CA1125749A - 5h-2,3-benzodiazepine derivatives and a process for the preparation thereof - Google Patents
5h-2,3-benzodiazepine derivatives and a process for the preparation thereofInfo
- Publication number
- CA1125749A CA1125749A CA337,955A CA337955A CA1125749A CA 1125749 A CA1125749 A CA 1125749A CA 337955 A CA337955 A CA 337955A CA 1125749 A CA1125749 A CA 1125749A
- Authority
- CA
- Canada
- Prior art keywords
- methyl
- ethyl
- benzodiazepine
- group
- dimethoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- YVOHCRLDUPTKOH-UHFFFAOYSA-N 5h-2,3-benzodiazepine Chemical class C1C=NN=CC2=CC=CC=C12 YVOHCRLDUPTKOH-UHFFFAOYSA-N 0.000 title claims abstract description 6
- 238000000034 method Methods 0.000 title claims description 46
- 238000002360 preparation method Methods 0.000 title claims description 31
- 150000001875 compounds Chemical class 0.000 claims abstract description 66
- 239000002253 acid Substances 0.000 claims abstract description 43
- 150000003839 salts Chemical class 0.000 claims abstract description 40
- -1 nitro, amino, methylenedioxy Chemical group 0.000 claims abstract description 36
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims abstract description 33
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 claims abstract description 25
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 claims abstract description 25
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 16
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 9
- 125000001424 substituent group Chemical group 0.000 claims abstract description 8
- 125000004423 acyloxy group Chemical group 0.000 claims abstract description 7
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 7
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 6
- 125000005586 carbonic acid group Chemical group 0.000 claims abstract description 4
- 150000007942 carboxylates Chemical class 0.000 claims abstract description 4
- 125000004984 dialkylaminoalkoxy group Chemical group 0.000 claims abstract description 4
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims abstract description 4
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 4
- 150000002367 halogens Chemical class 0.000 claims abstract description 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims abstract description 4
- UUDYWELSMJWOIM-UHFFFAOYSA-N isochromen-6-one Chemical class O1C=CC2=CC(=O)C=CC2=C1 UUDYWELSMJWOIM-UHFFFAOYSA-N 0.000 claims abstract description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 4
- 125000005504 styryl group Chemical group 0.000 claims abstract description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 4
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 claims abstract description 3
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims abstract 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract 4
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims abstract 3
- 125000005843 halogen group Chemical group 0.000 claims abstract 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 61
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 37
- 239000000126 substance Substances 0.000 claims description 35
- 238000007792 addition Methods 0.000 claims description 28
- 239000000203 mixture Substances 0.000 claims description 26
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 19
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 claims description 10
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 239000011541 reaction mixture Substances 0.000 claims description 8
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 claims description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 7
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 6
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 4
- 239000011707 mineral Substances 0.000 claims description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 4
- 239000000376 reactant Substances 0.000 claims description 4
- SZYQATHWZBRBJH-UHFFFAOYSA-N 7,8-dimethoxy-1-(3-methoxyphenyl)-4-methyl-5h-2,3-benzodiazepine Chemical compound COC1=CC=CC(C=2C3=CC(OC)=C(OC)C=C3CC(C)=NN=2)=C1 SZYQATHWZBRBJH-UHFFFAOYSA-N 0.000 claims description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 3
- 239000012458 free base Substances 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims description 3
- 150000007530 organic bases Chemical class 0.000 claims description 3
- 239000002798 polar solvent Substances 0.000 claims description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 3
- 238000007363 ring formation reaction Methods 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- 150000008065 acid anhydrides Chemical class 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 claims description 2
- 238000000746 purification Methods 0.000 claims description 2
- VCQFUVLZFBNFJG-UHFFFAOYSA-N 1-(3,4-dimethoxyphenyl)-5-ethyl-8-methoxy-4-methyl-7-propan-2-yloxy-5h-2,3-benzodiazepine Chemical compound N=1N=C(C)C(CC)C2=CC(OC(C)C)=C(OC)C=C2C=1C1=CC=C(OC)C(OC)=C1 VCQFUVLZFBNFJG-UHFFFAOYSA-N 0.000 claims 3
- WPRPCLBGSNSPRO-UHFFFAOYSA-N 1-(3,4-dimethoxyphenyl)-5-ethyl-8-methoxy-4-methyl-7-propoxy-5h-2,3-benzodiazepine Chemical compound C1=2C=C(OC)C(OCCC)=CC=2C(CC)C(C)=NN=C1C1=CC=C(OC)C(OC)=C1 WPRPCLBGSNSPRO-UHFFFAOYSA-N 0.000 claims 3
- CPXXEBDVEMCDMW-UHFFFAOYSA-N 1-butoxy-8-methoxy-5H-2,3-benzodiazepine Chemical compound C(CCC)OC1=NN=CCC2=C1C=C(C=C2)OC CPXXEBDVEMCDMW-UHFFFAOYSA-N 0.000 claims 3
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims 2
- NUYJXPGEZFOLHN-UHFFFAOYSA-N 1-(2-chlorophenyl)-5-ethyl-7,8-dimethoxy-4-methyl-5h-2,3-benzodiazepine Chemical compound N=1N=C(C)C(CC)C2=CC(OC)=C(OC)C=C2C=1C1=CC=CC=C1Cl NUYJXPGEZFOLHN-UHFFFAOYSA-N 0.000 claims 2
- WXNFGGMDTHCBKJ-UHFFFAOYSA-N 5-ethyl-1-(2-fluorophenyl)-7,8-dimethoxy-4-methyl-5h-2,3-benzodiazepine Chemical compound N=1N=C(C)C(CC)C2=CC(OC)=C(OC)C=C2C=1C1=CC=CC=C1F WXNFGGMDTHCBKJ-UHFFFAOYSA-N 0.000 claims 2
- RCTGNTKOLFSJSH-UHFFFAOYSA-N 5-ethyl-7,8-dimethoxy-1-(4-methoxyphenyl)-4-methyl-5h-2,3-benzodiazepine Chemical compound N=1N=C(C)C(CC)C2=CC(OC)=C(OC)C=C2C=1C1=CC=C(OC)C=C1 RCTGNTKOLFSJSH-UHFFFAOYSA-N 0.000 claims 2
- GGXVPAUJNNBKJT-UHFFFAOYSA-N 5-ethyl-7,8-dimethoxy-4-methyl-1-(2-methylphenyl)-5h-2,3-benzodiazepine Chemical compound N=1N=C(C)C(CC)C2=CC(OC)=C(OC)C=C2C=1C1=CC=CC=C1C GGXVPAUJNNBKJT-UHFFFAOYSA-N 0.000 claims 2
- AHBHWSXHUJCMCY-UHFFFAOYSA-N 7,8-dimethoxy-4-methyl-1-[3-(trifluoromethyl)phenyl]-5h-2,3-benzodiazepine Chemical compound C1=2C=C(OC)C(OC)=CC=2CC(C)=NN=C1C1=CC=CC(C(F)(F)F)=C1 AHBHWSXHUJCMCY-UHFFFAOYSA-N 0.000 claims 2
- VQYLGVVODFDFNK-UHFFFAOYSA-N girisopam Chemical compound C1=2C=C(OC)C(OC)=CC=2CC(C)=NN=C1C1=CC=CC(Cl)=C1 VQYLGVVODFDFNK-UHFFFAOYSA-N 0.000 claims 2
- RGAIACSTGBXCMU-UHFFFAOYSA-N 3-[2-(4-chlorobenzoyl)-4,5-dimethoxyphenyl]pentan-2-one Chemical compound C(C)C(C(=O)C)C1=C(C(=O)C2=CC=C(C=C2)Cl)C=C(C(=C1)OC)OC RGAIACSTGBXCMU-UHFFFAOYSA-N 0.000 claims 1
- HXKGMQQAXQUEDH-UHFFFAOYSA-N 5-ethyl-7,8-dimethoxy-4-methyl-1-phenyl-5h-2,3-benzodiazepine Chemical compound N=1N=C(C)C(CC)C2=CC(OC)=C(OC)C=C2C=1C1=CC=CC=C1 HXKGMQQAXQUEDH-UHFFFAOYSA-N 0.000 claims 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims 1
- 150000008041 alkali metal carbonates Chemical class 0.000 claims 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 claims 1
- 150000003840 hydrochlorides Chemical class 0.000 claims 1
- 239000012429 reaction media Substances 0.000 claims 1
- 230000000694 effects Effects 0.000 abstract description 6
- 229910052757 nitrogen Inorganic materials 0.000 abstract description 2
- 125000003118 aryl group Chemical group 0.000 abstract 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 abstract 2
- 125000003282 alkyl amino group Chemical group 0.000 abstract 2
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 abstract 2
- 125000004663 dialkyl amino group Chemical group 0.000 abstract 2
- 125000000623 heterocyclic group Chemical group 0.000 abstract 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 abstract 1
- 150000008372 isochromenes Chemical class 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 229910052717 sulfur Inorganic materials 0.000 abstract 1
- 125000004434 sulfur atom Chemical group 0.000 abstract 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 58
- 229960004592 isopropanol Drugs 0.000 description 29
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 239000000155 melt Substances 0.000 description 18
- 238000001953 recrystallisation Methods 0.000 description 18
- RUJBDQSFYCKFAA-UHFFFAOYSA-N Tofisopam Chemical compound N=1N=C(C)C(CC)C2=CC(OC)=C(OC)C=C2C=1C1=CC=C(OC)C(OC)=C1 RUJBDQSFYCKFAA-UHFFFAOYSA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- 229940049706 benzodiazepine Drugs 0.000 description 13
- 229960002501 tofisopam Drugs 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 241000699670 Mus sp. Species 0.000 description 7
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical class [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 208000010513 Stupor Diseases 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 230000003389 potentiating effect Effects 0.000 description 5
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 239000008298 dragée Substances 0.000 description 4
- 238000007912 intraperitoneal administration Methods 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 230000037023 motor activity Effects 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 230000002269 spontaneous effect Effects 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 229940093499 ethyl acetate Drugs 0.000 description 3
- 235000019439 ethyl acetate Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- BSDRAQVJZCAZRN-UHFFFAOYSA-N 1-(2-chlorophenyl)-7,8-dimethoxy-4-methyl-5h-2,3-benzodiazepine Chemical compound C1=2C=C(OC)C(OC)=CC=2CC(C)=NN=C1C1=CC=CC=C1Cl BSDRAQVJZCAZRN-UHFFFAOYSA-N 0.000 description 2
- PBCGGWZWRWGTFK-UHFFFAOYSA-N 5h-2,3-benzodiazepine-4-carboxylic acid Chemical class C1C(C(=O)O)=NN=CC2=CC=CC=C21 PBCGGWZWRWGTFK-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229940053197 benzodiazepine derivative antiepileptics Drugs 0.000 description 2
- 150000001557 benzodiazepines Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- XTLNYNMNUCLWEZ-UHFFFAOYSA-N ethanol;propan-2-one Chemical compound CCO.CC(C)=O XTLNYNMNUCLWEZ-UHFFFAOYSA-N 0.000 description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 230000001379 nervous effect Effects 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- 239000013558 reference substance Substances 0.000 description 2
- SQMCFUSVGSBKFK-UHFFFAOYSA-M sodium;5-(cyclohexen-1-yl)-1,5-dimethylpyrimidin-3-ide-2,4,6-trione Chemical compound [Na+].O=C1N(C)C(=O)[N-]C(=O)C1(C)C1=CCCCC1 SQMCFUSVGSBKFK-UHFFFAOYSA-M 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- GHPYJLCQYMAXGG-WCCKRBBISA-N (2R)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid hydrochloride Chemical compound Cl.N[C@@H](CSCCB(O)O)C(O)=O GHPYJLCQYMAXGG-WCCKRBBISA-N 0.000 description 1
- VMRDCIDRWYETRF-UHFFFAOYSA-N 1-(furan-2-yl)-7,8-dimethoxy-4-methyl-5h-2,3-benzodiazepine Chemical compound C1=2C=C(OC)C(OC)=CC=2CC(C)=NN=C1C1=CC=CO1 VMRDCIDRWYETRF-UHFFFAOYSA-N 0.000 description 1
- ZXWJNKQFCWPSHS-UHFFFAOYSA-N 1-[2-(2-fluorobenzoyl)-4,5-dimethoxyphenyl]propan-2-one Chemical compound C(C(=O)C)C1=C(C(=O)C2=C(C=CC=C2)F)C=C(C(=C1)OC)OC ZXWJNKQFCWPSHS-UHFFFAOYSA-N 0.000 description 1
- SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical compound N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 description 1
- NIBFJPXGNVPNHK-UHFFFAOYSA-N 2,2-difluoro-1,3-benzodioxole-4-carbaldehyde Chemical group C1=CC(C=O)=C2OC(F)(F)OC2=C1 NIBFJPXGNVPNHK-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- RQKDTQACQPHOQL-UHFFFAOYSA-N 3h-2,3-benzodiazepine Chemical compound C1=NNC=CC2=CC=CC=C21 RQKDTQACQPHOQL-UHFFFAOYSA-N 0.000 description 1
- VNTCGXMLDSKOKN-OAHLLOKOSA-N 4-[4-[[(3r)-3-methyl-4-[5-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl]methyl]-1h-pyrazol-5-yl]benzonitrile Chemical compound C([C@H](N(CC1)C=2N=CC(=CC=2)C(F)(F)F)C)N1CC=1C=NNC=1C1=CC=C(C#N)C=C1 VNTCGXMLDSKOKN-OAHLLOKOSA-N 0.000 description 1
- YQHRIORZKUWFPX-UHFFFAOYSA-N 4-methyl-5h-2,3-benzodiazepine Chemical class C1C(C)=NN=CC2=CC=CC=C21 YQHRIORZKUWFPX-UHFFFAOYSA-N 0.000 description 1
- AVNFEYMXBJNPAG-UHFFFAOYSA-N 5-ethyl-7,8-dimethoxy-4-methyl-1-thiophen-2-yl-5h-2,3-benzodiazepine;hydrochloride Chemical compound Cl.N=1N=C(C)C(CC)C2=CC(OC)=C(OC)C=C2C=1C1=CC=CS1 AVNFEYMXBJNPAG-UHFFFAOYSA-N 0.000 description 1
- XVRSHGGEAVHANN-UHFFFAOYSA-N 5h-2,3-benzodiazepin-4-ylmethanol Chemical class C1C(CO)=NN=CC2=CC=CC=C21 XVRSHGGEAVHANN-UHFFFAOYSA-N 0.000 description 1
- FFGGACTWQWEFLL-UHFFFAOYSA-N 7,8-dimethoxy-4-methyl-1-(3-nitrophenyl)-5h-2,3-benzodiazepine Chemical compound C1=2C=C(OC)C(OC)=CC=2CC(C)=NN=C1C1=CC=CC([N+]([O-])=O)=C1 FFGGACTWQWEFLL-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 208000009132 Catalepsy Diseases 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- OPFTUNCRGUEPRZ-QLFBSQMISA-N Cyclohexane Natural products CC(=C)[C@@H]1CC[C@@](C)(C=C)[C@H](C(C)=C)C1 OPFTUNCRGUEPRZ-QLFBSQMISA-N 0.000 description 1
- 235000019227 E-number Nutrition 0.000 description 1
- 239000004243 E-number Substances 0.000 description 1
- 101150049580 Esam gene Proteins 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 101100010166 Mus musculus Dok3 gene Proteins 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 101100409194 Rattus norvegicus Ppargc1b gene Proteins 0.000 description 1
- 241000428533 Rhis Species 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 1
- 206010047853 Waxy flexibility Diseases 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 1
- 239000002249 anxiolytic agent Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- XYOVOXDWRFGKEX-UHFFFAOYSA-N azepine Chemical compound N1C=CC=CC=C1 XYOVOXDWRFGKEX-UHFFFAOYSA-N 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 125000003310 benzodiazepinyl group Chemical group N1N=C(C=CC2=C1C=CC=C2)* 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- SDIXRDNYIMOKSG-UHFFFAOYSA-L disodium methyl arsenate Chemical compound [Na+].[Na+].C[As]([O-])([O-])=O SDIXRDNYIMOKSG-UHFFFAOYSA-L 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- UYXAWHWODHRRMR-UHFFFAOYSA-N hexobarbital Chemical compound O=C1N(C)C(=O)NC(=O)C1(C)C1=CCCCC1 UYXAWHWODHRRMR-UHFFFAOYSA-N 0.000 description 1
- 229960002456 hexobarbital Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 125000006303 iodophenyl group Chemical group 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000010825 rotarod performance test Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 231100000048 toxicity data Toxicity 0.000 description 1
- 229940086542 triethylamine Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/02—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 2
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/20—Hypnotics; Sedatives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/76—Benzo[c]pyrans
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Neurosurgery (AREA)
- Biomedical Technology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Neurology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Anesthesiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU78GO1426A HU179018B (en) | 1978-10-19 | 1978-10-19 | Process for producing new 5h-2,3-benzodiazepine derivatives |
| HUGO-1426 | 1978-10-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1125749A true CA1125749A (en) | 1982-06-15 |
Family
ID=10996876
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA337,955A Expired CA1125749A (en) | 1978-10-19 | 1979-10-18 | 5h-2,3-benzodiazepine derivatives and a process for the preparation thereof |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US4322346A (enExample) |
| JP (1) | JPS5592377A (enExample) |
| AT (1) | AT373589B (enExample) |
| AU (1) | AU532079B2 (enExample) |
| BE (1) | BE879404A (enExample) |
| BG (1) | BG60270B2 (enExample) |
| CA (1) | CA1125749A (enExample) |
| CH (1) | CH643835A5 (enExample) |
| CS (1) | CS236456B2 (enExample) |
| DD (1) | DD146596A5 (enExample) |
| DE (1) | DE2940483A1 (enExample) |
| DK (1) | DK155327C (enExample) |
| ES (1) | ES485163A1 (enExample) |
| FI (1) | FI66604C (enExample) |
| FR (1) | FR2439189A1 (enExample) |
| GB (1) | GB2034706B (enExample) |
| GR (1) | GR74034B (enExample) |
| HU (1) | HU179018B (enExample) |
| IT (1) | IT1220947B (enExample) |
| NL (1) | NL190552C (enExample) |
| NO (1) | NO152048C (enExample) |
| PL (1) | PL124063B1 (enExample) |
| SE (1) | SE439919B (enExample) |
| SU (1) | SU1402258A3 (enExample) |
| YU (1) | YU41887B (enExample) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU186760B (en) * | 1981-03-12 | 1985-09-30 | Gyogyszerkutato Intezet | Process for preparing 3,4-dihydro-5h-2,3-aenzodiazepine derivatives |
| HU191702B (en) * | 1984-06-27 | 1987-03-30 | Gyogyszerkutato Intezet | New process for preparing 1-aryl-5 h-2,3-benzodiazepines |
| HU191698B (en) * | 1984-07-27 | 1987-03-30 | Gyogyszerkutato Intezet | Process for producing new 1-aryl-5h-2beta-benzodiazepines |
| HU195788B (en) * | 1986-05-21 | 1988-07-28 | Gyogyszerkutato Intezet | Process for producing 1-/hydroxy-stiryl/-5h-2,3-benzobiazepines and pharmaceutical compositions containing them |
| JPH01311400A (ja) * | 1988-06-09 | 1989-12-15 | Kyocera Corp | 発光標識体の点灯方法 |
| JPH0251568U (enExample) * | 1988-10-07 | 1990-04-11 | ||
| JPH0324693U (enExample) * | 1989-07-18 | 1991-03-14 | ||
| HU207055B (en) * | 1990-10-17 | 1993-03-01 | Gyogyszerkutato Intezet | Process for producing new 5h-2,3-benzodiazepine derivative and pharmaceutical compositions comprising same |
| HU208429B (en) * | 1991-05-03 | 1993-10-28 | Gyogyszerkutato Intezet | Process for producing 1-/3-chloro-phenyl/-4-methyl-7,8-dimethoxy-5h-2,3-benzodiazepine of high purity |
| WO1993000095A2 (en) * | 1991-06-28 | 1993-01-07 | Smithkline Beecham Corporation | Bicyclic fibrinogen antagonists |
| US5939412A (en) * | 1992-06-26 | 1999-08-17 | Smithkline Beecham Corporation | Bicyclic fibrinogen antagonists |
| US6458784B1 (en) | 1994-06-29 | 2002-10-01 | Smithkline Beecham Corporation | Vitronectin receptor antagonists |
| ATE200487T1 (de) * | 1995-02-09 | 2001-04-15 | Egyt Gyogyszervegyeszeti Gyar | 1-(hetero)arylvinyl-5h-2,3- benzodiazepinderivative verwendbar zur behandlung von erkrankungen des zentralnervensystems, sowie benzopyrylium intermediate zu ihrer herstellung |
| HU224435B1 (hu) * | 1995-02-09 | 2005-10-28 | EGIS Gyógyszergyár Rt. | Benzodiazepin-származékok, eljárás előállításukra, alkalmazásukra és ezeket tartalmazó gyógyászati készítmények |
| SK283859B6 (sk) * | 1995-02-09 | 2004-03-02 | Egis Gy�Gyszergy�R Rt. | 1-[2'-(Substituovaný)vinyl]-5H-2,3-benzodiazepínové deriváty, spôsob ich prípravy a medziprodukty na ich prípravu, liečivá ich obsahujúce a ich použitie |
| US5977101A (en) * | 1995-06-29 | 1999-11-02 | Smithkline Beecham Corporation | Benzimidazoles/Imidazoles Linked to a Fibrinogen Receptor Antagonist Template Having Vitronectin Receptor Antagonist Activity |
| DE19604920A1 (de) | 1996-02-01 | 1997-08-07 | Schering Ag | Neue 2,3-Benzodiazepinderivate, deren Herstellung und Verwendung als Arzneimittel |
| DE19604919A1 (de) * | 1996-02-01 | 1997-08-07 | Schering Ag | Neue 2,3-Benzodiazepinderivate, deren Herstellung und Verwendung als Arzneimittel |
| ES2111493B1 (es) * | 1996-02-08 | 1999-08-01 | Egyt Gyogyszervegyeszeti Gyar | Derivados de 1-(2- (vinilo substituido ) ) -5h-2,3-benzo-diazepina, procedimiento para su preparacion, composiciones farmaceuticas que los contienen y utilizaciones correspondientes. |
| ZA972746B (en) * | 1996-04-04 | 1998-10-09 | Egyt Gyogyszervegyeszeti Gyar | Novel 2,3-benzodiazepine derivatives |
| HU9600871D0 (en) * | 1996-04-04 | 1996-05-28 | Gyogyszerkutato Intezet | New 2,3-benzodiazepine derivatives |
| HUP9701284A3 (en) * | 1997-07-24 | 2005-11-28 | Egyt Gyogyszervegyeszeti Gyar | Use of 2,3-benzodiazepine derivatives for producing pharmaceutical compositions for treating and prophylacting illnesses and conditions connected with the endogene opioide system |
| HU227128B1 (en) * | 1999-07-07 | 2010-07-28 | Egyt Gyogyszervegyeszeti Gyar | New 2,3-benzodiazepine derivatives |
| FR2824065A1 (fr) * | 2001-04-26 | 2002-10-31 | Neuro3D | Composes inhibiteurs des phosphodiesterases des nucleotides cycliques, preparation et utilisations |
| US6649607B2 (en) | 2001-05-18 | 2003-11-18 | Vela Pharmaceuticals, Inc. | Compositions and methods for treating or preventing convulsions or seizures |
| JP4630665B2 (ja) * | 2002-09-13 | 2011-02-09 | モタック・ニューロサイエンス・リミテッド | 2,3−ベンゾジアゼピンによる基底核関連運動障害の治療 |
| DE60313474T2 (de) * | 2002-09-17 | 2008-01-03 | Motac Neuroscience Ltd. | Behandlung von dyskinesie |
| CA2510275A1 (en) * | 2002-12-03 | 2004-08-19 | Vela Pharmaceuticals, Inc. | Pharmaceutical composition of 1-(3-hydroxy-4-methoxyphenyl)-4-methyl-5-ethyl-7,8-dimethoxy-5h-2,3-benzodiazepine and uses therof |
| US7745431B2 (en) * | 2002-12-03 | 2010-06-29 | Vela Acquisition Corporation | Pharmaceutical composition of 1-(3,4-dimethoxyphenyl)-4-methyl-5-ethyl-7-methoxy-8-hydroxy-5H-2,3-benzodiazepine and uses thereof |
| US7022700B2 (en) * | 2002-12-03 | 2006-04-04 | Vela Pharmaceuticals, Inc. | Method of increasing neutrophil production using optically-pure (R)-2,3-benzodiazepines |
| US6638928B1 (en) | 2002-12-03 | 2003-10-28 | Vela Pharmaceuticals, Inc. | Treatment of irritable bowel syndrome and nonulcer dyspepsia with substituted 2,3-benzodiazepines |
| US6864251B2 (en) * | 2002-12-03 | 2005-03-08 | Vela Pharmaceuticals, Inc. | Treatment of LTB4-mediated inflammatory disorders with optically-pure (R)-2,3-benzodiazepines |
| US20040162284A1 (en) * | 2003-02-19 | 2004-08-19 | Harris Herbert W. | Method of lowering body temperature with (S) tofisopam |
| US20040224943A1 (en) * | 2003-02-19 | 2004-11-11 | Leventer Steven M. | Method of lowering body temperature with (R) - 2,3-benzodiazepines |
| JP4611308B2 (ja) * | 2003-05-16 | 2011-01-12 | ヴェラ アクイジション コーポレイション | 鏡像的に純粋な(r)2,3−ベンゾジアゼピンを使用する胃腸の機能不全及び関連するストレスの治療 |
| US20070021412A1 (en) * | 2003-05-16 | 2007-01-25 | Vela Pharmaceuticals, Inc. | Treatment of gastrointestinal dysfunction and related stress with an enantiomerically-pure (S) 2,3-benzodiazepine |
| US20040254173A1 (en) * | 2003-06-13 | 2004-12-16 | Leventer Steven M. | Modulation of dopamine responses with substituted (S)-2,3-benzodiazepines |
| HUP0302449A3 (en) * | 2003-08-04 | 2005-06-28 | Egis Gyogyszergyar Nyilvanosan | 8-chloro-2,3-benzodiazepine derivatives, pharmaceutical compositions containing them and process for producing them |
| US7541355B2 (en) * | 2005-05-23 | 2009-06-02 | Vela Acquisition Corporation | Conversion process for 2,3-benzodiazepine enantiomers |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK118660B (da) * | 1966-12-09 | 1970-09-21 | Egyt Gyogyszervegyeszeti Gyar | Analogifremgangsmåde til fremstilling af 1-(3',4'-dimethoxyphenyl)-3-methyl-4-ethyl-6,7-dimethoxy-isoquinolin-N-imid. |
| USRE30014E (en) | 1966-12-09 | 1979-05-29 | Egyesult Gyogyazer-es Tapozergyar | 1-(3,4-Dimethoxy-phenyl)-4-methyl-5-ethyl-7,8-dimethoxy-5H-2,3-benzodiazepine |
| GB1202579A (en) * | 1966-12-09 | 1970-08-19 | Egyt Gyogyszervegyeszeti Gyar | Pharmacologically active new isoquinoline derivative and process for preparing same |
| ZA712798B (en) * | 1970-11-06 | 1972-02-23 | Egyt Gyogyszervegyeszeti Gyar | New,pharmaceutically active 2,3-diazabicyclo(5.4.0)undecapentaene derivative and process for preparing same |
-
1978
- 1978-10-19 HU HU78GO1426A patent/HU179018B/hu not_active IP Right Cessation
-
1979
- 1979-10-03 YU YU2410/79A patent/YU41887B/xx unknown
- 1979-10-04 AT AT0647279A patent/AT373589B/de not_active IP Right Cessation
- 1979-10-05 DE DE19792940483 patent/DE2940483A1/de active Granted
- 1979-10-12 SE SE7908481A patent/SE439919B/sv not_active IP Right Cessation
- 1979-10-15 BE BE1/9569A patent/BE879404A/fr not_active IP Right Cessation
- 1979-10-16 CS CS797020A patent/CS236456B2/cs unknown
- 1979-10-16 CH CH929279A patent/CH643835A5/de not_active IP Right Cessation
- 1979-10-16 FR FR7925698A patent/FR2439189A1/fr active Granted
- 1979-10-16 AU AU51817/79A patent/AU532079B2/en not_active Ceased
- 1979-10-16 FI FI793209A patent/FI66604C/fi not_active IP Right Cessation
- 1979-10-17 GR GR60290A patent/GR74034B/el unknown
- 1979-10-17 DD DD79216290A patent/DD146596A5/de not_active IP Right Cessation
- 1979-10-18 CA CA337,955A patent/CA1125749A/en not_active Expired
- 1979-10-18 BG BG45206A patent/BG60270B2/bg unknown
- 1979-10-18 NL NLAANVRAGE7907692,A patent/NL190552C/xx not_active IP Right Cessation
- 1979-10-18 GB GB7936185A patent/GB2034706B/en not_active Expired
- 1979-10-18 IT IT7926579A patent/IT1220947B/it active
- 1979-10-18 JP JP13471879A patent/JPS5592377A/ja active Granted
- 1979-10-18 PL PL1979219034A patent/PL124063B1/pl unknown
- 1979-10-18 SU SU792832177A patent/SU1402258A3/ru active
- 1979-10-18 NO NO793349A patent/NO152048C/no unknown
- 1979-10-18 DK DK440179A patent/DK155327C/da not_active IP Right Cessation
- 1979-10-18 ES ES485163A patent/ES485163A1/es not_active Expired
-
1980
- 1980-09-26 US US06/191,811 patent/US4322346A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1125749A (en) | 5h-2,3-benzodiazepine derivatives and a process for the preparation thereof | |
| IE51015B1 (en) | Heterocyclic compounds,processes for their preparation and pharmaceutical compositions containing them | |
| GB2097387A (en) | 3,4-dihydro-5h-2,3-benzodiazepine derivatives | |
| GB2092145A (en) | Substituted chromans | |
| US3547922A (en) | 1-((3-indolyl)-lower-alkyl)-4- substituted-piperazines | |
| US4052508A (en) | Heterocyclic dihydroanthracen imines | |
| US4094984A (en) | 6-Phenyl-8-bromo-4H-s-triazolo-[3,4C]-thieno-[2,3E]-1,4-diazepines and salts thereof | |
| CA1271751A (en) | Dihydroimidazo[1,2-a]pyrimidine derivatives | |
| CA1203801A (en) | Piperazine derivatives, their production and pharmaceutical compositions containing them | |
| US3842090A (en) | Certain 1-aminomethyl-6-phenyl 4h-s-triazolo(4,3-a)(1,4)benzodiazepines | |
| US4515944A (en) | 1,5-Diphenyl-2-haloalkylpyrazolin-3-one intermediates | |
| US4268513A (en) | Pyrrolo [3,4-c]quinoline compounds and pharmaceutical compositions, methods for their use and preparation | |
| US3373168A (en) | Certain benzazepinoxyridoindole compounds and their preparation | |
| CA1084049A (en) | Pyridobenzodiazepinones, processes for their preparation and pharmaceuticals containing them | |
| HU179951B (en) | Process for preparing 1,2,4-oxadiazolin-5-one derivatives and pharmaceutical compositions containing thereof | |
| US4440768A (en) | Hexahydropyrrolo[3,4-c]quinoline compounds and pharmaceutical compositions, and methods for their use | |
| CA1171083A (en) | Tricyclic pyrroles, a process for their preparation, their use, and medicaments containing them | |
| PL91000B1 (en) | Process for the manufacture of indole derivatives [gb1407658a] | |
| HU191702B (en) | New process for preparing 1-aryl-5 h-2,3-benzodiazepines | |
| US3329680A (en) | Phenylpiperazinoethyl-indazoles | |
| FI89357C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara benso- och cyklohepta/1,2-c;3,4-c'/dipyrazolderivat | |
| US4350814A (en) | Pyrrolo [3,4-c]quinoline compounds | |
| US3457271A (en) | 11-lower alkyl-hexahydro-1-benzazepino (3,2,1-h,i)pyrido(4,3-b)indole | |
| US3706749A (en) | N-acyl carbostyrils | |
| SE439920B (sv) | Substituerade 1-piperazinyl-triazolo-tieno-1,4-diazepiner och farmaceutiska preparat derav |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |