CA1074981A - Stabilized red phosphorus and process for making it - Google Patents
Stabilized red phosphorus and process for making itInfo
- Publication number
- CA1074981A CA1074981A CA279,641A CA279641A CA1074981A CA 1074981 A CA1074981 A CA 1074981A CA 279641 A CA279641 A CA 279641A CA 1074981 A CA1074981 A CA 1074981A
- Authority
- CA
- Canada
- Prior art keywords
- red phosphorus
- phosphonic acid
- metal compound
- calcium
- aluminum
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 title claims abstract description 67
- 238000000034 method Methods 0.000 title claims abstract description 28
- 230000003647 oxidation Effects 0.000 claims abstract description 25
- 238000007254 oxidation reaction Methods 0.000 claims abstract description 25
- 239000000203 mixture Substances 0.000 claims abstract description 15
- 150000002736 metal compounds Chemical class 0.000 claims abstract description 14
- 239000002245 particle Substances 0.000 claims abstract description 14
- 239000011575 calcium Substances 0.000 claims abstract description 10
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims abstract description 9
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 9
- 229910052791 calcium Inorganic materials 0.000 claims abstract description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 9
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 9
- 239000003381 stabilizer Substances 0.000 claims abstract description 9
- 150000003751 zinc Chemical class 0.000 claims abstract description 9
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims abstract description 8
- 239000011777 magnesium Substances 0.000 claims abstract description 8
- 229910052749 magnesium Inorganic materials 0.000 claims abstract description 8
- 229910052782 aluminium Inorganic materials 0.000 claims abstract description 7
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims abstract description 7
- 230000000737 periodic effect Effects 0.000 claims abstract description 5
- 239000007900 aqueous suspension Substances 0.000 claims description 20
- 239000000725 suspension Substances 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- NSETWVJZUWGCKE-UHFFFAOYSA-N propylphosphonic acid Chemical compound CCCP(O)(O)=O NSETWVJZUWGCKE-UHFFFAOYSA-N 0.000 claims description 4
- RXXCIBALSKQCAE-UHFFFAOYSA-N 3-methylbutoxymethylbenzene Chemical compound CC(C)CCOCC1=CC=CC=C1 RXXCIBALSKQCAE-UHFFFAOYSA-N 0.000 claims description 3
- 229910000329 aluminium sulfate Inorganic materials 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 3
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 claims description 3
- SNRUBQQJIBEYMU-UHFFFAOYSA-N dodecane Chemical compound CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 claims description 3
- 238000001914 filtration Methods 0.000 claims description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 claims description 3
- -1 vinyl- Chemical group 0.000 claims description 3
- 229910000368 zinc sulfate Inorganic materials 0.000 claims description 3
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 claims description 2
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical group [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 claims description 2
- 238000001035 drying Methods 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 238000002156 mixing Methods 0.000 claims description 2
- 238000001556 precipitation Methods 0.000 claims description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 claims 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 claims 2
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 claims 2
- 235000011128 aluminium sulphate Nutrition 0.000 claims 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 claims 1
- IIRVGTWONXBBAW-UHFFFAOYSA-M disodium;dioxido(oxo)phosphanium Chemical compound [Na+].[Na+].[O-][P+]([O-])=O IIRVGTWONXBBAW-UHFFFAOYSA-M 0.000 claims 1
- 235000019341 magnesium sulphate Nutrition 0.000 claims 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 claims 1
- 239000011686 zinc sulphate Substances 0.000 claims 1
- 235000009529 zinc sulphate Nutrition 0.000 claims 1
- 229910052698 phosphorus Inorganic materials 0.000 description 12
- 239000011574 phosphorus Substances 0.000 description 12
- 235000014786 phosphorus Nutrition 0.000 description 12
- 239000000243 solution Substances 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229940116254 phosphonic acid Drugs 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000013019 agitation Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- NJGCRMAPOWGWMW-UHFFFAOYSA-N octylphosphonic acid Chemical compound CCCCCCCCP(O)(O)=O NJGCRMAPOWGWMW-UHFFFAOYSA-N 0.000 description 3
- 230000000087 stabilizing effect Effects 0.000 description 3
- UDPGUMQDCGORJQ-UHFFFAOYSA-N (2-chloroethyl)phosphonic acid Chemical compound OP(O)(=O)CCCl UDPGUMQDCGORJQ-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- FBSFTJQYCLLGKH-UHFFFAOYSA-N cyclohexylphosphonic acid Chemical compound OP(O)(=O)C1CCCCC1 FBSFTJQYCLLGKH-UHFFFAOYSA-N 0.000 description 2
- 238000007323 disproportionation reaction Methods 0.000 description 2
- SVMUEEINWGBIPD-UHFFFAOYSA-N dodecylphosphonic acid Chemical compound CCCCCCCCCCCCP(O)(O)=O SVMUEEINWGBIPD-UHFFFAOYSA-N 0.000 description 2
- 238000005755 formation reaction Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 150000003007 phosphonic acid derivatives Chemical class 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- ZTWTYVWXUKTLCP-UHFFFAOYSA-N vinylphosphonic acid Chemical group OP(O)(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-N 0.000 description 2
- FNZSVEHJZREFPF-SSDOTTSWSA-N (2r)-2-pentylbutanedioic acid Chemical class CCCCC[C@@H](C(O)=O)CC(O)=O FNZSVEHJZREFPF-SSDOTTSWSA-N 0.000 description 1
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- NLBSQHGCGGFVJW-UHFFFAOYSA-N 2-carboxyethylphosphonic acid Chemical compound OC(=O)CCP(O)(O)=O NLBSQHGCGGFVJW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- QLZHNIAADXEJJP-UHFFFAOYSA-N Phenylphosphonic acid Chemical compound OP(O)(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 238000004380 ashing Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 229940000425 combination drug Drugs 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 229940042400 direct acting antivirals phosphonic acid derivative Drugs 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 150000004715 keto acids Chemical class 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 229910001388 sodium aluminate Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006557 surface reaction Methods 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 229940007718 zinc hydroxide Drugs 0.000 description 1
- 229910021511 zinc hydroxide Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B25/00—Phosphorus; Compounds thereof
- C01B25/003—Phosphorus
- C01B25/006—Stabilisation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Fireproofing Substances (AREA)
- Colloid Chemistry (AREA)
- Compounds Of Alkaline-Earth Elements, Aluminum Or Rare-Earth Metals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2632296A DE2632296C2 (de) | 1976-07-17 | 1976-07-17 | Stabilisierter roter Phosphor sowie Verfahren zu seiner Herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1074981A true CA1074981A (en) | 1980-04-08 |
Family
ID=5983302
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA279,641A Expired CA1074981A (en) | 1976-07-17 | 1977-06-01 | Stabilized red phosphorus and process for making it |
Country Status (10)
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2813151A1 (de) * | 1978-03-25 | 1979-09-27 | Hoechst Ag | Stabilisierter roter phosphor |
| US4163682A (en) * | 1978-10-05 | 1979-08-07 | The United States Of America As Represented By The Secretary Of The Navy | Method for disposing of red phosphorus composition |
| DE2945118C2 (de) * | 1979-11-08 | 1981-12-03 | Hoechst Ag, 6000 Frankfurt | Stabilisierter roter Phosphor sowie Verfahren zu seiner Herstellung |
| CA1178788A (en) * | 1982-06-29 | 1984-12-04 | Erco Industries Limited | Stabilization of red phosphorus |
| DE3342640C2 (de) * | 1983-11-25 | 1987-01-02 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Herstellung von eisenarmen rotem Phosphor |
| GB8611357D0 (en) * | 1986-05-09 | 1986-06-18 | Ciba Geigy Ag | Flame retardent polymer compositions |
| DE3710170A1 (de) * | 1987-03-27 | 1988-10-13 | Hoechst Ag | Stabilisierter roter phosphor sowie verfahren zu seiner herstellung |
| US4841865A (en) * | 1987-06-17 | 1989-06-27 | Her Majesty The Queen In Right Of Canada, As Represented By The Minister Of National Defence | Smoke composition and method of making same |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1433100A (en) * | 1921-12-22 | 1922-10-24 | Essex Specialty Co Inc | Phosphorus compound |
| US2132996A (en) * | 1936-02-12 | 1938-10-11 | Samuel D Ehrlich | Ignition and priming compound |
| US2399120A (en) * | 1941-02-24 | 1946-04-23 | Rohm & Haas | Stable red phosphorus |
| US2635953A (en) * | 1947-10-08 | 1953-04-21 | Martin S Silverstein | Inflammable compositions including red phosphorus |
| DE1567629B1 (de) * | 1966-06-24 | 1970-05-27 | Knapsack Ag | Verfahren zum Impraegnieren von rotem Phosphor |
| DE2249638B2 (de) * | 1972-10-11 | 1981-01-15 | Hoechst Ag, 6000 Frankfurt | Phlegmatisierter roter Phosphor |
-
1976
- 1976-07-17 DE DE2632296A patent/DE2632296C2/de not_active Expired
-
1977
- 1977-05-27 GB GB22500/77A patent/GB1519929A/en not_active Expired
- 1977-06-01 CA CA279,641A patent/CA1074981A/en not_active Expired
- 1977-06-03 IN IN834/CAL/77A patent/IN146212B/en unknown
- 1977-06-15 DD DD7700199506A patent/DD131742A5/xx unknown
- 1977-07-13 US US05/815,160 patent/US4113841A/en not_active Expired - Lifetime
- 1977-07-14 SE SE7708205A patent/SE416540B/xx not_active IP Right Cessation
- 1977-07-15 JP JP52084926A patent/JPS6037043B2/ja not_active Expired
- 1977-07-15 SU SU772503099A patent/SU999962A3/ru active
- 1977-07-15 IT IT50310/77A patent/IT1079788B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| DE2632296C2 (de) | 1979-02-01 |
| JPS5311193A (en) | 1978-02-01 |
| SE416540B (sv) | 1981-01-19 |
| IN146212B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1979-03-24 |
| DD131742A5 (de) | 1978-07-19 |
| IT1079788B (it) | 1985-05-13 |
| GB1519929A (en) | 1978-08-02 |
| DE2632296A1 (de) | 1978-01-19 |
| DE2632296B1 (de) | 1978-06-01 |
| JPS6037043B2 (ja) | 1985-08-23 |
| SE7708205L (sv) | 1978-01-18 |
| SU999962A3 (ru) | 1983-02-23 |
| US4113841A (en) | 1978-09-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1074981A (en) | Stabilized red phosphorus and process for making it | |
| US4315897A (en) | Stabilized red phosphorus and process for its manufacture | |
| CA1334621C (en) | Stabilized red phosphorus and process for making it | |
| US4210630A (en) | Stabilized red phosphorus | |
| US4136154A (en) | Stabilized red phosphorus and process for making it | |
| US4115522A (en) | Stabilized red phosphorus and process for making it | |
| FI73402B (fi) | Foerfarande foer framstaellning av basiskt aluminium(iii)sulfat. | |
| US4404169A (en) | Process for producing cupric hydroxide | |
| EP0308175B1 (en) | Stripping and recovery of dichromate in electrolytic chlorate systems | |
| AU6570000A (en) | Method for preparing highly stabilised hydroxylamine solutions | |
| EP0113153B1 (en) | A process for the manufacture of highly pure trimagnesium phosphate octahydrate | |
| CA1075439A (en) | Stabilized red phosphorus and process for making it | |
| US3993735A (en) | Cleanup of wet process phosphoric acid | |
| CZ291133B6 (cs) | Způsob odstraňování N-fosfonomethylglycinu z vodné směsi | |
| US5093199A (en) | Stabilized red phosphorus | |
| EP1034136A1 (en) | Treatment of a solution containing iron salts | |
| US2385188A (en) | Process for making alkali metal ferric pyrophosphate | |
| CA1261586A (en) | Sodium tripolyphosphate manufacture | |
| US3356448A (en) | Method of preparing dicalcium phosphate substantially free from f, fe, and al impurities | |
| EP0246761A1 (en) | Preparation of high purity zirconia and zirconia mixtures from zirconium carbonate | |
| RU2051104C1 (ru) | Способ получения хлорокиси меди | |
| SU833291A1 (ru) | Раствор дл нейтрализации серово-дОРОдА | |
| JPS61141607A (ja) | 燐酸溶液からの脱砒素化法 | |
| SU1701627A1 (ru) | Способ получени стабилизированного порошкообразного красного фосфора | |
| US3652210A (en) | Dearsenication of phosphate rock |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |