NZ190921A - 1-acetyl-3-cyano-4-phenyl-pyrroles and fungicidal compositions - Google Patents
1-acetyl-3-cyano-4-phenyl-pyrroles and fungicidal compositionsInfo
- Publication number
- NZ190921A NZ190921A NZ190921A NZ19092179A NZ190921A NZ 190921 A NZ190921 A NZ 190921A NZ 190921 A NZ190921 A NZ 190921A NZ 19092179 A NZ19092179 A NZ 19092179A NZ 190921 A NZ190921 A NZ 190921A
- Authority
- NZ
- New Zealand
- Prior art keywords
- pyrroles
- acetyl
- cyano
- phenyl
- fungicidal compositions
- Prior art date
Links
- JKZOTMJACAPLOA-UHFFFAOYSA-N 1-acetyl-4-phenylpyrrole-3-carbonitrile Chemical class CC(=O)N1C=C(C#N)C(C=2C=CC=CC=2)=C1 JKZOTMJACAPLOA-UHFFFAOYSA-N 0.000 title 1
- 230000000855 fungicidal effect Effects 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/36—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom five-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Agronomy & Crop Science (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8367178A JPS5511524A (en) | 1978-07-10 | 1978-07-10 | Cyanopyrrole derivative, its preparation and agricultural and horticultural fungicide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ190921A true NZ190921A (en) | 1981-03-16 |
Family
ID=13808929
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ190921A NZ190921A (en) | 1978-07-10 | 1979-07-05 | 1-acetyl-3-cyano-4-phenyl-pyrroles and fungicidal compositions |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4229465A (enExample) |
| JP (1) | JPS5511524A (enExample) |
| AR (1) | AR222179A1 (enExample) |
| AU (1) | AU514270B2 (enExample) |
| BR (1) | BR7904350A (enExample) |
| CA (1) | CA1113476A (enExample) |
| DE (1) | DE2927480C2 (enExample) |
| FR (1) | FR2430940A1 (enExample) |
| GB (1) | GB2024824B (enExample) |
| HU (1) | HU178663B (enExample) |
| NL (1) | NL7905348A (enExample) |
| NZ (1) | NZ190921A (enExample) |
| PL (1) | PL117605B1 (enExample) |
| SU (1) | SU1083895A3 (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4303667A (en) * | 1979-05-25 | 1981-12-01 | Nippon Soda Company Limited | Phenylprrole derivatives |
| JPS56100885A (en) * | 1980-01-17 | 1981-08-13 | Mitsui Toatsu Chem Inc | Composition for liquid crystal color display |
| ATE40114T1 (de) * | 1981-12-18 | 1989-02-15 | Ciba Geigy Ag | Mikrobizide sulfenyl-pyrrole. |
| US4567052A (en) * | 1983-06-17 | 1986-01-28 | Ciba-Geigy Corporation | 3-Phenyl-4-cyanopyrrole derivatives, the preparation thereof, and method of use thereof as microbicides |
| EP0130149B1 (de) * | 1983-06-17 | 1989-04-12 | Ciba-Geigy Ag | 3-Phenyl-4-cyanopyrrol-Derivate, Verfahren zu deren Herstellung und deren Verwendung als Mikrobizide |
| US4546099A (en) * | 1983-07-22 | 1985-10-08 | Ciba-Geigy Corporation | N-Aminomethyl-3-phenyl-4-cyanopyrrole derivatives, compositions and use thereof as microbicides |
| JPS60119026U (ja) * | 1984-01-23 | 1985-08-12 | 日本電子機器株式会社 | エア搬送装置 |
| EP0174910B1 (de) * | 1984-09-12 | 1990-04-04 | Ciba-Geigy Ag | Verfahren zur Herstellung von 4-Phenyl-pyrrol-derivaten |
| US4705801A (en) * | 1984-10-16 | 1987-11-10 | Ciba-Geigy Corporation | Production for producing 3-cyano-4-phenyl indoles and intermediates |
| EP0182737A3 (de) * | 1984-10-16 | 1986-10-08 | Ciba-Geigy Ag | 3-Phenylpyrrolderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Schädlingsbekämpfungsmittel |
| US4687861A (en) * | 1984-11-28 | 1987-08-18 | Ciba-Geigy Corporation | Microbicidal compositions |
| US4705800A (en) * | 1985-06-21 | 1987-11-10 | Ciba-Geigy Corporation | Difluorbenzodioxyl cyanopyrrole microbicidal compositions |
| LT2599B (lt) * | 1985-06-21 | 1994-03-25 | Ciba Geigy Ag | Kovos su fitopatogeniniais mikroorganizmais budas |
| US4680413A (en) * | 1986-01-17 | 1987-07-14 | Nippon Soda Co., Ltd. | Process for the production of 3-phenyl-4-cyanopyrroles |
| DE3770657D1 (de) * | 1986-03-04 | 1991-07-18 | Ciba Geigy Ag | Fungizide verwendung eines cyanopyrrol-derivates. |
| MD18B1 (ro) * | 1986-12-18 | 1994-05-31 | Ciba Geigy Ag | Procedeu de obtinere a 3-(2, 2-difluorbenzodioxol-4-il)-4-ciano-pirolului |
| DE3718375A1 (de) * | 1987-06-02 | 1988-12-15 | Bayer Ag | Verfahren zur herstellung von 3-cyano-4-aryl-pyrrolen |
| EP0310558A3 (de) * | 1987-10-02 | 1990-07-04 | Ciba-Geigy Ag | Mikrobizide Mittel |
| DE3737984A1 (de) * | 1987-11-09 | 1989-08-03 | Bayer Ag | 3-cyano-4-phenyl-pyrrole |
| DE3737983A1 (de) * | 1987-11-09 | 1989-08-03 | Bayer Ag | 3-cyano-4-phenyl-pyrrol-derivate |
| DE3800387A1 (de) * | 1988-01-09 | 1989-07-20 | Bayer Ag | Verfahren zur herstellung von 3-cyano-4-aryl-pyrrolen |
| US5420301A (en) * | 1988-03-18 | 1995-05-30 | Ciba-Geigy Corporation | Process for the preparation of substituted difluorobenzo-1,3-dioxoles |
| US5194628A (en) * | 1988-03-18 | 1993-03-16 | Ciba-Geigy Corporation | Process for the preparation of substituted difluorobenzo-1,3-dioxoles |
| DE3814479A1 (de) * | 1988-04-29 | 1989-11-09 | Bayer Ag | 3-cyano-4-phenyl-pyrrol-derivate, verfahren zu ihrer herstellung und ihre verwendung in schaedlingsbekaempfungsmitteln |
| DE3814478A1 (de) * | 1988-04-29 | 1989-11-09 | Bayer Ag | 3-cyano-4-phenyl-pyrrole, verfahren zu ihrer herstellung und ihre verwendung in schaedlingsbekaempfungsmitteln |
| ES2054087T3 (es) * | 1988-08-04 | 1994-08-01 | Ciba Geigy Ag | Productos microbicidas. |
| EP0358047A3 (en) * | 1988-09-08 | 1991-05-29 | American Cyanamid Company | Method of controlling phytopathogenic fungi |
| EP0386681A1 (de) * | 1989-03-08 | 1990-09-12 | Ciba-Geigy Ag | 3-Aryl-4-cyano-pyrrol-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende mikrobiozide Mittel |
| DE4128132A1 (de) * | 1991-08-24 | 1993-02-25 | Bayer Ag | 3-(2-chlor-3-trifluormethylphenyl)-4-cyanopyrrol, dessen herstellung und verwendung und neue zwischenprodukte |
| US5234943A (en) * | 1989-04-13 | 1993-08-10 | Bayer Aktiengesellschaft | Fungicidal 3-(2-chloro-3-trifluoromethylphenyl)-4-cyanopyrrole |
| DE3912156A1 (de) * | 1989-04-13 | 1990-10-25 | Bayer Ag | 3-cyano-4-phenyl-pyrrol-derivate |
| US4940720A (en) * | 1989-08-02 | 1990-07-10 | Ciba-Geigy Corporation | Microbicidal compositions |
| ZA914221B (en) | 1990-06-05 | 1992-03-25 | Ciba Geigy | Aromatic compounds |
| US6204397B1 (en) | 1991-03-08 | 2001-03-20 | Bayer Aktiengesellschaft | Process for the preparation of 3-substituted 4-cyano-pyrrole compounds |
| DE4107398A1 (de) * | 1991-03-08 | 1992-11-05 | Bayer Ag | Verfahren zur herstellung von in 3-stellung substituierten 4-cyano-pyrrolverbindungen |
| MD24B1 (ro) * | 1991-07-09 | 1994-05-31 | Parfumerii Si Cosmetice Vioric | Compozitie de substante odorante |
| US5342980A (en) | 1992-12-30 | 1994-08-30 | American Cyanamid Company | Fungicidal agents |
| UA39100C2 (uk) * | 1993-06-28 | 2001-06-15 | Новартіс Аг | Бактерицидний засіб для рослин, спосіб боротьби з грибковими захворюваннями рослин та рослинний матеріал для розмноження |
| US5519026A (en) * | 1994-06-27 | 1996-05-21 | Ciba-Geigy Corporation | Microbicides |
| US5616041A (en) * | 1995-01-17 | 1997-04-01 | Heyco Stamped Products, Inc. | Female connector for a plastic molded receptacle and an extension cord |
| US6011155A (en) * | 1996-11-07 | 2000-01-04 | Novartis Ag | N-(substituted glycyl)-2-cyanopyrrolidines, pharmaceutical compositions containing them and their use in inhibiting dipeptidyl peptidase-IV |
| CN104094937B (zh) * | 2014-06-25 | 2016-09-14 | 广东中迅农科股份有限公司 | 一种含有氟菌唑和咯菌腈的杀菌组合物 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL23184A (en) * | 1964-03-25 | 1968-11-27 | Fujisawa Pharmaceutical Co | New antibiotic substance designated as pyrrolnitrin and production thereof |
| FR1441892A (fr) * | 1964-07-09 | 1966-06-10 | Fujisawa Pharmaceutical Co | Dérivés du phényl-3-pyrrole et procédé d'obtention |
| GB1283452A (en) * | 1970-07-24 | 1972-07-26 | Parke Davis & Co | Substituted 1,3-dialkylpyrrolidines and processes for their production |
-
1978
- 1978-07-10 JP JP8367178A patent/JPS5511524A/ja active Granted
-
1979
- 1979-07-05 GB GB7923420A patent/GB2024824B/en not_active Expired
- 1979-07-05 NZ NZ190921A patent/NZ190921A/xx unknown
- 1979-07-06 US US06/055,321 patent/US4229465A/en not_active Expired - Lifetime
- 1979-07-06 DE DE2927480A patent/DE2927480C2/de not_active Expired
- 1979-07-06 FR FR7917609A patent/FR2430940A1/fr active Granted
- 1979-07-09 NL NL7905348A patent/NL7905348A/nl not_active Application Discontinuation
- 1979-07-09 AU AU48786/79A patent/AU514270B2/en not_active Ceased
- 1979-07-09 BR BR7904350A patent/BR7904350A/pt unknown
- 1979-07-09 SU SU792788553A patent/SU1083895A3/ru active
- 1979-07-09 CA CA331,371A patent/CA1113476A/en not_active Expired
- 1979-07-10 AR AR277239A patent/AR222179A1/es active
- 1979-07-10 HU HU79NI228A patent/HU178663B/hu not_active IP Right Cessation
- 1979-07-10 PL PL1979216997A patent/PL117605B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2430940A1 (fr) | 1980-02-08 |
| HU178663B (en) | 1982-06-28 |
| FR2430940B1 (enExample) | 1984-03-30 |
| PL117605B1 (en) | 1981-08-31 |
| DE2927480C2 (de) | 1982-06-03 |
| US4229465A (en) | 1980-10-21 |
| NL7905348A (nl) | 1980-01-14 |
| GB2024824B (en) | 1982-10-27 |
| SU1083895A3 (ru) | 1984-03-30 |
| AR222179A1 (es) | 1981-04-30 |
| BR7904350A (pt) | 1980-04-08 |
| GB2024824A (en) | 1980-01-16 |
| AU514270B2 (en) | 1981-01-29 |
| PL216997A1 (enExample) | 1980-06-02 |
| AU4878679A (en) | 1980-02-07 |
| JPS5511524A (en) | 1980-01-26 |
| DE2927480A1 (de) | 1980-01-24 |
| JPS6129338B2 (enExample) | 1986-07-05 |
| CA1113476A (en) | 1981-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NZ190921A (en) | 1-acetyl-3-cyano-4-phenyl-pyrroles and fungicidal compositions | |
| ZA796465B (en) | Compounds and compositions | |
| GB2022416B (en) | Microbicidal compositions | |
| NZ195006A (en) | 2-carbonyloxy-3fluromethyl-1-phenoxy-1-triazolyl-butanes and fungicidal compositions | |
| GB2026867B (en) | Algicidal compositions | |
| GB2022601B (en) | Sulphonato-organosilanol compounds and compositions | |
| NZ189584A (en) | N-azolylalkyl-haloacetanilides and herbicidal compositions | |
| NZ191565A (en) | N-benzyl-haloacetamides and herbicidal compositions | |
| NZ191947A (en) | Substituted n-propargyl-anilides and fungicidal compositions | |
| NZ189317A (en) | Carbamoyl-triazolyl-o n-acetals and fungicidal compositions | |
| ZA79338B (en) | Microbicidal compositions | |
| KE3426A (en) | Etomidate-containing compositions | |
| NZ191774A (en) | 2-( -phenoxyalkyl)-imidazolines and miticidal compositions | |
| NZ190602A (en) | Substituted benzoylimidates and insecticidal compositions | |
| ZA794439B (en) | Pesticidal compositions and their use | |
| DE2960289D1 (en) | Fungicidal compositions | |
| NZ193909A (en) | N-oximinoalkyl-anilides and fungicidal compositions | |
| ZA793681B (en) | Insecticidal compositions | |
| ZA79337B (en) | Microbicidal compositions | |
| ZA795727B (en) | Microbicidal composition | |
| ZA793302B (en) | Fasciolicidal compositions | |
| PT69225A (en) | Compositions | |
| NZ189386A (en) | 3-phenyl-pyrrole derivatives and fungicidal compositions | |
| EG13669A (en) | Microbicidal composition | |
| JPS54132233A (en) | Fungicide composition |