O)C(C(O)=O)C(O)=O NJKRDXUWFBJCDI-UHFFFAOYSA-N 0.000 description 1
- NJEVMKZODGWUQT-UHFFFAOYSA-N propane-1,1,3,3-tetracarboxylic acid Chemical compound OC(=O)C(C(O)=O)CC(C(O)=O)C(O)=O NJEVMKZODGWUQT-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000276 sauconite Inorganic materials 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910021647 smectite Inorganic materials 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- 230000001180 sulfating effect Effects 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000008053 sultones Chemical class 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- 229940066771 systemic antihistamines piperazine derivative Drugs 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- JZBRFIUYUGTUGG-UHFFFAOYSA-J tetrapotassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical class [K+].[K+].[K+].[K+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O JZBRFIUYUGTUGG-UHFFFAOYSA-J 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- GTZCVFVGUGFEME-UHFFFAOYSA-N trans-aconitic acid Natural products OC(=O)CC(C(O)=O)=CC(O)=O GTZCVFVGUGFEME-UHFFFAOYSA-N 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- 229910052902 vermiculite Inorganic materials 0.000 description 1
- 239000010455 vermiculite Substances 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
- C11D3/1246—Silicates, e.g. diatomaceous earth
- C11D3/1253—Layer silicates, e.g. talcum, kaolin, clay, bentonite, smectite, montmorillonite, hectorite or attapulgite
- C11D3/126—Layer silicates, e.g. talcum, kaolin, clay, bentonite, smectite, montmorillonite, hectorite or attapulgite in solid compositions
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
- C11D3/1246—Silicates, e.g. diatomaceous earth
- C11D3/128—Aluminium silicates, e.g. zeolites
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7938144 | 1979-11-03 | ||
| GB7938144 | 1979-11-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1152845A true CA1152845A (en) | 1983-08-30 |
Family
ID=10508966
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000363781A Expired CA1152845A (en) | 1979-11-03 | 1980-10-31 | Granular laundry compositions |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4321157A (esLanguage) |
| EP (1) | EP0028432B1 (esLanguage) |
| JP (1) | JPS56139595A (esLanguage) |
| AT (1) | ATE5896T1 (esLanguage) |
| CA (1) | CA1152845A (esLanguage) |
| DE (1) | DE3066202D1 (esLanguage) |
| ES (1) | ES496432A0 (esLanguage) |
| GR (1) | GR70383B (esLanguage) |
Families Citing this family (114)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES8400768A1 (es) * | 1980-11-06 | 1983-11-01 | Procter & Gamble | Un procedimiento para preparar una composicion granular ac- tivadora del blanqueo. |
| US4391725A (en) * | 1981-10-21 | 1983-07-05 | The Procter & Gamble Company | Controlled release laundry bleach product |
| US4443352A (en) * | 1982-03-04 | 1984-04-17 | Colgate-Palmolive Company | Silicate-free bleaching and laundering composition |
| DE3311368A1 (de) * | 1982-04-08 | 1983-10-27 | Colgate-Palmolive Co., 10022 New York, N.Y. | Teilchenfoermiges, bleichendes und weichmachendes textilwaschmittel |
| ZA832109B (en) * | 1982-04-15 | 1984-11-28 | Colgate Palmolive Co | Fabric softening detergent |
| DE3377140D1 (en) * | 1982-11-26 | 1988-07-28 | Unilever Nv | Liquid detergent compositions |
| DE3243983C2 (de) * | 1982-11-27 | 1984-11-22 | Degussa Ag, 6000 Frankfurt | Wäscheweichmachmittelkonzentrat |
| DK161841C (da) * | 1983-03-15 | 1992-01-27 | Colgate Palmolive Co | Blege- og vaskemiddel, der er fri for vandoploeselige silikater, og fremgangsmaade til blegning |
| ZA841401B (en) * | 1983-03-15 | 1985-10-30 | Colgate Palmolive Co | Bleaching and laundering composition free of water-soluble silicates |
| GB8307036D0 (en) * | 1983-03-15 | 1983-04-20 | Interox Chemicals Ltd | Peroxygen compounds |
| DE3337921A1 (de) * | 1983-10-19 | 1985-05-02 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von alkali- und erdalkalisalzen von acyloxibenzolfulfonsaeuren |
| DE3419795A1 (de) * | 1984-05-26 | 1985-11-28 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von acyloxybenzolsulfonsaeuren und ihrer alkali- und erdalkalisalze |
| DE3419793A1 (de) * | 1984-05-26 | 1985-11-28 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von acyloxybenzolsulfonsaeuren und ihrer alkali- und erdalkalisalze |
| GB8413802D0 (en) | 1984-05-30 | 1984-07-04 | Procter & Gamble | Detergent with suds control |
| GB8422158D0 (en) * | 1984-09-01 | 1984-10-03 | Procter & Gamble Ltd | Bleach compositions |
| JPH0680160B2 (ja) * | 1984-09-14 | 1994-10-12 | 花王株式会社 | 流動性の改良された高密度の粒状洗剤の製法 |
| JPH0672237B2 (ja) * | 1984-09-14 | 1994-09-14 | 花王株式会社 | 流動性の改良された高密度の粒状洗剤の製法 |
| US4964870A (en) * | 1984-12-14 | 1990-10-23 | The Clorox Company | Bleaching with phenylene diester peracid precursors |
| US4601845A (en) * | 1985-04-02 | 1986-07-22 | Lever Brothers Company | Bleaching compositions containing mixed metal cations adsorbed onto aluminosilicate support materials |
| JPS6225198A (ja) * | 1985-07-25 | 1987-02-03 | ユ−ホ−ケミカル株式会社 | 漂白洗浄剤組成物 |
| GB8519363D0 (en) * | 1985-08-01 | 1985-09-04 | Procter & Gamble | Dispersible fabric softeners |
| GB2182051A (en) * | 1985-09-10 | 1987-05-07 | Interox Chemicals Ltd | Stabilisation of peroxyacids in detergent compositions containing nonionic surfactant |
| GB8609883D0 (en) * | 1986-04-23 | 1986-05-29 | Procter & Gamble | Softening detergent compositions |
| US4790952A (en) * | 1986-08-14 | 1988-12-13 | The Clorox Company | Alkyl monoperoxysuccinic acid precursors and method of synthesis |
| US5112514A (en) * | 1986-11-06 | 1992-05-12 | The Clorox Company | Oxidant detergent containing stable bleach activator granules |
| US5002691A (en) * | 1986-11-06 | 1991-03-26 | The Clorox Company | Oxidant detergent containing stable bleach activator granules |
| US4992079A (en) * | 1986-11-07 | 1991-02-12 | Fmc Corporation | Process for preparing a nonphosphate laundry detergent |
| US4756844A (en) * | 1986-12-29 | 1988-07-12 | The Dow Chemical Company | Controlled-release composition having a membrane comprising submicron particles |
| US4923753A (en) * | 1987-03-26 | 1990-05-08 | The Dow Chemical Company | Controlled-release compositions for acids |
| JPS6464740A (en) * | 1987-04-14 | 1989-03-10 | Northrop Corp | Built-up data model system |
| GB8709057D0 (en) * | 1987-04-15 | 1987-05-20 | Unilever Plc | Composition for softening fabrics |
| GB8724900D0 (en) * | 1987-10-23 | 1987-11-25 | Unilever Plc | Detergent bleach compositions |
| GB8726675D0 (en) * | 1987-11-13 | 1987-12-16 | Unilever Plc | Detergent composition |
| GB8728386D0 (en) * | 1987-12-04 | 1988-01-13 | Unilever Plc | Phosphate-free detergent bleach compositions |
| DE3812556A1 (de) * | 1988-04-15 | 1989-10-26 | Hoechst Ag | Waschmittel mit lagerstabilisiertem bleichsystem |
| DE3812555A1 (de) * | 1988-04-15 | 1989-10-26 | Hoechst Ag | Lagerstabilisiertes waschmittel mit verstaerkter bleichwirkung |
| GB8823008D0 (en) * | 1988-09-30 | 1988-11-09 | Unilever Plc | Composition for softening fabrics |
| US5269962A (en) * | 1988-10-14 | 1993-12-14 | The Clorox Company | Oxidant composition containing stable bleach activator granules |
| DE3835918A1 (de) * | 1988-10-21 | 1990-04-26 | Henkel Kgaa | Verfahren zur herstellung von tensidhaltigen granulaten |
| DE3920593A1 (de) * | 1989-06-23 | 1991-01-03 | Wfk Testgewebe Gmbh | Waschmittel fuer eine gewerbliche waesche oder haushaltswaesche |
| GB8925621D0 (en) * | 1989-11-13 | 1990-01-04 | Unilever Plc | Process for preparing particulate detergent additive bodies and use thereof in detergent compositions |
| US5085852A (en) * | 1991-04-19 | 1992-02-04 | The Procter & Gamble Company | Antimicrobial oral compositions |
| US5427711A (en) * | 1991-12-29 | 1995-06-27 | Kao Corporation | Synthesized inorganic ion exchange material and detergent composition containing the same |
| US5223179A (en) * | 1992-03-26 | 1993-06-29 | The Procter & Gamble Company | Cleaning compositions with glycerol amides |
| WO1993025474A1 (de) * | 1992-06-12 | 1993-12-23 | Loehnert Gernot | Verfahren zur verdickung von wasser und seine verwendung |
| ATE117363T1 (de) * | 1992-07-20 | 1995-02-15 | Kao Corp Sa | Waschmittelzusammensetzungen. |
| US5534195A (en) * | 1993-12-23 | 1996-07-09 | The Procter & Gamble Co. | Process for making particles comprising lactam bleach activators |
| US5534196A (en) * | 1993-12-23 | 1996-07-09 | The Procter & Gamble Co. | Process for making lactam bleach activator containing particles |
| US5618783A (en) * | 1994-03-03 | 1997-04-08 | Kao Corporation | Synthesized inorganic ion exchange material and detergent composition containing the same |
| EP0687727B1 (en) * | 1994-06-17 | 2001-01-17 | The Procter & Gamble Company | Bleaching compositions based on mixtures of cationic and nonionic surfactants |
| US5496486A (en) * | 1994-06-30 | 1996-03-05 | Amway Corporation | Process for increasing liquid surfactant loading in free flowing powder detergents |
| GB2294695A (en) * | 1994-11-05 | 1996-05-08 | Procter & Gamble | A method of washing laundry |
| DE19518039A1 (de) * | 1995-05-17 | 1996-11-21 | Basf Ag | Verwendung von heterocyclischen Verbindungen als Aktivatoren für anorganische Perverbindungen |
| US5562866A (en) * | 1995-06-20 | 1996-10-08 | Albemarle Corporation | Formulated branched chain alcohol ether sulfate compounds |
| US6008178A (en) * | 1995-07-08 | 1999-12-28 | Procter & Gamble Company | Detergent composition comprising cationic ester surfactant and protease enzyme |
| EP0753571A1 (en) * | 1995-07-10 | 1997-01-15 | The Procter & Gamble Company | Process for making granular detergent composition |
| US5962397A (en) * | 1995-07-10 | 1999-10-05 | The Procter & Gamble Company | Process for making granular detergent component |
| GB2303858A (en) * | 1995-08-02 | 1997-03-05 | Procter & Gamble | Detergent composition |
| DE19541012A1 (de) | 1995-11-03 | 1997-05-07 | Basf Ag | Verwendung von Oximestern als Aktivatoren für anorganische Perverbindungen |
| DE19609953A1 (de) † | 1996-03-14 | 1997-09-18 | Basf Ag | Feste Zusammensetzung aus heterocyclischen Verbindungen und/oder Oximestern und inerten porösen Trägermaterialien und ihre Verwendung als stabile Bleichaktivator-Komponente in Wasch-, Bleich- und Reinigungsmitteln |
| EP0906385A4 (en) * | 1996-05-17 | 1999-06-09 | Procter & Gamble | DETERGENT COMPOSITION |
| US6191100B1 (en) | 1996-05-17 | 2001-02-20 | The Procter & Gamble Company | Detergent composition having effervescent generating ingredients |
| CN1225668A (zh) * | 1996-05-17 | 1999-08-11 | 普罗格特-甘布尔公司 | 洗涤剂组合物 |
| WO1997043367A1 (en) * | 1996-05-17 | 1997-11-20 | The Procter & Gamble Company | Detergent composition |
| GB2313603A (en) * | 1996-05-31 | 1997-12-03 | Procter & Gamble | Detergent compositions |
| US5858945A (en) * | 1996-06-26 | 1999-01-12 | Lever Brothers Company, Division Of Conopco, Inc. | Peracid granules containing citric acid monohydrate for improved dissolution rates |
| DE69722802T2 (de) * | 1996-10-18 | 2004-05-19 | The Procter & Gamble Company, Cincinnati | Waschmittel enthaltend ein gemisch aus kationischen, anionischen und nichtionischen tensiden |
| DE19746780A1 (de) | 1997-10-23 | 1999-04-29 | Henkel Kgaa | Verfahren zur Herstellung von Duftperlen |
| US5863887A (en) * | 1997-12-01 | 1999-01-26 | Precision Fabrics Group, Inc. | Laundry compositions having antistatic and fabric softening properties, and laundry detergent sheets containing the same |
| US6130193A (en) * | 1998-02-06 | 2000-10-10 | Precision Fabrics Group, Inc. | Laundry detergent compositions containing silica for laundry detergent sheets |
| US6017867A (en) * | 1998-06-05 | 2000-01-25 | The Procter & Gamble Company | Detergent compositions containing percarbonate and making processes thereof |
| US6673766B1 (en) * | 1998-09-25 | 2004-01-06 | The Procter & Gamble Company | Solid detergent compositions containing mixtures of surfactant/builder particles |
| US6964945B1 (en) * | 1998-09-25 | 2005-11-15 | The Procter & Gamble Company | Solid detergent compositions |
| DE19858886C2 (de) | 1998-12-19 | 2002-10-31 | Cognis Deutschland Gmbh | Tensidgranulate |
| DE19904513A1 (de) | 1999-02-04 | 2000-08-10 | Cognis Deutschland Gmbh | Detergensgemische |
| DE19918188A1 (de) | 1999-04-22 | 2000-10-26 | Cognis Deutschland Gmbh | Reinigungsmittel für harte Oberflächen |
| GB2351500A (en) * | 1999-06-28 | 2001-01-03 | Procter & Gamble | Detergent compositions |
| DE19939538A1 (de) | 1999-08-20 | 2001-02-22 | Cognis Deutschland Gmbh | Verzweigte, weitgehend ungesättigte Fettalkoholpolyglycolether |
| DE19939565A1 (de) | 1999-08-20 | 2001-02-22 | Cognis Deutschland Gmbh | Verzweigte, weitgehend ungesättigte Fettalkoholsulfate |
| DE19944218A1 (de) | 1999-09-15 | 2001-03-29 | Cognis Deutschland Gmbh | Waschmitteltabletten |
| US6610752B1 (en) | 1999-10-09 | 2003-08-26 | Cognis Deutschland Gmbh | Defoamer granules and processes for producing the same |
| US6686327B1 (en) | 1999-10-09 | 2004-02-03 | Cognis Deutschland Gmbh & Co. Kg | Shaped bodies with improved solubility in water |
| DE19951598A1 (de) | 1999-10-27 | 2001-05-03 | Cognis Deutschland Gmbh | Verfahren zur Herstellugn von festen Zuckertensiden |
| DE19953792A1 (de) | 1999-11-09 | 2001-05-17 | Cognis Deutschland Gmbh | Waschmitteltabletten |
| DE19956802A1 (de) | 1999-11-25 | 2001-06-13 | Cognis Deutschland Gmbh | Waschmitteltabletten |
| DE19956803A1 (de) | 1999-11-25 | 2001-06-13 | Cognis Deutschland Gmbh | Tensidgranulate mit verbesserter Auflösegeschwindigkeit |
| DE19962883A1 (de) | 1999-12-24 | 2001-07-12 | Cognis Deutschland Gmbh | Waschmitteltabletten |
| DE19962886A1 (de) | 1999-12-24 | 2001-07-05 | Cognis Deutschland Gmbh | Tensidgranulate mit verbesserter Auflösegeschwindigkeit |
| DE10003124A1 (de) | 2000-01-26 | 2001-08-09 | Cognis Deutschland Gmbh | Verfahren zur Herstellung von Tensidgranulaten |
| DE10018812A1 (de) | 2000-04-15 | 2001-10-25 | Cognis Deutschland Gmbh | Verfahren zur Herstellung von nichtionischen Tensidgranulaten |
| DE10019344A1 (de) | 2000-04-18 | 2001-11-08 | Cognis Deutschland Gmbh | Wasch- und Reinigungsmittel |
| DE10019405A1 (de) | 2000-04-19 | 2001-10-25 | Cognis Deutschland Gmbh | Verfahren zur Herstellung von Waschmittelgranulaten |
| DE10031619A1 (de) | 2000-06-29 | 2002-01-10 | Cognis Deutschland Gmbh | Tensidgranulate mit verbesserter Auflösegeschwindigkeit |
| DE10044472A1 (de) | 2000-09-08 | 2002-03-21 | Cognis Deutschland Gmbh | Waschmittel |
| DE10044471A1 (de) | 2000-09-08 | 2002-03-21 | Cognis Deutschland Gmbh | Waschmittel |
| DE10046251A1 (de) | 2000-09-19 | 2002-03-28 | Cognis Deutschland Gmbh | Wasch- und Reinigungsmittel auf Basis von Alkyl- und/oder Alkenyloligoglycosiden und Fettalkoholen |
| DE10063762A1 (de) | 2000-12-21 | 2002-06-27 | Cognis Deutschland Gmbh | Nichtionische Tenside |
| DE10163856A1 (de) | 2001-12-22 | 2003-07-10 | Cognis Deutschland Gmbh | Hydroxymischether und Polymere in Form von festen Mitteln als Vorcompound für Wasch-, Spül- und Reinigungsmittel |
| WO2004032626A2 (en) * | 2002-10-10 | 2004-04-22 | Sequoia Pacific Research Company, L.L.C. | Method for treating an environment that may be or is contaminated with an undesirable bacteria, virus and/or spore |
| US7771737B2 (en) | 2004-01-09 | 2010-08-10 | Ecolab Inc. | Medium chain peroxycarboxylic acid compositions |
| US7887641B2 (en) * | 2004-01-09 | 2011-02-15 | Ecolab Usa Inc. | Neutral or alkaline medium chain peroxycarboxylic acid compositions and methods employing them |
| DE102004020400A1 (de) | 2004-04-23 | 2005-11-17 | Henkel Kgaa | Parfümierte Feststoffe |
| US7754670B2 (en) | 2005-07-06 | 2010-07-13 | Ecolab Inc. | Surfactant peroxycarboxylic acid compositions |
| PL1754781T3 (pl) * | 2005-08-19 | 2013-09-30 | Procter & Gamble | Stała kompozycja detergentowa do prania zawierająca anionowy środek powierzchniowo czynny i technologię wspomagania wapniem |
| DE102005062268A1 (de) | 2005-12-24 | 2007-08-02 | Henkel Kgaa | Pulverförmige Stylingmittel und deren Spendersysteme |
| US7553450B2 (en) * | 2007-01-08 | 2009-06-30 | Appealing Products, Inc. | Irreversible humidity exposure dose indicator device |
| EP2380964A1 (en) * | 2010-04-19 | 2011-10-26 | The Procter & Gamble Company | Process for making a detergent |
| US20140308162A1 (en) | 2013-04-15 | 2014-10-16 | Ecolab Usa Inc. | Peroxycarboxylic acid based sanitizing rinse additives for use in ware washing |
| US9752105B2 (en) | 2012-09-13 | 2017-09-05 | Ecolab Usa Inc. | Two step method of cleaning, sanitizing, and rinsing a surface |
| IL239771B (en) | 2014-07-03 | 2021-06-30 | Shlomo Nir | A method for the production of complexes in the form of granules of micelles-clay and an application for the removal of organic and inorganic pollutants and microorganisms from polluted water |
| DE102015002877B4 (de) | 2015-03-09 | 2024-09-12 | Henkel Ag & Co. Kgaa | Wasch- oder reinigungsaktive Extrudate, deren Herstellung und Verwendung in granularen Wasch- oder Reinigungsmitteln |
| US10184095B1 (en) * | 2016-03-04 | 2019-01-22 | Spot Stuff, Inc. | Dry and portable calcined phyllosilicate spot removal product and method |
| IT201600070454A1 (it) * | 2016-07-06 | 2016-10-06 | 3V Sigma Spa | Attivatori di composti perossigenati |
| JP7334174B2 (ja) | 2018-02-14 | 2023-08-28 | エコラボ ユーエスエー インコーポレイティド | 膜からバイオフィルムおよび胞子を低減するための組成物および方法 |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US305417A (en) * | 1884-09-23 | Shifting pulley | ||
| NL113890C (esLanguage) | 1955-07-27 | |||
| DD56326A (esLanguage) * | 1965-07-03 | |||
| US3494787A (en) * | 1966-12-19 | 1970-02-10 | Ppg Industries Inc | Encapsulated perphthalic acid compositions and method of making same |
| NL137346C (esLanguage) * | 1966-12-19 | |||
| US3639248A (en) * | 1968-03-12 | 1972-02-01 | Dow Chemical Co | Bleaching composition |
| US4009113A (en) * | 1971-04-30 | 1977-02-22 | Lever Brothers Company | Protection of materials |
| ZA734721B (en) * | 1972-07-14 | 1974-03-27 | Procter & Gamble | Detergent compositions |
| GB1387167A (en) * | 1972-09-28 | 1975-03-12 | Procter & Gamble Ltd | Bleaching agent |
| AT375390B (de) * | 1973-05-23 | 1984-07-25 | Henkel Kgaa | Verfahren zum waschen bzw. bleichen von textilien sowie mittel dazu |
| AT373276B (de) | 1974-02-25 | 1984-01-10 | Henkel Kgaa | Nichtionische tenside enthaltende schuettfaehige wasch- und reinigungsmittel |
| US4064062A (en) * | 1975-12-15 | 1977-12-20 | Colgate-Palmolive | Stabilized activated percompound bleaching compositions and methods for manufacture thereof |
| ZA767283B (en) * | 1975-12-15 | 1978-07-26 | Colgate Palmolive Co | Bleaching compositions |
| ZA767170B (en) * | 1975-12-15 | 1978-07-26 | Colgate Palmolive Co | Detergent composition and method for use |
| GB1570498A (en) * | 1975-12-23 | 1980-07-02 | Interox Chemicals Ltd | Peroxides and their use in bleaching compositions |
| GB1557568A (en) | 1976-09-20 | 1979-12-12 | Procter & Gamble | Laundry composition comprising an agglomerate of a cationic surfactant and a bleach activator |
| US4179390A (en) * | 1976-10-06 | 1979-12-18 | The Procter & Gamble Company | Laundry additive product |
| US4087369A (en) * | 1976-11-08 | 1978-05-02 | The Procter & Gamble Company | Peroxybleach activated detergent composition |
| AT352241B (de) * | 1977-04-22 | 1979-09-10 | Henkel Kgaa | Pulverfoermiges, phosphatfreies textil- waschmittel |
| BE9T1 (fr) * | 1977-06-29 | 1980-01-11 | Procter & Gamble | Additif pour blanchissage |
| EP0001853B2 (en) * | 1977-11-07 | 1986-01-29 | THE PROCTER & GAMBLE COMPANY | Detergent compositions having improved bleaching effect |
| EP0006655B1 (en) * | 1978-06-26 | 1982-10-13 | THE PROCTER & GAMBLE COMPANY | Particulate detergent additive product |
| EP0010247B1 (de) * | 1978-10-12 | 1983-03-23 | Henkel Kommanditgesellschaft auf Aktien | Phosphatfreies Waschmittel und Verfahren zu dessen Herstellung |
-
1980
- 1980-10-27 AT AT80201015T patent/ATE5896T1/de active
- 1980-10-27 DE DE8080201015T patent/DE3066202D1/de not_active Expired
- 1980-10-27 EP EP80201015A patent/EP0028432B1/en not_active Expired
- 1980-10-31 US US06/202,528 patent/US4321157A/en not_active Expired - Lifetime
- 1980-10-31 CA CA000363781A patent/CA1152845A/en not_active Expired
- 1980-10-31 ES ES496432A patent/ES496432A0/es active Granted
- 1980-11-03 GR GR63270A patent/GR70383B/el unknown
- 1980-11-04 JP JP15509880A patent/JPS56139595A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| ES8107298A1 (es) | 1981-10-01 |
| GR70383B (esLanguage) | 1982-10-05 |
| ATE5896T1 (de) | 1984-02-15 |
| DE3066202D1 (en) | 1984-02-23 |
| JPH042640B2 (esLanguage) | 1992-01-20 |
| JPS56139595A (en) | 1981-10-31 |
| US4321157A (en) | 1982-03-23 |
| EP0028432A1 (en) | 1981-05-13 |
| EP0028432B1 (en) | 1984-01-18 |
| ES496432A0 (es) | 1981-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1152845A (en) | Granular laundry compositions | |
| US4444674A (en) | Granular bleach activator compositions and detergent compositions containing them | |
| EP0062523B1 (en) | Detergent additive compositions and preparations and use thereof in detergent compositions | |
| EP0034387B1 (en) | Mulls containing chain structure clay suspension aids | |
| CA2016030C (en) | Bleach activation and bleaching compositions | |
| US4259200A (en) | Bleaching and cleaning compositions | |
| CA1157339A (en) | Detergent compositions containing an aluminosilicate detergency builder and an unsaturated fatty acid soap | |
| EP0057088B2 (en) | Detergent compositions | |
| CA1299460C (en) | Granular non-phosphorus-containing bleach activator compositions and use thereof in granular detergent bleach compositions | |
| EP0564251A2 (en) | Amido peroxycarboxylic acids | |
| EP0213953A2 (en) | Antifoam ingredient for detergent compositions | |
| US4539131A (en) | Solid detergent composition containing sodium perborate monohydrate having specified surface area | |
| CA1191067A (en) | Cleaning composition | |
| EP0564250A2 (en) | Structured liquid detergent compositions containing amido and imido peroxy acids | |
| US4551263A (en) | Triazolidine-3,5-diones as activators for per-compounds | |
| EP0063017B1 (en) | Detergent compositions | |
| EP0675194A1 (en) | Detergent additives in structured liquids | |
| CA1160132A (en) | Granular detergent compositions | |
| US5241077A (en) | Peroxyacids | |
| JPS6181499A (ja) | 漂白化合物 | |
| JP2583308B2 (ja) | 液体洗浄剤 | |
| JPH05440B2 (esLanguage) | ||
| EP0333248A2 (en) | Bleach precursors and their use in bleaching and/or detergent composition | |
| CA1182026A (en) | Detergent compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |