JPS5511524A - Cyanopyrrole derivative, its preparation and agricultural and horticultural fungicide - Google Patents
Cyanopyrrole derivative, its preparation and agricultural and horticultural fungicideInfo
- Publication number
- JPS5511524A JPS5511524A JP8367178A JP8367178A JPS5511524A JP S5511524 A JPS5511524 A JP S5511524A JP 8367178 A JP8367178 A JP 8367178A JP 8367178 A JP8367178 A JP 8367178A JP S5511524 A JPS5511524 A JP S5511524A
- Authority
- JP
- Japan
- Prior art keywords
- compound
- formula
- agricultural
- preparation
- horticultural fungicide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000417 fungicide Substances 0.000 title abstract 2
- 150000005245 cyanopyrroles Chemical class 0.000 title 1
- 230000000855 fungicidal effect Effects 0.000 title 1
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 abstract 3
- 150000001875 compounds Chemical class 0.000 abstract 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 3
- FXSMDFDDFGSBFV-UHFFFAOYSA-N 1-acetyl-4-(2-chlorophenyl)pyrrole-3-carbonitrile Chemical compound CC(=O)N1C=C(C#N)C(C=2C(=CC=CC=2)Cl)=C1 FXSMDFDDFGSBFV-UHFFFAOYSA-N 0.000 abstract 1
- 239000012345 acetylating agent Substances 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 230000000844 anti-bacterial effect Effects 0.000 abstract 1
- 230000000694 effects Effects 0.000 abstract 1
- 125000001188 haloalkyl group Chemical group 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/36—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom five-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Agronomy & Crop Science (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyrrole Compounds (AREA)
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8367178A JPS5511524A (en) | 1978-07-10 | 1978-07-10 | Cyanopyrrole derivative, its preparation and agricultural and horticultural fungicide |
| NZ190921A NZ190921A (en) | 1978-07-10 | 1979-07-05 | 1-acetyl-3-cyano-4-phenyl-pyrroles and fungicidal compositions |
| GB7923420A GB2024824B (en) | 1978-07-10 | 1979-07-05 | Cyanopyrrole derivatives |
| FR7917609A FR2430940A1 (fr) | 1978-07-10 | 1979-07-06 | Derives de cyanopyrrole, leur procede de preparation et application comme agents fongicides permettant le controle des champignons |
| US06/055,321 US4229465A (en) | 1978-07-10 | 1979-07-06 | Cyanopyrrole derivatives |
| DE2927480A DE2927480C2 (de) | 1978-07-10 | 1979-07-06 | 1-Acetyl-3-cyano-4-phenylpyrrol-Derivate |
| SU792788553A SU1083895A3 (ru) | 1978-07-10 | 1979-07-09 | Фунгицидна композици |
| AU48786/79A AU514270B2 (en) | 1978-07-10 | 1979-07-09 | Cyanopyrrole derivatives |
| NL7905348A NL7905348A (nl) | 1978-07-10 | 1979-07-09 | Cyaanpyrroolderivaten, werkwijzen ter bereiding ervan, alsmede de toepassing als fungiciden. |
| BR7904350A BR7904350A (pt) | 1978-07-10 | 1979-07-09 | Composto fungicida,composicao fungicida,processo para o controle de fungos,e processo para a producao de um composto fungicida |
| CA331,371A CA1113476A (en) | 1978-07-10 | 1979-07-09 | Cyanopyrrole derivatives |
| HU79NI228A HU178663B (en) | 1978-07-10 | 1979-07-10 | Fungicide compositions containing cyanopirrole derivatives as active agents,and process for producing the active agents |
| AR277239A AR222179A1 (es) | 1978-07-10 | 1979-07-10 | Nuevos derivados de 1-acetil-3-ciano-4-fenil-pirrol,composiciones fungicidas que los contienen y procedimiento para prepararlos |
| PL1979216997A PL117605B1 (en) | 1978-07-10 | 1979-07-10 | Fungicide and process for preparing derivatives of phenylpyrrole |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8367178A JPS5511524A (en) | 1978-07-10 | 1978-07-10 | Cyanopyrrole derivative, its preparation and agricultural and horticultural fungicide |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP9169985A Division JPS6169A (ja) | 1985-04-27 | 1985-04-27 | シアノピロ−ル誘導体 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5511524A true JPS5511524A (en) | 1980-01-26 |
| JPS6129338B2 JPS6129338B2 (enExample) | 1986-07-05 |
Family
ID=13808929
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP8367178A Granted JPS5511524A (en) | 1978-07-10 | 1978-07-10 | Cyanopyrrole derivative, its preparation and agricultural and horticultural fungicide |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4229465A (enExample) |
| JP (1) | JPS5511524A (enExample) |
| AR (1) | AR222179A1 (enExample) |
| AU (1) | AU514270B2 (enExample) |
| BR (1) | BR7904350A (enExample) |
| CA (1) | CA1113476A (enExample) |
| DE (1) | DE2927480C2 (enExample) |
| FR (1) | FR2430940A1 (enExample) |
| GB (1) | GB2024824B (enExample) |
| HU (1) | HU178663B (enExample) |
| NL (1) | NL7905348A (enExample) |
| NZ (1) | NZ190921A (enExample) |
| PL (1) | PL117605B1 (enExample) |
| SU (1) | SU1083895A3 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS60119026U (ja) * | 1984-01-23 | 1985-08-12 | 日本電子機器株式会社 | エア搬送装置 |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4303667A (en) * | 1979-05-25 | 1981-12-01 | Nippon Soda Company Limited | Phenylprrole derivatives |
| JPS56100885A (en) * | 1980-01-17 | 1981-08-13 | Mitsui Toatsu Chem Inc | Composition for liquid crystal color display |
| ATE40114T1 (de) * | 1981-12-18 | 1989-02-15 | Ciba Geigy Ag | Mikrobizide sulfenyl-pyrrole. |
| US4567052A (en) * | 1983-06-17 | 1986-01-28 | Ciba-Geigy Corporation | 3-Phenyl-4-cyanopyrrole derivatives, the preparation thereof, and method of use thereof as microbicides |
| DE3477662D1 (en) * | 1983-06-17 | 1989-05-18 | Ciba Geigy Ag | 3-phenyl-4-cyanopyrrole derivatives, process for their preparation and their use as microbicides |
| US4546099A (en) * | 1983-07-22 | 1985-10-08 | Ciba-Geigy Corporation | N-Aminomethyl-3-phenyl-4-cyanopyrrole derivatives, compositions and use thereof as microbicides |
| ATE51617T1 (de) * | 1984-09-12 | 1990-04-15 | Ciba Geigy Ag | Verfahren zur herstellung von 4-phenyl-pyrrolderivaten. |
| EP0182737A3 (de) * | 1984-10-16 | 1986-10-08 | Ciba-Geigy Ag | 3-Phenylpyrrolderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Schädlingsbekämpfungsmittel |
| US4705801A (en) * | 1984-10-16 | 1987-11-10 | Ciba-Geigy Corporation | Production for producing 3-cyano-4-phenyl indoles and intermediates |
| US4687861A (en) * | 1984-11-28 | 1987-08-18 | Ciba-Geigy Corporation | Microbicidal compositions |
| LT2599B (lt) * | 1985-06-21 | 1994-03-25 | Ciba Geigy Ag | Kovos su fitopatogeniniais mikroorganizmais budas |
| US4705800A (en) * | 1985-06-21 | 1987-11-10 | Ciba-Geigy Corporation | Difluorbenzodioxyl cyanopyrrole microbicidal compositions |
| US4680413A (en) * | 1986-01-17 | 1987-07-14 | Nippon Soda Co., Ltd. | Process for the production of 3-phenyl-4-cyanopyrroles |
| DE3770657D1 (de) * | 1986-03-04 | 1991-07-18 | Ciba Geigy Ag | Fungizide verwendung eines cyanopyrrol-derivates. |
| MD18B1 (ro) * | 1986-12-18 | 1994-05-31 | Ciba Geigy Ag | Procedeu de obtinere a 3-(2, 2-difluorbenzodioxol-4-il)-4-ciano-pirolului |
| DE3718375A1 (de) * | 1987-06-02 | 1988-12-15 | Bayer Ag | Verfahren zur herstellung von 3-cyano-4-aryl-pyrrolen |
| EP0310558A3 (de) * | 1987-10-02 | 1990-07-04 | Ciba-Geigy Ag | Mikrobizide Mittel |
| DE3737984A1 (de) * | 1987-11-09 | 1989-08-03 | Bayer Ag | 3-cyano-4-phenyl-pyrrole |
| DE3737983A1 (de) * | 1987-11-09 | 1989-08-03 | Bayer Ag | 3-cyano-4-phenyl-pyrrol-derivate |
| DE3800387A1 (de) * | 1988-01-09 | 1989-07-20 | Bayer Ag | Verfahren zur herstellung von 3-cyano-4-aryl-pyrrolen |
| US5420301A (en) * | 1988-03-18 | 1995-05-30 | Ciba-Geigy Corporation | Process for the preparation of substituted difluorobenzo-1,3-dioxoles |
| US5194628A (en) * | 1988-03-18 | 1993-03-16 | Ciba-Geigy Corporation | Process for the preparation of substituted difluorobenzo-1,3-dioxoles |
| DE3814479A1 (de) * | 1988-04-29 | 1989-11-09 | Bayer Ag | 3-cyano-4-phenyl-pyrrol-derivate, verfahren zu ihrer herstellung und ihre verwendung in schaedlingsbekaempfungsmitteln |
| DE3814478A1 (de) * | 1988-04-29 | 1989-11-09 | Bayer Ag | 3-cyano-4-phenyl-pyrrole, verfahren zu ihrer herstellung und ihre verwendung in schaedlingsbekaempfungsmitteln |
| EP0354182B1 (de) * | 1988-08-04 | 1993-01-20 | Ciba-Geigy Ag | Mikrobizide Mittel |
| EP0358047A3 (en) * | 1988-09-08 | 1991-05-29 | American Cyanamid Company | Method of controlling phytopathogenic fungi |
| EP0386681A1 (de) * | 1989-03-08 | 1990-09-12 | Ciba-Geigy Ag | 3-Aryl-4-cyano-pyrrol-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende mikrobiozide Mittel |
| DE3912156A1 (de) * | 1989-04-13 | 1990-10-25 | Bayer Ag | 3-cyano-4-phenyl-pyrrol-derivate |
| US5234943A (en) * | 1989-04-13 | 1993-08-10 | Bayer Aktiengesellschaft | Fungicidal 3-(2-chloro-3-trifluoromethylphenyl)-4-cyanopyrrole |
| DE4128132A1 (de) * | 1991-08-24 | 1993-02-25 | Bayer Ag | 3-(2-chlor-3-trifluormethylphenyl)-4-cyanopyrrol, dessen herstellung und verwendung und neue zwischenprodukte |
| US4940720A (en) * | 1989-08-02 | 1990-07-10 | Ciba-Geigy Corporation | Microbicidal compositions |
| MX26077A (es) | 1990-06-05 | 1993-10-01 | Ciba Geigy Ag | Esteres de oxima y procedimiento para su preparacion |
| US6204397B1 (en) | 1991-03-08 | 2001-03-20 | Bayer Aktiengesellschaft | Process for the preparation of 3-substituted 4-cyano-pyrrole compounds |
| DE4107398A1 (de) * | 1991-03-08 | 1992-11-05 | Bayer Ag | Verfahren zur herstellung von in 3-stellung substituierten 4-cyano-pyrrolverbindungen |
| MD24C2 (ro) * | 1991-07-09 | 1994-05-31 | Fabrica De Parfumerii Si Cosmetica "Viorica" | Compoziţie de substanţe odorante |
| US5342980A (en) | 1992-12-30 | 1994-08-30 | American Cyanamid Company | Fungicidal agents |
| UA39100C2 (uk) * | 1993-06-28 | 2001-06-15 | Новартіс Аг | Бактерицидний засіб для рослин, спосіб боротьби з грибковими захворюваннями рослин та рослинний матеріал для розмноження |
| US5519026A (en) * | 1994-06-27 | 1996-05-21 | Ciba-Geigy Corporation | Microbicides |
| US5616041A (en) * | 1995-01-17 | 1997-04-01 | Heyco Stamped Products, Inc. | Female connector for a plastic molded receptacle and an extension cord |
| US6011155A (en) * | 1996-11-07 | 2000-01-04 | Novartis Ag | N-(substituted glycyl)-2-cyanopyrrolidines, pharmaceutical compositions containing them and their use in inhibiting dipeptidyl peptidase-IV |
| CN104094937B (zh) * | 2014-06-25 | 2016-09-14 | 广东中迅农科股份有限公司 | 一种含有氟菌唑和咯菌腈的杀菌组合物 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL23184A (en) * | 1964-03-25 | 1968-11-27 | Fujisawa Pharmaceutical Co | New antibiotic substance designated as pyrrolnitrin and production thereof |
| FR1441892A (fr) * | 1964-07-09 | 1966-06-10 | Fujisawa Pharmaceutical Co | Dérivés du phényl-3-pyrrole et procédé d'obtention |
| GB1283452A (en) * | 1970-07-24 | 1972-07-26 | Parke Davis & Co | Substituted 1,3-dialkylpyrrolidines and processes for their production |
-
1978
- 1978-07-10 JP JP8367178A patent/JPS5511524A/ja active Granted
-
1979
- 1979-07-05 NZ NZ190921A patent/NZ190921A/xx unknown
- 1979-07-05 GB GB7923420A patent/GB2024824B/en not_active Expired
- 1979-07-06 DE DE2927480A patent/DE2927480C2/de not_active Expired
- 1979-07-06 US US06/055,321 patent/US4229465A/en not_active Expired - Lifetime
- 1979-07-06 FR FR7917609A patent/FR2430940A1/fr active Granted
- 1979-07-09 CA CA331,371A patent/CA1113476A/en not_active Expired
- 1979-07-09 NL NL7905348A patent/NL7905348A/nl not_active Application Discontinuation
- 1979-07-09 SU SU792788553A patent/SU1083895A3/ru active
- 1979-07-09 BR BR7904350A patent/BR7904350A/pt unknown
- 1979-07-09 AU AU48786/79A patent/AU514270B2/en not_active Ceased
- 1979-07-10 PL PL1979216997A patent/PL117605B1/pl unknown
- 1979-07-10 HU HU79NI228A patent/HU178663B/hu not_active IP Right Cessation
- 1979-07-10 AR AR277239A patent/AR222179A1/es active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS60119026U (ja) * | 1984-01-23 | 1985-08-12 | 日本電子機器株式会社 | エア搬送装置 |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6129338B2 (enExample) | 1986-07-05 |
| FR2430940B1 (enExample) | 1984-03-30 |
| CA1113476A (en) | 1981-12-01 |
| US4229465A (en) | 1980-10-21 |
| PL117605B1 (en) | 1981-08-31 |
| BR7904350A (pt) | 1980-04-08 |
| AU4878679A (en) | 1980-02-07 |
| GB2024824B (en) | 1982-10-27 |
| AR222179A1 (es) | 1981-04-30 |
| DE2927480A1 (de) | 1980-01-24 |
| HU178663B (en) | 1982-06-28 |
| SU1083895A3 (ru) | 1984-03-30 |
| NZ190921A (en) | 1981-03-16 |
| DE2927480C2 (de) | 1982-06-03 |
| AU514270B2 (en) | 1981-01-29 |
| GB2024824A (en) | 1980-01-16 |
| PL216997A1 (enExample) | 1980-06-02 |
| NL7905348A (nl) | 1980-01-14 |
| FR2430940A1 (fr) | 1980-02-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5511524A (en) | Cyanopyrrole derivative, its preparation and agricultural and horticultural fungicide | |
| JPS5540653A (en) | Perhydropyrroloimidazole derivative, and agricultural and horticultural fungicide comprising it | |
| JPS56113744A (en) | Benzoate derivative, its preparation, and use of said derivative | |
| JPS53126063A (en) | Production of chitin derivative | |
| JPS5557508A (en) | Agricultural and horticultural fungicide | |
| JPS5551066A (en) | Agricultural and horticultural microbicide | |
| JPS54160344A (en) | Novel phosphoric acid anilide derivative | |
| JPS5522605A (en) | 1-acyl-3-(3,5-dihalogenophenyl)hydantoin derivatives, their preparation and agricultural and horticultural microbicide containing thereof as effective component | |
| JPS5549343A (en) | Cyclopropanecarboxylic ester derivative, its preparation, and insecticide comprising it | |
| JPS5543034A (en) | Thiazolidine-2-carboxylic acid derivative and agricultural and horticultural fungicide containing the same | |
| JPS5555179A (en) | Pyran derivative | |
| JPS5639043A (en) | Cyclopropanecarboxylic acid ester and insecticide and miticide | |
| JPS54141746A (en) | N-benzoyl-n'-halogenoalkylidene hydrazine derivative, its preparation, and agricultural and horticultural fungicide containing the same | |
| JPS55160769A (en) | Hydrazinophthalazine derivative | |
| JPS5622783A (en) | 4-(1,3-dithioran-2-yliden -2-pyrazolin-5-one derivative | |
| JPS5661390A (en) | Perhydroimidazothiazole derivative and agricultural and horticultural germicide containing the same as active constituent | |
| JPS5495533A (en) | Preparation of derivative of anthranylaldehyde | |
| JPS56127378A (en) | 2-alkoxyindolizine derivative and its preparation | |
| JPS559031A (en) | Pyrrole-type agricultural and horticultural fungicide | |
| JPS5754167A (ja) | Pirogurutaminsanjudotaioyobisonoseizoho | |
| JPS53135949A (en) | Toluic acid anilides, their preparation and agricultural and horticultural fungicide containing the same | |
| JPS55147275A (en) | Ppacetamidophenollalphaamethyll4*2**thienyll carbonyl*phenylacetate and its use and manufacture | |
| JPS5555168A (en) | Novel 4-carboxy-2-phenyl-1-phthalazone derivative | |
| JPS56125339A (en) | Preparation of phenylacetic acid derivative | |
| JPS55108849A (en) | Trifluoromethylphenoxycumenehydroperoxide and its preparation |