CA1113476A - Cyanopyrrole derivatives - Google Patents
Cyanopyrrole derivativesInfo
- Publication number
- CA1113476A CA1113476A CA331,371A CA331371A CA1113476A CA 1113476 A CA1113476 A CA 1113476A CA 331371 A CA331371 A CA 331371A CA 1113476 A CA1113476 A CA 1113476A
- Authority
- CA
- Canada
- Prior art keywords
- compound
- compounds
- control
- pyrrole
- fungi
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000005245 cyanopyrroles Chemical class 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 54
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 4
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 4
- 238000000034 method Methods 0.000 claims description 7
- 241000233866 Fungi Species 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 150000002367 halogens Chemical group 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 230000000397 acetylating effect Effects 0.000 claims 1
- 239000000417 fungicide Substances 0.000 abstract description 6
- 125000005843 halogen group Chemical group 0.000 abstract 1
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 21
- 239000000203 mixture Substances 0.000 description 14
- 230000000855 fungicidal effect Effects 0.000 description 11
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 239000004480 active ingredient Substances 0.000 description 7
- 238000009472 formulation Methods 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 244000046052 Phaseolus vulgaris Species 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 241000196324 Embryophyta Species 0.000 description 5
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 5
- 239000000428 dust Substances 0.000 description 5
- 239000004495 emulsifiable concentrate Substances 0.000 description 5
- 150000005358 3-phenylpyrroles Chemical class 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000004563 wettable powder Substances 0.000 description 4
- 239000002689 soil Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- GCGOFPYVHQHDDR-UHFFFAOYSA-N 3-chloro-4-(3,4-dichlorophenyl)-1h-pyrrole Chemical compound ClC1=CNC=C1C1=CC=C(Cl)C(Cl)=C1 GCGOFPYVHQHDDR-UHFFFAOYSA-N 0.000 description 2
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 241000123650 Botrytis cinerea Species 0.000 description 2
- 240000008067 Cucumis sativus Species 0.000 description 2
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 2
- 241000223218 Fusarium Species 0.000 description 2
- 240000005979 Hordeum vulgare Species 0.000 description 2
- 235000007340 Hordeum vulgare Nutrition 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- 231100000674 Phytotoxicity Toxicity 0.000 description 2
- -1 Polyoxyethylene Polymers 0.000 description 2
- 239000012345 acetylating agent Substances 0.000 description 2
- 238000006640 acetylation reaction Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000010419 fine particle Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000011081 inoculation Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- CFOAUYCPAUGDFF-UHFFFAOYSA-N tosmic Chemical compound CC1=CC=C(S(=O)(=O)C[N+]#[C-])C=C1 CFOAUYCPAUGDFF-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- GQHAFQGNHSIGCT-UHFFFAOYSA-N 1-[3-chloro-4-(3-chloro-2-nitrophenyl)pyrrol-1-yl]ethanone Chemical compound CC(=O)N1C=C(Cl)C(C=2C(=C(Cl)C=CC=2)[N+]([O-])=O)=C1 GQHAFQGNHSIGCT-UHFFFAOYSA-N 0.000 description 1
- GEWCXMLSRUQIDQ-UHFFFAOYSA-N 4-(2-chlorophenyl)-1h-pyrrole-3-carbonitrile Chemical compound ClC1=CC=CC=C1C1=CNC=C1C#N GEWCXMLSRUQIDQ-UHFFFAOYSA-N 0.000 description 1
- KXAKEOKSXLUKGY-UHFFFAOYSA-N 4-[2-(trifluoromethyl)phenyl]-1h-pyrrole-3-carbonitrile Chemical compound FC(F)(F)C1=CC=CC=C1C1=CNC=C1C#N KXAKEOKSXLUKGY-UHFFFAOYSA-N 0.000 description 1
- HCTYUKFXOOTSDB-UHFFFAOYSA-N 4-chloro-2-(4-chloro-1h-pyrrol-3-yl)-3-nitrophenol Chemical compound OC1=CC=C(Cl)C([N+]([O-])=O)=C1C1=CNC=C1Cl HCTYUKFXOOTSDB-UHFFFAOYSA-N 0.000 description 1
- BMMCNKYHQAKJBN-UHFFFAOYSA-N 4-phenyl-1h-pyrrole-3-carbonitrile Chemical compound N#CC1=CNC=C1C1=CC=CC=C1 BMMCNKYHQAKJBN-UHFFFAOYSA-N 0.000 description 1
- 244000144730 Amygdalus persica Species 0.000 description 1
- 125000006519 CCH3 Chemical group 0.000 description 1
- 241000371644 Curvularia ravenelii Species 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- OPFTUNCRGUEPRZ-QLFBSQMISA-N Cyclohexane Natural products CC(=C)[C@@H]1CC[C@@](C)(C=C)[C@H](C(C)=C)C1 OPFTUNCRGUEPRZ-QLFBSQMISA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 206010027146 Melanoderma Diseases 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 235000006040 Prunus persica var persica Nutrition 0.000 description 1
- 235000014443 Pyrus communis Nutrition 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241000031845 Tilletia laevis Species 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- 235000009754 Vitis X bourquina Nutrition 0.000 description 1
- 235000012333 Vitis X labruscana Nutrition 0.000 description 1
- 240000006365 Vitis vinifera Species 0.000 description 1
- 235000014787 Vitis vinifera Nutrition 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 229910052586 apatite Inorganic materials 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- WURGXGVFSMYFCG-UHFFFAOYSA-N dichlofluanid Chemical compound CN(C)S(=O)(=O)N(SC(F)(Cl)Cl)C1=CC=CC=C1 WURGXGVFSMYFCG-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- FKLFBQCQQYDUAM-UHFFFAOYSA-N fenpiclonil Chemical compound ClC1=CC=CC(C=2C(=CNC=2)C#N)=C1Cl FKLFBQCQQYDUAM-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 239000012053 oil suspension Substances 0.000 description 1
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 1
- VSIIXMUUUJUKCM-UHFFFAOYSA-D pentacalcium;fluoride;triphosphate Chemical compound [F-].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O VSIIXMUUUJUKCM-UHFFFAOYSA-D 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000008060 phenylpyrroles Chemical class 0.000 description 1
- 244000000003 plant pathogen Species 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- QJBZDBLBQWFTPZ-UHFFFAOYSA-N pyrrolnitrin Chemical compound [O-][N+](=O)C1=C(Cl)C=CC=C1C1=CNC=C1Cl QJBZDBLBQWFTPZ-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/36—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom five-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Agronomy & Crop Science (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP83671/1978 | 1978-07-10 | ||
| JP8367178A JPS5511524A (en) | 1978-07-10 | 1978-07-10 | Cyanopyrrole derivative, its preparation and agricultural and horticultural fungicide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1113476A true CA1113476A (en) | 1981-12-01 |
Family
ID=13808929
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA331,371A Expired CA1113476A (en) | 1978-07-10 | 1979-07-09 | Cyanopyrrole derivatives |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4229465A (enExample) |
| JP (1) | JPS5511524A (enExample) |
| AR (1) | AR222179A1 (enExample) |
| AU (1) | AU514270B2 (enExample) |
| BR (1) | BR7904350A (enExample) |
| CA (1) | CA1113476A (enExample) |
| DE (1) | DE2927480C2 (enExample) |
| FR (1) | FR2430940A1 (enExample) |
| GB (1) | GB2024824B (enExample) |
| HU (1) | HU178663B (enExample) |
| NL (1) | NL7905348A (enExample) |
| NZ (1) | NZ190921A (enExample) |
| PL (1) | PL117605B1 (enExample) |
| SU (1) | SU1083895A3 (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4303667A (en) * | 1979-05-25 | 1981-12-01 | Nippon Soda Company Limited | Phenylprrole derivatives |
| JPS56100885A (en) * | 1980-01-17 | 1981-08-13 | Mitsui Toatsu Chem Inc | Composition for liquid crystal color display |
| ATE40114T1 (de) * | 1981-12-18 | 1989-02-15 | Ciba Geigy Ag | Mikrobizide sulfenyl-pyrrole. |
| US4567052A (en) * | 1983-06-17 | 1986-01-28 | Ciba-Geigy Corporation | 3-Phenyl-4-cyanopyrrole derivatives, the preparation thereof, and method of use thereof as microbicides |
| EP0130149B1 (de) * | 1983-06-17 | 1989-04-12 | Ciba-Geigy Ag | 3-Phenyl-4-cyanopyrrol-Derivate, Verfahren zu deren Herstellung und deren Verwendung als Mikrobizide |
| US4546099A (en) * | 1983-07-22 | 1985-10-08 | Ciba-Geigy Corporation | N-Aminomethyl-3-phenyl-4-cyanopyrrole derivatives, compositions and use thereof as microbicides |
| JPS60119026U (ja) * | 1984-01-23 | 1985-08-12 | 日本電子機器株式会社 | エア搬送装置 |
| EP0174910B1 (de) * | 1984-09-12 | 1990-04-04 | Ciba-Geigy Ag | Verfahren zur Herstellung von 4-Phenyl-pyrrol-derivaten |
| US4705801A (en) * | 1984-10-16 | 1987-11-10 | Ciba-Geigy Corporation | Production for producing 3-cyano-4-phenyl indoles and intermediates |
| EP0182737A3 (de) * | 1984-10-16 | 1986-10-08 | Ciba-Geigy Ag | 3-Phenylpyrrolderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Schädlingsbekämpfungsmittel |
| US4687861A (en) * | 1984-11-28 | 1987-08-18 | Ciba-Geigy Corporation | Microbicidal compositions |
| US4705800A (en) * | 1985-06-21 | 1987-11-10 | Ciba-Geigy Corporation | Difluorbenzodioxyl cyanopyrrole microbicidal compositions |
| LT2599B (lt) * | 1985-06-21 | 1994-03-25 | Ciba Geigy Ag | Kovos su fitopatogeniniais mikroorganizmais budas |
| US4680413A (en) * | 1986-01-17 | 1987-07-14 | Nippon Soda Co., Ltd. | Process for the production of 3-phenyl-4-cyanopyrroles |
| DE3770657D1 (de) * | 1986-03-04 | 1991-07-18 | Ciba Geigy Ag | Fungizide verwendung eines cyanopyrrol-derivates. |
| MD18B1 (ro) * | 1986-12-18 | 1994-05-31 | Ciba Geigy Ag | Procedeu de obtinere a 3-(2, 2-difluorbenzodioxol-4-il)-4-ciano-pirolului |
| DE3718375A1 (de) * | 1987-06-02 | 1988-12-15 | Bayer Ag | Verfahren zur herstellung von 3-cyano-4-aryl-pyrrolen |
| EP0310558A3 (de) * | 1987-10-02 | 1990-07-04 | Ciba-Geigy Ag | Mikrobizide Mittel |
| DE3737984A1 (de) * | 1987-11-09 | 1989-08-03 | Bayer Ag | 3-cyano-4-phenyl-pyrrole |
| DE3737983A1 (de) * | 1987-11-09 | 1989-08-03 | Bayer Ag | 3-cyano-4-phenyl-pyrrol-derivate |
| DE3800387A1 (de) * | 1988-01-09 | 1989-07-20 | Bayer Ag | Verfahren zur herstellung von 3-cyano-4-aryl-pyrrolen |
| US5420301A (en) * | 1988-03-18 | 1995-05-30 | Ciba-Geigy Corporation | Process for the preparation of substituted difluorobenzo-1,3-dioxoles |
| US5194628A (en) * | 1988-03-18 | 1993-03-16 | Ciba-Geigy Corporation | Process for the preparation of substituted difluorobenzo-1,3-dioxoles |
| DE3814479A1 (de) * | 1988-04-29 | 1989-11-09 | Bayer Ag | 3-cyano-4-phenyl-pyrrol-derivate, verfahren zu ihrer herstellung und ihre verwendung in schaedlingsbekaempfungsmitteln |
| DE3814478A1 (de) * | 1988-04-29 | 1989-11-09 | Bayer Ag | 3-cyano-4-phenyl-pyrrole, verfahren zu ihrer herstellung und ihre verwendung in schaedlingsbekaempfungsmitteln |
| ES2054087T3 (es) * | 1988-08-04 | 1994-08-01 | Ciba Geigy Ag | Productos microbicidas. |
| EP0358047A3 (en) * | 1988-09-08 | 1991-05-29 | American Cyanamid Company | Method of controlling phytopathogenic fungi |
| EP0386681A1 (de) * | 1989-03-08 | 1990-09-12 | Ciba-Geigy Ag | 3-Aryl-4-cyano-pyrrol-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende mikrobiozide Mittel |
| DE4128132A1 (de) * | 1991-08-24 | 1993-02-25 | Bayer Ag | 3-(2-chlor-3-trifluormethylphenyl)-4-cyanopyrrol, dessen herstellung und verwendung und neue zwischenprodukte |
| US5234943A (en) * | 1989-04-13 | 1993-08-10 | Bayer Aktiengesellschaft | Fungicidal 3-(2-chloro-3-trifluoromethylphenyl)-4-cyanopyrrole |
| DE3912156A1 (de) * | 1989-04-13 | 1990-10-25 | Bayer Ag | 3-cyano-4-phenyl-pyrrol-derivate |
| US4940720A (en) * | 1989-08-02 | 1990-07-10 | Ciba-Geigy Corporation | Microbicidal compositions |
| ZA914221B (en) | 1990-06-05 | 1992-03-25 | Ciba Geigy | Aromatic compounds |
| US6204397B1 (en) | 1991-03-08 | 2001-03-20 | Bayer Aktiengesellschaft | Process for the preparation of 3-substituted 4-cyano-pyrrole compounds |
| DE4107398A1 (de) * | 1991-03-08 | 1992-11-05 | Bayer Ag | Verfahren zur herstellung von in 3-stellung substituierten 4-cyano-pyrrolverbindungen |
| MD24B1 (ro) * | 1991-07-09 | 1994-05-31 | Parfumerii Si Cosmetice Vioric | Compozitie de substante odorante |
| US5342980A (en) | 1992-12-30 | 1994-08-30 | American Cyanamid Company | Fungicidal agents |
| UA39100C2 (uk) * | 1993-06-28 | 2001-06-15 | Новартіс Аг | Бактерицидний засіб для рослин, спосіб боротьби з грибковими захворюваннями рослин та рослинний матеріал для розмноження |
| US5519026A (en) * | 1994-06-27 | 1996-05-21 | Ciba-Geigy Corporation | Microbicides |
| US5616041A (en) * | 1995-01-17 | 1997-04-01 | Heyco Stamped Products, Inc. | Female connector for a plastic molded receptacle and an extension cord |
| US6011155A (en) * | 1996-11-07 | 2000-01-04 | Novartis Ag | N-(substituted glycyl)-2-cyanopyrrolidines, pharmaceutical compositions containing them and their use in inhibiting dipeptidyl peptidase-IV |
| CN104094937B (zh) * | 2014-06-25 | 2016-09-14 | 广东中迅农科股份有限公司 | 一种含有氟菌唑和咯菌腈的杀菌组合物 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL23184A (en) * | 1964-03-25 | 1968-11-27 | Fujisawa Pharmaceutical Co | New antibiotic substance designated as pyrrolnitrin and production thereof |
| FR1441892A (fr) * | 1964-07-09 | 1966-06-10 | Fujisawa Pharmaceutical Co | Dérivés du phényl-3-pyrrole et procédé d'obtention |
| GB1283452A (en) * | 1970-07-24 | 1972-07-26 | Parke Davis & Co | Substituted 1,3-dialkylpyrrolidines and processes for their production |
-
1978
- 1978-07-10 JP JP8367178A patent/JPS5511524A/ja active Granted
-
1979
- 1979-07-05 GB GB7923420A patent/GB2024824B/en not_active Expired
- 1979-07-05 NZ NZ190921A patent/NZ190921A/xx unknown
- 1979-07-06 US US06/055,321 patent/US4229465A/en not_active Expired - Lifetime
- 1979-07-06 DE DE2927480A patent/DE2927480C2/de not_active Expired
- 1979-07-06 FR FR7917609A patent/FR2430940A1/fr active Granted
- 1979-07-09 NL NL7905348A patent/NL7905348A/nl not_active Application Discontinuation
- 1979-07-09 AU AU48786/79A patent/AU514270B2/en not_active Ceased
- 1979-07-09 BR BR7904350A patent/BR7904350A/pt unknown
- 1979-07-09 SU SU792788553A patent/SU1083895A3/ru active
- 1979-07-09 CA CA331,371A patent/CA1113476A/en not_active Expired
- 1979-07-10 AR AR277239A patent/AR222179A1/es active
- 1979-07-10 HU HU79NI228A patent/HU178663B/hu not_active IP Right Cessation
- 1979-07-10 PL PL1979216997A patent/PL117605B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2430940A1 (fr) | 1980-02-08 |
| HU178663B (en) | 1982-06-28 |
| FR2430940B1 (enExample) | 1984-03-30 |
| PL117605B1 (en) | 1981-08-31 |
| DE2927480C2 (de) | 1982-06-03 |
| US4229465A (en) | 1980-10-21 |
| NL7905348A (nl) | 1980-01-14 |
| GB2024824B (en) | 1982-10-27 |
| SU1083895A3 (ru) | 1984-03-30 |
| AR222179A1 (es) | 1981-04-30 |
| BR7904350A (pt) | 1980-04-08 |
| GB2024824A (en) | 1980-01-16 |
| AU514270B2 (en) | 1981-01-29 |
| NZ190921A (en) | 1981-03-16 |
| PL216997A1 (enExample) | 1980-06-02 |
| AU4878679A (en) | 1980-02-07 |
| JPS5511524A (en) | 1980-01-26 |
| DE2927480A1 (de) | 1980-01-24 |
| JPS6129338B2 (enExample) | 1986-07-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1113476A (en) | Cyanopyrrole derivatives | |
| DE3883695T2 (de) | Amid-Derivate, Verfahren zu deren Herstellung sowie diese enthaltende Fungizide in der Agrikultur und im Gartenbau. | |
| DE3713774C2 (de) | Pyrazol-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende Fungizide | |
| IE54555B1 (en) | A fungicidal indanylbenzamide | |
| CA1203539A (en) | N-aryl-n-acyl-3-amino-oxazolidin-2-ones fungicides | |
| US4500536A (en) | Derivatives of N,N'-substituted azolecarboxamide and agricultural and horticultural fungicidal or nematicidal composition containing same as active ingredients | |
| US3950534A (en) | Fungicidal composition containing 2-(N-n-butylcarbamoylthio) ethyl N1 -n-butyl-thiocarbamate | |
| EP0158954A2 (de) | Tetrahydrochinolin-1-ylcarbonylimidazol-Derivate, Zwischenprodukte für diese, Verfahren zur ihrer Herstellung und Herbizide oder Fungizide für Landwirtschaft und Gartenbau | |
| US4303667A (en) | Phenylprrole derivatives | |
| JPS62221672A (ja) | 新規スルホニルアゾ−ル | |
| US4152460A (en) | 3-Chloro-2,6-dinitro-N-(substituted phenyl)-4-(trifluoromethyl)benzenamines | |
| US4049820A (en) | Substituted urazole and thiourazole compounds as agricultural fungicidal agents | |
| US4004022A (en) | Spirolactone derivatives | |
| US4405743A (en) | Pyrazolylpyrimidine derivatives | |
| CA1046061A (en) | Pyridyltriazinone compounds | |
| CA1085407A (en) | Phenylpyrrole derivatives | |
| US4181732A (en) | 1-Branched-alkylcarbonyl-3-(3,5-dihalophenyl)imidazolidine-2,4-diones | |
| DE3102907A1 (de) | "benzoxazolonderivate, verfahren zur herstellung derselben sowie zubereitungen, die diese derivate enthalten" | |
| EP0121344A2 (en) | N,N-substituted azolecarboxamide derivatives useful as fungicides and nematicides | |
| US4564638A (en) | Fungicidal novel N-benzyl-N-(2-norbornyl)-ureas | |
| DE2935578C2 (enExample) | ||
| US4162315A (en) | Agricultural fungicidal composition | |
| DE3854436T2 (de) | Alkoxymethylbenzoesäure. | |
| KR800001553B1 (ko) | 이미다졸 유도체의 제조방법 | |
| US4078074A (en) | 2H-Chromene-2-spiro-3'-phthalides useful as horticultural and agricultural fungicides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |