CA1102336A - Process for preparing d,1-m,p-dipivalylepinephrine hydrochloride and hydrochloride salts of related sympathomimetically-active catecholamines using cesium chloride reactant - Google Patents
Process for preparing d,1-m,p-dipivalylepinephrine hydrochloride and hydrochloride salts of related sympathomimetically-active catecholamines using cesium chloride reactantInfo
- Publication number
- CA1102336A CA1102336A CA282,259A CA282259A CA1102336A CA 1102336 A CA1102336 A CA 1102336A CA 282259 A CA282259 A CA 282259A CA 1102336 A CA1102336 A CA 1102336A
- Authority
- CA
- Canada
- Prior art keywords
- hydrochloride
- carbon atoms
- formula
- followed
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- AIYUHDOJVYHVIT-UHFFFAOYSA-M caesium chloride Chemical compound [Cl-].[Cs+] AIYUHDOJVYHVIT-UHFFFAOYSA-M 0.000 title claims abstract description 15
- 239000000376 reactant Substances 0.000 title description 3
- 150000003943 catecholamines Chemical class 0.000 title description 2
- 238000004519 manufacturing process Methods 0.000 title description 2
- 150000003840 hydrochlorides Chemical class 0.000 title 1
- -1 naphthalenecarbonyl Chemical group 0.000 claims abstract description 79
- 238000000034 method Methods 0.000 claims abstract description 29
- 150000001875 compounds Chemical class 0.000 claims abstract description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 25
- 125000002252 acyl group Chemical group 0.000 claims abstract description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 5
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 4
- 125000005236 alkanoylamino group Chemical group 0.000 claims abstract description 3
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 3
- 125000004663 dialkyl amino group Chemical group 0.000 claims abstract description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 3
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 claims abstract 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 33
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 24
- CSRRBDMYOUQTCO-UHFFFAOYSA-N [2-(3,4-dihydroxyphenyl)-2-oxoethyl]-methylazanium;chloride Chemical compound Cl.CNCC(=O)C1=CC=C(O)C(O)=C1 CSRRBDMYOUQTCO-UHFFFAOYSA-N 0.000 claims description 12
- 229960005151 adrenalone hydrochloride Drugs 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 238000005984 hydrogenation reaction Methods 0.000 claims description 10
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 6
- 150000001450 anions Chemical class 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 6
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical group CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 claims description 4
- 229910019020 PtO2 Inorganic materials 0.000 claims description 4
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 claims description 4
- 239000003610 charcoal Substances 0.000 claims description 4
- 239000003638 chemical reducing agent Substances 0.000 claims description 4
- 230000003197 catalytic effect Effects 0.000 claims description 3
- 150000002576 ketones Chemical class 0.000 claims description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Chemical compound [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 claims description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims description 2
- 229910001914 chlorine tetroxide Inorganic materials 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 230000000875 corresponding effect Effects 0.000 claims 6
- 239000007858 starting material Substances 0.000 claims 6
- 229910010084 LiAlH4 Inorganic materials 0.000 claims 3
- 239000012280 lithium aluminium hydride Substances 0.000 claims 3
- 239000002253 acid Substances 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 239000012442 inert solvent Substances 0.000 claims 1
- 125000001589 carboacyl group Chemical group 0.000 abstract description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 abstract description 2
- 241001465754 Metazoa Species 0.000 abstract description 2
- 125000001475 halogen functional group Chemical group 0.000 abstract description 2
- 230000001975 sympathomimetic effect Effects 0.000 abstract 2
- 206010027646 Miosis Diseases 0.000 abstract 1
- 208000006550 Mydriasis Diseases 0.000 abstract 1
- 239000000150 Sympathomimetic Substances 0.000 abstract 1
- 230000007883 bronchodilation Effects 0.000 abstract 1
- 230000004410 intraocular pressure Effects 0.000 abstract 1
- 230000003547 miosis Effects 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 238000001914 filtration Methods 0.000 description 6
- UCTWMZQNUQWSLP-VIFPVBQESA-N (R)-adrenaline Chemical compound CNC[C@H](O)C1=CC=C(O)C(O)=C1 UCTWMZQNUQWSLP-VIFPVBQESA-N 0.000 description 5
- FQTFHMSZCSUVEU-QRPNPIFTSA-N 4-[(1r)-2-amino-1-hydroxyethyl]benzene-1,2-diol;hydrochloride Chemical compound Cl.NC[C@H](O)C1=CC=C(O)C(O)=C1 FQTFHMSZCSUVEU-QRPNPIFTSA-N 0.000 description 5
- IROWCYIEJAOFOW-UHFFFAOYSA-N DL-Isoprenaline hydrochloride Chemical compound Cl.CC(C)NCC(O)C1=CC=C(O)C(O)=C1 IROWCYIEJAOFOW-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 229960003072 epinephrine hydrochloride Drugs 0.000 description 5
- 229940018448 isoproterenol hydrochloride Drugs 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 238000002845 discoloration Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 101150041968 CDC13 gene Proteins 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- WKDKOOITVYKILI-UHFFFAOYSA-M caesium perchlorate Chemical compound [Cs+].[O-]Cl(=O)(=O)=O WKDKOOITVYKILI-UHFFFAOYSA-M 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- 125000002379 2-iodobenzoyl group Chemical group IC1=C(C(=O)*)C=CC=C1 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 208000010412 Glaucoma Diseases 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- RZKYEQDPDZUERB-UHFFFAOYSA-N Pindone Chemical group C1=CC=C2C(=O)C(C(=O)C(C)(C)C)C(=O)C2=C1 RZKYEQDPDZUERB-UHFFFAOYSA-N 0.000 description 1
- 206010039085 Rhinitis allergic Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 229960002892 adrenalone Drugs 0.000 description 1
- PZMVOUYYNKPMSI-UHFFFAOYSA-N adrenalone Chemical compound CNCC(=O)C1=CC=C(O)C(O)=C1 PZMVOUYYNKPMSI-UHFFFAOYSA-N 0.000 description 1
- 201000010105 allergic rhinitis Diseases 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000003910 behenoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-M chlorate Inorganic materials [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 1
- 150000003841 chloride salts Chemical group 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- NKLCHDQGUHMCGL-UHFFFAOYSA-N cyclohexylidenemethanone Chemical group O=C=C1CCCCC1 NKLCHDQGUHMCGL-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000004005 formimidoyl group Chemical group [H]\N=C(/[H])* 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 208000030603 inherited susceptibility to asthma Diseases 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 238000003541 multi-stage reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- NQLVQOSNDJXLKG-UHFFFAOYSA-N prosulfocarb Chemical compound CCCN(CCC)C(=O)SCC1=CC=CC=C1 NQLVQOSNDJXLKG-UHFFFAOYSA-N 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/10—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C323/18—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and singly-bound oxygen atoms bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
- C07C323/20—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and singly-bound oxygen atoms bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton with singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/02—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton by reactions involving the formation of amino groups from compounds containing hydroxy groups or etherified or esterified hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/08—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton by reactions not involving the formation of amino groups, hydroxy groups or etherified or esterified hydroxy groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US703,943 | 1976-07-09 | ||
| US05/703,943 US4035405A (en) | 1976-07-09 | 1976-07-09 | Novel synthesis for preparing the hydrochloride salt of selected catecholamine derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1102336A true CA1102336A (en) | 1981-06-02 |
Family
ID=24827413
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA282,259A Expired CA1102336A (en) | 1976-07-09 | 1977-07-07 | Process for preparing d,1-m,p-dipivalylepinephrine hydrochloride and hydrochloride salts of related sympathomimetically-active catecholamines using cesium chloride reactant |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4035405A (enExample) |
| JP (2) | JPS539729A (enExample) |
| AU (1) | AU510701B2 (enExample) |
| CA (1) | CA1102336A (enExample) |
| DE (1) | DE2730200C2 (enExample) |
| FR (1) | FR2357527A1 (enExample) |
| GB (1) | GB1561013A (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5185710A (en) * | 1974-12-27 | 1976-07-27 | Matsushita Electric Industrial Co Ltd | Jikihetsudonoseizoho |
| US4275219A (en) * | 1979-09-24 | 1981-06-23 | Interx Research Corporation | Novel process and intermediates useful in the preparation of sympathomimetic amines |
| DE3163114D1 (en) * | 1980-07-09 | 1984-05-17 | Draco Ab | Therapeutically active derivatives of phenylethanol amines |
| FI61474C (fi) * | 1981-03-06 | 1982-08-10 | Star Oy Ab | Foerfarande foer framstaellning av syraadditionssalter av 3,4-diacyloxi-alfa-((metylamino)-metyl)-bensylalkohol |
| DE3173866D1 (en) * | 1981-06-18 | 1986-04-03 | Maurice E Langham | Compounds and compositions for treatment of ocular hypertension |
| IT1229846B (it) * | 1989-04-20 | 1991-09-13 | Simes | Esteri di catecolammine. |
| JP2802456B2 (ja) | 1991-08-06 | 1998-09-24 | 住化ファインケム株式会社 | カテコラミン誘導体塩酸塩の製造方法 |
| US11690825B2 (en) | 2016-03-09 | 2023-07-04 | Board Of Regents, The University Of Texas System | 20-HETE receptor (GPR75) antagonists and methods of use |
| CN111565716B (zh) | 2017-09-08 | 2023-06-09 | 因斯格尼斯疗法有限公司 | 使用地匹福林的方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3904671A (en) * | 1969-04-01 | 1975-09-09 | Sterling Drug Inc | Esters of 3-(hydroxy or hydroxymethyl)-4-hydroxyphenyl aminomethyl ketones |
| US3809714A (en) * | 1972-08-31 | 1974-05-07 | Interx Research Corp | Novel ester of ((methylamino)methyl) benzyl alcohol |
-
1976
- 1976-07-09 US US05/703,943 patent/US4035405A/en not_active Expired - Lifetime
-
1977
- 1977-06-30 JP JP7726577A patent/JPS539729A/ja active Granted
- 1977-07-04 DE DE2730200A patent/DE2730200C2/de not_active Expired
- 1977-07-07 CA CA282,259A patent/CA1102336A/en not_active Expired
- 1977-07-08 GB GB28789/77A patent/GB1561013A/en not_active Expired
- 1977-07-08 FR FR7721171A patent/FR2357527A1/fr active Granted
- 1977-07-11 AU AU26913/77A patent/AU510701B2/en not_active Expired
-
1985
- 1985-03-13 JP JP60048434A patent/JPS60214765A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6147820B2 (enExample) | 1986-10-21 |
| US4035405A (en) | 1977-07-12 |
| JPS6338344B2 (enExample) | 1988-07-29 |
| AU510701B2 (en) | 1980-07-10 |
| FR2357527A1 (fr) | 1978-02-03 |
| JPS60214765A (ja) | 1985-10-28 |
| DE2730200C2 (de) | 1986-08-21 |
| AU2691377A (en) | 1979-01-18 |
| GB1561013A (en) | 1980-02-13 |
| JPS539729A (en) | 1978-01-28 |
| FR2357527B3 (enExample) | 1980-05-16 |
| DE2730200A1 (de) | 1978-01-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US11643391B2 (en) | Prodrugs and conjugates of dimethyltryptamine | |
| DE69115379T2 (de) | Neue arylethenylenderivate und verfahren zu ihrer herstellung | |
| DE69415445T2 (de) | Zytotoxische Stilben-Derivate und diese enthaltende pharmazeutische Zusammensetzungen | |
| ES2208698T3 (es) | Derivados de imidazol. | |
| CA1102336A (en) | Process for preparing d,1-m,p-dipivalylepinephrine hydrochloride and hydrochloride salts of related sympathomimetically-active catecholamines using cesium chloride reactant | |
| NZ219241A (en) | Pyridine derivatives and pharmaceutical compositions | |
| CZ657890A3 (cs) | Chromanový derivát, způsob jeho výroby a farmaceutický prostředek s jeho obsahem | |
| JPS5874666A (ja) | アルカノイルアニリド酸 | |
| DE69528229T2 (de) | N-substituierte beta-aryl und beta-heteroaryl-alpha-cyamoacrylamidderivate als tyrosine kinase inhibitoren | |
| TW408117B (en) | Use of N-substituted phenothiazines | |
| FI86175B (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara fenolderivat. | |
| DE69202120T2 (de) | Harnstoffderivate, ihre Herstellung und ihre Verwendung bei der Therapie. | |
| AU2001254997A1 (en) | A pyridine-1-oxide derivative, and process for its transformation into pharmaceutically effective compounds | |
| FI77224C (fi) | Foerfarande foer framstaellning av nya, terapeutiskt anvaendbara aminopropanolderivat av 2-hydroxi- -fenylpropiofenoner. | |
| EP0144853B1 (en) | Semicarbazide derivatives, processes for preparation thereof and pharmaceutical composition comprising the same | |
| CN108884054A (zh) | 用于治疗增殖性疾病的化合物 | |
| US4727079A (en) | Brain-specific dopaminergic activity involving dihydropyridine carboxamides, dihydroquinoline and isoquinoline carboxamides | |
| JP2931986B2 (ja) | アラルキルアミン誘導体 | |
| CA2140781C (en) | Pharmocologically active .alpha.-¬tertiary-aminomethyl|- benzenemethanol derivatives | |
| Da Re et al. | . beta.-Adrenergic blocking agents of the chromone and xanthone groups. II. Propanolol type derivatives | |
| US4098884A (en) | Doxorubicin thioesters | |
| IE922391A1 (en) | Dimethylacetoacetamides, process for their preparation and¹pharmaceuticals | |
| JP2019518757A (ja) | 安息香酸リチウムの共結晶及びその使用 | |
| DE2656678C2 (de) | 4-Amino-trans-decahydrochinolin-Derivate und Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Zusammensetzungen | |
| US4539331A (en) | Imidazole carboxamide derivatives and pharmaceutical compositions thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |