CA1063119A - Process for preparing substituted thioureas and guanidines - Google Patents
Process for preparing substituted thioureas and guanidinesInfo
- Publication number
- CA1063119A CA1063119A CA233,788A CA233788A CA1063119A CA 1063119 A CA1063119 A CA 1063119A CA 233788 A CA233788 A CA 233788A CA 1063119 A CA1063119 A CA 1063119A
- Authority
- CA
- Canada
- Prior art keywords
- methyl
- ethyl
- methylthio
- cyano
- guanidine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 15
- 150000002357 guanidines Chemical class 0.000 title 1
- 150000003585 thioureas Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 28
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 8
- 239000005864 Sulphur Substances 0.000 claims abstract description 8
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 8
- 239000001257 hydrogen Substances 0.000 claims abstract description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 5
- 238000002360 preparation method Methods 0.000 claims abstract description 4
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims abstract description 3
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims description 40
- 238000000034 method Methods 0.000 claims description 34
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims description 20
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims description 20
- -1 trifluoroacetoxy Chemical group 0.000 claims description 15
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- AQIXAKUUQRKLND-UHFFFAOYSA-N cimetidine Chemical compound N#C/N=C(/NC)NCCSCC=1N=CNC=1C AQIXAKUUQRKLND-UHFFFAOYSA-N 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- PDWPOXKSTFGRIT-UHFFFAOYSA-N 4-(chloromethyl)-5-methyl-1h-imidazole;hydrochloride Chemical compound Cl.CC=1NC=NC=1CCl PDWPOXKSTFGRIT-UHFFFAOYSA-N 0.000 claims description 3
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 claims description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 3
- OPBJASQANXTUFX-UHFFFAOYSA-N 2-sulfanylethylthiourea Chemical compound NC(=S)NCCS OPBJASQANXTUFX-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000002883 imidazolyl group Chemical group 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 150000003852 triazoles Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- UGUHFDPGDQDVGX-UHFFFAOYSA-N 1,2,3-thiadiazole Chemical group C1=CSN=N1 UGUHFDPGDQDVGX-UHFFFAOYSA-N 0.000 claims 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 3
- 230000027119 gastric acid secretion Effects 0.000 abstract description 2
- 239000003485 histamine H2 receptor antagonist Substances 0.000 abstract description 2
- 239000003112 inhibitor Substances 0.000 abstract description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 30
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 15
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- AAJNJQHTYWDEBU-UHFFFAOYSA-N 1-butyl-3-[2-[(5-methyl-1h-imidazol-4-yl)methylsulfanyl]ethyl]thiourea Chemical compound CCCCNC(=S)NCCSCC=1N=CNC=1C AAJNJQHTYWDEBU-UHFFFAOYSA-N 0.000 description 8
- MNOCTFZHUCINGC-UHFFFAOYSA-N 3-chloro-2-(chloromethyl)pyridine Chemical compound ClCC1=NC=CC=C1Cl MNOCTFZHUCINGC-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- YSLWEGFJMBMNGN-UHFFFAOYSA-N 1-cyano-2-methyl-3-[2-(1h-1,2,4-triazol-5-ylmethylsulfanyl)ethyl]guanidine Chemical compound N#CNC(=NC)NCCSCC1=NC=NN1 YSLWEGFJMBMNGN-UHFFFAOYSA-N 0.000 description 5
- UGHWFYKQWZHCHK-UHFFFAOYSA-N 2-(chloromethyl)-1h-imidazole Chemical compound ClCC1=NC=CN1 UGHWFYKQWZHCHK-UHFFFAOYSA-N 0.000 description 5
- MKFCBJOVMMLPRT-UHFFFAOYSA-N 3-(chloromethyl)-1,2-oxazole Chemical compound ClCC=1C=CON=1 MKFCBJOVMMLPRT-UHFFFAOYSA-N 0.000 description 5
- VJLLMWSPBFVMGO-UHFFFAOYSA-N 3-(chloromethyl)-1,2-thiazole Chemical compound ClCC=1C=CSN=1 VJLLMWSPBFVMGO-UHFFFAOYSA-N 0.000 description 5
- PDUVPBCMEMJQGB-UHFFFAOYSA-N 5-(chloromethyl)-1,3,4-thiadiazol-2-amine Chemical compound NC1=NN=C(CCl)S1 PDUVPBCMEMJQGB-UHFFFAOYSA-N 0.000 description 5
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 5
- 238000006467 substitution reaction Methods 0.000 description 5
- ZORWZOOZJGMSTE-UHFFFAOYSA-N 1-cyano-2-methyl-3-(2-sulfanylethyl)guanidine Chemical compound N#CNC(=NC)NCCS ZORWZOOZJGMSTE-UHFFFAOYSA-N 0.000 description 4
- ZHAKAIBZKYHXJS-UHFFFAOYSA-N 2-(chloromethyl)-1,3-thiazole Chemical compound ClCC1=NC=CS1 ZHAKAIBZKYHXJS-UHFFFAOYSA-N 0.000 description 4
- YRQHBXNPVQOISM-UHFFFAOYSA-N 2-(chloromethyl)-3-methylpyridine Chemical compound CC1=CC=CN=C1CCl YRQHBXNPVQOISM-UHFFFAOYSA-N 0.000 description 4
- UMQUDSSPLPWFMX-UHFFFAOYSA-N 2-(chloromethyl)pyridin-3-ol Chemical compound OC1=CC=CN=C1CCl UMQUDSSPLPWFMX-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- FGRPSQGAABFCHF-UHFFFAOYSA-N 3-bromo-2-(chloromethyl)pyridine Chemical compound ClCC1=NC=CC=C1Br FGRPSQGAABFCHF-UHFFFAOYSA-N 0.000 description 3
- APZXPRHPPCTRHN-UHFFFAOYSA-N 4-(chloromethyl)-5-methyl-1h-imidazole Chemical compound CC=1NC=NC=1CCl APZXPRHPPCTRHN-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- HXYXGJPLCOCBMF-UHFFFAOYSA-N 4-bromo-5-(chloromethyl)-1h-imidazole Chemical compound ClCC=1NC=NC=1Br HXYXGJPLCOCBMF-UHFFFAOYSA-N 0.000 description 2
- LJBSKUABXVDRGS-UHFFFAOYSA-N 5-(2-chloroethyl)-1h-imidazole Chemical compound ClCCC1=CN=CN1 LJBSKUABXVDRGS-UHFFFAOYSA-N 0.000 description 2
- GLAZMGQANOHRCR-UHFFFAOYSA-N 5-(chloromethyl)-1h-1,2,4-triazole Chemical compound ClCC1=NC=NN1 GLAZMGQANOHRCR-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 238000001311 chemical methods and process Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 150000002540 isothiocyanates Chemical class 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- HVKZRQWANMCRNO-UHFFFAOYSA-N 1-butyl-3-(2-sulfanylethyl)thiourea Chemical compound CCCCNC(=S)NCCS HVKZRQWANMCRNO-UHFFFAOYSA-N 0.000 description 1
- QOENFLOBZSDYRH-UHFFFAOYSA-N 1-cyano-2-(2-sulfanylethyl)guanidine Chemical compound SCCNC(=N)NC#N QOENFLOBZSDYRH-UHFFFAOYSA-N 0.000 description 1
- MKULFRKBUGNGRM-UHFFFAOYSA-N 1-ethyl-3-(2-sulfanylethyl)thiourea Chemical compound CCNC(=S)NCCS MKULFRKBUGNGRM-UHFFFAOYSA-N 0.000 description 1
- CGDLCFBOCPCUHF-UHFFFAOYSA-N 1-ethyl-3-[2-[(5-methyl-1h-imidazol-4-yl)methylsulfanyl]ethyl]thiourea Chemical compound CCNC(=S)NCCSCC=1NC=NC=1C CGDLCFBOCPCUHF-UHFFFAOYSA-N 0.000 description 1
- SMUCJORXVWLBEU-UHFFFAOYSA-N 1-methyl-3-(2-sulfanylethyl)thiourea Chemical compound CNC(=S)NCCS SMUCJORXVWLBEU-UHFFFAOYSA-N 0.000 description 1
- FQMKAEFKYZWWEO-UHFFFAOYSA-N 1-methyl-3-(2-sulfanylpropyl)thiourea Chemical compound CNC(=S)NCC(C)S FQMKAEFKYZWWEO-UHFFFAOYSA-N 0.000 description 1
- VYEGAEUUQMJXTM-UHFFFAOYSA-N 2-(chloromethyl)-1-methylimidazole Chemical compound CN1C=CN=C1CCl VYEGAEUUQMJXTM-UHFFFAOYSA-N 0.000 description 1
- OGMADIBCHLQMIP-UHFFFAOYSA-N 2-aminoethanethiol;hydron;chloride Chemical compound Cl.NCCS OGMADIBCHLQMIP-UHFFFAOYSA-N 0.000 description 1
- DDZNTLGDOIENQK-UHFFFAOYSA-N 2-butyl-1-cyano-3-(2-sulfanylethyl)guanidine Chemical compound CCCCN=C(NC#N)NCCS DDZNTLGDOIENQK-UHFFFAOYSA-N 0.000 description 1
- IYGAMTQMILRCCI-UHFFFAOYSA-N 3-aminopropane-1-thiol Chemical compound NCCCS IYGAMTQMILRCCI-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- HCGYTFXTHWTYFK-UHFFFAOYSA-N 5-(chloromethyl)-1h-imidazole Chemical compound ClCC1=CN=CN1 HCGYTFXTHWTYFK-UHFFFAOYSA-N 0.000 description 1
- FASMXPUFMXBVRL-UHFFFAOYSA-N 5-(chloromethyl)-1h-imidazole;hydron;chloride Chemical compound Cl.ClCC1=CN=CN1 FASMXPUFMXBVRL-UHFFFAOYSA-N 0.000 description 1
- VYZAHLCBVHPDDF-UHFFFAOYSA-N Dinitrochlorobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 VYZAHLCBVHPDDF-UHFFFAOYSA-N 0.000 description 1
- FPBPLBWLMYGIQR-UHFFFAOYSA-N Metiamide Chemical compound CNC(=S)NCCSCC=1N=CNC=1C FPBPLBWLMYGIQR-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- XOJHLCFQADZPHU-UHFFFAOYSA-N Thiaburimamide Chemical compound CNC(=S)NCCSCC1=CNC=N1 XOJHLCFQADZPHU-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000004849 alkoxymethyl group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- IULFXBLVJIPESI-UHFFFAOYSA-N bis(methylsulfanyl)methylidenecyanamide Chemical compound CSC(SC)=NC#N IULFXBLVJIPESI-UHFFFAOYSA-N 0.000 description 1
- MFZXDNJVJDYOQA-UHFFFAOYSA-N cadmium;cyanamide Chemical compound [Cd].NC#N MFZXDNJVJDYOQA-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 235000019628 coolness Nutrition 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- UFULAYFCSOUIOV-UHFFFAOYSA-N cysteamine Chemical compound NCCS UFULAYFCSOUIOV-UHFFFAOYSA-N 0.000 description 1
- 229940097265 cysteamine hydrochloride Drugs 0.000 description 1
- 238000005661 deetherification reaction Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 229960003151 mercaptamine Drugs 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- CIRSLBTYBPGMNO-UHFFFAOYSA-N methyl n-cyano-n-methylcarbamimidothioate Chemical compound CSC(=N)N(C)C#N CIRSLBTYBPGMNO-UHFFFAOYSA-N 0.000 description 1
- 125000004372 methylthioethyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])* 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/64—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms, e.g. histidine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/43—Y being a hetero atom
- C07C323/44—X or Y being nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/32—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/61—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/65—One oxygen atom attached in position 3 or 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/68—Halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/08—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/32—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/02—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D277/26—Radicals substituted by sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
- C07D285/125—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
- C07D285/135—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB38257/74A GB1533380A (en) | 1974-09-02 | 1974-09-02 | Process for the preparation of heterocyclic substituted thioureas and h-cyanoguanidines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1063119A true CA1063119A (en) | 1979-09-25 |
Family
ID=10402297
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA233,788A Expired CA1063119A (en) | 1974-09-02 | 1975-08-20 | Process for preparing substituted thioureas and guanidines |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4013678A (enExample) |
| JP (2) | JPS51125074A (enExample) |
| BE (1) | BE832663A (enExample) |
| CA (1) | CA1063119A (enExample) |
| CH (1) | CH608232A5 (enExample) |
| GB (1) | GB1533380A (enExample) |
| IE (1) | IE41856B1 (enExample) |
| NL (1) | NL7510344A (enExample) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1574214A (en) * | 1976-03-11 | 1980-09-03 | Smith Kline French Lab | Amidines |
| US4189488A (en) * | 1976-03-11 | 1980-02-19 | Smith Kline & French Laboratories Limited | Amidinoformic and amidinosulphinic acids |
| ZA774220B (en) * | 1976-07-28 | 1978-06-28 | Smith Kline French Lab | Pharmacologically active compounds |
| NZ184893A (en) * | 1976-09-21 | 1980-11-28 | Smith Kline French Lab | Pure crystalline form of cimetidine a(n-methyl-n-cyano-n-(-2-(5-methyl-4imidazolyl) methylthio) ethyl)-guanidine andpharmaceutical compositions containing it |
| IE47044B1 (en) | 1977-04-20 | 1983-12-14 | Ici Ltd | Guanidine derivatives |
| US4165378A (en) | 1977-04-20 | 1979-08-21 | Ici Americas Inc. | Guanidine derivatives of imidazoles and thiazoles |
| US4158013A (en) * | 1977-06-03 | 1979-06-12 | Bristol-Myers Company | N-Cyano-N'-alkynyl-N"-2-mercaptoethylguanidines |
| CA1110251A (en) * | 1977-06-03 | 1981-10-06 | Ronnie R. Crenshaw | N-cyano-n'- 2-¬(4-methyl-5- imidazolyl)methylthio|ethyl - n"-alkynylguanidines h.sub.2 receptor blocking agents |
| IL56265A (en) * | 1977-12-28 | 1982-08-31 | Om Lab Sa | Process for preparing imidazolyl methylthio guanidine derivatives and a novel intermediate therefor |
| GR65283B (en) * | 1977-12-30 | 1980-08-01 | Crc Ricerca Chim | Method for the alkyliosis of 4(5)-merka ptomethyl-imidazoles with aziridin derivatives |
| YU40332B (en) * | 1978-04-26 | 1985-12-31 | Lek Tovarna Farmacevtskih | Process for preparing n-cyano-n'-methyl-n''-((2-((4-methyl-5-imidazolyl)-methylthio)ethyl)-guanidine |
| ATE1353T1 (de) | 1978-05-24 | 1982-08-15 | Imperial Chemical Industries Plc | Anti-sekretion thiadiazol-derivate, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische zusammensetzungen. |
| US4157340A (en) * | 1978-06-27 | 1979-06-05 | Bristol-Meyers Company | N,N'-[Bis(N-cyanoguanyl)]cystamine derivatives |
| YU40716B (en) * | 1978-07-19 | 1986-04-30 | Pliva Pharm & Chem Works | Process for obtaining n-cyano-n'-methyl-n'-û2-|5-metylimidazole4-yl)-methyl¨-thioethylù guanidine |
| US4200760A (en) * | 1978-09-26 | 1980-04-29 | Bristol-Myers Company | Imidazolylalkylthioalkylamino-ethylene derivatives |
| CA1140925A (en) * | 1978-10-16 | 1983-02-08 | Derrick F. Jones | Antisecretory branched chain heterocyclic derivatives, processes for their manufacture and pharmaceutical compositions containing them |
| GB2035313B (en) * | 1978-11-02 | 1983-01-06 | Pliva Pharm & Chem Works | Preparation of n-cyano-n'-methyl-n''-(2-mercaptoethyl)-guanidine |
| US4276421A (en) * | 1978-11-18 | 1981-06-30 | Societe De Recherches Et De Syntheses Organiques S.A. | Cyano-guanidine geometrical isomers |
| EP0014057B1 (en) | 1979-01-18 | 1985-01-02 | Imperial Chemical Industries Plc | Guanidine derivatives, processes for their manufacture and pharmaceutical compositions containing them |
| US4383115A (en) * | 1979-02-14 | 1983-05-10 | Baudet Pierre J | Imino-alkyl and amino-nitrile cyano-guanidines |
| US4242351A (en) * | 1979-05-07 | 1980-12-30 | Imperial Chemical Industries Limited | Antisecretory oxadiazoles and pharmaceutical compositions containing them |
| JPS6056139B2 (ja) * | 1980-11-26 | 1985-12-09 | 藤本製薬株式会社 | シアノグアニジン誘導体の製造法 |
| JPS57120574A (en) * | 1981-01-21 | 1982-07-27 | Fujimoto Seiyaku Kk | Production of guanidine derivative |
| JPS57120572A (en) * | 1981-01-21 | 1982-07-27 | Fujimoto Seiyaku Kk | Guanidine derivative and its preparation |
| US4374996A (en) * | 1981-06-03 | 1983-02-22 | Sk & F Lab Co. | Disulfide intermediate for cimetidine |
| US4447621A (en) * | 1981-06-03 | 1984-05-08 | Sk&F Lab Co. | Use of N-cyano-N'-methyl-N"-[2-(5-methyl-4-imidazolylmethyldithio)ethyl]guanidine in the preparation of cimetidine |
| JPS5888366A (ja) * | 1981-11-19 | 1983-05-26 | Fujimoto Seiyaku Kk | グアニジン誘導体の製造法 |
| IE55946B1 (en) * | 1982-10-08 | 1991-02-27 | Gea Farmaceutisk Fabrik As | Thioethercyanoguanidines and their use as intermediates in producing imidazoles |
| JPS59128375A (ja) * | 1983-01-10 | 1984-07-24 | Tokawa Tetsuo | イミダゾ−ル系化合物の製法 |
| JPS59130274A (ja) * | 1983-01-14 | 1984-07-26 | Tokawa Tetsuo | イミダゾ−ル系化合物の製法 |
| JPH0655711B2 (ja) * | 1986-09-12 | 1994-07-27 | 三井石油化学工業株式会社 | シアノグアニジン誘導体の製造方法 |
| JPH0373817A (ja) * | 1989-08-16 | 1991-03-28 | Shinko Electric Co Ltd | 温度計測方法及び装置 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1338169A (en) * | 1971-03-09 | 1973-11-21 | Smith Kline French Lab | Ureas thioureas and guanidines |
| US3905984A (en) * | 1971-03-09 | 1975-09-16 | Smith Kline French Lab | Pyridyl substituted thioalkyl-and oxyalkyl-thioureas and ureas |
-
1974
- 1974-09-02 GB GB38257/74A patent/GB1533380A/en not_active Expired
-
1975
- 1975-08-12 IE IE1797/75A patent/IE41856B1/en unknown
- 1975-08-20 CA CA233,788A patent/CA1063119A/en not_active Expired
- 1975-08-20 US US05/606,269 patent/US4013678A/en not_active Expired - Lifetime
- 1975-08-22 BE BE159393A patent/BE832663A/xx not_active IP Right Cessation
- 1975-08-26 CH CH1104975A patent/CH608232A5/xx not_active IP Right Cessation
- 1975-09-01 JP JP50106460A patent/JPS51125074A/ja active Granted
- 1975-09-02 NL NL7510344A patent/NL7510344A/xx not_active Application Discontinuation
-
1982
- 1982-08-25 JP JP57148483A patent/JPS5940829B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IE41856L (en) | 1976-03-02 |
| BE832663A (fr) | 1976-02-23 |
| JPS635389B2 (enExample) | 1988-02-03 |
| GB1533380A (en) | 1978-11-22 |
| US4013678A (en) | 1977-03-22 |
| CH608232A5 (enExample) | 1978-12-29 |
| JPS5849361A (ja) | 1983-03-23 |
| IE41856B1 (en) | 1980-04-09 |
| JPS5940829B2 (ja) | 1984-10-03 |
| NL7510344A (nl) | 1976-03-04 |
| JPS51125074A (en) | 1976-11-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1063119A (en) | Process for preparing substituted thioureas and guanidines | |
| CA1045142A (en) | Cyanoguanidines | |
| SU567405A3 (ru) | Способ получени гетероциклических соединений | |
| DE2265369B1 (de) | Heterocyclische Aminoaether und -thioaether und ihre Salze mit Saeuren | |
| US4049671A (en) | Process for preparing N-cyanoguanidines | |
| EP0128736B1 (en) | Novel 2-guanidinothiazoline compounds, their preparation, and their use as intermediates | |
| US3152136A (en) | Dinitroaroyl-nu-pyridyl amides | |
| US4301165A (en) | Pharmacologically active compounds | |
| CA1053242A (en) | Heterocyclic guanidine derivatives | |
| US4093621A (en) | Process for preparing heterocyclicalkylthioalkyl-N-cyanoguanidines and thioureas | |
| CA2369404C (en) | Method of producing nitroguanidine- and nitroenamine derivatives | |
| IE49320B1 (en) | N-alkynyl-n'((optionally substituted thiazolyl)methylthio)alkyl-derivatives of n"-cyanoguanidine and of 1,1-diamino-2-substituted ethylene | |
| PL115042B1 (en) | Method of manufacture of therapeutically active derivative of guanidine | |
| JPH01172378A (ja) | 新規2−グアニジノ−チアゾール化合物、その製造及びファモチジン法の中間体としての使用 | |
| US4171325A (en) | Chemical process | |
| EP0057564A1 (en) | Process for preparing 3,5-diamino-1,2,4-triazoles | |
| CA1100146A (en) | Derivatives of r,s-[2-(2-hydroxyethylamino)-1- phenyl]-ethylamine, and a process of obtaining them | |
| EP0054409A1 (en) | Preparation of thiazolidine derivatives | |
| FI63753C (fi) | Foerfarande foer framstaellning av kristallint simetidin. | |
| CS207750B2 (en) | Method of making the n'-cyano-n'-alcyl-n-2-/5-methyl-1h-imidazol-4-yl/methyl thicethyl guanidines | |
| US4090026A (en) | Certain nitrogen heterocyclic isothiocyanate esters | |
| CA1121363A (en) | Process to prepare n-cyano-n'-methyl-n''-(2-¬(4- methyl-5-imidazolyl)-methylthio|-ethyl) guanidine | |
| US3178443A (en) | N-(2-guandinoethyl)-n-(picolyl)-amines | |
| US4049669A (en) | Process for preparing 5-(alkoxy- and aminoethyl thio)methylthiazole compounds | |
| KR870001539B1 (ko) | 4-메틸-5-티오포름아미디노메틸이미다졸 디하이드로클로라이드의 제조방법 |